<feature
id="org.jcae.opencascade.lib"
label="Open CASCADE Feature"
- version="6.5.4.qualifier"
+ version="7.3.0.qualifier"
os="win32"
arch="x86_64">
<artifactId>org.jcae.opencascade.lib</artifactId>
<packaging>eclipse-feature</packaging>
- <version>6.5.4-SNAPSHOT</version>
+ <version>7.3.0-SNAPSHOT</version>
</project>
Bundle-ManifestVersion: 2
Bundle-Name: X86_64
Bundle-SymbolicName: org.jcae.opencascade.win32.x86_64
-Bundle-Version: 6.5.4.qualifier
-Fragment-Host: org.jcae.opencascade;bundle-version="6.5.4"
+Bundle-Version: 7.3.0.qualifier
+Fragment-Host: org.jcae.opencascade;bundle-version="7.3.0"
Bundle-RequiredExecutionEnvironment: JavaSE-1.6
Eclipse-PlatformFilter: (& (osgi.os=win32) (osgi.arch=x86_64))
-source.. = src/\r
-output.. = bin/\r
-bin.includes = META-INF/,\\r
- .,\\r
- FWOSPlugin.dll,\\r
- OccJava.dll,\\r
- PTKernel.dll,\\r
- TKAdvTools.dll,\\r
- TKBO.dll,\\r
- TKBRep.dll,\\r
- TKBin.dll,\\r
- TKBinL.dll,\\r
- TKBinTObj.dll,\\r
- TKBinXCAF.dll,\\r
- TKBool.dll,\\r
- TKCAF.dll,\\r
- TKCDF.dll,\\r
- TKFeat.dll,\\r
- TKFillet.dll,\\r
- TKG2d.dll,\\r
- TKG3d.dll,\\r
- TKGeomAlgo.dll,\\r
- TKGeomBase.dll,\\r
- TKHLR.dll,\\r
- TKIGES.dll,\\r
- TKLCAF.dll,\\r
- TKMath.dll,\\r
- TKMesh.dll,\\r
- TKNIS.dll,\\r
- TKMeshVS.dll,\\r
- TKOffset.dll,\\r
- TKPCAF.dll,\\r
- TKPLCAF.dll,\\r
- TKPShape.dll,\\r
- TKPrim.dll,\\r
- TKSTEP.dll,\\r
- TKSTEP209.dll,\\r
- TKSTEPAttr.dll,\\r
- TKSTEPBase.dll,\\r
- TKSTL.dll,\\r
- TKService.dll,\\r
- TKShapeSchema.dll,\\r
- TKShHealing.dll,\\r
- TKStdLSchema.dll,\\r
- TKStdSchema.dll,\\r
- TKTObj.dll,\\r
- TKTopAlgo.dll,\\r
- TKV2d.dll,\\r
- TKV3d.dll,\\r
- TKVRML.dll,\\r
- TKVoxel.dll,\\r
- TKXCAF.dll,\\r
- TKXCAFSchema.dll,\\r
- TKXDEIGES.dll,\\r
- TKXDESTEP.dll,\\r
- TKXMesh.dll,\\r
- TKXSBase.dll,\\r
- TKXml.dll,\\r
- TKXmlL.dll,\\r
- TKXmlTObj.dll,\\r
- TKernel.dll,\\r
- TKXmlXCAF.dll\r
+
+output.. = bin/
+bin.includes = META-INF/,\
+ .,\
+ OccJava.dll,\
+ TKBin.dll,\
+ TKBinL.dll,\
+ TKBinTObj.dll,\
+ TKBinXCAF.dll,\
+ TKBO.dll,\
+ TKBool.dll,\
+ TKBRep.dll,\
+ TKCAF.dll,\
+ TKCDF.dll,\
+ TKDCAF.dll,\
+ TKernel.dll,\
+ TKFeat.dll,\
+ TKFillet.dll,\
+ TKG2d.dll,\
+ TKG3d.dll,\
+ TKGeomAlgo.dll,\
+ TKGeomBase.dll,\
+ TKHLR.dll,\
+ TKIGES.dll,\
+ TKLCAF.dll,\
+ TKMath.dll,\
+ TKMesh.dll,\
+ TKMeshVS.dll,\
+ TKOffset.dll,\
+ TKPrim.dll,\
+ TKService.dll,\
+ TKShHealing.dll,\
+ TKStd.dll,\
+ TKStdL.dll,\
+ TKSTEP.dll,\
+ TKSTEP209.dll,\
+ TKSTEPAttr.dll,\
+ TKSTEPBase.dll,\
+ TKSTL.dll,\
+ TKTObj.dll,\
+ TKTopAlgo.dll,\
+ TKTopTest.dll,\
+ TKV3d.dll,\
+ TKVCAF.dll,\
+ TKVRML.dll,\
+ TKXCAF.dll,\
+ TKXDEIGES.dll,\
+ TKXDESTEP.dll,\
+ TKXMesh.dll,\
+ TKXml.dll,\
+ TKXmlL.dll,\
+ TKXmlTObj.dll,\
+ TKXmlXCAF.dll,\
+ TKXSBase.dll
+
+
+
<artifactId>org.jcae.opencascade.win32.x86_64</artifactId>
<packaging>eclipse-plugin</packaging>
- <version>6.5.4-SNAPSHOT</version>
+ <version>7.3.0-SNAPSHOT</version>
<build>
<plugins>
Bundle-ManifestVersion: 2
Bundle-Name: Opencascade
Bundle-SymbolicName: org.jcae.opencascade
-Bundle-Version: 6.5.4.qualifier
+Bundle-Version: 7.3.0.qualifier
Bundle-Activator: org.jcae.opencascade.Activator
Require-Bundle: org.eclipse.core.runtime
Bundle-ActivationPolicy: lazy
<artifactId>org.jcae.opencascade</artifactId>
<packaging>eclipse-plugin</packaging>
- <version>6.5.4-SNAPSHOT</version>
+ <version>7.3.0-SNAPSHOT</version>
</project>
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class APIHeaderSection_MakeHeader {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public APIHeaderSection_MakeHeader(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(APIHeaderSection_MakeHeader obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_APIHeaderSection_MakeHeader(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public APIHeaderSection_MakeHeader(SWIGTYPE_p_Handle_StepData_StepModel model) {\r
- this(OccJavaJNI.new_APIHeaderSection_MakeHeader(SWIGTYPE_p_Handle_StepData_StepModel.getCPtr(model)), true);\r
- }\r
-\r
- public void setName(SWIGTYPE_p_Handle_TCollection_HAsciiString aName) {\r
- OccJavaJNI.APIHeaderSection_MakeHeader_setName(swigCPtr, this, SWIGTYPE_p_Handle_TCollection_HAsciiString.getCPtr(aName));\r
- }\r
-\r
- public void setAuthorValue(int num, SWIGTYPE_p_Handle_TCollection_HAsciiString aAuthor) {\r
- OccJavaJNI.APIHeaderSection_MakeHeader_setAuthorValue(swigCPtr, this, num, SWIGTYPE_p_Handle_TCollection_HAsciiString.getCPtr(aAuthor));\r
- }\r
-\r
- public void setOrganizationValue(int num, SWIGTYPE_p_Handle_TCollection_HAsciiString aOrganization) {\r
- OccJavaJNI.APIHeaderSection_MakeHeader_setOrganizationValue(swigCPtr, this, num, SWIGTYPE_p_Handle_TCollection_HAsciiString.getCPtr(aOrganization));\r
- }\r
-\r
- public void setOriginatingSystem(SWIGTYPE_p_Handle_TCollection_HAsciiString aOriginatingSystem) {\r
- OccJavaJNI.APIHeaderSection_MakeHeader_setOriginatingSystem(swigCPtr, this, SWIGTYPE_p_Handle_TCollection_HAsciiString.getCPtr(aOriginatingSystem));\r
- }\r
-\r
- public void setDescriptionValue(int num, SWIGTYPE_p_Handle_TCollection_HAsciiString description) {\r
- OccJavaJNI.APIHeaderSection_MakeHeader_setDescriptionValue(swigCPtr, this, num, SWIGTYPE_p_Handle_TCollection_HAsciiString.getCPtr(description));\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class APIHeaderSection_MakeHeader {
+
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Adaptor2d_Curve2d {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Adaptor2d_Curve2d(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Adaptor2d_Curve2d obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Adaptor2d_Curve2d(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public double[] value(double U) {\r
- return OccJavaJNI.Adaptor2d_Curve2d_value(swigCPtr, this, U);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Adaptor2d_Curve2d {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Adaptor2d_Curve2d(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Adaptor2d_Curve2d obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Adaptor2d_Curve2d(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public double[] value(double U) {
+ return OccJavaJNI.Adaptor2d_Curve2d_value(swigCPtr, this, U);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Adaptor3d_Curve {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Adaptor3d_Curve(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Adaptor3d_Curve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Adaptor3d_Curve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public double[] value(double U) {\r
- return OccJavaJNI.Adaptor3d_Curve_value(swigCPtr, this, U);\r
-}\r
-\r
- public void arrayValues(int size, double[] u) {\r
- OccJavaJNI.Adaptor3d_Curve_arrayValues(swigCPtr, this, size, u);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Adaptor3d_Curve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Adaptor3d_Curve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Adaptor3d_Curve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Adaptor3d_Curve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public double[] value(double U) {
+ return OccJavaJNI.Adaptor3d_Curve_value(swigCPtr, this, U);
+}
+
+ public void arrayValues(int size, double[] u) {
+ OccJavaJNI.Adaptor3d_Curve_arrayValues(swigCPtr, this, size, u);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgo {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepAlgo(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgo obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgo(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static boolean isValid(TopoDS_Shape S) {\r
- return OccJavaJNI.BRepAlgo_isValid(TopoDS_Shape.getCPtr(S), S);\r
-}\r
-\r
- public static boolean isTopologicallyValid(TopoDS_Shape S) {\r
- return OccJavaJNI.BRepAlgo_isTopologicallyValid(TopoDS_Shape.getCPtr(S), S);\r
-}\r
-\r
- public BRepAlgo() {\r
- this(OccJavaJNI.new_BRepAlgo(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgo {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepAlgo(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgo obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgo(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static boolean isValid(TopoDS_Shape S) {
+ return OccJavaJNI.BRepAlgo_isValid(TopoDS_Shape.getCPtr(S), S);
+}
+
+ public static boolean isTopologicallyValid(TopoDS_Shape S) {
+ return OccJavaJNI.BRepAlgo_isTopologicallyValid(TopoDS_Shape.getCPtr(S), S);
+}
+
+ public BRepAlgo() {
+ this(OccJavaJNI.new_BRepAlgo(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgoAPI_BooleanOperation extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepAlgoAPI_BooleanOperation(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepAlgoAPI_BooleanOperation_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgoAPI_BooleanOperation obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgoAPI_BooleanOperation(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Shape[] modified(TopoDS_Shape aS) {\r
- return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepAlgoAPI_BooleanOperation_modified(swigCPtr, this, TopoDS_Shape.getCPtr(aS), aS));\r
-}\r
-\r
- public boolean isDeleted(TopoDS_Shape aS) {\r
- return OccJavaJNI.BRepAlgoAPI_BooleanOperation_isDeleted(swigCPtr, this, TopoDS_Shape.getCPtr(aS), aS);\r
-}\r
-\r
- public TopoDS_Shape[] modified2(TopoDS_Shape aS) {\r
- return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepAlgoAPI_BooleanOperation_modified2(swigCPtr, this, TopoDS_Shape.getCPtr(aS), aS));\r
-}\r
-\r
- public TopoDS_Shape[] generated(TopoDS_Shape S) {\r
- return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepAlgoAPI_BooleanOperation_generated(swigCPtr, this, TopoDS_Shape.getCPtr(S), S));\r
-}\r
-\r
- public boolean hasModified() {\r
- return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasModified(swigCPtr, this);\r
-}\r
-\r
- public boolean hasGenerated() {\r
- return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasGenerated(swigCPtr, this);\r
-}\r
-\r
- public boolean hasDeleted() {\r
- return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasDeleted(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgoAPI_BooleanOperation extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepAlgoAPI_BooleanOperation(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepAlgoAPI_BooleanOperation_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgoAPI_BooleanOperation obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgoAPI_BooleanOperation(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Shape[] modified(TopoDS_Shape aS) {
+ return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepAlgoAPI_BooleanOperation_modified(swigCPtr, this, TopoDS_Shape.getCPtr(aS), aS));
+}
+
+ public boolean isDeleted(TopoDS_Shape aS) {
+ return OccJavaJNI.BRepAlgoAPI_BooleanOperation_isDeleted(swigCPtr, this, TopoDS_Shape.getCPtr(aS), aS);
+}
+
+ public TopoDS_Shape[] generated(TopoDS_Shape S) {
+ return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepAlgoAPI_BooleanOperation_generated(swigCPtr, this, TopoDS_Shape.getCPtr(S), S));
+}
+
+ public boolean hasModified() {
+ return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasModified(swigCPtr, this);
+}
+
+ public boolean hasGenerated() {
+ return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasGenerated(swigCPtr, this);
+}
+
+ public boolean hasDeleted() {
+ return OccJavaJNI.BRepAlgoAPI_BooleanOperation_hasDeleted(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgoAPI_Common extends BRepAlgoAPI_BooleanOperation {\r
- private long swigCPtr;\r
-\r
- public BRepAlgoAPI_Common(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepAlgoAPI_Common_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgoAPI_Common obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgoAPI_Common(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepAlgoAPI_Common(TopoDS_Shape S1, TopoDS_Shape S2) {\r
- this(OccJavaJNI.new_BRepAlgoAPI_Common(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgoAPI_Common extends BRepAlgoAPI_BooleanOperation {
+ private transient long swigCPtr;
+
+ protected BRepAlgoAPI_Common(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepAlgoAPI_Common_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgoAPI_Common obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgoAPI_Common(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepAlgoAPI_Common(TopoDS_Shape S1, TopoDS_Shape S2) {
+ this(OccJavaJNI.new_BRepAlgoAPI_Common(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgoAPI_Cut extends BRepAlgoAPI_BooleanOperation {\r
- private long swigCPtr;\r
-\r
- public BRepAlgoAPI_Cut(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepAlgoAPI_Cut_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgoAPI_Cut obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgoAPI_Cut(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepAlgoAPI_Cut(TopoDS_Shape S1, TopoDS_Shape S2) {\r
- this(OccJavaJNI.new_BRepAlgoAPI_Cut(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgoAPI_Cut extends BRepAlgoAPI_BooleanOperation {
+ private transient long swigCPtr;
+
+ protected BRepAlgoAPI_Cut(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepAlgoAPI_Cut_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgoAPI_Cut obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgoAPI_Cut(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepAlgoAPI_Cut(TopoDS_Shape S1, TopoDS_Shape S2) {
+ this(OccJavaJNI.new_BRepAlgoAPI_Cut(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgoAPI_Fuse extends BRepAlgoAPI_BooleanOperation {\r
- private long swigCPtr;\r
-\r
- public BRepAlgoAPI_Fuse(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepAlgoAPI_Fuse_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgoAPI_Fuse obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgoAPI_Fuse(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepAlgoAPI_Fuse(TopoDS_Shape S1, TopoDS_Shape S2) {\r
- this(OccJavaJNI.new_BRepAlgoAPI_Fuse(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgoAPI_Fuse extends BRepAlgoAPI_BooleanOperation {
+ private transient long swigCPtr;
+
+ protected BRepAlgoAPI_Fuse(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepAlgoAPI_Fuse_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgoAPI_Fuse obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgoAPI_Fuse(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepAlgoAPI_Fuse(TopoDS_Shape S1, TopoDS_Shape S2) {
+ this(OccJavaJNI.new_BRepAlgoAPI_Fuse(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepAlgoAPI_Section extends BRepAlgoAPI_BooleanOperation {\r
- private long swigCPtr;\r
-\r
- public BRepAlgoAPI_Section(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepAlgoAPI_Section_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepAlgoAPI_Section obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepAlgoAPI_Section(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepAlgoAPI_Section(TopoDS_Shape S1, TopoDS_Shape S2) {\r
- this(OccJavaJNI.new_BRepAlgoAPI_Section(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepAlgoAPI_Section extends BRepAlgoAPI_BooleanOperation {
+ private transient long swigCPtr;
+
+ protected BRepAlgoAPI_Section(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepAlgoAPI_Section_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepAlgoAPI_Section obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepAlgoAPI_Section(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepAlgoAPI_Section(TopoDS_Shape S1, TopoDS_Shape S2) {
+ this(OccJavaJNI.new_BRepAlgoAPI_Section(TopoDS_Shape.getCPtr(S1), S1, TopoDS_Shape.getCPtr(S2), S2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBndLib {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepBndLib(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBndLib obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBndLib(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static void add(TopoDS_Shape shape, Bnd_Box bndBox) {\r
- OccJavaJNI.BRepBndLib_add(TopoDS_Shape.getCPtr(shape), shape, Bnd_Box.getCPtr(bndBox), bndBox);\r
- }\r
-\r
- public BRepBndLib() {\r
- this(OccJavaJNI.new_BRepBndLib(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBndLib {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepBndLib(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBndLib obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBndLib(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static void add(TopoDS_Shape shape, Bnd_Box bndBox) {
+ OccJavaJNI.BRepBndLib_add(TopoDS_Shape.getCPtr(shape), shape, Bnd_Box.getCPtr(bndBox), bndBox);
+ }
+
+ public BRepBndLib() {
+ this(OccJavaJNI.new_BRepBndLib(), true);
+ }
+
+}
--- /dev/null
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_Command {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepBuilderAPI_Command(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_Command obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_Command(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepBuilderAPI_Command_isDone(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeEdge extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeEdge(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeEdge_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeEdge obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeEdge(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_0(), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_1(Geom_Curve.getCPtr(L), L), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_2(TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_3(P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Circ L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_4(GP_Circ.getCPtr(L), L), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Circ L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_5(GP_Circ.getCPtr(L), L, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Circ L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_6(GP_Circ.getCPtr(L), L, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Circ L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_7(GP_Circ.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Parab L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_8(GP_Parab.getCPtr(L), L), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Parab L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_9(GP_Parab.getCPtr(L), L, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Parab L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_10(GP_Parab.getCPtr(L), L, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Parab L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_11(GP_Parab.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepBuilderAPI_MakeEdge_isDone(swigCPtr, this);\r
-}\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Lin L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_12(GP_Lin.getCPtr(L), L), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Lin L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_13(GP_Lin.getCPtr(L), L, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Lin L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_14(GP_Lin.getCPtr(L), L, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Lin L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_15(GP_Lin.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Elips L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_16(GP_Elips.getCPtr(L), L), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Elips L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_17(GP_Elips.getCPtr(L), L, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Elips L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_18(GP_Elips.getCPtr(L), L, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(GP_Elips L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_19(GP_Elips.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_20(SWIGTYPE_p_gp_Hypr.getCPtr(L)), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_21(SWIGTYPE_p_gp_Hypr.getCPtr(L), p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_22(SWIGTYPE_p_gp_Hypr.getCPtr(L), P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_23(SWIGTYPE_p_gp_Hypr.getCPtr(L), TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_24(Geom_Curve.getCPtr(L), L, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_25(Geom_Curve.getCPtr(L), L, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_26(Geom_Curve.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L, double[] P1, double[] P2, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_27(Geom_Curve.getCPtr(L), L, P1, P2, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom_Curve L, TopoDS_Vertex V1, TopoDS_Vertex V2, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_28(Geom_Curve.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_29(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_30(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, p1, p2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_31(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, P1, P2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, TopoDS_Vertex V1, TopoDS_Vertex V2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_32(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double[] P1, double[] P2, double p1, double p2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_33(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, P1, P2, p1, p2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeEdge extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeEdge(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeEdge_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeEdge obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeEdge(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeEdge() {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_0(), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_1(Geom_Curve.getCPtr(L), L), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_2(TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_3(P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Circ L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_4(GP_Circ.getCPtr(L), L), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Circ L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_5(GP_Circ.getCPtr(L), L, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Circ L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_6(GP_Circ.getCPtr(L), L, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Circ L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_7(GP_Circ.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Parab L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_8(GP_Parab.getCPtr(L), L), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Parab L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_9(GP_Parab.getCPtr(L), L, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Parab L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_10(GP_Parab.getCPtr(L), L, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Parab L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_11(GP_Parab.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_12(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_TrimmedCurve L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_13(Geom_TrimmedCurve.getCPtr(L), L), true);
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepBuilderAPI_MakeEdge_isDone(swigCPtr, this);
+}
+
+ public TopoDS_Edge edge() {
+ return new TopoDS_Edge(OccJavaJNI.BRepBuilderAPI_MakeEdge_edge(swigCPtr, this), false);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Lin L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_14(GP_Lin.getCPtr(L), L), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Lin L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_15(GP_Lin.getCPtr(L), L, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Lin L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_16(GP_Lin.getCPtr(L), L, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Lin L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_17(GP_Lin.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Elips L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_18(GP_Elips.getCPtr(L), L), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Elips L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_19(GP_Elips.getCPtr(L), L, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Elips L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_20(GP_Elips.getCPtr(L), L, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(GP_Elips L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_21(GP_Elips.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_22(SWIGTYPE_p_gp_Hypr.getCPtr(L)), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_23(SWIGTYPE_p_gp_Hypr.getCPtr(L), p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_24(SWIGTYPE_p_gp_Hypr.getCPtr(L), P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(SWIGTYPE_p_gp_Hypr L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_25(SWIGTYPE_p_gp_Hypr.getCPtr(L), TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_26(Geom_Curve.getCPtr(L), L, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_27(Geom_Curve.getCPtr(L), L, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_28(Geom_Curve.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L, double[] P1, double[] P2, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_29(Geom_Curve.getCPtr(L), L, P1, P2, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom_Curve L, TopoDS_Vertex V1, TopoDS_Vertex V2, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_30(Geom_Curve.getCPtr(L), L, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_31(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, p1, p2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_32(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, P1, P2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, TopoDS_Vertex V1, TopoDS_Vertex V2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_33(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, TopoDS_Vertex.getCPtr(V1), V1, TopoDS_Vertex.getCPtr(V2), V2), true);
+ }
+
+ public BRepBuilderAPI_MakeEdge(Geom2d_Curve L, Geom_Surface S, double[] P1, double[] P2, double p1, double p2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeEdge__SWIG_34(Geom2d_Curve.getCPtr(L), L, Geom_Surface.getCPtr(S), S, P1, P2, p1, p2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeFace extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeFace(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeFace_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeFace obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeFace(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeFace(TopoDS_Wire W, boolean OnlyPlane) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_0(TopoDS_Wire.getCPtr(W), W, OnlyPlane), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeFace(TopoDS_Wire W) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_1(TopoDS_Wire.getCPtr(W), W), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeFace(TopoDS_Face F, TopoDS_Wire W) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_2(TopoDS_Face.getCPtr(F), F, TopoDS_Wire.getCPtr(W), W), true);\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepBuilderAPI_MakeFace_isDone(swigCPtr, this);\r
-}\r
-\r
- public SWIGTYPE_p_BRepBuilderAPI_FaceError error() {\r
- return new SWIGTYPE_p_BRepBuilderAPI_FaceError(OccJavaJNI.BRepBuilderAPI_MakeFace_error(swigCPtr, this), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeFace extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeFace(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeFace_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeFace obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeFace(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeFace(TopoDS_Wire W, boolean OnlyPlane) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_0(TopoDS_Wire.getCPtr(W), W, OnlyPlane), true);
+ }
+
+ public BRepBuilderAPI_MakeFace(TopoDS_Wire W) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_1(TopoDS_Wire.getCPtr(W), W), true);
+ }
+
+ public BRepBuilderAPI_MakeFace(TopoDS_Face F, TopoDS_Wire W) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeFace__SWIG_2(TopoDS_Face.getCPtr(F), F, TopoDS_Wire.getCPtr(W), W), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepBuilderAPI_MakeShape(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeShape obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeShape(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public TopoDS_Shape shape() {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_MakeShape_shape(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeShape extends BRepBuilderAPI_Command {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeShape(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeShape_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeShape obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeShape(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public void build() {
+ OccJavaJNI.BRepBuilderAPI_MakeShape_build(swigCPtr, this);
+ }
+
+ public TopoDS_Shape shape() {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_MakeShape_shape(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeShell extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeShell(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeShell_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeShell obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeShell(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeShell() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_0(), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeShell(Geom_Surface S, boolean Segment) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_1(Geom_Surface.getCPtr(S), S, Segment), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeShell(Geom_Surface S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_2(Geom_Surface.getCPtr(S), S), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeShell(Geom_Surface S, double UMin, double UMax, double VMin, double VMax, boolean Segment) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_3(Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax, Segment), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeShell(Geom_Surface S, double UMin, double UMax, double VMin, double VMax) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_4(Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax), true);\r
- }\r
-\r
- public void init(Geom_Surface S, double UMin, double UMax, double VMin, double VMax, boolean Segment) {\r
- OccJavaJNI.BRepBuilderAPI_MakeShell_init__SWIG_0(swigCPtr, this, Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax, Segment);\r
- }\r
-\r
- public void init(Geom_Surface S, double UMin, double UMax, double VMin, double VMax) {\r
- OccJavaJNI.BRepBuilderAPI_MakeShell_init__SWIG_1(swigCPtr, this, Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax);\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepBuilderAPI_MakeShell_isDone(swigCPtr, this);\r
-}\r
-\r
- public SWIGTYPE_p_BRepBuilderAPI_ShellError error() {\r
- return new SWIGTYPE_p_BRepBuilderAPI_ShellError(OccJavaJNI.BRepBuilderAPI_MakeShell_error(swigCPtr, this), true);\r
- }\r
-\r
- public TopoDS_Shell Shell() {\r
- return new TopoDS_Shell(OccJavaJNI.BRepBuilderAPI_MakeShell_Shell(swigCPtr, this), false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeShell extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeShell(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeShell_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeShell obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeShell(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeShell() {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_0(), true);
+ }
+
+ public BRepBuilderAPI_MakeShell(Geom_Surface S, boolean Segment) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_1(Geom_Surface.getCPtr(S), S, Segment), true);
+ }
+
+ public BRepBuilderAPI_MakeShell(Geom_Surface S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_2(Geom_Surface.getCPtr(S), S), true);
+ }
+
+ public BRepBuilderAPI_MakeShell(Geom_Surface S, double UMin, double UMax, double VMin, double VMax, boolean Segment) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_3(Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax, Segment), true);
+ }
+
+ public BRepBuilderAPI_MakeShell(Geom_Surface S, double UMin, double UMax, double VMin, double VMax) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeShell__SWIG_4(Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax), true);
+ }
+
+ public void init(Geom_Surface S, double UMin, double UMax, double VMin, double VMax, boolean Segment) {
+ OccJavaJNI.BRepBuilderAPI_MakeShell_init__SWIG_0(swigCPtr, this, Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax, Segment);
+ }
+
+ public void init(Geom_Surface S, double UMin, double UMax, double VMin, double VMax) {
+ OccJavaJNI.BRepBuilderAPI_MakeShell_init__SWIG_1(swigCPtr, this, Geom_Surface.getCPtr(S), S, UMin, UMax, VMin, VMax);
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepBuilderAPI_MakeShell_isDone(swigCPtr, this);
+}
+
+ public SWIGTYPE_p_BRepBuilderAPI_ShellError error() {
+ return new SWIGTYPE_p_BRepBuilderAPI_ShellError(OccJavaJNI.BRepBuilderAPI_MakeShell_error(swigCPtr, this), true);
+ }
+
+ public TopoDS_Shell Shell() {
+ return new TopoDS_Shell(OccJavaJNI.BRepBuilderAPI_MakeShell_Shell(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeSolid extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeSolid(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeSolid_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeSolid obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeSolid(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_0(), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_CompSolid S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_1(TopoDS_CompSolid.getCPtr(S), S), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_Shell S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_2(TopoDS_Shell.getCPtr(S), S), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_Shell S1, TopoDS_Shell S2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_3(TopoDS_Shell.getCPtr(S1), S1, TopoDS_Shell.getCPtr(S2), S2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_Shell S1, TopoDS_Shell S2, TopoDS_Shell S3) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_4(TopoDS_Shell.getCPtr(S1), S1, TopoDS_Shell.getCPtr(S2), S2, TopoDS_Shell.getCPtr(S3), S3), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_Solid So) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_5(TopoDS_Solid.getCPtr(So), So), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeSolid(TopoDS_Solid So, TopoDS_Shell S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_6(TopoDS_Solid.getCPtr(So), So, TopoDS_Shell.getCPtr(S), S), true);\r
- }\r
-\r
- public void add(TopoDS_Shell S) {\r
- OccJavaJNI.BRepBuilderAPI_MakeSolid_add(swigCPtr, this, TopoDS_Shell.getCPtr(S), S);\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepBuilderAPI_MakeSolid_isDone(swigCPtr, this);\r
-}\r
-\r
- public boolean isDeleted(TopoDS_Shape S) {\r
- return OccJavaJNI.BRepBuilderAPI_MakeSolid_isDeleted(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeSolid extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeSolid(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeSolid_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeSolid obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeSolid(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeSolid() {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_0(), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_CompSolid S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_1(TopoDS_CompSolid.getCPtr(S), S), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_Shell S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_2(TopoDS_Shell.getCPtr(S), S), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_Shell S1, TopoDS_Shell S2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_3(TopoDS_Shell.getCPtr(S1), S1, TopoDS_Shell.getCPtr(S2), S2), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_Shell S1, TopoDS_Shell S2, TopoDS_Shell S3) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_4(TopoDS_Shell.getCPtr(S1), S1, TopoDS_Shell.getCPtr(S2), S2, TopoDS_Shell.getCPtr(S3), S3), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_Solid So) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_5(TopoDS_Solid.getCPtr(So), So), true);
+ }
+
+ public BRepBuilderAPI_MakeSolid(TopoDS_Solid So, TopoDS_Shell S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeSolid__SWIG_6(TopoDS_Solid.getCPtr(So), So, TopoDS_Shell.getCPtr(S), S), true);
+ }
+
+ public void add(TopoDS_Shell S) {
+ OccJavaJNI.BRepBuilderAPI_MakeSolid_add(swigCPtr, this, TopoDS_Shell.getCPtr(S), S);
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepBuilderAPI_MakeSolid_isDone(swigCPtr, this);
+}
+
+ public boolean isDeleted(TopoDS_Shape S) {
+ return OccJavaJNI.BRepBuilderAPI_MakeSolid_isDeleted(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeVertex extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeVertex(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeVertex_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeVertex obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeVertex(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeVertex(double[] P) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeVertex(P), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeVertex extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeVertex(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeVertex_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeVertex obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeVertex(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeVertex(double[] P) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeVertex(P), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_MakeWire extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_MakeWire(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_MakeWire_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_MakeWire obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_MakeWire(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_0(), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Edge E) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_1(TopoDS_Edge.getCPtr(E), E), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_2(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2, TopoDS_Edge E3) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_3(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2, TopoDS_Edge.getCPtr(E3), E3), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2, TopoDS_Edge E3, TopoDS_Edge E4) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_4(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2, TopoDS_Edge.getCPtr(E3), E3, TopoDS_Edge.getCPtr(E4), E4), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Wire W) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_5(TopoDS_Wire.getCPtr(W), W), true);\r
- }\r
-\r
- public BRepBuilderAPI_MakeWire(TopoDS_Wire W, TopoDS_Edge E) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_6(TopoDS_Wire.getCPtr(W), W, TopoDS_Edge.getCPtr(E), E), true);\r
- }\r
-\r
- public void add(TopoDS_Edge E) {\r
- OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_0(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);\r
- }\r
-\r
- public void add(TopoDS_Wire W) {\r
- OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_1(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);\r
- }\r
-\r
- public void add(TopoDS_Shape[] shapes) {\r
- OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_2(swigCPtr, this, TopoDS_Shape.cArrayUnwrap(shapes));\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepBuilderAPI_MakeWire_isDone(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_MakeWire extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_MakeWire(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_MakeWire_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_MakeWire obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_MakeWire(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_MakeWire() {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_0(), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Edge E) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_1(TopoDS_Edge.getCPtr(E), E), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_2(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2, TopoDS_Edge E3) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_3(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2, TopoDS_Edge.getCPtr(E3), E3), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Edge E1, TopoDS_Edge E2, TopoDS_Edge E3, TopoDS_Edge E4) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_4(TopoDS_Edge.getCPtr(E1), E1, TopoDS_Edge.getCPtr(E2), E2, TopoDS_Edge.getCPtr(E3), E3, TopoDS_Edge.getCPtr(E4), E4), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Wire W) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_5(TopoDS_Wire.getCPtr(W), W), true);
+ }
+
+ public BRepBuilderAPI_MakeWire(TopoDS_Wire W, TopoDS_Edge E) {
+ this(OccJavaJNI.new_BRepBuilderAPI_MakeWire__SWIG_6(TopoDS_Wire.getCPtr(W), W, TopoDS_Edge.getCPtr(E), E), true);
+ }
+
+ public void add(TopoDS_Edge E) {
+ OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_0(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);
+ }
+
+ public void add(TopoDS_Wire W) {
+ OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_1(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);
+ }
+
+ public void add(TopoDS_Shape[] shapes) {
+ OccJavaJNI.BRepBuilderAPI_MakeWire_add__SWIG_2(swigCPtr, this, TopoDS_Shape.cArrayUnwrap(shapes));
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepBuilderAPI_MakeWire_isDone(swigCPtr, this);
+}
+
+ public TopoDS_Wire wire() {
+ return new TopoDS_Wire(OccJavaJNI.BRepBuilderAPI_MakeWire_wire(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_ModifyShape extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_ModifyShape(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_ModifyShape_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_ModifyShape obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_ModifyShape(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Shape modifiedShape(TopoDS_Shape S) {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_ModifyShape_modifiedShape(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_ModifyShape extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_ModifyShape(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_ModifyShape_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_ModifyShape obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_ModifyShape(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Shape modifiedShape(TopoDS_Shape S) {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_ModifyShape_modifiedShape(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_NurbsConvert extends BRepBuilderAPI_ModifyShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_NurbsConvert(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_NurbsConvert_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_NurbsConvert obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_NurbsConvert(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_NurbsConvert() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_0(), true);\r
- }\r
-\r
- public BRepBuilderAPI_NurbsConvert(TopoDS_Shape S, boolean Copy) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_1(TopoDS_Shape.getCPtr(S), S, Copy), true);\r
- }\r
-\r
- public BRepBuilderAPI_NurbsConvert(TopoDS_Shape S) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_2(TopoDS_Shape.getCPtr(S), S), true);\r
- }\r
-\r
- public void perform(TopoDS_Shape S, boolean Copy) {\r
- OccJavaJNI.BRepBuilderAPI_NurbsConvert_perform__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, Copy);\r
- }\r
-\r
- public void perform(TopoDS_Shape S) {\r
- OccJavaJNI.BRepBuilderAPI_NurbsConvert_perform__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_NurbsConvert extends BRepBuilderAPI_ModifyShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_NurbsConvert(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_NurbsConvert_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_NurbsConvert obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_NurbsConvert(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_NurbsConvert() {
+ this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_0(), true);
+ }
+
+ public BRepBuilderAPI_NurbsConvert(TopoDS_Shape S, boolean Copy) {
+ this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_1(TopoDS_Shape.getCPtr(S), S, Copy), true);
+ }
+
+ public BRepBuilderAPI_NurbsConvert(TopoDS_Shape S) {
+ this(OccJavaJNI.new_BRepBuilderAPI_NurbsConvert__SWIG_2(TopoDS_Shape.getCPtr(S), S), true);
+ }
+
+ public void perform(TopoDS_Shape S, boolean Copy) {
+ OccJavaJNI.BRepBuilderAPI_NurbsConvert_perform__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, Copy);
+ }
+
+ public void perform(TopoDS_Shape S) {
+ OccJavaJNI.BRepBuilderAPI_NurbsConvert_perform__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_Sewing {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepBuilderAPI_Sewing(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_Sewing obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_Sewing(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public BRepBuilderAPI_Sewing(double tolerance, boolean option, boolean cutting, boolean nonmanifold) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_0(tolerance, option, cutting, nonmanifold), true);\r
- }\r
-\r
- public BRepBuilderAPI_Sewing(double tolerance, boolean option, boolean cutting) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_1(tolerance, option, cutting), true);\r
- }\r
-\r
- public BRepBuilderAPI_Sewing(double tolerance, boolean option) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_2(tolerance, option), true);\r
- }\r
-\r
- public BRepBuilderAPI_Sewing(double tolerance) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_3(tolerance), true);\r
- }\r
-\r
- public BRepBuilderAPI_Sewing() {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_4(), true);\r
- }\r
-\r
- public void init(double tolerance, boolean option, boolean cutting, boolean nonmanifold) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_0(swigCPtr, this, tolerance, option, cutting, nonmanifold);\r
- }\r
-\r
- public void init(double tolerance, boolean option, boolean cutting) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_1(swigCPtr, this, tolerance, option, cutting);\r
- }\r
-\r
- public void init(double tolerance, boolean option) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_2(swigCPtr, this, tolerance, option);\r
- }\r
-\r
- public void init(double tolerance) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_3(swigCPtr, this, tolerance);\r
- }\r
-\r
- public void load(TopoDS_Shape shape) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_load(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
- }\r
-\r
- public void add(TopoDS_Shape shape) {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_add(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
- }\r
-\r
- public void perform() {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_perform(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape sewedShape() {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_sewedShape(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public int nbFreeEdges() {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_nbFreeEdges(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Edge freeEdge(int index) {\r
- return new TopoDS_Edge(OccJavaJNI.BRepBuilderAPI_Sewing_freeEdge(swigCPtr, this, index), false);\r
- }\r
-\r
- public int nbMultipleEdges() {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_nbMultipleEdges(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Edge multipleEdge(int index) {\r
- return new TopoDS_Edge(OccJavaJNI.BRepBuilderAPI_Sewing_multipleEdge(swigCPtr, this, index), false);\r
- }\r
-\r
- public int nbDegeneratedShapes() {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_nbDegeneratedShapes(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape degeneratedShape(int index) {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_degeneratedShape(swigCPtr, this, index);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public int nbDeletedFaces() {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_nbDeletedFaces(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Face deletedFace(int index) {\r
- return new TopoDS_Face(OccJavaJNI.BRepBuilderAPI_Sewing_deletedFace(swigCPtr, this, index), false);\r
- }\r
-\r
- public boolean isDegenerated(TopoDS_Shape shape) {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_isDegenerated(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
-}\r
-\r
- public boolean isModified(TopoDS_Shape shape) {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_isModified(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
-}\r
-\r
- public TopoDS_Shape modified(TopoDS_Shape shape) {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_modified(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public void dump() {\r
- OccJavaJNI.BRepBuilderAPI_Sewing_dump(swigCPtr, this);\r
- }\r
-\r
- public boolean isModifiedSubShape(TopoDS_Shape shape) {\r
- return OccJavaJNI.BRepBuilderAPI_Sewing_isModifiedSubShape(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
-}\r
-\r
- public TopoDS_Shape modifiedSubShape(TopoDS_Shape shape) {\r
- long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_modifiedSubShape(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_Sewing {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepBuilderAPI_Sewing(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_Sewing obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_Sewing(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public BRepBuilderAPI_Sewing(double tolerance, boolean option, boolean cutting, boolean nonmanifold) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_0(tolerance, option, cutting, nonmanifold), true);
+ }
+
+ public BRepBuilderAPI_Sewing(double tolerance, boolean option, boolean cutting) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_1(tolerance, option, cutting), true);
+ }
+
+ public BRepBuilderAPI_Sewing(double tolerance, boolean option) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_2(tolerance, option), true);
+ }
+
+ public BRepBuilderAPI_Sewing(double tolerance) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_3(tolerance), true);
+ }
+
+ public BRepBuilderAPI_Sewing() {
+ this(OccJavaJNI.new_BRepBuilderAPI_Sewing__SWIG_4(), true);
+ }
+
+ public void init(double tolerance, boolean option, boolean cutting, boolean nonmanifold) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_0(swigCPtr, this, tolerance, option, cutting, nonmanifold);
+ }
+
+ public void init(double tolerance, boolean option, boolean cutting) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_1(swigCPtr, this, tolerance, option, cutting);
+ }
+
+ public void init(double tolerance, boolean option) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_2(swigCPtr, this, tolerance, option);
+ }
+
+ public void init(double tolerance) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_init__SWIG_3(swigCPtr, this, tolerance);
+ }
+
+ public void load(TopoDS_Shape shape) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_load(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+ }
+
+ public void add(TopoDS_Shape shape) {
+ OccJavaJNI.BRepBuilderAPI_Sewing_add(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+ }
+
+ public void perform() {
+ OccJavaJNI.BRepBuilderAPI_Sewing_perform(swigCPtr, this);
+ }
+
+ public TopoDS_Shape sewedShape() {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_sewedShape(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public int nbFreeEdges() {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_nbFreeEdges(swigCPtr, this);
+ }
+
+ public TopoDS_Edge freeEdge(int index) {
+ return new TopoDS_Edge(OccJavaJNI.BRepBuilderAPI_Sewing_freeEdge(swigCPtr, this, index), false);
+ }
+
+ public int nbMultipleEdges() {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_nbMultipleEdges(swigCPtr, this);
+ }
+
+ public TopoDS_Edge multipleEdge(int index) {
+ return new TopoDS_Edge(OccJavaJNI.BRepBuilderAPI_Sewing_multipleEdge(swigCPtr, this, index), false);
+ }
+
+ public int nbDegeneratedShapes() {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_nbDegeneratedShapes(swigCPtr, this);
+ }
+
+ public TopoDS_Shape degeneratedShape(int index) {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_degeneratedShape(swigCPtr, this, index);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public int nbDeletedFaces() {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_nbDeletedFaces(swigCPtr, this);
+ }
+
+ public TopoDS_Face deletedFace(int index) {
+ return new TopoDS_Face(OccJavaJNI.BRepBuilderAPI_Sewing_deletedFace(swigCPtr, this, index), false);
+ }
+
+ public boolean isDegenerated(TopoDS_Shape shape) {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_isDegenerated(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+}
+
+ public boolean isModified(TopoDS_Shape shape) {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_isModified(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+}
+
+ public TopoDS_Shape modified(TopoDS_Shape shape) {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_modified(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public void dump() {
+ OccJavaJNI.BRepBuilderAPI_Sewing_dump(swigCPtr, this);
+ }
+
+ public boolean isModifiedSubShape(TopoDS_Shape shape) {
+ return OccJavaJNI.BRepBuilderAPI_Sewing_isModifiedSubShape(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+}
+
+ public TopoDS_Shape modifiedSubShape(TopoDS_Shape shape) {
+ long cPtr = OccJavaJNI.BRepBuilderAPI_Sewing_modifiedSubShape(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepBuilderAPI_Transform extends BRepBuilderAPI_ModifyShape {\r
- private long swigCPtr;\r
-\r
- public BRepBuilderAPI_Transform(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepBuilderAPI_Transform_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepBuilderAPI_Transform obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepBuilderAPI_Transform(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepBuilderAPI_Transform(GP_Trsf T) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_0(GP_Trsf.getCPtr(T), T), true);\r
- }\r
-\r
- public BRepBuilderAPI_Transform(TopoDS_Shape S, GP_Trsf T, boolean Copy) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_1(TopoDS_Shape.getCPtr(S), S, GP_Trsf.getCPtr(T), T, Copy), true);\r
- }\r
-\r
- public BRepBuilderAPI_Transform(TopoDS_Shape S, GP_Trsf T) {\r
- this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_2(TopoDS_Shape.getCPtr(S), S, GP_Trsf.getCPtr(T), T), true);\r
- }\r
-\r
- public void perform(TopoDS_Shape S, boolean Copy) {\r
- OccJavaJNI.BRepBuilderAPI_Transform_perform__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, Copy);\r
- }\r
-\r
- public void perform(TopoDS_Shape S) {\r
- OccJavaJNI.BRepBuilderAPI_Transform_perform__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepBuilderAPI_Transform extends BRepBuilderAPI_ModifyShape {
+ private transient long swigCPtr;
+
+ protected BRepBuilderAPI_Transform(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepBuilderAPI_Transform_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepBuilderAPI_Transform obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepBuilderAPI_Transform(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepBuilderAPI_Transform(GP_Trsf T) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_0(GP_Trsf.getCPtr(T), T), true);
+ }
+
+ public BRepBuilderAPI_Transform(TopoDS_Shape S, GP_Trsf T, boolean Copy) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_1(TopoDS_Shape.getCPtr(S), S, GP_Trsf.getCPtr(T), T, Copy), true);
+ }
+
+ public BRepBuilderAPI_Transform(TopoDS_Shape S, GP_Trsf T) {
+ this(OccJavaJNI.new_BRepBuilderAPI_Transform__SWIG_2(TopoDS_Shape.getCPtr(S), S, GP_Trsf.getCPtr(T), T), true);
+ }
+
+ public void perform(TopoDS_Shape S, boolean Copy) {
+ OccJavaJNI.BRepBuilderAPI_Transform_perform__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, Copy);
+ }
+
+ public void perform(TopoDS_Shape S) {
+ OccJavaJNI.BRepBuilderAPI_Transform_perform__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepCheck_Analyzer {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepCheck_Analyzer(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepCheck_Analyzer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepCheck_Analyzer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public BRepCheck_Analyzer(TopoDS_Shape S, boolean GeomControls) {\r
- this(OccJavaJNI.new_BRepCheck_Analyzer__SWIG_0(TopoDS_Shape.getCPtr(S), S, GeomControls), true);\r
- }\r
-\r
- public BRepCheck_Analyzer(TopoDS_Shape S) {\r
- this(OccJavaJNI.new_BRepCheck_Analyzer__SWIG_1(TopoDS_Shape.getCPtr(S), S), true);\r
- }\r
-\r
- public void init(TopoDS_Shape S, boolean GeomControls) {\r
- OccJavaJNI.BRepCheck_Analyzer_init__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, GeomControls);\r
- }\r
-\r
- public void init(TopoDS_Shape S) {\r
- OccJavaJNI.BRepCheck_Analyzer_init__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public boolean isValid() {\r
- return OccJavaJNI.BRepCheck_Analyzer_isValid(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepCheck_Analyzer {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepCheck_Analyzer(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepCheck_Analyzer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepCheck_Analyzer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public BRepCheck_Analyzer(TopoDS_Shape S, boolean GeomControls) {
+ this(OccJavaJNI.new_BRepCheck_Analyzer__SWIG_0(TopoDS_Shape.getCPtr(S), S, GeomControls), true);
+ }
+
+ public BRepCheck_Analyzer(TopoDS_Shape S) {
+ this(OccJavaJNI.new_BRepCheck_Analyzer__SWIG_1(TopoDS_Shape.getCPtr(S), S), true);
+ }
+
+ public void init(TopoDS_Shape S, boolean GeomControls) {
+ OccJavaJNI.BRepCheck_Analyzer_init__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, GeomControls);
+ }
+
+ public void init(TopoDS_Shape S) {
+ OccJavaJNI.BRepCheck_Analyzer_init__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public boolean isValid() {
+ return OccJavaJNI.BRepCheck_Analyzer_isValid(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepFilletAPI_LocalOperation extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepFilletAPI_LocalOperation(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepFilletAPI_LocalOperation_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepFilletAPI_LocalOperation obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepFilletAPI_LocalOperation(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepFilletAPI_LocalOperation extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepFilletAPI_LocalOperation(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepFilletAPI_LocalOperation_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepFilletAPI_LocalOperation obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepFilletAPI_LocalOperation(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepFilletAPI_MakeChamfer extends BRepFilletAPI_LocalOperation {\r
- private long swigCPtr;\r
-\r
- public BRepFilletAPI_MakeChamfer(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepFilletAPI_MakeChamfer_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepFilletAPI_MakeChamfer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepFilletAPI_MakeChamfer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepFilletAPI_MakeChamfer(TopoDS_Shape shape) {\r
- this(OccJavaJNI.new_BRepFilletAPI_MakeChamfer(TopoDS_Shape.getCPtr(shape), shape), true);\r
- }\r
-\r
- public void add(double distance, TopoDS_Edge edge, TopoDS_Face face) {\r
- OccJavaJNI.BRepFilletAPI_MakeChamfer_add(swigCPtr, this, distance, TopoDS_Edge.getCPtr(edge), edge, TopoDS_Face.getCPtr(face), face);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepFilletAPI_MakeChamfer extends BRepFilletAPI_LocalOperation {
+ private transient long swigCPtr;
+
+ protected BRepFilletAPI_MakeChamfer(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepFilletAPI_MakeChamfer_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepFilletAPI_MakeChamfer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepFilletAPI_MakeChamfer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepFilletAPI_MakeChamfer(TopoDS_Shape shape) {
+ this(OccJavaJNI.new_BRepFilletAPI_MakeChamfer(TopoDS_Shape.getCPtr(shape), shape), true);
+ }
+
+ public void add(double distance, TopoDS_Edge edge, TopoDS_Face face) {
+ OccJavaJNI.BRepFilletAPI_MakeChamfer_add(swigCPtr, this, distance, TopoDS_Edge.getCPtr(edge), edge, TopoDS_Face.getCPtr(face), face);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepFilletAPI_MakeFillet extends BRepFilletAPI_LocalOperation {\r
- private long swigCPtr;\r
-\r
- public BRepFilletAPI_MakeFillet(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepFilletAPI_MakeFillet_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepFilletAPI_MakeFillet obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepFilletAPI_MakeFillet(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepFilletAPI_MakeFillet(TopoDS_Shape shape, ChFi3d_FilletShape type) {\r
- this(OccJavaJNI.new_BRepFilletAPI_MakeFillet__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, type.swigValue()), true);\r
- }\r
-\r
- public BRepFilletAPI_MakeFillet(TopoDS_Shape shape) {\r
- this(OccJavaJNI.new_BRepFilletAPI_MakeFillet__SWIG_1(TopoDS_Shape.getCPtr(shape), shape), true);\r
- }\r
-\r
- public void add(double radius, TopoDS_Edge edge) {\r
- OccJavaJNI.BRepFilletAPI_MakeFillet_add(swigCPtr, this, radius, TopoDS_Edge.getCPtr(edge), edge);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepFilletAPI_MakeFillet extends BRepFilletAPI_LocalOperation {
+ private transient long swigCPtr;
+
+ protected BRepFilletAPI_MakeFillet(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepFilletAPI_MakeFillet_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepFilletAPI_MakeFillet obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepFilletAPI_MakeFillet(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepFilletAPI_MakeFillet(TopoDS_Shape shape, ChFi3d_FilletShape type) {
+ this(OccJavaJNI.new_BRepFilletAPI_MakeFillet__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, type.swigValue()), true);
+ }
+
+ public BRepFilletAPI_MakeFillet(TopoDS_Shape shape) {
+ this(OccJavaJNI.new_BRepFilletAPI_MakeFillet__SWIG_1(TopoDS_Shape.getCPtr(shape), shape), true);
+ }
+
+ public void add(double radius, TopoDS_Edge edge) {
+ OccJavaJNI.BRepFilletAPI_MakeFillet_add(swigCPtr, this, radius, TopoDS_Edge.getCPtr(edge), edge);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepGProp {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepGProp(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepGProp obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepGProp(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static void linearProperties(TopoDS_Shape shape, GProp_GProps properties) {\r
- OccJavaJNI.BRepGProp_linearProperties(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);\r
- }\r
-\r
- public static void volumeProperties(TopoDS_Shape shape, GProp_GProps properties, boolean onlyClosed) {\r
- OccJavaJNI.BRepGProp_volumeProperties__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, onlyClosed);\r
- }\r
-\r
- public static void volumeProperties(TopoDS_Shape shape, GProp_GProps properties) {\r
- OccJavaJNI.BRepGProp_volumeProperties__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);\r
- }\r
-\r
- public static double volumeProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed) {\r
- return OccJavaJNI.BRepGProp_volumeProperties__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed);\r
- }\r
-\r
- public static double volumeProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps) {\r
- return OccJavaJNI.BRepGProp_volumeProperties__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);\r
- }\r
-\r
- public static void surfaceProperties(TopoDS_Shape shape, GProp_GProps properties) {\r
- OccJavaJNI.BRepGProp_surfaceProperties__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);\r
- }\r
-\r
- public static double surfaceProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps) {\r
- return OccJavaJNI.BRepGProp_surfaceProperties__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);\r
- }\r
-\r
- public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan, boolean cgFlag, boolean iFlag) {\r
- return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan, cgFlag, iFlag);\r
- }\r
-\r
- public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan, boolean cgFlag) {\r
- return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan, cgFlag);\r
- }\r
-\r
- public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan) {\r
- return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan);\r
- }\r
-\r
- public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed) {\r
- return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed);\r
- }\r
-\r
- public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps) {\r
- return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_4(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);\r
- }\r
-\r
- public BRepGProp() {\r
- this(OccJavaJNI.new_BRepGProp(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepGProp {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepGProp(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepGProp obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepGProp(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static void linearProperties(TopoDS_Shape shape, GProp_GProps properties) {
+ OccJavaJNI.BRepGProp_linearProperties(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);
+ }
+
+ public static void volumeProperties(TopoDS_Shape shape, GProp_GProps properties, boolean onlyClosed) {
+ OccJavaJNI.BRepGProp_volumeProperties__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, onlyClosed);
+ }
+
+ public static void volumeProperties(TopoDS_Shape shape, GProp_GProps properties) {
+ OccJavaJNI.BRepGProp_volumeProperties__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);
+ }
+
+ public static double volumeProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed) {
+ return OccJavaJNI.BRepGProp_volumeProperties__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed);
+ }
+
+ public static double volumeProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps) {
+ return OccJavaJNI.BRepGProp_volumeProperties__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);
+ }
+
+ public static void surfaceProperties(TopoDS_Shape shape, GProp_GProps properties) {
+ OccJavaJNI.BRepGProp_surfaceProperties__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties);
+ }
+
+ public static double surfaceProperties(TopoDS_Shape shape, GProp_GProps properties, double Eps) {
+ return OccJavaJNI.BRepGProp_surfaceProperties__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);
+ }
+
+ public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan, boolean cgFlag, boolean iFlag) {
+ return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan, cgFlag, iFlag);
+ }
+
+ public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan, boolean cgFlag) {
+ return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan, cgFlag);
+ }
+
+ public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed, boolean isUseSpan) {
+ return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed, isUseSpan);
+ }
+
+ public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps, boolean onlyClosed) {
+ return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps, onlyClosed);
+ }
+
+ public static double volumePropertiesGK(TopoDS_Shape shape, GProp_GProps properties, double Eps) {
+ return OccJavaJNI.BRepGProp_volumePropertiesGK__SWIG_4(TopoDS_Shape.getCPtr(shape), shape, GProp_GProps.getCPtr(properties), properties, Eps);
+ }
+
+ public BRepGProp() {
+ this(OccJavaJNI.new_BRepGProp(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepLib {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepLib(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepLib obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepLib(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static void encodeRegularity(TopoDS_Shape S, double TolAng) {\r
- OccJavaJNI.BRepLib_encodeRegularity__SWIG_0(TopoDS_Shape.getCPtr(S), S, TolAng);\r
- }\r
-\r
- public static void encodeRegularity(TopoDS_Shape S) {\r
- OccJavaJNI.BRepLib_encodeRegularity__SWIG_1(TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public BRepLib() {\r
- this(OccJavaJNI.new_BRepLib(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepLib {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepLib(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepLib obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepLib(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static void encodeRegularity(TopoDS_Shape S, double TolAng) {
+ OccJavaJNI.BRepLib_encodeRegularity__SWIG_0(TopoDS_Shape.getCPtr(S), S, TolAng);
+ }
+
+ public static void encodeRegularity(TopoDS_Shape S) {
+ OccJavaJNI.BRepLib_encodeRegularity__SWIG_1(TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public BRepLib() {
+ this(OccJavaJNI.new_BRepLib(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepMesh_DiscretRoot {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepMesh_DiscretRoot(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepMesh_DiscretRoot obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepMesh_DiscretRoot(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public void setDeflection(double D) {\r
- OccJavaJNI.BRepMesh_DiscretRoot_setDeflection(swigCPtr, this, D);\r
- }\r
-\r
- public void setAngle(double Ang) {\r
- OccJavaJNI.BRepMesh_DiscretRoot_setAngle(swigCPtr, this, Ang);\r
- }\r
-\r
- public double deflection() {\r
- return OccJavaJNI.BRepMesh_DiscretRoot_deflection(swigCPtr, this);\r
- }\r
-\r
- public double angle() {\r
- return OccJavaJNI.BRepMesh_DiscretRoot_angle(swigCPtr, this);\r
- }\r
-\r
- public void perform() {\r
- OccJavaJNI.BRepMesh_DiscretRoot_perform(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepMesh_DiscretRoot {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepMesh_DiscretRoot(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepMesh_DiscretRoot obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepMesh_DiscretRoot(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public void perform() {
+ OccJavaJNI.BRepMesh_DiscretRoot_perform(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepMesh_IncrementalMesh extends BRepMesh_DiscretRoot {\r
- private long swigCPtr;\r
-\r
- public BRepMesh_IncrementalMesh(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepMesh_IncrementalMesh_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepMesh_IncrementalMesh obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepMesh_IncrementalMesh(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepMesh_IncrementalMesh() {\r
- this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_0(), true);\r
- }\r
-\r
- public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D, boolean Relatif, double Ang) {\r
- this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_1(TopoDS_Shape.getCPtr(S), S, D, Relatif, Ang), true);\r
- }\r
-\r
- public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D, boolean Relatif) {\r
- this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_2(TopoDS_Shape.getCPtr(S), S, D, Relatif), true);\r
- }\r
-\r
- public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D) {\r
- this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_3(TopoDS_Shape.getCPtr(S), S, D), true);\r
- }\r
-\r
- public void perform() {\r
- OccJavaJNI.BRepMesh_IncrementalMesh_perform(swigCPtr, this);\r
- }\r
-\r
- public void update(TopoDS_Shape S) {\r
- OccJavaJNI.BRepMesh_IncrementalMesh_update(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public boolean isModified() {\r
- return OccJavaJNI.BRepMesh_IncrementalMesh_isModified(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepMesh_IncrementalMesh extends BRepMesh_DiscretRoot {
+ private transient long swigCPtr;
+
+ protected BRepMesh_IncrementalMesh(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepMesh_IncrementalMesh_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepMesh_IncrementalMesh obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepMesh_IncrementalMesh(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepMesh_IncrementalMesh() {
+ this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_0(), true);
+ }
+
+ public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D, boolean Relatif, double Ang) {
+ this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_1(TopoDS_Shape.getCPtr(S), S, D, Relatif, Ang), true);
+ }
+
+ public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D, boolean Relatif) {
+ this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_2(TopoDS_Shape.getCPtr(S), S, D, Relatif), true);
+ }
+
+ public BRepMesh_IncrementalMesh(TopoDS_Shape S, double D) {
+ this(OccJavaJNI.new_BRepMesh_IncrementalMesh__SWIG_3(TopoDS_Shape.getCPtr(S), S, D), true);
+ }
+
+ public void perform() {
+ OccJavaJNI.BRepMesh_IncrementalMesh_perform(swigCPtr, this);
+ }
+
+ public boolean isModified() {
+ return OccJavaJNI.BRepMesh_IncrementalMesh_isModified(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepOffsetAPI_MakePipe extends BRepPrimAPI_MakeSweep {\r
- private long swigCPtr;\r
-\r
- public BRepOffsetAPI_MakePipe(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepOffsetAPI_MakePipe_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepOffsetAPI_MakePipe obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepOffsetAPI_MakePipe(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepOffsetAPI_MakePipe(TopoDS_Wire Spine, TopoDS_Shape Profile) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakePipe(TopoDS_Wire.getCPtr(Spine), Spine, TopoDS_Shape.getCPtr(Profile), Profile), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepOffsetAPI_MakePipe extends BRepPrimAPI_MakeSweep {
+ private transient long swigCPtr;
+
+ protected BRepOffsetAPI_MakePipe(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepOffsetAPI_MakePipe_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepOffsetAPI_MakePipe obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepOffsetAPI_MakePipe(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepOffsetAPI_MakePipe(TopoDS_Wire Spine, TopoDS_Shape Profile) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakePipe(TopoDS_Wire.getCPtr(Spine), Spine, TopoDS_Shape.getCPtr(Profile), Profile), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepOffsetAPI_MakeThickSolid extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepOffsetAPI_MakeThickSolid(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepOffsetAPI_MakeThickSolid_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepOffsetAPI_MakeThickSolid obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepOffsetAPI_MakeThickSolid(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection, boolean SelfInter, SWIGTYPE_p_GeomAbs_JoinType Join) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_0(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection, SelfInter, SWIGTYPE_p_GeomAbs_JoinType.getCPtr(Join)), true);\r
- }\r
-\r
- public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection, boolean SelfInter) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_1(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection, SelfInter), true);\r
- }\r
-\r
- public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_2(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection), true);\r
- }\r
-\r
- public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_3(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue()), true);\r
- }\r
-\r
- public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_4(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepOffsetAPI_MakeThickSolid extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepOffsetAPI_MakeThickSolid(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepOffsetAPI_MakeThickSolid_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepOffsetAPI_MakeThickSolid obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepOffsetAPI_MakeThickSolid(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection, boolean SelfInter, SWIGTYPE_p_GeomAbs_JoinType Join) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_0(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection, SelfInter, SWIGTYPE_p_GeomAbs_JoinType.getCPtr(Join)), true);
+ }
+
+ public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection, boolean SelfInter) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_1(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection, SelfInter), true);
+ }
+
+ public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode, boolean Intersection) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_2(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue(), Intersection), true);
+ }
+
+ public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol, BRepOffset_Mode Mode) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_3(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol, Mode.swigValue()), true);
+ }
+
+ public BRepOffsetAPI_MakeThickSolid(TopoDS_Shape S, TopoDS_Shape[] ClosingFaces, double Offset, double Tol) {
+ this(OccJavaJNI.new_BRepOffsetAPI_MakeThickSolid__SWIG_4(TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.cArrayUnwrap(ClosingFaces), Offset, Tol), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepOffsetAPI_NormalProjection extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepOffsetAPI_NormalProjection(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepOffsetAPI_NormalProjection_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepOffsetAPI_NormalProjection obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepOffsetAPI_NormalProjection(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepOffsetAPI_NormalProjection() {\r
- this(OccJavaJNI.new_BRepOffsetAPI_NormalProjection__SWIG_0(), true);\r
- }\r
-\r
- public BRepOffsetAPI_NormalProjection(TopoDS_Shape S) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_NormalProjection__SWIG_1(TopoDS_Shape.getCPtr(S), S), true);\r
- }\r
-\r
- public void init(TopoDS_Shape S) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_init(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public void add(TopoDS_Shape ToProj) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_add(swigCPtr, this, TopoDS_Shape.getCPtr(ToProj), ToProj);\r
- }\r
-\r
- public void setParams(double Tol3D, double Tol2D, GeomAbs_Shape InternalContinuity, int MaxDegree, int MaxSeg) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_setParams(swigCPtr, this, Tol3D, Tol2D, InternalContinuity.swigValue(), MaxDegree, MaxSeg);\r
- }\r
-\r
- public void setMaxDistance(double MaxDist) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_setMaxDistance(swigCPtr, this, MaxDist);\r
- }\r
-\r
- public void setLimit(boolean FaceBoundaries) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_setLimit__SWIG_0(swigCPtr, this, FaceBoundaries);\r
- }\r
-\r
- public void setLimit() {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_setLimit__SWIG_1(swigCPtr, this);\r
- }\r
-\r
- public void compute3d(boolean With3d) {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_compute3d__SWIG_0(swigCPtr, this, With3d);\r
- }\r
-\r
- public void compute3d() {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_compute3d__SWIG_1(swigCPtr, this);\r
- }\r
-\r
- public void build() {\r
- OccJavaJNI.BRepOffsetAPI_NormalProjection_build(swigCPtr, this);\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.BRepOffsetAPI_NormalProjection_isDone(swigCPtr, this);\r
-}\r
-\r
- public TopoDS_Shape projection() {\r
- long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_projection(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public TopoDS_Shape couple(TopoDS_Edge E) {\r
- long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_couple(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public TopoDS_Shape[] generated(TopoDS_Shape S) {\r
- return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepOffsetAPI_NormalProjection_generated(swigCPtr, this, TopoDS_Shape.getCPtr(S), S));\r
-}\r
-\r
- public TopoDS_Shape ancestor(TopoDS_Edge E) {\r
- long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_ancestor(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public boolean buildWire(SWIGTYPE_p_TopTools_ListOfShape Liste) {\r
- return OccJavaJNI.BRepOffsetAPI_NormalProjection_buildWire(swigCPtr, this, SWIGTYPE_p_TopTools_ListOfShape.getCPtr(Liste));\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepOffsetAPI_NormalProjection extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepOffsetAPI_NormalProjection(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepOffsetAPI_NormalProjection_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepOffsetAPI_NormalProjection obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepOffsetAPI_NormalProjection(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepOffsetAPI_NormalProjection() {
+ this(OccJavaJNI.new_BRepOffsetAPI_NormalProjection__SWIG_0(), true);
+ }
+
+ public BRepOffsetAPI_NormalProjection(TopoDS_Shape S) {
+ this(OccJavaJNI.new_BRepOffsetAPI_NormalProjection__SWIG_1(TopoDS_Shape.getCPtr(S), S), true);
+ }
+
+ public void init(TopoDS_Shape S) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_init(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public void add(TopoDS_Shape ToProj) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_add(swigCPtr, this, TopoDS_Shape.getCPtr(ToProj), ToProj);
+ }
+
+ public void setParams(double Tol3D, double Tol2D, GeomAbs_Shape InternalContinuity, int MaxDegree, int MaxSeg) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_setParams(swigCPtr, this, Tol3D, Tol2D, InternalContinuity.swigValue(), MaxDegree, MaxSeg);
+ }
+
+ public void setMaxDistance(double MaxDist) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_setMaxDistance(swigCPtr, this, MaxDist);
+ }
+
+ public void setLimit(boolean FaceBoundaries) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_setLimit__SWIG_0(swigCPtr, this, FaceBoundaries);
+ }
+
+ public void setLimit() {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_setLimit__SWIG_1(swigCPtr, this);
+ }
+
+ public void compute3d(boolean With3d) {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_compute3d__SWIG_0(swigCPtr, this, With3d);
+ }
+
+ public void compute3d() {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_compute3d__SWIG_1(swigCPtr, this);
+ }
+
+ public void build() {
+ OccJavaJNI.BRepOffsetAPI_NormalProjection_build(swigCPtr, this);
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.BRepOffsetAPI_NormalProjection_isDone(swigCPtr, this);
+}
+
+ public TopoDS_Shape projection() {
+ long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_projection(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public TopoDS_Shape couple(TopoDS_Edge E) {
+ long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_couple(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public TopoDS_Shape[] generated(TopoDS_Shape S) {
+ return TopoDS_Shape.cArrayWrap(OccJavaJNI.BRepOffsetAPI_NormalProjection_generated(swigCPtr, this, TopoDS_Shape.getCPtr(S), S));
+}
+
+ public TopoDS_Shape ancestor(TopoDS_Edge E) {
+ long cPtr = OccJavaJNI.BRepOffsetAPI_NormalProjection_ancestor(swigCPtr, this, TopoDS_Edge.getCPtr(E), E);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public boolean buildWire(SWIGTYPE_p_TopTools_ListOfShape Liste) {
+ return OccJavaJNI.BRepOffsetAPI_NormalProjection_buildWire(swigCPtr, this, SWIGTYPE_p_TopTools_ListOfShape.getCPtr(Liste));
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepOffsetAPI_ThruSections extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepOffsetAPI_ThruSections(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepOffsetAPI_ThruSections_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepOffsetAPI_ThruSections obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepOffsetAPI_ThruSections(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepOffsetAPI_ThruSections(boolean isSolid, boolean ruled, double pres3d) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_0(isSolid, ruled, pres3d), true);\r
- }\r
-\r
- public BRepOffsetAPI_ThruSections(boolean isSolid, boolean ruled) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_1(isSolid, ruled), true);\r
- }\r
-\r
- public BRepOffsetAPI_ThruSections(boolean isSolid) {\r
- this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_2(isSolid), true);\r
- }\r
-\r
- public BRepOffsetAPI_ThruSections() {\r
- this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_3(), true);\r
- }\r
-\r
- public void init(boolean isSolid, boolean ruled, double pres3d) {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_0(swigCPtr, this, isSolid, ruled, pres3d);\r
- }\r
-\r
- public void init(boolean isSolid, boolean ruled) {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_1(swigCPtr, this, isSolid, ruled);\r
- }\r
-\r
- public void init(boolean isSolid) {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_2(swigCPtr, this, isSolid);\r
- }\r
-\r
- public void init() {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_3(swigCPtr, this);\r
- }\r
-\r
- public void addWire(TopoDS_Wire wire) {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_addWire(swigCPtr, this, TopoDS_Wire.getCPtr(wire), wire);\r
- }\r
-\r
- public void addVertex(TopoDS_Vertex aVertex) {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_addVertex(swigCPtr, this, TopoDS_Vertex.getCPtr(aVertex), aVertex);\r
- }\r
-\r
- public void build() {\r
- OccJavaJNI.BRepOffsetAPI_ThruSections_build(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepOffsetAPI_ThruSections extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepOffsetAPI_ThruSections(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepOffsetAPI_ThruSections_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepOffsetAPI_ThruSections obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepOffsetAPI_ThruSections(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepOffsetAPI_ThruSections(boolean isSolid, boolean ruled, double pres3d) {
+ this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_0(isSolid, ruled, pres3d), true);
+ }
+
+ public BRepOffsetAPI_ThruSections(boolean isSolid, boolean ruled) {
+ this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_1(isSolid, ruled), true);
+ }
+
+ public BRepOffsetAPI_ThruSections(boolean isSolid) {
+ this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_2(isSolid), true);
+ }
+
+ public BRepOffsetAPI_ThruSections() {
+ this(OccJavaJNI.new_BRepOffsetAPI_ThruSections__SWIG_3(), true);
+ }
+
+ public void addWire(TopoDS_Wire wire) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_addWire(swigCPtr, this, TopoDS_Wire.getCPtr(wire), wire);
+ }
+
+ public void checkCompatibility(boolean check) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_checkCompatibility__SWIG_0(swigCPtr, this, check);
+ }
+
+ public void checkCompatibility() {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_checkCompatibility__SWIG_1(swigCPtr, this);
+ }
+
+ public TopoDS_Shape shape() {
+ long cPtr = OccJavaJNI.BRepOffsetAPI_ThruSections_shape(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public void init(boolean isSolid, boolean ruled, double pres3d) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_0(swigCPtr, this, isSolid, ruled, pres3d);
+ }
+
+ public void init(boolean isSolid, boolean ruled) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_1(swigCPtr, this, isSolid, ruled);
+ }
+
+ public void init(boolean isSolid) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_2(swigCPtr, this, isSolid);
+ }
+
+ public void init() {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_init__SWIG_3(swigCPtr, this);
+ }
+
+ public void addVertex(TopoDS_Vertex aVertex) {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_addVertex(swigCPtr, this, TopoDS_Vertex.getCPtr(aVertex), aVertex);
+ }
+
+ public void build() {
+ OccJavaJNI.BRepOffsetAPI_ThruSections_build(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum BRepOffset_Mode {\r
- Skin,\r
- Pipe,\r
- RectoVerso;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static BRepOffset_Mode swigToEnum(int swigValue) {\r
- BRepOffset_Mode[] swigValues = BRepOffset_Mode.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (BRepOffset_Mode swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + BRepOffset_Mode.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private BRepOffset_Mode() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private BRepOffset_Mode(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private BRepOffset_Mode(BRepOffset_Mode swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum BRepOffset_Mode {
+ Skin,
+ Pipe,
+ RectoVerso;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static BRepOffset_Mode swigToEnum(int swigValue) {
+ BRepOffset_Mode[] swigValues = BRepOffset_Mode.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (BRepOffset_Mode swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + BRepOffset_Mode.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private BRepOffset_Mode() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private BRepOffset_Mode(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private BRepOffset_Mode(BRepOffset_Mode swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeBox extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeBox(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeBox_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeBox obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeBox(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeBox(double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeBox(P1, P2), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeBox extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeBox(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeBox_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeBox obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeBox(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeBox(double[] P1, double[] P2) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeBox(P1, P2), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeCone extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeCone(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeCone_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeCone obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeCone(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeCone(double[] axes, double baseRadius, double topRadius, double height, double angle) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeCone(axes, baseRadius, topRadius, height, angle), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeCone extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeCone(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeCone_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeCone obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeCone(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeCone(double[] axes, double baseRadius, double topRadius, double height, double angle) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeCone(axes, baseRadius, topRadius, height, angle), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeCylinder extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeCylinder(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeCylinder_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeCylinder obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeCylinder(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- \r
- /**\r
- * @param axes is {X, Y, Z, directionX, directionY, directionZ}\r
- */\r
-public BRepPrimAPI_MakeCylinder(double[] axes, double radius, double height, double angle) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeCylinder(axes, radius, height, angle), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeCylinder extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeCylinder(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeCylinder_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeCylinder obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeCylinder(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+
+ /**
+ * @param axes is {X, Y, Z, directionX, directionY, directionZ}
+ */
+public BRepPrimAPI_MakeCylinder(double[] axes, double radius, double height, double angle) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeCylinder(axes, radius, height, angle), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakePrism extends BRepPrimAPI_MakeSweep {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakePrism(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakePrism_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakePrism obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakePrism(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection, boolean Copy, boolean Canonize) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_0(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection, Copy, Canonize), true);\r
- }\r
-\r
- public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection, boolean Copy) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_1(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection, Copy), true);\r
- }\r
-\r
- public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_2(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakePrism extends BRepPrimAPI_MakeSweep {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakePrism(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakePrism_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakePrism obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakePrism(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection, boolean Copy, boolean Canonize) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_0(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection, Copy, Canonize), true);
+ }
+
+ public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection, boolean Copy) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_1(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection, Copy), true);
+ }
+
+ public BRepPrimAPI_MakePrism(TopoDS_Shape baseShape, double[] extrudeDirection) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakePrism__SWIG_2(TopoDS_Shape.getCPtr(baseShape), baseShape, extrudeDirection), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeRevol extends BRepPrimAPI_MakeSweep {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeRevol(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeRevol_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeRevol obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeRevol(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, double angle, boolean copy) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, axis, angle, copy), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, double angle) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, axis, angle), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, boolean copy) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, axis, copy), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, axis), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeRevol extends BRepPrimAPI_MakeSweep {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeRevol(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeRevol_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeRevol obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeRevol(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, double angle, boolean copy) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, axis, angle, copy), true);
+ }
+
+ public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, double angle) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, axis, angle), true);
+ }
+
+ public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis, boolean copy) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_2(TopoDS_Shape.getCPtr(shape), shape, axis, copy), true);
+ }
+
+ public BRepPrimAPI_MakeRevol(TopoDS_Shape shape, double[] axis) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeRevol__SWIG_3(TopoDS_Shape.getCPtr(shape), shape, axis), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeSphere extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeSphere(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeSphere_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeSphere obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeSphere(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeSphere(double[] center, double radius) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeSphere__SWIG_0(center, radius), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeSphere(double[] axis, double R, double angle1, double angle2, double angle3) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeSphere__SWIG_1(axis, R, angle1, angle2, angle3), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeSphere extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeSphere(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeSphere_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeSphere obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeSphere(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeSphere(double[] center, double radius) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeSphere__SWIG_0(center, radius), true);
+ }
+
+ public BRepPrimAPI_MakeSphere(double[] axis, double R, double angle1, double angle2, double angle3) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeSphere__SWIG_1(axis, R, angle1, angle2, angle3), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeSweep extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeSweep(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeSweep_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeSweep obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeSweep(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeSweep extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeSweep(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeSweep_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeSweep obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeSweep(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeTorus extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeTorus(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeTorus_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeTorus obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeTorus(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeTorus(double[] Axes, double R1, double R2) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeTorus__SWIG_0(Axes, R1, R2), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeTorus(double[] Axes, double R1, double R2, double angle1, double angle2, double angle) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeTorus__SWIG_1(Axes, R1, R2, angle1, angle2, angle), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeTorus extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeTorus(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeTorus_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeTorus obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeTorus(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeTorus(double[] Axes, double R1, double R2) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeTorus__SWIG_0(Axes, R1, R2), true);
+ }
+
+ public BRepPrimAPI_MakeTorus(double[] Axes, double R1, double R2, double angle1, double angle2, double angle) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeTorus__SWIG_1(Axes, R1, R2, angle1, angle2, angle), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepPrimAPI_MakeWedge extends BRepBuilderAPI_MakeShape {\r
- private long swigCPtr;\r
-\r
- public BRepPrimAPI_MakeWedge(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRepPrimAPI_MakeWedge_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepPrimAPI_MakeWedge obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepPrimAPI_MakeWedge(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRepPrimAPI_MakeWedge(double[] Axes, double dx, double dy, double dz, double xmin, double zmin, double xmax, double zmax) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeWedge__SWIG_0(Axes, dx, dy, dz, xmin, zmin, xmax, zmax), true);\r
- }\r
-\r
- public BRepPrimAPI_MakeWedge(double[] Axes, double dx, double dy, double dz, double ltx) {\r
- this(OccJavaJNI.new_BRepPrimAPI_MakeWedge__SWIG_1(Axes, dx, dy, dz, ltx), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepPrimAPI_MakeWedge extends BRepBuilderAPI_MakeShape {
+ private transient long swigCPtr;
+
+ protected BRepPrimAPI_MakeWedge(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRepPrimAPI_MakeWedge_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepPrimAPI_MakeWedge obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepPrimAPI_MakeWedge(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRepPrimAPI_MakeWedge(double[] Axes, double dx, double dy, double dz, double xmin, double zmin, double xmax, double zmax) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeWedge__SWIG_0(Axes, dx, dy, dz, xmin, zmin, xmax, zmax), true);
+ }
+
+ public BRepPrimAPI_MakeWedge(double[] Axes, double dx, double dy, double dz, double ltx) {
+ this(OccJavaJNI.new_BRepPrimAPI_MakeWedge__SWIG_1(Axes, dx, dy, dz, ltx), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-/** Provides various utilities for BRep. */\r
-public class BRepTools {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepTools(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepTools obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- private synchronized void delete() {}\r
-\r
- /**\r
- * Read a shape from a file.\r
- * This is an helper method. It do not exists in Opencascade.\r
- * @param file the file to read\r
- * @param builder the builder which will be used to create the shape (i.e. <code>new BRep_Builder()</code>).\r
- */\r
- public static TopoDS_Shape read(String file, BRep_Builder builder)\r
- {\r
- TopoDS_Shape toReturn=new TopoDS_Shape();\r
- if(read(toReturn, file, builder))\r
- return TopoDS_Shape.downcast(toReturn);\r
- else\r
- return null;\r
- }\r
-\r
- \r
- /**\r
- * Reads a shape from a file.\r
- * @param shape an empty shape created with <code>new TopoDS_Shape()</code>\r
- * @param builder used to build the shape (i.e. <code>new BRep_Builder()</code>).\r
- * @return false on IO or file format errors.\r
- */\r
- public static boolean read(TopoDS_Shape shape, String file, BRep_Builder builder) {\r
- return OccJavaJNI.BRepTools_read__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, file, BRep_Builder.getCPtr(builder), builder);\r
-}\r
-\r
- \r
- /**\r
- * Write a shape to a file.\r
- * @param shape the shape to write\r
- * @param file the file where to write the shape\r
- * @return false on IO error.\r
- */\r
- public static boolean write(TopoDS_Shape shape, String file) {\r
- return OccJavaJNI.BRepTools_write__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, file);\r
-}\r
-\r
- public static void write(TopoDS_Shape Sh, java.nio.channels.WritableByteChannel S) {\r
- OccJavaJNI.BRepTools_write__SWIG_1(TopoDS_Shape.getCPtr(Sh), Sh, S);\r
- }\r
-\r
- public static void clean(TopoDS_Shape S) {\r
- OccJavaJNI.BRepTools_clean(TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public static boolean read(TopoDS_Shape shape, java.nio.channels.ReadableByteChannel input, BRep_Builder builder) {\r
- return OccJavaJNI.BRepTools_read__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, input, BRep_Builder.getCPtr(builder), builder);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+/** Provides various utilities for BRep. */
+public class BRepTools {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepTools(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepTools obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ private synchronized void delete() {}
+
+ /**
+ * Read a shape from a file.
+ * This is an helper method. It do not exists in Opencascade.
+ * @param file the file to read
+ * @param builder the builder which will be used to create the shape (i.e. <code>new BRep_Builder()</code>).
+ */
+ public static TopoDS_Shape read(String file, BRep_Builder builder)
+ {
+ TopoDS_Shape toReturn=new TopoDS_Shape();
+ if(read(toReturn, file, builder))
+ return TopoDS_Shape.downcast(toReturn);
+ else
+ return null;
+ }
+
+
+ /**
+ * Reads a shape from a file.
+ * @param shape an empty shape created with <code>new TopoDS_Shape()</code>
+ * @param builder used to build the shape (i.e. <code>new BRep_Builder()</code>).
+ * @return false on IO or file format errors.
+ */
+ public static boolean read(TopoDS_Shape shape, String file, BRep_Builder builder) {
+ return OccJavaJNI.BRepTools_read__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, file, BRep_Builder.getCPtr(builder), builder);
+}
+
+
+ /**
+ * Write a shape to a file.
+ * @param shape the shape to write
+ * @param file the file where to write the shape
+ * @return false on IO error.
+ */
+ public static boolean write(TopoDS_Shape shape, String file) {
+ return OccJavaJNI.BRepTools_write__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, file);
+}
+
+ public static void write(TopoDS_Shape Sh, java.nio.channels.WritableByteChannel S) {
+ OccJavaJNI.BRepTools_write__SWIG_1(TopoDS_Shape.getCPtr(Sh), Sh, S);
+ }
+
+ public static void clean(TopoDS_Shape S) {
+ OccJavaJNI.BRepTools_clean(TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public static boolean read(TopoDS_Shape shape, java.nio.channels.ReadableByteChannel input, BRep_Builder builder) {
+ return OccJavaJNI.BRepTools_read__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, input, BRep_Builder.getCPtr(builder), builder);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepTools_Quilt {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepTools_Quilt(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepTools_Quilt obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepTools_Quilt(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public BRepTools_Quilt() {\r
- this(OccJavaJNI.new_BRepTools_Quilt(), true);\r
- }\r
-\r
- public void bind(TopoDS_Edge Eold, TopoDS_Edge Enew) {\r
- OccJavaJNI.BRepTools_Quilt_bind__SWIG_0(swigCPtr, this, TopoDS_Edge.getCPtr(Eold), Eold, TopoDS_Edge.getCPtr(Enew), Enew);\r
- }\r
-\r
- public void bind(TopoDS_Vertex Vold, TopoDS_Vertex Vnew) {\r
- OccJavaJNI.BRepTools_Quilt_bind__SWIG_1(swigCPtr, this, TopoDS_Vertex.getCPtr(Vold), Vold, TopoDS_Vertex.getCPtr(Vnew), Vnew);\r
- }\r
-\r
- public void add(TopoDS_Shape S) {\r
- OccJavaJNI.BRepTools_Quilt_add(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public boolean isCopied(TopoDS_Shape S) {\r
- return OccJavaJNI.BRepTools_Quilt_isCopied(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
-}\r
-\r
- public TopoDS_Shape copy(TopoDS_Shape S) {\r
- long cPtr = OccJavaJNI.BRepTools_Quilt_copy(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public TopoDS_Shape shells() {\r
- long cPtr = OccJavaJNI.BRepTools_Quilt_shells(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepTools_Quilt {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepTools_Quilt(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepTools_Quilt obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepTools_Quilt(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public BRepTools_Quilt() {
+ this(OccJavaJNI.new_BRepTools_Quilt(), true);
+ }
+
+ public void bind(TopoDS_Edge Eold, TopoDS_Edge Enew) {
+ OccJavaJNI.BRepTools_Quilt_bind__SWIG_0(swigCPtr, this, TopoDS_Edge.getCPtr(Eold), Eold, TopoDS_Edge.getCPtr(Enew), Enew);
+ }
+
+ public void bind(TopoDS_Vertex Vold, TopoDS_Vertex Vnew) {
+ OccJavaJNI.BRepTools_Quilt_bind__SWIG_1(swigCPtr, this, TopoDS_Vertex.getCPtr(Vold), Vold, TopoDS_Vertex.getCPtr(Vnew), Vnew);
+ }
+
+ public void add(TopoDS_Shape S) {
+ OccJavaJNI.BRepTools_Quilt_add(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public boolean isCopied(TopoDS_Shape S) {
+ return OccJavaJNI.BRepTools_Quilt_isCopied(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+}
+
+ public TopoDS_Shape copy(TopoDS_Shape S) {
+ long cPtr = OccJavaJNI.BRepTools_Quilt_copy(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public TopoDS_Shape shells() {
+ long cPtr = OccJavaJNI.BRepTools_Quilt_shells(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRepTools_WireExplorer {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRepTools_WireExplorer(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRepTools_WireExplorer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRepTools_WireExplorer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public BRepTools_WireExplorer() {\r
- this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_0(), true);\r
- }\r
-\r
- public BRepTools_WireExplorer(TopoDS_Wire W) {\r
- this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_1(TopoDS_Wire.getCPtr(W), W), true);\r
- }\r
-\r
- public BRepTools_WireExplorer(TopoDS_Wire W, TopoDS_Face F) {\r
- this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_2(TopoDS_Wire.getCPtr(W), W, TopoDS_Face.getCPtr(F), F), true);\r
- }\r
-\r
- public void init(TopoDS_Wire W) {\r
- OccJavaJNI.BRepTools_WireExplorer_init__SWIG_0(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);\r
- }\r
-\r
- public void init(TopoDS_Wire W, TopoDS_Face F) {\r
- OccJavaJNI.BRepTools_WireExplorer_init__SWIG_1(swigCPtr, this, TopoDS_Wire.getCPtr(W), W, TopoDS_Face.getCPtr(F), F);\r
- }\r
-\r
- public boolean more() {\r
- return OccJavaJNI.BRepTools_WireExplorer_more(swigCPtr, this);\r
-}\r
-\r
- public void next() {\r
- OccJavaJNI.BRepTools_WireExplorer_next(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Edge current() {\r
- return new TopoDS_Edge(OccJavaJNI.BRepTools_WireExplorer_current(swigCPtr, this), false);\r
- }\r
-\r
- public TopAbs_Orientation orientation() {\r
- return TopAbs_Orientation.swigToEnum(OccJavaJNI.BRepTools_WireExplorer_orientation(swigCPtr, this));\r
- }\r
-\r
- public TopoDS_Vertex currentVertex() {\r
- return new TopoDS_Vertex(OccJavaJNI.BRepTools_WireExplorer_currentVertex(swigCPtr, this), false);\r
- }\r
-\r
- public void clear() {\r
- OccJavaJNI.BRepTools_WireExplorer_clear(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRepTools_WireExplorer {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRepTools_WireExplorer(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRepTools_WireExplorer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRepTools_WireExplorer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public BRepTools_WireExplorer() {
+ this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_0(), true);
+ }
+
+ public BRepTools_WireExplorer(TopoDS_Wire W) {
+ this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_1(TopoDS_Wire.getCPtr(W), W), true);
+ }
+
+ public BRepTools_WireExplorer(TopoDS_Wire W, TopoDS_Face F) {
+ this(OccJavaJNI.new_BRepTools_WireExplorer__SWIG_2(TopoDS_Wire.getCPtr(W), W, TopoDS_Face.getCPtr(F), F), true);
+ }
+
+ public void init(TopoDS_Wire W) {
+ OccJavaJNI.BRepTools_WireExplorer_init__SWIG_0(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);
+ }
+
+ public void init(TopoDS_Wire W, TopoDS_Face F) {
+ OccJavaJNI.BRepTools_WireExplorer_init__SWIG_1(swigCPtr, this, TopoDS_Wire.getCPtr(W), W, TopoDS_Face.getCPtr(F), F);
+ }
+
+ public boolean more() {
+ return OccJavaJNI.BRepTools_WireExplorer_more(swigCPtr, this);
+}
+
+ public void next() {
+ OccJavaJNI.BRepTools_WireExplorer_next(swigCPtr, this);
+ }
+
+ public TopoDS_Edge current() {
+ return new TopoDS_Edge(OccJavaJNI.BRepTools_WireExplorer_current(swigCPtr, this), false);
+ }
+
+ public TopAbs_Orientation orientation() {
+ return TopAbs_Orientation.swigToEnum(OccJavaJNI.BRepTools_WireExplorer_orientation(swigCPtr, this));
+ }
+
+ public TopoDS_Vertex currentVertex() {
+ return new TopoDS_Vertex(OccJavaJNI.BRepTools_WireExplorer_currentVertex(swigCPtr, this), false);
+ }
+
+ public void clear() {
+ OccJavaJNI.BRepTools_WireExplorer_clear(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRep_Builder extends TopoDS_Builder {\r
- private long swigCPtr;\r
-\r
- public BRep_Builder(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.BRep_Builder_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRep_Builder obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRep_Builder(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public BRep_Builder() {\r
- this(OccJavaJNI.new_BRep_Builder(), true);\r
- }\r
-\r
- public void updateVertex(TopoDS_Vertex vertex, double u, double v, TopoDS_Face face, double tolerance) {\r
- OccJavaJNI.BRep_Builder_updateVertex__SWIG_0(swigCPtr, this, TopoDS_Vertex.getCPtr(vertex), vertex, u, v, TopoDS_Face.getCPtr(face), face, tolerance);\r
- }\r
-\r
- public void updateVertex(TopoDS_Vertex vertex, double tolerance) {\r
- OccJavaJNI.BRep_Builder_updateVertex__SWIG_1(swigCPtr, this, TopoDS_Vertex.getCPtr(vertex), vertex, tolerance);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRep_Builder extends TopoDS_Builder {
+ private transient long swigCPtr;
+
+ protected BRep_Builder(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.BRep_Builder_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRep_Builder obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRep_Builder(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public BRep_Builder() {
+ this(OccJavaJNI.new_BRep_Builder(), true);
+ }
+
+ public void updateVertex(TopoDS_Vertex vertex, double u, double v, TopoDS_Face face, double tolerance) {
+ OccJavaJNI.BRep_Builder_updateVertex__SWIG_0(swigCPtr, this, TopoDS_Vertex.getCPtr(vertex), vertex, u, v, TopoDS_Face.getCPtr(face), face, tolerance);
+ }
+
+ public void updateVertex(TopoDS_Vertex vertex, double tolerance) {
+ OccJavaJNI.BRep_Builder_updateVertex__SWIG_1(swigCPtr, this, TopoDS_Vertex.getCPtr(vertex), vertex, tolerance);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class BRep_Tool {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public BRep_Tool(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(BRep_Tool obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_BRep_Tool(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static double[] range(TopoDS_Edge edge)\r
- {\r
- double[] toReturn=new double[2];\r
- range(edge, toReturn);\r
- return toReturn;\r
- }\r
-\r
- public static Geom2d_Curve curveOnSurface(TopoDS_Edge e, TopoDS_Face f, double[] range)\r
- {\r
- double[] d2=new double[1];\r
- Geom2d_Curve toReturn=curveOnSurface(e, f, range, d2);\r
- range[1]=d2[0];\r
- return toReturn;\r
- }\r
-\r
- public static Geom_Curve curve(TopoDS_Edge e, double[] range)\r
- {\r
- double[] d2=new double[1];\r
- Geom_Curve toReturn=curve(e, range, d2);\r
- range[1]=d2[0];\r
- return toReturn;\r
- }\r
-\r
- public static double[] pnt(TopoDS_Vertex V) {\r
- return OccJavaJNI.BRep_Tool_pnt(TopoDS_Vertex.getCPtr(V), V);\r
-}\r
-\r
- public static double[] parameters(TopoDS_Vertex V, TopoDS_Face F) {\r
- return OccJavaJNI.BRep_Tool_parameters(TopoDS_Vertex.getCPtr(V), V, TopoDS_Face.getCPtr(F), F);\r
-}\r
-\r
- public static double parameter(TopoDS_Vertex V, TopoDS_Edge E) {\r
- return OccJavaJNI.BRep_Tool_parameter(TopoDS_Vertex.getCPtr(V), V, TopoDS_Edge.getCPtr(E), E);\r
- }\r
-\r
- public static boolean degenerated(TopoDS_Edge E) {\r
- return OccJavaJNI.BRep_Tool_degenerated(TopoDS_Edge.getCPtr(E), E);\r
-}\r
-\r
- public static boolean hasContinuity(TopoDS_Edge E, TopoDS_Face F1, TopoDS_Face F2) {\r
- return OccJavaJNI.BRep_Tool_hasContinuity(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F1), F1, TopoDS_Face.getCPtr(F2), F2);\r
-}\r
-\r
- public static GeomAbs_Shape continuity(TopoDS_Edge E, TopoDS_Face F1, TopoDS_Face F2) {\r
- return GeomAbs_Shape.swigToEnum(OccJavaJNI.BRep_Tool_continuity(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F1), F1, TopoDS_Face.getCPtr(F2), F2));\r
- }\r
-\r
- public static double tolerance(TopoDS_Face F) {\r
- return OccJavaJNI.BRep_Tool_tolerance__SWIG_0(TopoDS_Face.getCPtr(F), F);\r
- }\r
-\r
- public static double tolerance(TopoDS_Edge E) {\r
- return OccJavaJNI.BRep_Tool_tolerance__SWIG_1(TopoDS_Edge.getCPtr(E), E);\r
- }\r
-\r
- public static double tolerance(TopoDS_Vertex V) {\r
- return OccJavaJNI.BRep_Tool_tolerance__SWIG_2(TopoDS_Vertex.getCPtr(V), V);\r
- }\r
-\r
- public static Poly_Triangulation triangulation(TopoDS_Face F, TopLoc_Location L) {\r
- long cPtr = OccJavaJNI.BRep_Tool_triangulation(TopoDS_Face.getCPtr(F), F, TopLoc_Location.getCPtr(L), L);\r
- return (cPtr == 0) ? null : new Poly_Triangulation(cPtr, false);\r
- }\r
-\r
- public static void range(TopoDS_Edge E, double[] range) {\r
- OccJavaJNI.BRep_Tool_range(TopoDS_Edge.getCPtr(E), E, range);\r
- }\r
-\r
- public static Geom_Curve curve(TopoDS_Edge E, double[] First, double[] Last) {\r
- long cPtr = OccJavaJNI.BRep_Tool_curve(TopoDS_Edge.getCPtr(E), E, First, Last);\r
- return (cPtr == 0) ? null : new Geom_Curve(cPtr, false);\r
- }\r
-\r
- public static Geom_Surface surface(TopoDS_Face F) {\r
- long cPtr = OccJavaJNI.BRep_Tool_surface(TopoDS_Face.getCPtr(F), F);\r
- return (cPtr == 0) ? null : new Geom_Surface(cPtr, false);\r
- }\r
-\r
- public static Geom2d_Curve curveOnSurface(TopoDS_Edge E, TopoDS_Face F, double[] First, double[] Last) {\r
- long cPtr = OccJavaJNI.BRep_Tool_curveOnSurface(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F), F, First, Last);\r
- return (cPtr == 0) ? null : new Geom2d_Curve(cPtr, false);\r
- }\r
-\r
- public BRep_Tool() {\r
- this(OccJavaJNI.new_BRep_Tool(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class BRep_Tool {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected BRep_Tool(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(BRep_Tool obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_BRep_Tool(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static double[] range(TopoDS_Edge edge)
+ {
+ double[] toReturn=new double[2];
+ range(edge, toReturn);
+ return toReturn;
+ }
+
+ public static Geom2d_Curve curveOnSurface(TopoDS_Edge e, TopoDS_Face f, double[] range)
+ {
+ double[] d2=new double[1];
+ Geom2d_Curve toReturn=curveOnSurface(e, f, range, d2);
+ range[1]=d2[0];
+ return toReturn;
+ }
+
+ public static Geom_Curve curve(TopoDS_Edge e, double[] range)
+ {
+ double[] d2=new double[1];
+ Geom_Curve toReturn=curve(e, range, d2);
+ range[1]=d2[0];
+ return toReturn;
+ }
+
+ public static double[] pnt(TopoDS_Vertex V) {
+ return OccJavaJNI.BRep_Tool_pnt(TopoDS_Vertex.getCPtr(V), V);
+}
+
+ public static double[] parameters(TopoDS_Vertex V, TopoDS_Face F) {
+ return OccJavaJNI.BRep_Tool_parameters(TopoDS_Vertex.getCPtr(V), V, TopoDS_Face.getCPtr(F), F);
+}
+
+ public static double parameter(TopoDS_Vertex V, TopoDS_Edge E) {
+ return OccJavaJNI.BRep_Tool_parameter(TopoDS_Vertex.getCPtr(V), V, TopoDS_Edge.getCPtr(E), E);
+ }
+
+ public static boolean degenerated(TopoDS_Edge E) {
+ return OccJavaJNI.BRep_Tool_degenerated(TopoDS_Edge.getCPtr(E), E);
+}
+
+ public static boolean hasContinuity(TopoDS_Edge E, TopoDS_Face F1, TopoDS_Face F2) {
+ return OccJavaJNI.BRep_Tool_hasContinuity(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F1), F1, TopoDS_Face.getCPtr(F2), F2);
+}
+
+ public static GeomAbs_Shape continuity(TopoDS_Edge E, TopoDS_Face F1, TopoDS_Face F2) {
+ return GeomAbs_Shape.swigToEnum(OccJavaJNI.BRep_Tool_continuity(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F1), F1, TopoDS_Face.getCPtr(F2), F2));
+ }
+
+ public static double tolerance(TopoDS_Face F) {
+ return OccJavaJNI.BRep_Tool_tolerance__SWIG_0(TopoDS_Face.getCPtr(F), F);
+ }
+
+ public static double tolerance(TopoDS_Edge E) {
+ return OccJavaJNI.BRep_Tool_tolerance__SWIG_1(TopoDS_Edge.getCPtr(E), E);
+ }
+
+ public static double tolerance(TopoDS_Vertex V) {
+ return OccJavaJNI.BRep_Tool_tolerance__SWIG_2(TopoDS_Vertex.getCPtr(V), V);
+ }
+
+ public static Poly_Triangulation triangulation(TopoDS_Face F, TopLoc_Location L) {
+ long cPtr = OccJavaJNI.BRep_Tool_triangulation(TopoDS_Face.getCPtr(F), F, TopLoc_Location.getCPtr(L), L);
+ return (cPtr == 0) ? null : new Poly_Triangulation(cPtr, false);
+ }
+
+ public static void range(TopoDS_Edge E, double[] range) {
+ OccJavaJNI.BRep_Tool_range(TopoDS_Edge.getCPtr(E), E, range);
+ }
+
+ public static Geom_Curve curve(TopoDS_Edge E, double[] First, double[] Last) {
+ long cPtr = OccJavaJNI.BRep_Tool_curve(TopoDS_Edge.getCPtr(E), E, First, Last);
+ return (cPtr == 0) ? null : new Geom_Curve(cPtr, false);
+ }
+
+ public static Geom_Surface surface(TopoDS_Face F) {
+ long cPtr = OccJavaJNI.BRep_Tool_surface(TopoDS_Face.getCPtr(F), F);
+ return (cPtr == 0) ? null : new Geom_Surface(cPtr, false);
+ }
+
+ public static Geom2d_Curve curveOnSurface(TopoDS_Edge E, TopoDS_Face F, double[] First, double[] Last) {
+ long cPtr = OccJavaJNI.BRep_Tool_curveOnSurface(TopoDS_Edge.getCPtr(E), E, TopoDS_Face.getCPtr(F), F, First, Last);
+ return (cPtr == 0) ? null : new Geom2d_Curve(cPtr, false);
+ }
+
+ public BRep_Tool() {
+ this(OccJavaJNI.new_BRep_Tool(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Bnd_Box {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Bnd_Box(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Bnd_Box obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Bnd_Box(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- /**\r
- * Return the array { Xmin, Ymin, Zmin, Xmax, Ymax, Zmax }\r
- */ \r
- public double[] get()\r
- {\r
- double[] toReturn=new double[6];\r
- get(toReturn);\r
- return toReturn;\r
- }\r
-\r
- public Bnd_Box() {\r
- this(OccJavaJNI.new_Bnd_Box(), true);\r
- }\r
-\r
- public boolean isVoid() {\r
- return OccJavaJNI.Bnd_Box_isVoid(swigCPtr, this);\r
-}\r
-\r
- public void get(double[] box) {\r
- OccJavaJNI.Bnd_Box_get(swigCPtr, this, box);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Bnd_Box {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Bnd_Box(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Bnd_Box obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Bnd_Box(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ /**
+ * Return the array { Xmin, Ymin, Zmin, Xmax, Ymax, Zmax }
+ */
+ public double[] get()
+ {
+ double[] toReturn=new double[6];
+ get(toReturn);
+ return toReturn;
+ }
+
+ public Bnd_Box() {
+ this(OccJavaJNI.new_Bnd_Box(), true);
+ }
+
+ public boolean isVoid() {
+ return OccJavaJNI.Bnd_Box_isVoid(swigCPtr, this);
+}
+
+ public void get(double[] box) {
+ OccJavaJNI.Bnd_Box_get(swigCPtr, this, box);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum ChFi3d_FilletShape {\r
- Rational,\r
- QuasiAngular,\r
- Polynomial;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static ChFi3d_FilletShape swigToEnum(int swigValue) {\r
- ChFi3d_FilletShape[] swigValues = ChFi3d_FilletShape.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (ChFi3d_FilletShape swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + ChFi3d_FilletShape.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private ChFi3d_FilletShape() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private ChFi3d_FilletShape(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private ChFi3d_FilletShape(ChFi3d_FilletShape swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum ChFi3d_FilletShape {
+ Rational,
+ QuasiAngular,
+ Polynomial;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static ChFi3d_FilletShape swigToEnum(int swigValue) {
+ ChFi3d_FilletShape[] swigValues = ChFi3d_FilletShape.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (ChFi3d_FilletShape swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + ChFi3d_FilletShape.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private ChFi3d_FilletShape() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private ChFi3d_FilletShape(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private ChFi3d_FilletShape(ChFi3d_FilletShape swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GCPnts_UniformDeflection {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GCPnts_UniformDeflection(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GCPnts_UniformDeflection obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GCPnts_UniformDeflection(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GCPnts_UniformDeflection() {\r
- this(OccJavaJNI.new_GCPnts_UniformDeflection(), true);\r
- }\r
-\r
- public void initialize(Adaptor3d_Curve C, double Deflection, double U1, double U2, boolean WithControl) {\r
- OccJavaJNI.GCPnts_UniformDeflection_initialize__SWIG_0(swigCPtr, this, Adaptor3d_Curve.getCPtr(C), C, Deflection, U1, U2, WithControl);\r
- }\r
-\r
- public void initialize(Adaptor3d_Curve C, double Deflection, double U1, double U2) {\r
- OccJavaJNI.GCPnts_UniformDeflection_initialize__SWIG_1(swigCPtr, this, Adaptor3d_Curve.getCPtr(C), C, Deflection, U1, U2);\r
- }\r
-\r
- public int nbPoints() {\r
- return OccJavaJNI.GCPnts_UniformDeflection_nbPoints(swigCPtr, this);\r
- }\r
-\r
- public double parameter(int Index) {\r
- return OccJavaJNI.GCPnts_UniformDeflection_parameter(swigCPtr, this, Index);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GCPnts_UniformDeflection {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GCPnts_UniformDeflection(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GCPnts_UniformDeflection obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GCPnts_UniformDeflection(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GCPnts_UniformDeflection() {
+ this(OccJavaJNI.new_GCPnts_UniformDeflection(), true);
+ }
+
+ public void initialize(Adaptor3d_Curve C, double Deflection, double U1, double U2, boolean WithControl) {
+ OccJavaJNI.GCPnts_UniformDeflection_initialize__SWIG_0(swigCPtr, this, Adaptor3d_Curve.getCPtr(C), C, Deflection, U1, U2, WithControl);
+ }
+
+ public void initialize(Adaptor3d_Curve C, double Deflection, double U1, double U2) {
+ OccJavaJNI.GCPnts_UniformDeflection_initialize__SWIG_1(swigCPtr, this, Adaptor3d_Curve.getCPtr(C), C, Deflection, U1, U2);
+ }
+
+ public int nbPoints() {
+ return OccJavaJNI.GCPnts_UniformDeflection_nbPoints(swigCPtr, this);
+ }
+
+ public double parameter(int Index) {
+ return OccJavaJNI.GCPnts_UniformDeflection_parameter(swigCPtr, this, Index);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GC_MakeArcOfCircle extends GC_Root {\r
- private long swigCPtr;\r
-\r
- public GC_MakeArcOfCircle(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GC_MakeArcOfCircle_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GC_MakeArcOfCircle obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GC_MakeArcOfCircle(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GC_MakeArcOfCircle(double[] P1, double[] P2, double[] P3) {\r
- this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_0(P1, P2, P3), true);\r
- }\r
-\r
- public GC_MakeArcOfCircle(GP_Circ Circ, double[] P1, double[] P2, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_1(GP_Circ.getCPtr(Circ), Circ, P1, P2, Sense), true);\r
- }\r
-\r
- public Geom_TrimmedCurve value() {\r
- return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeArcOfCircle_value(swigCPtr, this), false);\r
- }\r
-\r
- public GC_MakeArcOfCircle(GP_Circ Circ, double Alpha1, double Alpha2, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_2(GP_Circ.getCPtr(Circ), Circ, Alpha1, Alpha2, Sense), true);\r
- }\r
-\r
- public GC_MakeArcOfCircle(GP_Circ Circ, double[] P, double Alpha, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_3(GP_Circ.getCPtr(Circ), Circ, P, Alpha, Sense), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GC_MakeArcOfCircle extends GC_Root {
+ private transient long swigCPtr;
+
+ protected GC_MakeArcOfCircle(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GC_MakeArcOfCircle_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GC_MakeArcOfCircle obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GC_MakeArcOfCircle(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GC_MakeArcOfCircle(double[] P1, double[] P2, double[] P3) {
+ this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_0(P1, P2, P3), true);
+ }
+
+ public GC_MakeArcOfCircle(GP_Circ Circ, double[] P1, double[] P2, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_1(GP_Circ.getCPtr(Circ), Circ, P1, P2, Sense), true);
+ }
+
+ public Geom_TrimmedCurve value() {
+ return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeArcOfCircle_value(swigCPtr, this), false);
+ }
+
+ public GC_MakeArcOfCircle(GP_Circ Circ, double Alpha1, double Alpha2, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_2(GP_Circ.getCPtr(Circ), Circ, Alpha1, Alpha2, Sense), true);
+ }
+
+ public GC_MakeArcOfCircle(GP_Circ Circ, double[] P, double Alpha, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfCircle__SWIG_3(GP_Circ.getCPtr(Circ), Circ, P, Alpha, Sense), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GC_MakeArcOfEllipse extends GC_Root {\r
- private long swigCPtr;\r
-\r
- public GC_MakeArcOfEllipse(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GC_MakeArcOfEllipse_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GC_MakeArcOfEllipse obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GC_MakeArcOfEllipse(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GC_MakeArcOfEllipse(GP_Elips Elips, double Alpha1, double Alpha2, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_0(GP_Elips.getCPtr(Elips), Elips, Alpha1, Alpha2, Sense), true);\r
- }\r
-\r
- public GC_MakeArcOfEllipse(GP_Elips Elips, double[] P, double Alpha, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_1(GP_Elips.getCPtr(Elips), Elips, P, Alpha, Sense), true);\r
- }\r
-\r
- public GC_MakeArcOfEllipse(GP_Elips Elips, double[] P1, double[] P2, boolean Sense) {\r
- this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_2(GP_Elips.getCPtr(Elips), Elips, P1, P2, Sense), true);\r
- }\r
-\r
- public Geom_TrimmedCurve value() {\r
- return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeArcOfEllipse_value(swigCPtr, this), false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GC_MakeArcOfEllipse extends GC_Root {
+ private transient long swigCPtr;
+
+ protected GC_MakeArcOfEllipse(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GC_MakeArcOfEllipse_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GC_MakeArcOfEllipse obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GC_MakeArcOfEllipse(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GC_MakeArcOfEllipse(GP_Elips Elips, double Alpha1, double Alpha2, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_0(GP_Elips.getCPtr(Elips), Elips, Alpha1, Alpha2, Sense), true);
+ }
+
+ public GC_MakeArcOfEllipse(GP_Elips Elips, double[] P, double Alpha, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_1(GP_Elips.getCPtr(Elips), Elips, P, Alpha, Sense), true);
+ }
+
+ public GC_MakeArcOfEllipse(GP_Elips Elips, double[] P1, double[] P2, boolean Sense) {
+ this(OccJavaJNI.new_GC_MakeArcOfEllipse__SWIG_2(GP_Elips.getCPtr(Elips), Elips, P1, P2, Sense), true);
+ }
+
+ public Geom_TrimmedCurve value() {
+ return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeArcOfEllipse_value(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GC_MakeSegment extends GC_Root {\r
- private long swigCPtr;\r
-\r
- public GC_MakeSegment(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GC_MakeSegment_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GC_MakeSegment obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GC_MakeSegment(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GC_MakeSegment(double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_GC_MakeSegment__SWIG_0(P1, P2), true);\r
- }\r
-\r
- public GC_MakeSegment(GP_Lin Line, double U1, double U2) {\r
- this(OccJavaJNI.new_GC_MakeSegment__SWIG_1(GP_Lin.getCPtr(Line), Line, U1, U2), true);\r
- }\r
-\r
- public GC_MakeSegment(GP_Lin Line, double[] Point, double Ulast) {\r
- this(OccJavaJNI.new_GC_MakeSegment__SWIG_2(GP_Lin.getCPtr(Line), Line, Point, Ulast), true);\r
- }\r
-\r
- public GC_MakeSegment(GP_Lin Line, double[] P1, double[] P2) {\r
- this(OccJavaJNI.new_GC_MakeSegment__SWIG_3(GP_Lin.getCPtr(Line), Line, P1, P2), true);\r
- }\r
-\r
- public Geom_TrimmedCurve value() {\r
- return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeSegment_value(swigCPtr, this), false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GC_MakeSegment extends GC_Root {
+ private transient long swigCPtr;
+
+ protected GC_MakeSegment(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GC_MakeSegment_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GC_MakeSegment obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GC_MakeSegment(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GC_MakeSegment(double[] P1, double[] P2) {
+ this(OccJavaJNI.new_GC_MakeSegment__SWIG_0(P1, P2), true);
+ }
+
+ public GC_MakeSegment(GP_Lin Line, double U1, double U2) {
+ this(OccJavaJNI.new_GC_MakeSegment__SWIG_1(GP_Lin.getCPtr(Line), Line, U1, U2), true);
+ }
+
+ public GC_MakeSegment(GP_Lin Line, double[] Point, double Ulast) {
+ this(OccJavaJNI.new_GC_MakeSegment__SWIG_2(GP_Lin.getCPtr(Line), Line, Point, Ulast), true);
+ }
+
+ public GC_MakeSegment(GP_Lin Line, double[] P1, double[] P2) {
+ this(OccJavaJNI.new_GC_MakeSegment__SWIG_3(GP_Lin.getCPtr(Line), Line, P1, P2), true);
+ }
+
+ public Geom_TrimmedCurve value() {
+ return new Geom_TrimmedCurve(OccJavaJNI.GC_MakeSegment_value(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GC_Root {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GC_Root(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GC_Root obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GC_Root(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public boolean isDone() {\r
- return OccJavaJNI.GC_Root_isDone(swigCPtr, this);\r
-}\r
-\r
- public GC_Root() {\r
- this(OccJavaJNI.new_GC_Root(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GC_Root {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GC_Root(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GC_Root obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GC_Root(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public boolean isDone() {
+ return OccJavaJNI.GC_Root_isDone(swigCPtr, this);
+}
+
+ public GC_Root() {
+ this(OccJavaJNI.new_GC_Root(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GP_Circ {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GP_Circ(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GP_Circ obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GP_Circ(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GP_Circ(double[] axis, double radius) {\r
- this(OccJavaJNI.new_GP_Circ(axis, radius), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GP_Circ {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GP_Circ(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GP_Circ obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GP_Circ(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GP_Circ(double[] axis, double radius) {
+ this(OccJavaJNI.new_GP_Circ(axis, radius), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GP_Elips {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GP_Elips(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GP_Elips obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GP_Elips(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GP_Elips(double[] A2, double MajorRadius, double MinorRadius) {\r
- this(OccJavaJNI.new_GP_Elips(A2, MajorRadius, MinorRadius), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GP_Elips {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GP_Elips(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GP_Elips obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GP_Elips(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GP_Elips(double[] A2, double MajorRadius, double MinorRadius) {
+ this(OccJavaJNI.new_GP_Elips(A2, MajorRadius, MinorRadius), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GP_Lin {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GP_Lin(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GP_Lin obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GP_Lin(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GP_Lin(double[] A1) {\r
- this(OccJavaJNI.new_GP_Lin(A1), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GP_Lin {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GP_Lin(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GP_Lin obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GP_Lin(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GP_Lin(double[] A1) {
+ this(OccJavaJNI.new_GP_Lin(A1), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GP_Parab {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GP_Parab(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GP_Parab obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GP_Parab(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GP_Parab(double[] A2, double Focal) {\r
- this(OccJavaJNI.new_GP_Parab__SWIG_0(A2, Focal), true);\r
- }\r
-\r
- public GP_Parab(double[] D, double[] F) {\r
- this(OccJavaJNI.new_GP_Parab__SWIG_1(D, F), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GP_Parab {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GP_Parab(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GP_Parab obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GP_Parab(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GP_Parab(double[] A2, double Focal) {
+ this(OccJavaJNI.new_GP_Parab__SWIG_0(A2, Focal), true);
+ }
+
+ public GP_Parab(double[] D, double[] F) {
+ this(OccJavaJNI.new_GP_Parab__SWIG_1(D, F), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GP_Trsf {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GP_Trsf(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GP_Trsf obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GP_Trsf(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public void setValues(double[] matrix, double tolAng, double tolDist)\r
- {\r
- if(matrix.length!=12)\r
- throw new IllegalArgumentException("matrix length must be 12");\r
- setValues(\r
- matrix[0], matrix[1], matrix[2], matrix[3],\r
- matrix[4], matrix[5], matrix[6], matrix[7],\r
- matrix[8], matrix[9], matrix[10], matrix[11],\r
- tolAng, tolDist);\r
- } \r
-\r
- public GP_Trsf() {\r
- this(OccJavaJNI.new_GP_Trsf(), true);\r
- }\r
-\r
- public void setRotation(double[] A1, double Ang) {\r
- OccJavaJNI.GP_Trsf_setRotation(swigCPtr, this, A1, Ang);\r
- }\r
-\r
- public void setTranslation(double[] V) {\r
- OccJavaJNI.GP_Trsf_setTranslation(swigCPtr, this, V);\r
- }\r
-\r
- public void setValues(double a11, double a12, double a13, double a14, double a21, double a22, double a23, double a24, double a31, double a32, double a33, double a34, double Tolang, double TolDist) {\r
- OccJavaJNI.GP_Trsf_setValues(swigCPtr, this, a11, a12, a13, a14, a21, a22, a23, a24, a31, a32, a33, a34, Tolang, TolDist);\r
- }\r
-\r
- public void getValues(double[] matrix) {\r
- OccJavaJNI.GP_Trsf_getValues(swigCPtr, this, matrix);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GP_Trsf {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GP_Trsf(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GP_Trsf obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GP_Trsf(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public void setValues(double[] matrix)
+ {
+ if(matrix.length!=12)
+ throw new IllegalArgumentException("matrix length must be 12");
+ setValues(
+ matrix[0], matrix[1], matrix[2], matrix[3],
+ matrix[4], matrix[5], matrix[6], matrix[7],
+ matrix[8], matrix[9], matrix[10], matrix[11]);
+ }
+
+ public GP_Trsf() {
+ this(OccJavaJNI.new_GP_Trsf(), true);
+ }
+
+ public void setRotation(double[] A1, double Ang) {
+ OccJavaJNI.GP_Trsf_setRotation(swigCPtr, this, A1, Ang);
+ }
+
+ public void setTranslation(double[] V) {
+ OccJavaJNI.GP_Trsf_setTranslation(swigCPtr, this, V);
+ }
+
+ public void setValues(double a11, double a12, double a13, double a14, double a21, double a22, double a23, double a24, double a31, double a32, double a33, double a34) {
+ OccJavaJNI.GP_Trsf_setValues(swigCPtr, this, a11, a12, a13, a14, a21, a22, a23, a24, a31, a32, a33, a34);
+ }
+
+ public void getValues(double[] matrix) {
+ OccJavaJNI.GP_Trsf_getValues(swigCPtr, this, matrix);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GProp_CelGProps extends GProp_GProps {\r
- private long swigCPtr;\r
-\r
- public GProp_CelGProps(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GProp_CelGProps_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GProp_CelGProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GProp_CelGProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GProp_CelGProps() {\r
- this(OccJavaJNI.new_GProp_CelGProps(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GProp_CelGProps extends GProp_GProps {
+ private transient long swigCPtr;
+
+ protected GProp_CelGProps(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GProp_CelGProps_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GProp_CelGProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GProp_CelGProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GProp_CelGProps() {
+ this(OccJavaJNI.new_GProp_CelGProps(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GProp_GProps {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GProp_GProps(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GProp_GProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GProp_GProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GProp_GProps() {\r
- this(OccJavaJNI.new_GProp_GProps(), true);\r
- }\r
-\r
- public double mass() {\r
- return OccJavaJNI.GProp_GProps_mass(swigCPtr, this);\r
- }\r
-\r
- public double[] centreOfMass() {\r
- return OccJavaJNI.GProp_GProps_centreOfMass(swigCPtr, this);\r
-}\r
-\r
- public double[] matrixOfInertia() {\r
- return OccJavaJNI.GProp_GProps_matrixOfInertia(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GProp_GProps {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GProp_GProps(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GProp_GProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GProp_GProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GProp_GProps() {
+ this(OccJavaJNI.new_GProp_GProps(), true);
+ }
+
+ public double mass() {
+ return OccJavaJNI.GProp_GProps_mass(swigCPtr, this);
+ }
+
+ public double[] centreOfMass() {
+ return OccJavaJNI.GProp_GProps_centreOfMass(swigCPtr, this);
+}
+
+ public double[] matrixOfInertia() {
+ return OccJavaJNI.GProp_GProps_matrixOfInertia(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GProp_PGProps extends GProp_GProps {\r
- private long swigCPtr;\r
-\r
- public GProp_PGProps(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GProp_PGProps_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GProp_PGProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GProp_PGProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GProp_PGProps() {\r
- this(OccJavaJNI.new_GProp_PGProps(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GProp_PGProps extends GProp_GProps {
+ private transient long swigCPtr;
+
+ protected GProp_PGProps(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GProp_PGProps_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GProp_PGProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GProp_PGProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GProp_PGProps() {
+ this(OccJavaJNI.new_GProp_PGProps(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GProp_SelGProps extends GProp_GProps {\r
- private long swigCPtr;\r
-\r
- public GProp_SelGProps(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GProp_SelGProps_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GProp_SelGProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GProp_SelGProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GProp_SelGProps() {\r
- this(OccJavaJNI.new_GProp_SelGProps(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GProp_SelGProps extends GProp_GProps {
+ private transient long swigCPtr;
+
+ protected GProp_SelGProps(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GProp_SelGProps_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GProp_SelGProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GProp_SelGProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GProp_SelGProps() {
+ this(OccJavaJNI.new_GProp_SelGProps(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GProp_VelGProps extends GProp_GProps {\r
- private long swigCPtr;\r
-\r
- public GProp_VelGProps(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GProp_VelGProps_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GProp_VelGProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GProp_VelGProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GProp_VelGProps() {\r
- this(OccJavaJNI.new_GProp_VelGProps(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GProp_VelGProps extends GProp_GProps {
+ private transient long swigCPtr;
+
+ protected GProp_VelGProps(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GProp_VelGProps_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GProp_VelGProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GProp_VelGProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GProp_VelGProps() {
+ this(OccJavaJNI.new_GProp_VelGProps(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom2dAdaptor_Curve extends Adaptor2d_Curve2d {\r
- private long swigCPtr;\r
-\r
- public Geom2dAdaptor_Curve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom2dAdaptor_Curve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom2dAdaptor_Curve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom2dAdaptor_Curve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public Geom2dAdaptor_Curve() {\r
- this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_0(), true);\r
- }\r
-\r
- public Geom2dAdaptor_Curve(Geom2d_Curve C) {\r
- this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_1(Geom2d_Curve.getCPtr(C), C), true);\r
- }\r
-\r
- public Geom2dAdaptor_Curve(Geom2d_Curve C, double UFirst, double ULast) {\r
- this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_2(Geom2d_Curve.getCPtr(C), C, UFirst, ULast), true);\r
- }\r
-\r
- public void load(Geom2d_Curve C) {\r
- OccJavaJNI.Geom2dAdaptor_Curve_load__SWIG_0(swigCPtr, this, Geom2d_Curve.getCPtr(C), C);\r
- }\r
-\r
- public void load(Geom2d_Curve C, double UFirst, double ULast) {\r
- OccJavaJNI.Geom2dAdaptor_Curve_load__SWIG_1(swigCPtr, this, Geom2d_Curve.getCPtr(C), C, UFirst, ULast);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom2dAdaptor_Curve extends Adaptor2d_Curve2d {
+ private transient long swigCPtr;
+
+ protected Geom2dAdaptor_Curve(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.Geom2dAdaptor_Curve_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom2dAdaptor_Curve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom2dAdaptor_Curve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public Geom2dAdaptor_Curve() {
+ this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_0(), true);
+ }
+
+ public Geom2dAdaptor_Curve(Geom2d_Curve C) {
+ this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_1(Geom2d_Curve.getCPtr(C), C), true);
+ }
+
+ public Geom2dAdaptor_Curve(Geom2d_Curve C, double UFirst, double ULast) {
+ this(OccJavaJNI.new_Geom2dAdaptor_Curve__SWIG_2(Geom2d_Curve.getCPtr(C), C, UFirst, ULast), true);
+ }
+
+ public void load(Geom2d_Curve C) {
+ OccJavaJNI.Geom2dAdaptor_Curve_load__SWIG_0(swigCPtr, this, Geom2d_Curve.getCPtr(C), C);
+ }
+
+ public void load(Geom2d_Curve C, double UFirst, double ULast) {
+ OccJavaJNI.Geom2dAdaptor_Curve_load__SWIG_1(swigCPtr, this, Geom2d_Curve.getCPtr(C), C, UFirst, ULast);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom2d_Curve extends Geom2d_Geometry {\r
- private long swigCPtr;\r
-\r
- public Geom2d_Curve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom2d_Curve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom2d_Curve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom2d_Curve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom2d_Curve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom2d_Curve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom2d_Curve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom2d_Curve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom2d_Geometry {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Geom2d_Geometry(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom2d_Geometry obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom2d_Geometry(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom2d_Geometry {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom2d_Geometry(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom2d_Geometry obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom2d_Geometry(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GeomAPI_Interpolate {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GeomAPI_Interpolate(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GeomAPI_Interpolate obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GeomAPI_Interpolate(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GeomAPI_Interpolate(double[] Points, boolean PeriodicFlag, double Tolerance) {\r
- this(OccJavaJNI.new_GeomAPI_Interpolate(Points, PeriodicFlag, Tolerance), true);\r
- }\r
-\r
- public void Load(double[] Tangents, boolean[] TangentFlags, boolean Scale) {\r
- OccJavaJNI.GeomAPI_Interpolate_Load__SWIG_0(swigCPtr, this, Tangents, TangentFlags, Scale);\r
- }\r
-\r
- public void Load(double[] Tangents, boolean[] TangentFlags) {\r
- OccJavaJNI.GeomAPI_Interpolate_Load__SWIG_1(swigCPtr, this, Tangents, TangentFlags);\r
- }\r
-\r
- public void Perform() {\r
- OccJavaJNI.GeomAPI_Interpolate_Perform(swigCPtr, this);\r
- }\r
-\r
- public Geom_BSplineCurve Curve() {\r
- return new Geom_BSplineCurve(OccJavaJNI.GeomAPI_Interpolate_Curve(swigCPtr, this), false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GeomAPI_Interpolate {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GeomAPI_Interpolate(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GeomAPI_Interpolate obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GeomAPI_Interpolate(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GeomAPI_Interpolate(double[] Points, boolean PeriodicFlag, double Tolerance) {
+ this(OccJavaJNI.new_GeomAPI_Interpolate(Points, PeriodicFlag, Tolerance), true);
+ }
+
+ public void Load(double[] Tangents, boolean[] TangentFlags, boolean Scale) {
+ OccJavaJNI.GeomAPI_Interpolate_Load__SWIG_0(swigCPtr, this, Tangents, TangentFlags, Scale);
+ }
+
+ public void Load(double[] Tangents, boolean[] TangentFlags) {
+ OccJavaJNI.GeomAPI_Interpolate_Load__SWIG_1(swigCPtr, this, Tangents, TangentFlags);
+ }
+
+ public void Perform() {
+ OccJavaJNI.GeomAPI_Interpolate_Perform(swigCPtr, this);
+ }
+
+ public Geom_BSplineCurve Curve() {
+ return new Geom_BSplineCurve(OccJavaJNI.GeomAPI_Interpolate_Curve(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GeomAPI_PointsToBSpline {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GeomAPI_PointsToBSpline(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GeomAPI_PointsToBSpline obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GeomAPI_PointsToBSpline(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public GeomAPI_PointsToBSpline() {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_0(), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax, GeomAbs_Shape Continuity, double Tol3D) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_1(Points, DegMin, DegMax, Continuity.swigValue(), Tol3D), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax, GeomAbs_Shape Continuity) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_2(Points, DegMin, DegMax, Continuity.swigValue()), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_3(Points, DegMin, DegMax), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, int DegMin) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_4(Points, DegMin), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_5(Points), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax, GeomAbs_Shape Continuity, double Tol3D) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_6(Points, Parameters, DegMin, DegMax, Continuity.swigValue(), Tol3D), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax, GeomAbs_Shape Continuity) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_7(Points, Parameters, DegMin, DegMax, Continuity.swigValue()), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_8(Points, Parameters, DegMin, DegMax), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_9(Points, Parameters, DegMin), true);\r
- }\r
-\r
- public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters) {\r
- this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_10(Points, Parameters), true);\r
- }\r
-\r
- public Geom_BSplineCurve Curve() {\r
- return new Geom_BSplineCurve(OccJavaJNI.GeomAPI_PointsToBSpline_Curve(swigCPtr, this), false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GeomAPI_PointsToBSpline {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GeomAPI_PointsToBSpline(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GeomAPI_PointsToBSpline obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GeomAPI_PointsToBSpline(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public GeomAPI_PointsToBSpline() {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_0(), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax, GeomAbs_Shape Continuity, double Tol3D) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_1(Points, DegMin, DegMax, Continuity.swigValue(), Tol3D), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax, GeomAbs_Shape Continuity) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_2(Points, DegMin, DegMax, Continuity.swigValue()), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, int DegMin, int DegMax) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_3(Points, DegMin, DegMax), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, int DegMin) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_4(Points, DegMin), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_5(Points), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax, GeomAbs_Shape Continuity, double Tol3D) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_6(Points, Parameters, DegMin, DegMax, Continuity.swigValue(), Tol3D), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax, GeomAbs_Shape Continuity) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_7(Points, Parameters, DegMin, DegMax, Continuity.swigValue()), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin, int DegMax) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_8(Points, Parameters, DegMin, DegMax), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters, int DegMin) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_9(Points, Parameters, DegMin), true);
+ }
+
+ public GeomAPI_PointsToBSpline(double[] Points, double[] Parameters) {
+ this(OccJavaJNI.new_GeomAPI_PointsToBSpline__SWIG_10(Points, Parameters), true);
+ }
+
+ public Geom_BSplineCurve Curve() {
+ return new Geom_BSplineCurve(OccJavaJNI.GeomAPI_PointsToBSpline_Curve(swigCPtr, this), false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GeomAPI_ProjectPointOnSurf {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GeomAPI_ProjectPointOnSurf(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GeomAPI_ProjectPointOnSurf obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GeomAPI_ProjectPointOnSurf(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public void lowerDistanceParameters(double[] uv)\r
- {\r
- double[] d2=new double[1];\r
- lowerDistanceParameters(uv, d2);\r
- uv[1]=d2[0];\r
- }\r
-\r
- public GeomAPI_ProjectPointOnSurf(double[] P, Geom_Surface Surface) {\r
- this(OccJavaJNI.new_GeomAPI_ProjectPointOnSurf(P, Geom_Surface.getCPtr(Surface), Surface), true);\r
- }\r
-\r
- public void init(double[] P, Geom_Surface surface) {\r
- OccJavaJNI.GeomAPI_ProjectPointOnSurf_init(swigCPtr, this, P, Geom_Surface.getCPtr(surface), surface);\r
- }\r
-\r
- public int nbPoints() {\r
- return OccJavaJNI.GeomAPI_ProjectPointOnSurf_nbPoints(swigCPtr, this);\r
- }\r
-\r
- public double lowerDistance() {\r
- return OccJavaJNI.GeomAPI_ProjectPointOnSurf_lowerDistance(swigCPtr, this);\r
- }\r
-\r
- public double[] point(int Index) {\r
- return OccJavaJNI.GeomAPI_ProjectPointOnSurf_point(swigCPtr, this, Index);\r
-}\r
-\r
- public void lowerDistanceParameters(double[] U, double[] V) {\r
- OccJavaJNI.GeomAPI_ProjectPointOnSurf_lowerDistanceParameters(swigCPtr, this, U, V);\r
- }\r
-\r
- public void parameters(int Index, double[] U, double[] V) {\r
- OccJavaJNI.GeomAPI_ProjectPointOnSurf_parameters(swigCPtr, this, Index, U, V);\r
- }\r
-\r
- public double[] nearestPoint() {\r
- return OccJavaJNI.GeomAPI_ProjectPointOnSurf_nearestPoint(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GeomAPI_ProjectPointOnSurf {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GeomAPI_ProjectPointOnSurf(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GeomAPI_ProjectPointOnSurf obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GeomAPI_ProjectPointOnSurf(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public void lowerDistanceParameters(double[] uv)
+ {
+ double[] d2=new double[1];
+ lowerDistanceParameters(uv, d2);
+ uv[1]=d2[0];
+ }
+
+ public GeomAPI_ProjectPointOnSurf(double[] P, Geom_Surface Surface) {
+ this(OccJavaJNI.new_GeomAPI_ProjectPointOnSurf(P, Geom_Surface.getCPtr(Surface), Surface), true);
+ }
+
+ public void init(double[] P, Geom_Surface surface) {
+ OccJavaJNI.GeomAPI_ProjectPointOnSurf_init(swigCPtr, this, P, Geom_Surface.getCPtr(surface), surface);
+ }
+
+ public int nbPoints() {
+ return OccJavaJNI.GeomAPI_ProjectPointOnSurf_nbPoints(swigCPtr, this);
+ }
+
+ public double lowerDistance() {
+ return OccJavaJNI.GeomAPI_ProjectPointOnSurf_lowerDistance(swigCPtr, this);
+ }
+
+ public double[] point(int Index) {
+ return OccJavaJNI.GeomAPI_ProjectPointOnSurf_point(swigCPtr, this, Index);
+}
+
+ public void lowerDistanceParameters(double[] U, double[] V) {
+ OccJavaJNI.GeomAPI_ProjectPointOnSurf_lowerDistanceParameters(swigCPtr, this, U, V);
+ }
+
+ public void parameters(int Index, double[] U, double[] V) {
+ OccJavaJNI.GeomAPI_ProjectPointOnSurf_parameters(swigCPtr, this, Index, U, V);
+ }
+
+ public double[] nearestPoint() {
+ return OccJavaJNI.GeomAPI_ProjectPointOnSurf_nearestPoint(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum GeomAbs_Shape {\r
- C0,\r
- G1,\r
- C1,\r
- G2,\r
- C2,\r
- C3,\r
- CN;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static GeomAbs_Shape swigToEnum(int swigValue) {\r
- GeomAbs_Shape[] swigValues = GeomAbs_Shape.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (GeomAbs_Shape swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + GeomAbs_Shape.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private GeomAbs_Shape() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private GeomAbs_Shape(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private GeomAbs_Shape(GeomAbs_Shape swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum GeomAbs_Shape {
+ C0,
+ G1,
+ C1,
+ G2,
+ C2,
+ C3,
+ CN;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static GeomAbs_Shape swigToEnum(int swigValue) {
+ GeomAbs_Shape[] swigValues = GeomAbs_Shape.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (GeomAbs_Shape swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + GeomAbs_Shape.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private GeomAbs_Shape() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private GeomAbs_Shape(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private GeomAbs_Shape(GeomAbs_Shape swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GeomAdaptor_Curve extends Adaptor3d_Curve {\r
- private long swigCPtr;\r
-\r
- public GeomAdaptor_Curve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.GeomAdaptor_Curve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GeomAdaptor_Curve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GeomAdaptor_Curve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public GeomAdaptor_Curve() {\r
- this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_0(), true);\r
- }\r
-\r
- public GeomAdaptor_Curve(Geom_Curve C) {\r
- this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_1(Geom_Curve.getCPtr(C), C), true);\r
- }\r
-\r
- public GeomAdaptor_Curve(Geom_Curve C, double UFirst, double ULast) {\r
- this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_2(Geom_Curve.getCPtr(C), C, UFirst, ULast), true);\r
- }\r
-\r
- public void load(Geom_Curve C) {\r
- OccJavaJNI.GeomAdaptor_Curve_load__SWIG_0(swigCPtr, this, Geom_Curve.getCPtr(C), C);\r
- }\r
-\r
- public void load(Geom_Curve C, double UFirst, double ULast) {\r
- OccJavaJNI.GeomAdaptor_Curve_load__SWIG_1(swigCPtr, this, Geom_Curve.getCPtr(C), C, UFirst, ULast);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GeomAdaptor_Curve extends Adaptor3d_Curve {
+ private transient long swigCPtr;
+
+ protected GeomAdaptor_Curve(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.GeomAdaptor_Curve_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GeomAdaptor_Curve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GeomAdaptor_Curve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public GeomAdaptor_Curve() {
+ this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_0(), true);
+ }
+
+ public GeomAdaptor_Curve(Geom_Curve C) {
+ this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_1(Geom_Curve.getCPtr(C), C), true);
+ }
+
+ public GeomAdaptor_Curve(Geom_Curve C, double UFirst, double ULast) {
+ this(OccJavaJNI.new_GeomAdaptor_Curve__SWIG_2(Geom_Curve.getCPtr(C), C, UFirst, ULast), true);
+ }
+
+ public void load(Geom_Curve C) {
+ OccJavaJNI.GeomAdaptor_Curve_load__SWIG_0(swigCPtr, this, Geom_Curve.getCPtr(C), C);
+ }
+
+ public void load(Geom_Curve C, double UFirst, double ULast) {
+ OccJavaJNI.GeomAdaptor_Curve_load__SWIG_1(swigCPtr, this, Geom_Curve.getCPtr(C), C, UFirst, ULast);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class GeomLProp_SLProps {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public GeomLProp_SLProps(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(GeomLProp_SLProps obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_GeomLProp_SLProps(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- /**\r
- * @deprecated Typo mistake in the previous version\r
- */\r
- public void setParameter(double u, double v)\r
- {\r
- setParameters(u, v);\r
- }\r
- \r
- public double[] normal()\r
- {\r
- double[] toReturn=new double[3];\r
- normal(toReturn);\r
- return toReturn;\r
- }\r
- \r
- /**Return the normal on the uv nodes.<br>\r
- *Invalid ones are set to zero.\r
- */\r
- public double[] normalArray(double[] uvNodes)\r
- {\r
- if(uvNodes==null)\r
- throw new NullPointerException();\r
- \r
- if(uvNodes.length%2!=0)\r
- throw new IllegalArgumentException("uvNodes array length must be peer");\r
- \r
- int numNodes=uvNodes.length/2;\r
- double[] toReturn=new double[numNodes*3];\r
- normalArray(uvNodes,toReturn,numNodes);\r
- \r
- return toReturn;\r
- }\r
- \r
- public double[] curvatureDirections()\r
- {\r
- double[] toReturn=new double[6];\r
- if(isCurvatureDefined())\r
- {\r
- double[] max=new double[3];\r
- double[] min=new double[3];\r
- curvatureDirection(max, min);\r
- System.arraycopy(max, 0, toReturn, 0, 3);\r
- System.arraycopy(min, 0, toReturn, 3, 3);\r
- }\r
- return toReturn;\r
- }\r
-\r
- \r
- /**\r
- * The current point and the derivatives are computed at the same time,\r
- * which allows an optimization of the computation time.\r
- * @param degree The maximum number of derivations to be done (0, 1, or 2).\r
- * For example, to compute only the tangent, N should be equal to 1.\r
- * @param resolution The linear tolerance (it is used to test if a vector is null).\r
- */\r
- public GeomLProp_SLProps(int degree, double resolution) {\r
- this(OccJavaJNI.new_GeomLProp_SLProps(degree, resolution), true);\r
- }\r
-\r
- public void setParameters(double u, double v) {\r
- OccJavaJNI.GeomLProp_SLProps_setParameters(swigCPtr, this, u, v);\r
- }\r
-\r
- public double[] value() {\r
- return OccJavaJNI.GeomLProp_SLProps_value(swigCPtr, this);\r
-}\r
-\r
- public double[] d1U() {\r
- return OccJavaJNI.GeomLProp_SLProps_d1U(swigCPtr, this);\r
-}\r
-\r
- public double[] d1V() {\r
- return OccJavaJNI.GeomLProp_SLProps_d1V(swigCPtr, this);\r
-}\r
-\r
- public double[] d2U() {\r
- return OccJavaJNI.GeomLProp_SLProps_d2U(swigCPtr, this);\r
-}\r
-\r
- public double[] d2V() {\r
- return OccJavaJNI.GeomLProp_SLProps_d2V(swigCPtr, this);\r
-}\r
-\r
- public double[] dUV() {\r
- return OccJavaJNI.GeomLProp_SLProps_dUV(swigCPtr, this);\r
-}\r
-\r
- public boolean isTangentUDefined() {\r
- return OccJavaJNI.GeomLProp_SLProps_isTangentUDefined(swigCPtr, this);\r
-}\r
-\r
- public void tangentU(double[] D) {\r
- OccJavaJNI.GeomLProp_SLProps_tangentU(swigCPtr, this, D);\r
- }\r
-\r
- public boolean isTangentVDefined() {\r
- return OccJavaJNI.GeomLProp_SLProps_isTangentVDefined(swigCPtr, this);\r
-}\r
-\r
- public void tangentV(double[] D) {\r
- OccJavaJNI.GeomLProp_SLProps_tangentV(swigCPtr, this, D);\r
- }\r
-\r
- public boolean isNormalDefined() {\r
- return OccJavaJNI.GeomLProp_SLProps_isNormalDefined(swigCPtr, this);\r
-}\r
-\r
- public boolean isCurvatureDefined() {\r
- return OccJavaJNI.GeomLProp_SLProps_isCurvatureDefined(swigCPtr, this);\r
-}\r
-\r
- public boolean isUmbilic() {\r
- return OccJavaJNI.GeomLProp_SLProps_isUmbilic(swigCPtr, this);\r
-}\r
-\r
- public double meanCurvature() {\r
- return OccJavaJNI.GeomLProp_SLProps_meanCurvature(swigCPtr, this);\r
- }\r
-\r
- public double gaussianCurvature() {\r
- return OccJavaJNI.GeomLProp_SLProps_gaussianCurvature(swigCPtr, this);\r
- }\r
-\r
- public void setSurface(Geom_Surface S) {\r
- OccJavaJNI.GeomLProp_SLProps_setSurface(swigCPtr, this, Geom_Surface.getCPtr(S), S);\r
- }\r
-\r
- public void normal(double[] normal) {\r
- OccJavaJNI.GeomLProp_SLProps_normal(swigCPtr, this, normal);\r
- }\r
-\r
- private void normalArray(double[] uvNodes, double[] normalArray, int numNodes) {\r
- OccJavaJNI.GeomLProp_SLProps_normalArray(swigCPtr, this, uvNodes, normalArray, numNodes);\r
- }\r
-\r
- public double minCurvature() {\r
- return OccJavaJNI.GeomLProp_SLProps_minCurvature(swigCPtr, this);\r
- }\r
-\r
- public double maxCurvature() {\r
- return OccJavaJNI.GeomLProp_SLProps_maxCurvature(swigCPtr, this);\r
- }\r
-\r
- public void curvatureDirection(double[] jmax, double[] jmin) {\r
- OccJavaJNI.GeomLProp_SLProps_curvatureDirection(swigCPtr, this, jmax, jmin);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class GeomLProp_SLProps {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected GeomLProp_SLProps(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(GeomLProp_SLProps obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_GeomLProp_SLProps(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ /**
+ * @deprecated Typo mistake in the previous version
+ */
+ public void setParameter(double u, double v)
+ {
+ setParameters(u, v);
+ }
+
+ public double[] normal()
+ {
+ double[] toReturn=new double[3];
+ normal(toReturn);
+ return toReturn;
+ }
+
+ /**Return the normal on the uv nodes.<br>
+ *Invalid ones are set to zero.
+ */
+ public double[] normalArray(double[] uvNodes)
+ {
+ if(uvNodes==null)
+ throw new NullPointerException();
+
+ if(uvNodes.length%2!=0)
+ throw new IllegalArgumentException("uvNodes array length must be peer");
+
+ int numNodes=uvNodes.length/2;
+ double[] toReturn=new double[numNodes*3];
+ normalArray(uvNodes,toReturn,numNodes);
+
+ return toReturn;
+ }
+
+ public double[] curvatureDirections()
+ {
+ double[] toReturn=new double[6];
+ if(isCurvatureDefined())
+ {
+ double[] max=new double[3];
+ double[] min=new double[3];
+ curvatureDirection(max, min);
+ System.arraycopy(max, 0, toReturn, 0, 3);
+ System.arraycopy(min, 0, toReturn, 3, 3);
+ }
+ return toReturn;
+ }
+
+
+ /**
+ * The current point and the derivatives are computed at the same time,
+ * which allows an optimization of the computation time.
+ * @param degree The maximum number of derivations to be done (0, 1, or 2).
+ * For example, to compute only the tangent, N should be equal to 1.
+ * @param resolution The linear tolerance (it is used to test if a vector is null).
+ */
+ public GeomLProp_SLProps(int degree, double resolution) {
+ this(OccJavaJNI.new_GeomLProp_SLProps(degree, resolution), true);
+ }
+
+ public void setParameters(double u, double v) {
+ OccJavaJNI.GeomLProp_SLProps_setParameters(swigCPtr, this, u, v);
+ }
+
+ public double[] value() {
+ return OccJavaJNI.GeomLProp_SLProps_value(swigCPtr, this);
+}
+
+ public double[] d1U() {
+ return OccJavaJNI.GeomLProp_SLProps_d1U(swigCPtr, this);
+}
+
+ public double[] d1V() {
+ return OccJavaJNI.GeomLProp_SLProps_d1V(swigCPtr, this);
+}
+
+ public double[] d2U() {
+ return OccJavaJNI.GeomLProp_SLProps_d2U(swigCPtr, this);
+}
+
+ public double[] d2V() {
+ return OccJavaJNI.GeomLProp_SLProps_d2V(swigCPtr, this);
+}
+
+ public double[] dUV() {
+ return OccJavaJNI.GeomLProp_SLProps_dUV(swigCPtr, this);
+}
+
+ public boolean isTangentUDefined() {
+ return OccJavaJNI.GeomLProp_SLProps_isTangentUDefined(swigCPtr, this);
+}
+
+ public void tangentU(double[] D) {
+ OccJavaJNI.GeomLProp_SLProps_tangentU(swigCPtr, this, D);
+ }
+
+ public boolean isTangentVDefined() {
+ return OccJavaJNI.GeomLProp_SLProps_isTangentVDefined(swigCPtr, this);
+}
+
+ public void tangentV(double[] D) {
+ OccJavaJNI.GeomLProp_SLProps_tangentV(swigCPtr, this, D);
+ }
+
+ public boolean isNormalDefined() {
+ return OccJavaJNI.GeomLProp_SLProps_isNormalDefined(swigCPtr, this);
+}
+
+ public boolean isCurvatureDefined() {
+ return OccJavaJNI.GeomLProp_SLProps_isCurvatureDefined(swigCPtr, this);
+}
+
+ public boolean isUmbilic() {
+ return OccJavaJNI.GeomLProp_SLProps_isUmbilic(swigCPtr, this);
+}
+
+ public double meanCurvature() {
+ return OccJavaJNI.GeomLProp_SLProps_meanCurvature(swigCPtr, this);
+ }
+
+ public double gaussianCurvature() {
+ return OccJavaJNI.GeomLProp_SLProps_gaussianCurvature(swigCPtr, this);
+ }
+
+ public void setSurface(Geom_Surface S) {
+ OccJavaJNI.GeomLProp_SLProps_setSurface(swigCPtr, this, Geom_Surface.getCPtr(S), S);
+ }
+
+ public void normal(double[] normal) {
+ OccJavaJNI.GeomLProp_SLProps_normal(swigCPtr, this, normal);
+ }
+
+ private void normalArray(double[] uvNodes, double[] normalArray, int numNodes) {
+ OccJavaJNI.GeomLProp_SLProps_normalArray(swigCPtr, this, uvNodes, normalArray, numNodes);
+ }
+
+ public double minCurvature() {
+ return OccJavaJNI.GeomLProp_SLProps_minCurvature(swigCPtr, this);
+ }
+
+ public double maxCurvature() {
+ return OccJavaJNI.GeomLProp_SLProps_maxCurvature(swigCPtr, this);
+ }
+
+ public void curvatureDirection(double[] jmax, double[] jmin) {
+ OccJavaJNI.GeomLProp_SLProps_curvatureDirection(swigCPtr, this, jmax, jmin);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_BSplineCurve extends Geom_BoundedCurve {\r
- private long swigCPtr;\r
-\r
- public Geom_BSplineCurve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom_BSplineCurve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_BSplineCurve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_BSplineCurve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree, boolean Periodic, boolean CheckRational) {\r
- this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_0(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree, Periodic, CheckRational), true);\r
- }\r
-\r
- public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree, boolean Periodic) {\r
- this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_1(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree, Periodic), true);\r
- }\r
-\r
- public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree) {\r
- this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_2(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree), true);\r
- }\r
-\r
- public void setKnot(int Index, double K) {\r
- OccJavaJNI.Geom_BSplineCurve_setKnot__SWIG_0(swigCPtr, this, Index, K);\r
- }\r
-\r
- public void setKnot(int Index, double K, int M) {\r
- OccJavaJNI.Geom_BSplineCurve_setKnot__SWIG_1(swigCPtr, this, Index, K, M);\r
- }\r
-\r
- public void setPeriodic() {\r
- OccJavaJNI.Geom_BSplineCurve_setPeriodic(swigCPtr, this);\r
- }\r
-\r
- public void setNotPeriodic() {\r
- OccJavaJNI.Geom_BSplineCurve_setNotPeriodic(swigCPtr, this);\r
- }\r
-\r
- public void setOrigin(int Index) {\r
- OccJavaJNI.Geom_BSplineCurve_setOrigin__SWIG_0(swigCPtr, this, Index);\r
- }\r
-\r
- public void setOrigin(double U, double Tol) {\r
- OccJavaJNI.Geom_BSplineCurve_setOrigin__SWIG_1(swigCPtr, this, U, Tol);\r
- }\r
-\r
- public void setPole(int Index, double[] P) {\r
- OccJavaJNI.Geom_BSplineCurve_setPole__SWIG_0(swigCPtr, this, Index, P);\r
- }\r
-\r
- public void setPole(int Index, double[] P, double Weight) {\r
- OccJavaJNI.Geom_BSplineCurve_setPole__SWIG_1(swigCPtr, this, Index, P, Weight);\r
- }\r
-\r
- public void movePoint(double U, double[] P, int Index1, int Index2, SWIGTYPE_p_int FirstModifiedPole, SWIGTYPE_p_int LastModifiedPole) {\r
- OccJavaJNI.Geom_BSplineCurve_movePoint(swigCPtr, this, U, P, Index1, Index2, SWIGTYPE_p_int.getCPtr(FirstModifiedPole), SWIGTYPE_p_int.getCPtr(LastModifiedPole));\r
- }\r
-\r
- public void movePointAndTangent(double U, double[] P, double[] Tangent, double Tolerance, int StartingCondition, int EndingCondition) {\r
- OccJavaJNI.Geom_BSplineCurve_movePointAndTangent(swigCPtr, this, U, P, Tangent, Tolerance, StartingCondition, EndingCondition);\r
- }\r
-\r
- public boolean isClosed() {\r
- return OccJavaJNI.Geom_BSplineCurve_isClosed(swigCPtr, this);\r
-}\r
-\r
- public boolean isPeriodic() {\r
- return OccJavaJNI.Geom_BSplineCurve_isPeriodic(swigCPtr, this);\r
-}\r
-\r
- public boolean isRational() {\r
- return OccJavaJNI.Geom_BSplineCurve_isRational(swigCPtr, this);\r
-}\r
-\r
- public GeomAbs_Shape continuity() {\r
- return GeomAbs_Shape.swigToEnum(OccJavaJNI.Geom_BSplineCurve_continuity(swigCPtr, this));\r
- }\r
-\r
- public int Degree() {\r
- return OccJavaJNI.Geom_BSplineCurve_Degree(swigCPtr, this);\r
- }\r
-\r
- public double[] localValue(double U, int FromK1, int ToK2) {\r
- return OccJavaJNI.Geom_BSplineCurve_localValue(swigCPtr, this, U, FromK1, ToK2);\r
-}\r
-\r
- public double[] endPoint() {\r
- return OccJavaJNI.Geom_BSplineCurve_endPoint(swigCPtr, this);\r
-}\r
-\r
- public double[] startPoint() {\r
- return OccJavaJNI.Geom_BSplineCurve_startPoint(swigCPtr, this);\r
-}\r
-\r
- public int nbKnots() {\r
- return OccJavaJNI.Geom_BSplineCurve_nbKnots(swigCPtr, this);\r
- }\r
-\r
- public int nbPoles() {\r
- return OccJavaJNI.Geom_BSplineCurve_nbPoles(swigCPtr, this);\r
- }\r
-\r
- public double[] pole(int Index) {\r
- return OccJavaJNI.Geom_BSplineCurve_pole(swigCPtr, this, Index);\r
-}\r
-\r
- public double weight(int Index) {\r
- return OccJavaJNI.Geom_BSplineCurve_weight(swigCPtr, this, Index);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_BSplineCurve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_BSplineCurve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_BSplineCurve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_BSplineCurve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree, boolean Periodic, boolean CheckRational) {
+ this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_0(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree, Periodic, CheckRational), true);
+ }
+
+ public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree, boolean Periodic) {
+ this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_1(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree, Periodic), true);
+ }
+
+ public Geom_BSplineCurve(double[] Poles, double[] Weights, double[] Knots, SWIGTYPE_p_TColStd_Array1OfInteger Multiplicities, int Degree) {
+ this(OccJavaJNI.new_Geom_BSplineCurve__SWIG_2(Poles, Weights, Knots, SWIGTYPE_p_TColStd_Array1OfInteger.getCPtr(Multiplicities), Degree), true);
+ }
+
+ public void setKnot(int Index, double K) {
+ OccJavaJNI.Geom_BSplineCurve_setKnot__SWIG_0(swigCPtr, this, Index, K);
+ }
+
+ public void setKnot(int Index, double K, int M) {
+ OccJavaJNI.Geom_BSplineCurve_setKnot__SWIG_1(swigCPtr, this, Index, K, M);
+ }
+
+ public void setPeriodic() {
+ OccJavaJNI.Geom_BSplineCurve_setPeriodic(swigCPtr, this);
+ }
+
+ public void setNotPeriodic() {
+ OccJavaJNI.Geom_BSplineCurve_setNotPeriodic(swigCPtr, this);
+ }
+
+ public void setOrigin(int Index) {
+ OccJavaJNI.Geom_BSplineCurve_setOrigin__SWIG_0(swigCPtr, this, Index);
+ }
+
+ public void setOrigin(double U, double Tol) {
+ OccJavaJNI.Geom_BSplineCurve_setOrigin__SWIG_1(swigCPtr, this, U, Tol);
+ }
+
+ public void setPole(int Index, double[] P) {
+ OccJavaJNI.Geom_BSplineCurve_setPole__SWIG_0(swigCPtr, this, Index, P);
+ }
+
+ public void setPole(int Index, double[] P, double Weight) {
+ OccJavaJNI.Geom_BSplineCurve_setPole__SWIG_1(swigCPtr, this, Index, P, Weight);
+ }
+
+ public void movePoint(double U, double[] P, int Index1, int Index2, SWIGTYPE_p_int FirstModifiedPole, SWIGTYPE_p_int LastModifiedPole) {
+ OccJavaJNI.Geom_BSplineCurve_movePoint(swigCPtr, this, U, P, Index1, Index2, SWIGTYPE_p_int.getCPtr(FirstModifiedPole), SWIGTYPE_p_int.getCPtr(LastModifiedPole));
+ }
+
+ public void movePointAndTangent(double U, double[] P, double[] Tangent, double Tolerance, int StartingCondition, int EndingCondition) {
+ OccJavaJNI.Geom_BSplineCurve_movePointAndTangent(swigCPtr, this, U, P, Tangent, Tolerance, StartingCondition, EndingCondition);
+ }
+
+ public boolean isClosed() {
+ return OccJavaJNI.Geom_BSplineCurve_isClosed(swigCPtr, this);
+}
+
+ public boolean isPeriodic() {
+ return OccJavaJNI.Geom_BSplineCurve_isPeriodic(swigCPtr, this);
+}
+
+ public boolean isRational() {
+ return OccJavaJNI.Geom_BSplineCurve_isRational(swigCPtr, this);
+}
+
+ public GeomAbs_Shape continuity() {
+ return GeomAbs_Shape.swigToEnum(OccJavaJNI.Geom_BSplineCurve_continuity(swigCPtr, this));
+ }
+
+ public int Degree() {
+ return OccJavaJNI.Geom_BSplineCurve_Degree(swigCPtr, this);
+ }
+
+ public double[] localValue(double U, int FromK1, int ToK2) {
+ return OccJavaJNI.Geom_BSplineCurve_localValue(swigCPtr, this, U, FromK1, ToK2);
+}
+
+ public double[] endPoint() {
+ return OccJavaJNI.Geom_BSplineCurve_endPoint(swigCPtr, this);
+}
+
+ public double[] startPoint() {
+ return OccJavaJNI.Geom_BSplineCurve_startPoint(swigCPtr, this);
+}
+
+ public int nbKnots() {
+ return OccJavaJNI.Geom_BSplineCurve_nbKnots(swigCPtr, this);
+ }
+
+ public int nbPoles() {
+ return OccJavaJNI.Geom_BSplineCurve_nbPoles(swigCPtr, this);
+ }
+
+ public double[] pole(int Index) {
+ return OccJavaJNI.Geom_BSplineCurve_pole(swigCPtr, this, Index);
+}
+
+ public double weight(int Index) {
+ return OccJavaJNI.Geom_BSplineCurve_weight(swigCPtr, this, Index);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_BoundedCurve extends Geom_Curve {\r
- private long swigCPtr;\r
-\r
- public Geom_BoundedCurve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom_BoundedCurve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_BoundedCurve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_BoundedCurve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_BoundedCurve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_BoundedCurve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_BoundedCurve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_BoundedCurve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_Curve extends Geom_Geometry {\r
- private long swigCPtr;\r
-\r
- public Geom_Curve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom_Curve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_Curve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_Curve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public double firstParameter() {\r
- return OccJavaJNI.Geom_Curve_firstParameter(swigCPtr, this);\r
- }\r
-\r
- public double lastParameter() {\r
- return OccJavaJNI.Geom_Curve_lastParameter(swigCPtr, this);\r
- }\r
-\r
- public boolean isClosed() {\r
- return OccJavaJNI.Geom_Curve_isClosed(swigCPtr, this);\r
-}\r
-\r
- public boolean isPeriodic() {\r
- return OccJavaJNI.Geom_Curve_isPeriodic(swigCPtr, this);\r
-}\r
-\r
- public double period() {\r
- return OccJavaJNI.Geom_Curve_period(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_Curve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_Curve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_Curve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_Curve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public double firstParameter() {
+ return OccJavaJNI.Geom_Curve_firstParameter(swigCPtr, this);
+ }
+
+ public double lastParameter() {
+ return OccJavaJNI.Geom_Curve_lastParameter(swigCPtr, this);
+ }
+
+ public boolean isClosed() {
+ return OccJavaJNI.Geom_Curve_isClosed(swigCPtr, this);
+}
+
+ public boolean isPeriodic() {
+ return OccJavaJNI.Geom_Curve_isPeriodic(swigCPtr, this);
+}
+
+ public double period() {
+ return OccJavaJNI.Geom_Curve_period(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_Geometry {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Geom_Geometry(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_Geometry obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_Geometry(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_Geometry {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_Geometry(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_Geometry obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_Geometry(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_Surface extends Geom_Geometry {\r
- private long swigCPtr;\r
-\r
- public Geom_Surface(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom_Surface_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_Surface obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_Surface(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public double[] value(double U, double V) {\r
- return OccJavaJNI.Geom_Surface_value(swigCPtr, this, U, V);\r
-}\r
-\r
- \r
- /**\r
- * Return the bounds of the parameters of the surface.\r
- * @param bounds an array of size 4 which will receive {Umin, Umax, Vmin, Vmax}\r
- */\r
- public void bounds(double[] bounds) {\r
- OccJavaJNI.Geom_Surface_bounds__SWIG_0(swigCPtr, this, bounds);\r
- }\r
-\r
- \r
- /**\r
- * @deprecated use bounds(double[]) , it do not need to allocate 4 arrays.\r
- */\r
- public void bounds(double[] U1, double[] U2, double[] V1, double[] V2) {\r
- OccJavaJNI.Geom_Surface_bounds__SWIG_1(swigCPtr, this, U1, U2, V1, V2);\r
- }\r
-\r
- public boolean isUClosed() {\r
- return OccJavaJNI.Geom_Surface_isUClosed(swigCPtr, this);\r
-}\r
-\r
- public boolean isVClosed() {\r
- return OccJavaJNI.Geom_Surface_isVClosed(swigCPtr, this);\r
-}\r
-\r
- public Geom_Curve uIso(double U) {\r
- return new Geom_Curve(OccJavaJNI.Geom_Surface_uIso(swigCPtr, this, U), true);\r
- }\r
-\r
- public Geom_Curve vIso(double V) {\r
- return new Geom_Curve(OccJavaJNI.Geom_Surface_vIso(swigCPtr, this, V), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_Surface {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_Surface(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_Surface obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_Surface(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public double[] value(double U, double V) {
+ return OccJavaJNI.Geom_Surface_value(swigCPtr, this, U, V);
+}
+
+
+ /**
+ * Return the bounds of the parameters of the surface.
+ * @param bounds an array of size 4 which will receive {Umin, Umax, Vmin, Vmax}
+ */
+ public void bounds(double[] bounds) {
+ OccJavaJNI.Geom_Surface_bounds__SWIG_0(swigCPtr, this, bounds);
+ }
+
+
+ /**
+ * @deprecated use bounds(double[]) , it do not need to allocate 4 arrays.
+ */
+ public void bounds(double[] U1, double[] U2, double[] V1, double[] V2) {
+ OccJavaJNI.Geom_Surface_bounds__SWIG_1(swigCPtr, this, U1, U2, V1, V2);
+ }
+
+ public boolean isUClosed() {
+ return OccJavaJNI.Geom_Surface_isUClosed(swigCPtr, this);
+}
+
+ public boolean isVClosed() {
+ return OccJavaJNI.Geom_Surface_isVClosed(swigCPtr, this);
+}
+
+ public Geom_Curve uIso(double U) {
+ return new Geom_Curve(OccJavaJNI.Geom_Surface_uIso(swigCPtr, this, U), true);
+ }
+
+ public Geom_Curve vIso(double V) {
+ return new Geom_Curve(OccJavaJNI.Geom_Surface_vIso(swigCPtr, this, V), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Geom_TrimmedCurve extends Geom_BoundedCurve {\r
- private long swigCPtr;\r
-\r
- public Geom_TrimmedCurve(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.Geom_TrimmedCurve_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Geom_TrimmedCurve obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Geom_TrimmedCurve(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Geom_TrimmedCurve {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Geom_TrimmedCurve(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Geom_TrimmedCurve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Geom_TrimmedCurve(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Handle_TColStd_HArray1OfBoolean {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Handle_TColStd_HArray1OfBoolean(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Handle_TColStd_HArray1OfBoolean obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Handle_TColStd_HArray1OfBoolean(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Handle_TColStd_HArray1OfBoolean {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Handle_TColStd_HArray1OfBoolean(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Handle_TColStd_HArray1OfBoolean obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Handle_TColStd_HArray1OfBoolean(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Handle_TColgp_HArray1OfPnt {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Handle_TColgp_HArray1OfPnt(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Handle_TColgp_HArray1OfPnt obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Handle_TColgp_HArray1OfPnt(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Handle_TColgp_HArray1OfPnt {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Handle_TColgp_HArray1OfPnt(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Handle_TColgp_HArray1OfPnt obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Handle_TColgp_HArray1OfPnt(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum IFSelect_ReturnStatus {\r
- VOID,\r
- DONE,\r
- ERROR,\r
- FAIL,\r
- STOP;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static IFSelect_ReturnStatus swigToEnum(int swigValue) {\r
- IFSelect_ReturnStatus[] swigValues = IFSelect_ReturnStatus.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (IFSelect_ReturnStatus swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + IFSelect_ReturnStatus.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private IFSelect_ReturnStatus() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private IFSelect_ReturnStatus(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private IFSelect_ReturnStatus(IFSelect_ReturnStatus swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum IFSelect_ReturnStatus {
+ VOID,
+ DONE,
+ ERROR,
+ FAIL,
+ STOP;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static IFSelect_ReturnStatus swigToEnum(int swigValue) {
+ IFSelect_ReturnStatus[] swigValues = IFSelect_ReturnStatus.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (IFSelect_ReturnStatus swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + IFSelect_ReturnStatus.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private IFSelect_ReturnStatus() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private IFSelect_ReturnStatus(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private IFSelect_ReturnStatus(IFSelect_ReturnStatus swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class IGESControl_Controller {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public IGESControl_Controller(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(IGESControl_Controller obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_IGESControl_Controller(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public IGESControl_Controller() {\r
- this(OccJavaJNI.new_IGESControl_Controller(), true);\r
- }\r
-\r
- public void init() {\r
- OccJavaJNI.IGESControl_Controller_init(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class IGESControl_Controller {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected IGESControl_Controller(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(IGESControl_Controller obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_IGESControl_Controller(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public IGESControl_Controller() {
+ this(OccJavaJNI.new_IGESControl_Controller(), true);
+ }
+
+ public void init() {
+ OccJavaJNI.IGESControl_Controller_init(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class IGESControl_Reader extends XSControl_Reader {\r
- private long swigCPtr;\r
-\r
- public IGESControl_Reader(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.IGESControl_Reader_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(IGESControl_Reader obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_IGESControl_Reader(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public IGESControl_Reader() {\r
- this(OccJavaJNI.new_IGESControl_Reader(), true);\r
- }\r
-\r
- public String getLabel(TopoDS_Shape theShape) {\r
- return OccJavaJNI.IGESControl_Reader_getLabel(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape);\r
- }\r
-\r
- public TopoDS_Shape getShape(String shapeName) {\r
- long cPtr = OccJavaJNI.IGESControl_Reader_getShape(swigCPtr, this, shapeName);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public void dumpLabels() {\r
- OccJavaJNI.IGESControl_Reader_dumpLabels(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class IGESControl_Reader extends XSControl_Reader {
+ private transient long swigCPtr;
+
+ protected IGESControl_Reader(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.IGESControl_Reader_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(IGESControl_Reader obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_IGESControl_Reader(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public IGESControl_Reader() {
+ this(OccJavaJNI.new_IGESControl_Reader(), true);
+ }
+
+ public String getLabel(TopoDS_Shape theShape) {
+ return OccJavaJNI.IGESControl_Reader_getLabel(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape);
+ }
+
+ public TopoDS_Shape getShape(String shapeName) {
+ long cPtr = OccJavaJNI.IGESControl_Reader_getShape(swigCPtr, this, shapeName);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public void dumpLabels() {
+ OccJavaJNI.IGESControl_Reader_dumpLabels(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class IGESControl_Writer {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public IGESControl_Writer(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(IGESControl_Writer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_IGESControl_Writer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public IGESControl_Writer() {\r
- this(OccJavaJNI.new_IGESControl_Writer__SWIG_0(), true);\r
- }\r
-\r
- public IGESControl_Writer(String unit, int modecr) {\r
- this(OccJavaJNI.new_IGESControl_Writer__SWIG_1(unit, modecr), true);\r
- }\r
-\r
- public IGESControl_Writer(String unit) {\r
- this(OccJavaJNI.new_IGESControl_Writer__SWIG_2(unit), true);\r
- }\r
-\r
- public boolean write(String filename) {\r
- return OccJavaJNI.IGESControl_Writer_write(swigCPtr, this, filename);\r
-}\r
-\r
- public boolean addShape(TopoDS_Shape sh) {\r
- return OccJavaJNI.IGESControl_Writer_addShape(swigCPtr, this, TopoDS_Shape.getCPtr(sh), sh);\r
-}\r
-\r
- public void computeModel() {\r
- OccJavaJNI.IGESControl_Writer_computeModel(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class IGESControl_Writer {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected IGESControl_Writer(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(IGESControl_Writer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_IGESControl_Writer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public IGESControl_Writer() {
+ this(OccJavaJNI.new_IGESControl_Writer__SWIG_0(), true);
+ }
+
+ public IGESControl_Writer(String unit, int modecr) {
+ this(OccJavaJNI.new_IGESControl_Writer__SWIG_1(unit, modecr), true);
+ }
+
+ public IGESControl_Writer(String unit) {
+ this(OccJavaJNI.new_IGESControl_Writer__SWIG_2(unit), true);
+ }
+
+ public boolean write(String filename) {
+ return OccJavaJNI.IGESControl_Writer_write(swigCPtr, this, filename);
+}
+
+ public boolean addShape(TopoDS_Shape sh) {
+ return OccJavaJNI.IGESControl_Writer_addShape(swigCPtr, this, TopoDS_Shape.getCPtr(sh), sh);
+}
+
+ public void computeModel() {
+ OccJavaJNI.IGESControl_Writer_computeModel(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class OccJava {\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class OccJava {
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class OccJavaJNI {\r
-\r
- static\r
- {\r
- System.loadLibrary("TKERNEL");\r
- System.loadLibrary("TKMATH");\r
- System.loadLibrary("TKG2D");\r
- System.loadLibrary("TKG3D"); \r
- System.loadLibrary("TKGEOMBASE");\r
- System.loadLibrary("TKBREP");\r
- System.loadLibrary("TKGEOMALGO"); \r
- System.loadLibrary("TKTOPALGO");\r
- System.loadLibrary("TKMESH");\r
- \r
- System.loadLibrary("TKBO"); \r
- System.loadLibrary("TKSHHEALING");\r
- \r
- System.loadLibrary("TKPRIM");\r
- System.loadLibrary("TKBOOL");\r
- System.loadLibrary("TKFILLET");\r
- System.loadLibrary("TKOFFSET"); \r
- \r
- System.loadLibrary("TKXSBASE");\r
- System.loadLibrary("TKIGES");\r
- System.loadLibrary("TKSTEPBASE");\r
- System.loadLibrary("TKSTEPATTR");\r
- System.loadLibrary("TKSTEP209");\r
- System.loadLibrary("TKSTEP");\r
-\r
- System.loadLibrary("OccJava");\r
- String mmg_opt= System.getenv("MMGT_OPT");\r
- if(mmg_opt != null && !"0".equals(mmg_opt))\r
- throw new RuntimeException("The MMGT_OPT environement variable must be set to 0 before using occjava.");\r
- }\r
-\r
- public final static native long new_GP_Trsf();\r
- public final static native void GP_Trsf_setRotation(long jarg1, GP_Trsf jarg1_, double[] jarg2, double jarg3);\r
- public final static native void GP_Trsf_setTranslation(long jarg1, GP_Trsf jarg1_, double[] jarg2);\r
- public final static native void GP_Trsf_setValues(long jarg1, GP_Trsf jarg1_, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6, double jarg7, double jarg8, double jarg9, double jarg10, double jarg11, double jarg12, double jarg13, double jarg14, double jarg15);\r
- public final static native void GP_Trsf_getValues(long jarg1, GP_Trsf jarg1_, double[] jarg2);\r
- public final static native void delete_GP_Trsf(long jarg1);\r
- public final static native long new_GP_Circ(double[] jarg1, double jarg2);\r
- public final static native void delete_GP_Circ(long jarg1);\r
- public final static native long new_GP_Parab__SWIG_0(double[] jarg1, double jarg2);\r
- public final static native long new_GP_Parab__SWIG_1(double[] jarg1, double[] jarg2);\r
- public final static native void delete_GP_Parab(long jarg1);\r
- public final static native long new_GP_Elips(double[] jarg1, double jarg2, double jarg3);\r
- public final static native void delete_GP_Elips(long jarg1);\r
- public final static native long new_GP_Lin(double[] jarg1);\r
- public final static native void delete_GP_Lin(long jarg1);\r
- public final static native void delete_Handle_TColStd_HArray1OfBoolean(long jarg1);\r
- public final static native void delete_Handle_TColgp_HArray1OfPnt(long jarg1);\r
- public final static native int TopoDS_Shape_shapeType(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native boolean TopoDS_Shape_nativeIsSame(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native int TopoDS_Shape_orientation(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void TopoDS_Shape_reverse(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native long TopoDS_Shape_reversed(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native int TopoDS_Shape_hashCode(long jarg1, TopoDS_Shape jarg1_, int jarg2);\r
- public final static native boolean TopoDS_Shape_free__SWIG_0(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void TopoDS_Shape_free__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);\r
- public final static native long TopoDS_Shape_getTShape(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native long new_TopoDS_Shape();\r
- public final static native void delete_TopoDS_Shape(long jarg1);\r
- public final static native long new_TopoDS_Compound();\r
- public final static native void delete_TopoDS_Compound(long jarg1);\r
- public final static native long new_TopoDS_CompSolid();\r
- public final static native void delete_TopoDS_CompSolid(long jarg1);\r
- public final static native long new_TopoDS_Solid();\r
- public final static native void delete_TopoDS_Solid(long jarg1);\r
- public final static native long new_TopoDS_Shell();\r
- public final static native void delete_TopoDS_Shell(long jarg1);\r
- public final static native long new_TopoDS_Face();\r
- public final static native void delete_TopoDS_Face(long jarg1);\r
- public final static native long new_TopoDS_Wire();\r
- public final static native void delete_TopoDS_Wire(long jarg1);\r
- public final static native long new_TopoDS_Edge();\r
- public final static native void delete_TopoDS_Edge(long jarg1);\r
- public final static native long new_TopoDS_Vertex();\r
- public final static native void delete_TopoDS_Vertex(long jarg1);\r
- public final static native long new_TopoDS_Iterator__SWIG_0();\r
- public final static native long new_TopoDS_Iterator__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2, boolean jarg3);\r
- public final static native long new_TopoDS_Iterator__SWIG_2(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);\r
- public final static native long new_TopoDS_Iterator__SWIG_3(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void TopoDS_Iterator_initialize__SWIG_0(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3, boolean jarg4);\r
- public final static native void TopoDS_Iterator_initialize__SWIG_1(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);\r
- public final static native void TopoDS_Iterator_initialize__SWIG_2(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean TopoDS_Iterator_more(long jarg1, TopoDS_Iterator jarg1_);\r
- public final static native void TopoDS_Iterator_next(long jarg1, TopoDS_Iterator jarg1_);\r
- public final static native long TopoDS_Iterator_value(long jarg1, TopoDS_Iterator jarg1_);\r
- public final static native void delete_TopoDS_Iterator(long jarg1);\r
- public final static native void TopoDS_Builder_makeWire(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Wire jarg2_);\r
- public final static native void TopoDS_Builder_makeCompound(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Compound jarg2_);\r
- public final static native void TopoDS_Builder_add(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);\r
- public final static native void TopoDS_Builder_remove(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);\r
- public final static native void delete_TopoDS_Builder(long jarg1);\r
- public final static native double[] BRep_Tool_pnt(long jarg1, TopoDS_Vertex jarg1_);\r
- public final static native double[] BRep_Tool_parameters(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Face jarg2_);\r
- public final static native double BRep_Tool_parameter(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native boolean BRep_Tool_degenerated(long jarg1, TopoDS_Edge jarg1_);\r
- public final static native boolean BRep_Tool_hasContinuity(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, long jarg3, TopoDS_Face jarg3_);\r
- public final static native int BRep_Tool_continuity(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, long jarg3, TopoDS_Face jarg3_);\r
- public final static native double BRep_Tool_tolerance__SWIG_0(long jarg1, TopoDS_Face jarg1_);\r
- public final static native double BRep_Tool_tolerance__SWIG_1(long jarg1, TopoDS_Edge jarg1_);\r
- public final static native double BRep_Tool_tolerance__SWIG_2(long jarg1, TopoDS_Vertex jarg1_);\r
- public final static native long BRep_Tool_triangulation(long jarg1, TopoDS_Face jarg1_, long jarg2, TopLoc_Location jarg2_);\r
- public final static native void BRep_Tool_range(long jarg1, TopoDS_Edge jarg1_, double[] jarg2);\r
- public final static native long BRep_Tool_curve(long jarg1, TopoDS_Edge jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long BRep_Tool_surface(long jarg1, TopoDS_Face jarg1_);\r
- public final static native long BRep_Tool_curveOnSurface(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, double[] jarg3, double[] jarg4);\r
- public final static native long new_BRep_Tool();\r
- public final static native void delete_BRep_Tool(long jarg1);\r
- public final static native long new_BRep_Builder();\r
- public final static native void BRep_Builder_updateVertex__SWIG_0(long jarg1, BRep_Builder jarg1_, long jarg2, TopoDS_Vertex jarg2_, double jarg3, double jarg4, long jarg5, TopoDS_Face jarg5_, double jarg6);\r
- public final static native void BRep_Builder_updateVertex__SWIG_1(long jarg1, BRep_Builder jarg1_, long jarg2, TopoDS_Vertex jarg2_, double jarg3);\r
- public final static native void delete_BRep_Builder(long jarg1);\r
- public final static native long new_GeomLProp_SLProps(int jarg1, double jarg2);\r
- public final static native void GeomLProp_SLProps_setParameters(long jarg1, GeomLProp_SLProps jarg1_, double jarg2, double jarg3);\r
- public final static native double[] GeomLProp_SLProps_value(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double[] GeomLProp_SLProps_d1U(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double[] GeomLProp_SLProps_d1V(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double[] GeomLProp_SLProps_d2U(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double[] GeomLProp_SLProps_d2V(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double[] GeomLProp_SLProps_dUV(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native boolean GeomLProp_SLProps_isTangentUDefined(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native void GeomLProp_SLProps_tangentU(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);\r
- public final static native boolean GeomLProp_SLProps_isTangentVDefined(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native void GeomLProp_SLProps_tangentV(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);\r
- public final static native boolean GeomLProp_SLProps_isNormalDefined(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native boolean GeomLProp_SLProps_isCurvatureDefined(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native boolean GeomLProp_SLProps_isUmbilic(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double GeomLProp_SLProps_meanCurvature(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double GeomLProp_SLProps_gaussianCurvature(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native void GeomLProp_SLProps_setSurface(long jarg1, GeomLProp_SLProps jarg1_, long jarg2, Geom_Surface jarg2_);\r
- public final static native void GeomLProp_SLProps_normal(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);\r
- public final static native void GeomLProp_SLProps_normalArray(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2, double[] jarg3, int jarg4);\r
- public final static native double GeomLProp_SLProps_minCurvature(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native double GeomLProp_SLProps_maxCurvature(long jarg1, GeomLProp_SLProps jarg1_);\r
- public final static native void GeomLProp_SLProps_curvatureDirection(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native void delete_GeomLProp_SLProps(long jarg1);\r
- public final static native boolean BRepTools_read__SWIG_0(long jarg1, TopoDS_Shape jarg1_, String jarg2, long jarg3, BRep_Builder jarg3_);\r
- public final static native boolean BRepTools_write__SWIG_0(long jarg1, TopoDS_Shape jarg1_, String jarg2);\r
- public final static native void BRepTools_write__SWIG_1(long jarg1, TopoDS_Shape jarg1_, java.nio.channels.WritableByteChannel jarg2);\r
- public final static native void BRepTools_clean(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native boolean BRepTools_read__SWIG_1(long jarg1, TopoDS_Shape jarg1_, java.nio.channels.ReadableByteChannel jarg2, long jarg3, BRep_Builder jarg3_);\r
- public final static native void delete_BRepTools(long jarg1);\r
- public final static native long new_BRepTools_WireExplorer__SWIG_0();\r
- public final static native long new_BRepTools_WireExplorer__SWIG_1(long jarg1, TopoDS_Wire jarg1_);\r
- public final static native long new_BRepTools_WireExplorer__SWIG_2(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Face jarg2_);\r
- public final static native void BRepTools_WireExplorer_init__SWIG_0(long jarg1, BRepTools_WireExplorer jarg1_, long jarg2, TopoDS_Wire jarg2_);\r
- public final static native void BRepTools_WireExplorer_init__SWIG_1(long jarg1, BRepTools_WireExplorer jarg1_, long jarg2, TopoDS_Wire jarg2_, long jarg3, TopoDS_Face jarg3_);\r
- public final static native boolean BRepTools_WireExplorer_more(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native void BRepTools_WireExplorer_next(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native long BRepTools_WireExplorer_current(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native int BRepTools_WireExplorer_orientation(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native long BRepTools_WireExplorer_currentVertex(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native void BRepTools_WireExplorer_clear(long jarg1, BRepTools_WireExplorer jarg1_);\r
- public final static native void delete_BRepTools_WireExplorer(long jarg1);\r
- public final static native long new_BRepTools_Quilt();\r
- public final static native void BRepTools_Quilt_bind__SWIG_0(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_);\r
- public final static native void BRepTools_Quilt_bind__SWIG_1(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native void BRepTools_Quilt_add(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepTools_Quilt_isCopied(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long BRepTools_Quilt_copy(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long BRepTools_Quilt_shells(long jarg1, BRepTools_Quilt jarg1_);\r
- public final static native void delete_BRepTools_Quilt(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeShape_shape(long jarg1, BRepBuilderAPI_MakeShape jarg1_);\r
- public final static native void delete_BRepBuilderAPI_MakeShape(long jarg1);\r
- public final static native long BRepBuilderAPI_ModifyShape_modifiedShape(long jarg1, BRepBuilderAPI_ModifyShape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepBuilderAPI_ModifyShape(long jarg1);\r
- public final static native long new_BRepBuilderAPI_Transform__SWIG_0(long jarg1, GP_Trsf jarg1_);\r
- public final static native long new_BRepBuilderAPI_Transform__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GP_Trsf jarg2_, boolean jarg3);\r
- public final static native long new_BRepBuilderAPI_Transform__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GP_Trsf jarg2_);\r
- public final static native void BRepBuilderAPI_Transform_perform__SWIG_0(long jarg1, BRepBuilderAPI_Transform jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);\r
- public final static native void BRepBuilderAPI_Transform_perform__SWIG_1(long jarg1, BRepBuilderAPI_Transform jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepBuilderAPI_Transform(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeVertex(double[] jarg1);\r
- public final static native void delete_BRepBuilderAPI_MakeVertex(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_0();\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_1(long jarg1, TopoDS_Edge jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_2(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_3(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_4(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_, long jarg4, TopoDS_Edge jarg4_);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_5(long jarg1, TopoDS_Wire jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeWire__SWIG_6(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native void BRepBuilderAPI_MakeWire_add__SWIG_0(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native void BRepBuilderAPI_MakeWire_add__SWIG_1(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long jarg2, TopoDS_Wire jarg2_);\r
- public final static native void BRepBuilderAPI_MakeWire_add__SWIG_2(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long[] jarg2);\r
- public final static native boolean BRepBuilderAPI_MakeWire_isDone(long jarg1, BRepBuilderAPI_MakeWire jarg1_);\r
- public final static native void delete_BRepBuilderAPI_MakeWire(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_0();\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_1(long jarg1, Geom_Curve jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_2(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Vertex jarg2_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_3(double[] jarg1, double[] jarg2);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_4(long jarg1, GP_Circ jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_5(long jarg1, GP_Circ jarg1_, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_6(long jarg1, GP_Circ jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_7(long jarg1, GP_Circ jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_8(long jarg1, GP_Parab jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_9(long jarg1, GP_Parab jarg1_, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_10(long jarg1, GP_Parab jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_11(long jarg1, GP_Parab jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native boolean BRepBuilderAPI_MakeEdge_isDone(long jarg1, BRepBuilderAPI_MakeEdge jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_12(long jarg1, GP_Lin jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_13(long jarg1, GP_Lin jarg1_, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_14(long jarg1, GP_Lin jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_15(long jarg1, GP_Lin jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_16(long jarg1, GP_Elips jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_17(long jarg1, GP_Elips jarg1_, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_18(long jarg1, GP_Elips jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_19(long jarg1, GP_Elips jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_20(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_21(long jarg1, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_22(long jarg1, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_23(long jarg1, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_24(long jarg1, Geom_Curve jarg1_, double jarg2, double jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_25(long jarg1, Geom_Curve jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_26(long jarg1, Geom_Curve jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_27(long jarg1, Geom_Curve jarg1_, double[] jarg2, double[] jarg3, double jarg4, double jarg5);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_28(long jarg1, Geom_Curve jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_, double jarg4, double jarg5);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_29(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_30(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_31(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double[] jarg3, double[] jarg4);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_32(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, long jarg3, TopoDS_Vertex jarg3_, long jarg4, TopoDS_Vertex jarg4_);\r
- public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_33(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double[] jarg3, double[] jarg4, double jarg5, double jarg6);\r
- public final static native void delete_BRepBuilderAPI_MakeEdge(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeFace__SWIG_0(long jarg1, TopoDS_Wire jarg1_, boolean jarg2);\r
- public final static native long new_BRepBuilderAPI_MakeFace__SWIG_1(long jarg1, TopoDS_Wire jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeFace__SWIG_2(long jarg1, TopoDS_Face jarg1_, long jarg2, TopoDS_Wire jarg2_);\r
- public final static native boolean BRepBuilderAPI_MakeFace_isDone(long jarg1, BRepBuilderAPI_MakeFace jarg1_);\r
- public final static native long BRepBuilderAPI_MakeFace_error(long jarg1, BRepBuilderAPI_MakeFace jarg1_);\r
- public final static native void delete_BRepBuilderAPI_MakeFace(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_0();\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_1(long jarg1, TopoDS_CompSolid jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_2(long jarg1, TopoDS_Shell jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_3(long jarg1, TopoDS_Shell jarg1_, long jarg2, TopoDS_Shell jarg2_);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_4(long jarg1, TopoDS_Shell jarg1_, long jarg2, TopoDS_Shell jarg2_, long jarg3, TopoDS_Shell jarg3_);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_5(long jarg1, TopoDS_Solid jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_6(long jarg1, TopoDS_Solid jarg1_, long jarg2, TopoDS_Shell jarg2_);\r
- public final static native void BRepBuilderAPI_MakeSolid_add(long jarg1, BRepBuilderAPI_MakeSolid jarg1_, long jarg2, TopoDS_Shell jarg2_);\r
- public final static native boolean BRepBuilderAPI_MakeSolid_isDone(long jarg1, BRepBuilderAPI_MakeSolid jarg1_);\r
- public final static native boolean BRepBuilderAPI_MakeSolid_isDeleted(long jarg1, BRepBuilderAPI_MakeSolid jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepBuilderAPI_MakeSolid(long jarg1);\r
- public final static native long new_BRepBuilderAPI_Sewing__SWIG_0(double jarg1, boolean jarg2, boolean jarg3, boolean jarg4);\r
- public final static native long new_BRepBuilderAPI_Sewing__SWIG_1(double jarg1, boolean jarg2, boolean jarg3);\r
- public final static native long new_BRepBuilderAPI_Sewing__SWIG_2(double jarg1, boolean jarg2);\r
- public final static native long new_BRepBuilderAPI_Sewing__SWIG_3(double jarg1);\r
- public final static native long new_BRepBuilderAPI_Sewing__SWIG_4();\r
- public final static native void BRepBuilderAPI_Sewing_init__SWIG_0(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3, boolean jarg4, boolean jarg5);\r
- public final static native void BRepBuilderAPI_Sewing_init__SWIG_1(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3, boolean jarg4);\r
- public final static native void BRepBuilderAPI_Sewing_init__SWIG_2(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3);\r
- public final static native void BRepBuilderAPI_Sewing_init__SWIG_3(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2);\r
- public final static native void BRepBuilderAPI_Sewing_load(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void BRepBuilderAPI_Sewing_add(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void BRepBuilderAPI_Sewing_perform(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native long BRepBuilderAPI_Sewing_sewedShape(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native int BRepBuilderAPI_Sewing_nbFreeEdges(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native long BRepBuilderAPI_Sewing_freeEdge(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);\r
- public final static native int BRepBuilderAPI_Sewing_nbMultipleEdges(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native long BRepBuilderAPI_Sewing_multipleEdge(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);\r
- public final static native int BRepBuilderAPI_Sewing_nbDegeneratedShapes(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native long BRepBuilderAPI_Sewing_degeneratedShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);\r
- public final static native int BRepBuilderAPI_Sewing_nbDeletedFaces(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native long BRepBuilderAPI_Sewing_deletedFace(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);\r
- public final static native boolean BRepBuilderAPI_Sewing_isDegenerated(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepBuilderAPI_Sewing_isModified(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long BRepBuilderAPI_Sewing_modified(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void BRepBuilderAPI_Sewing_dump(long jarg1, BRepBuilderAPI_Sewing jarg1_);\r
- public final static native boolean BRepBuilderAPI_Sewing_isModifiedSubShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long BRepBuilderAPI_Sewing_modifiedSubShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepBuilderAPI_Sewing(long jarg1);\r
- public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_0();\r
- public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);\r
- public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_2(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void BRepBuilderAPI_NurbsConvert_perform__SWIG_0(long jarg1, BRepBuilderAPI_NurbsConvert jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);\r
- public final static native void BRepBuilderAPI_NurbsConvert_perform__SWIG_1(long jarg1, BRepBuilderAPI_NurbsConvert jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepBuilderAPI_NurbsConvert(long jarg1);\r
- public final static native long new_BRepBuilderAPI_MakeShell__SWIG_0();\r
- public final static native long new_BRepBuilderAPI_MakeShell__SWIG_1(long jarg1, Geom_Surface jarg1_, boolean jarg2);\r
- public final static native long new_BRepBuilderAPI_MakeShell__SWIG_2(long jarg1, Geom_Surface jarg1_);\r
- public final static native long new_BRepBuilderAPI_MakeShell__SWIG_3(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3, double jarg4, double jarg5, boolean jarg6);\r
- public final static native long new_BRepBuilderAPI_MakeShell__SWIG_4(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3, double jarg4, double jarg5);\r
- public final static native void BRepBuilderAPI_MakeShell_init__SWIG_0(long jarg1, BRepBuilderAPI_MakeShell jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4, double jarg5, double jarg6, boolean jarg7);\r
- public final static native void BRepBuilderAPI_MakeShell_init__SWIG_1(long jarg1, BRepBuilderAPI_MakeShell jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4, double jarg5, double jarg6);\r
- public final static native boolean BRepBuilderAPI_MakeShell_isDone(long jarg1, BRepBuilderAPI_MakeShell jarg1_);\r
- public final static native long BRepBuilderAPI_MakeShell_error(long jarg1, BRepBuilderAPI_MakeShell jarg1_);\r
- public final static native long BRepBuilderAPI_MakeShell_Shell(long jarg1, BRepBuilderAPI_MakeShell jarg1_);\r
- public final static native void delete_BRepBuilderAPI_MakeShell(long jarg1);\r
- public final static native long new_BRepOffsetAPI_NormalProjection__SWIG_0();\r
- public final static native long new_BRepOffsetAPI_NormalProjection__SWIG_1(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void BRepOffsetAPI_NormalProjection_init(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void BRepOffsetAPI_NormalProjection_add(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void BRepOffsetAPI_NormalProjection_setParams(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, double jarg2, double jarg3, int jarg4, int jarg5, int jarg6);\r
- public final static native void BRepOffsetAPI_NormalProjection_setMaxDistance(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, double jarg2);\r
- public final static native void BRepOffsetAPI_NormalProjection_setLimit__SWIG_0(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, boolean jarg2);\r
- public final static native void BRepOffsetAPI_NormalProjection_setLimit__SWIG_1(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);\r
- public final static native void BRepOffsetAPI_NormalProjection_compute3d__SWIG_0(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, boolean jarg2);\r
- public final static native void BRepOffsetAPI_NormalProjection_compute3d__SWIG_1(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);\r
- public final static native void BRepOffsetAPI_NormalProjection_build(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);\r
- public final static native boolean BRepOffsetAPI_NormalProjection_isDone(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);\r
- public final static native long BRepOffsetAPI_NormalProjection_projection(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);\r
- public final static native long BRepOffsetAPI_NormalProjection_couple(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native long[] BRepOffsetAPI_NormalProjection_generated(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long BRepOffsetAPI_NormalProjection_ancestor(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Edge jarg2_);\r
- public final static native boolean BRepOffsetAPI_NormalProjection_buildWire(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2);\r
- public final static native void delete_BRepOffsetAPI_NormalProjection(long jarg1);\r
- public final static native long new_BRepOffsetAPI_ThruSections__SWIG_0(boolean jarg1, boolean jarg2, double jarg3);\r
- public final static native long new_BRepOffsetAPI_ThruSections__SWIG_1(boolean jarg1, boolean jarg2);\r
- public final static native long new_BRepOffsetAPI_ThruSections__SWIG_2(boolean jarg1);\r
- public final static native long new_BRepOffsetAPI_ThruSections__SWIG_3();\r
- public final static native void BRepOffsetAPI_ThruSections_init__SWIG_0(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2, boolean jarg3, double jarg4);\r
- public final static native void BRepOffsetAPI_ThruSections_init__SWIG_1(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2, boolean jarg3);\r
- public final static native void BRepOffsetAPI_ThruSections_init__SWIG_2(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2);\r
- public final static native void BRepOffsetAPI_ThruSections_init__SWIG_3(long jarg1, BRepOffsetAPI_ThruSections jarg1_);\r
- public final static native void BRepOffsetAPI_ThruSections_addWire(long jarg1, BRepOffsetAPI_ThruSections jarg1_, long jarg2, TopoDS_Wire jarg2_);\r
- public final static native void BRepOffsetAPI_ThruSections_addVertex(long jarg1, BRepOffsetAPI_ThruSections jarg1_, long jarg2, TopoDS_Vertex jarg2_);\r
- public final static native void BRepOffsetAPI_ThruSections_build(long jarg1, BRepOffsetAPI_ThruSections jarg1_);\r
- public final static native void delete_BRepOffsetAPI_ThruSections(long jarg1);\r
- public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6, boolean jarg7, long jarg8);\r
- public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6, boolean jarg7);\r
- public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6);\r
- public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5);\r
- public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_4(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4);\r
- public final static native void delete_BRepOffsetAPI_MakeThickSolid(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeBox(double[] jarg1, double[] jarg2);\r
- public final static native void delete_BRepPrimAPI_MakeBox(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeCone(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);\r
- public final static native void delete_BRepPrimAPI_MakeCone(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeCylinder(double[] jarg1, double jarg2, double jarg3, double jarg4);\r
- public final static native void delete_BRepPrimAPI_MakeCylinder(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeTorus__SWIG_0(double[] jarg1, double jarg2, double jarg3);\r
- public final static native long new_BRepPrimAPI_MakeTorus__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6);\r
- public final static native void delete_BRepPrimAPI_MakeTorus(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeSphere__SWIG_0(double[] jarg1, double jarg2);\r
- public final static native long new_BRepPrimAPI_MakeSphere__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);\r
- public final static native void delete_BRepPrimAPI_MakeSphere(long jarg1);\r
- public final static native void delete_BRepPrimAPI_MakeSweep(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakePrism__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3, boolean jarg4);\r
- public final static native long new_BRepPrimAPI_MakePrism__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3);\r
- public final static native long new_BRepPrimAPI_MakePrism__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double[] jarg2);\r
- public final static native void delete_BRepPrimAPI_MakePrism(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeRevol__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, double jarg3, boolean jarg4);\r
- public final static native long new_BRepPrimAPI_MakeRevol__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, double jarg3);\r
- public final static native long new_BRepPrimAPI_MakeRevol__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3);\r
- public final static native long new_BRepPrimAPI_MakeRevol__SWIG_3(long jarg1, TopoDS_Shape jarg1_, double[] jarg2);\r
- public final static native void delete_BRepPrimAPI_MakeRevol(long jarg1);\r
- public final static native long new_BRepOffsetAPI_MakePipe(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepOffsetAPI_MakePipe(long jarg1);\r
- public final static native long new_BRepPrimAPI_MakeWedge__SWIG_0(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6, double jarg7, double jarg8);\r
- public final static native long new_BRepPrimAPI_MakeWedge__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);\r
- public final static native void delete_BRepPrimAPI_MakeWedge(long jarg1);\r
- public final static native long[] BRepAlgoAPI_BooleanOperation_modified(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepAlgoAPI_BooleanOperation_isDeleted(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long[] BRepAlgoAPI_BooleanOperation_modified2(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long[] BRepAlgoAPI_BooleanOperation_generated(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepAlgoAPI_BooleanOperation_hasModified(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);\r
- public final static native boolean BRepAlgoAPI_BooleanOperation_hasGenerated(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);\r
- public final static native boolean BRepAlgoAPI_BooleanOperation_hasDeleted(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);\r
- public final static native void delete_BRepAlgoAPI_BooleanOperation(long jarg1);\r
- public final static native long new_BRepAlgoAPI_Fuse(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepAlgoAPI_Fuse(long jarg1);\r
- public final static native long new_BRepAlgoAPI_Common(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepAlgoAPI_Common(long jarg1);\r
- public final static native long new_BRepAlgoAPI_Cut(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepAlgoAPI_Cut(long jarg1);\r
- public final static native long new_BRepAlgoAPI_Section(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_BRepAlgoAPI_Section(long jarg1);\r
- public final static native long new_Poly_Triangulation(int jarg1, int jarg2, boolean jarg3);\r
- public final static native double Poly_Triangulation_deflection__SWIG_0(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native void Poly_Triangulation_deflection__SWIG_1(long jarg1, Poly_Triangulation jarg1_, double jarg2);\r
- public final static native void Poly_Triangulation_removeUVNodes(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native int Poly_Triangulation_nbNodes(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native int Poly_Triangulation_nbTriangles(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native boolean Poly_Triangulation_hasUVNodes(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native int[] Poly_Triangulation_triangles(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native double[] Poly_Triangulation_nodes(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native double[] Poly_Triangulation_uvNodes(long jarg1, Poly_Triangulation jarg1_);\r
- public final static native void delete_Poly_Triangulation(long jarg1);\r
- public final static native void delete_Geom_Geometry(long jarg1);\r
- public final static native double Geom_Curve_firstParameter(long jarg1, Geom_Curve jarg1_);\r
- public final static native double Geom_Curve_lastParameter(long jarg1, Geom_Curve jarg1_);\r
- public final static native boolean Geom_Curve_isClosed(long jarg1, Geom_Curve jarg1_);\r
- public final static native boolean Geom_Curve_isPeriodic(long jarg1, Geom_Curve jarg1_);\r
- public final static native double Geom_Curve_period(long jarg1, Geom_Curve jarg1_);\r
- public final static native void delete_Geom_Curve(long jarg1);\r
- public final static native double[] Geom_Surface_value(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3);\r
- public final static native void Geom_Surface_bounds__SWIG_0(long jarg1, Geom_Surface jarg1_, double[] jarg2);\r
- public final static native void Geom_Surface_bounds__SWIG_1(long jarg1, Geom_Surface jarg1_, double[] jarg2, double[] jarg3, double[] jarg4, double[] jarg5);\r
- public final static native boolean Geom_Surface_isUClosed(long jarg1, Geom_Surface jarg1_);\r
- public final static native boolean Geom_Surface_isVClosed(long jarg1, Geom_Surface jarg1_);\r
- public final static native long Geom_Surface_uIso(long jarg1, Geom_Surface jarg1_, double jarg2);\r
- public final static native long Geom_Surface_vIso(long jarg1, Geom_Surface jarg1_, double jarg2);\r
- public final static native void delete_Geom_Surface(long jarg1);\r
- public final static native void delete_Geom2d_Geometry(long jarg1);\r
- public final static native void delete_Geom2d_Curve(long jarg1);\r
- public final static native void delete_Geom_BoundedCurve(long jarg1);\r
- public final static native long new_Geom_BSplineCurve__SWIG_0(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5, boolean jarg6, boolean jarg7);\r
- public final static native long new_Geom_BSplineCurve__SWIG_1(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5, boolean jarg6);\r
- public final static native long new_Geom_BSplineCurve__SWIG_2(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5);\r
- public final static native void Geom_BSplineCurve_setKnot__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double jarg3);\r
- public final static native void Geom_BSplineCurve_setKnot__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double jarg3, int jarg4);\r
- public final static native void Geom_BSplineCurve_setPeriodic(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native void Geom_BSplineCurve_setNotPeriodic(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native void Geom_BSplineCurve_setOrigin__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);\r
- public final static native void Geom_BSplineCurve_setOrigin__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double jarg3);\r
- public final static native void Geom_BSplineCurve_setPole__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double[] jarg3);\r
- public final static native void Geom_BSplineCurve_setPole__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double[] jarg3, double jarg4);\r
- public final static native void Geom_BSplineCurve_movePoint(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double[] jarg3, int jarg4, int jarg5, long jarg6, long jarg7);\r
- public final static native void Geom_BSplineCurve_movePointAndTangent(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double[] jarg3, double[] jarg4, double jarg5, int jarg6, int jarg7);\r
- public final static native boolean Geom_BSplineCurve_isClosed(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native boolean Geom_BSplineCurve_isPeriodic(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native boolean Geom_BSplineCurve_isRational(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native int Geom_BSplineCurve_continuity(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native int Geom_BSplineCurve_Degree(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native double[] Geom_BSplineCurve_localValue(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, int jarg3, int jarg4);\r
- public final static native double[] Geom_BSplineCurve_endPoint(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native double[] Geom_BSplineCurve_startPoint(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native int Geom_BSplineCurve_nbKnots(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native int Geom_BSplineCurve_nbPoles(long jarg1, Geom_BSplineCurve jarg1_);\r
- public final static native double[] Geom_BSplineCurve_pole(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);\r
- public final static native double Geom_BSplineCurve_weight(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);\r
- public final static native void delete_Geom_BSplineCurve(long jarg1);\r
- public final static native void delete_Geom_TrimmedCurve(long jarg1);\r
- public final static native void BRepLib_encodeRegularity__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double jarg2);\r
- public final static native void BRepLib_encodeRegularity__SWIG_1(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native long new_BRepLib();\r
- public final static native void delete_BRepLib(long jarg1);\r
- public final static native void delete_BRepFilletAPI_LocalOperation(long jarg1);\r
- public final static native long new_BRepFilletAPI_MakeFillet__SWIG_0(long jarg1, TopoDS_Shape jarg1_, int jarg2);\r
- public final static native long new_BRepFilletAPI_MakeFillet__SWIG_1(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void BRepFilletAPI_MakeFillet_add(long jarg1, BRepFilletAPI_MakeFillet jarg1_, double jarg2, long jarg3, TopoDS_Edge jarg3_);\r
- public final static native void delete_BRepFilletAPI_MakeFillet(long jarg1);\r
- public final static native long new_BRepFilletAPI_MakeChamfer(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void BRepFilletAPI_MakeChamfer_add(long jarg1, BRepFilletAPI_MakeChamfer jarg1_, double jarg2, long jarg3, TopoDS_Edge jarg3_, long jarg4, TopoDS_Face jarg4_);\r
- public final static native void delete_BRepFilletAPI_MakeChamfer(long jarg1);\r
- public final static native long new_BRepCheck_Analyzer__SWIG_0(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);\r
- public final static native long new_BRepCheck_Analyzer__SWIG_1(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void BRepCheck_Analyzer_init__SWIG_0(long jarg1, BRepCheck_Analyzer jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);\r
- public final static native void BRepCheck_Analyzer_init__SWIG_1(long jarg1, BRepCheck_Analyzer jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepCheck_Analyzer_isValid(long jarg1, BRepCheck_Analyzer jarg1_);\r
- public final static native void delete_BRepCheck_Analyzer(long jarg1);\r
- public final static native long new_ShapeBuild_ReShape();\r
- public final static native void ShapeBuild_ReShape_replace__SWIG_0(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_, boolean jarg4);\r
- public final static native void ShapeBuild_ReShape_replace__SWIG_1(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);\r
- public final static native long ShapeBuild_ReShape_apply__SWIG_0(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);\r
- public final static native long ShapeBuild_ReShape_apply__SWIG_1(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_ShapeBuild_ReShape(long jarg1);\r
- public final static native int XSControl_Reader_readFile__SWIG_0(long jarg1, XSControl_Reader jarg1_, String jarg2);\r
- public final static native int XSControl_Reader_transferRoots(long jarg1, XSControl_Reader jarg1_);\r
- public final static native void XSControl_Reader_clearShapes(long jarg1, XSControl_Reader jarg1_);\r
- public final static native int XSControl_Reader_nbRootsForTransfer(long jarg1, XSControl_Reader jarg1_);\r
- public final static native long XSControl_Reader_oneShape(long jarg1, XSControl_Reader jarg1_);\r
- public final static native int XSControl_Reader_readFile__SWIG_1(long jarg1, XSControl_Reader jarg1_, byte[] jarg2);\r
- public final static native boolean XSControl_Reader_setReadUnitM(long jarg1, XSControl_Reader jarg1_);\r
- public final static native boolean XSControl_Reader_setReadUnitMM(long jarg1, XSControl_Reader jarg1_);\r
- public final static native void delete_XSControl_Reader(long jarg1);\r
- public final static native long new_STEPControl_Reader();\r
- public final static native String STEPControl_Reader_getLabel(long jarg1, STEPControl_Reader jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void delete_STEPControl_Reader(long jarg1);\r
- public final static native long new_IGESControl_Reader();\r
- public final static native String IGESControl_Reader_getLabel(long jarg1, IGESControl_Reader jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native long IGESControl_Reader_getShape(long jarg1, IGESControl_Reader jarg1_, String jarg2);\r
- public final static native void IGESControl_Reader_dumpLabels(long jarg1, IGESControl_Reader jarg1_);\r
- public final static native void delete_IGESControl_Reader(long jarg1);\r
- public final static native long new_STEPControl_Writer();\r
- public final static native int STEPControl_Writer_write(long jarg1, STEPControl_Writer jarg1_, String jarg2);\r
- public final static native int STEPControl_Writer_transfer(long jarg1, STEPControl_Writer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);\r
- public final static native long STEPControl_Writer_model(long jarg1, STEPControl_Writer jarg1_, boolean jarg2);\r
- public final static native void delete_STEPControl_Writer(long jarg1);\r
- public final static native long new_IGESControl_Writer__SWIG_0();\r
- public final static native long new_IGESControl_Writer__SWIG_1(String jarg1, int jarg2);\r
- public final static native long new_IGESControl_Writer__SWIG_2(String jarg1);\r
- public final static native boolean IGESControl_Writer_write(long jarg1, IGESControl_Writer jarg1_, String jarg2);\r
- public final static native boolean IGESControl_Writer_addShape(long jarg1, IGESControl_Writer jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native void IGESControl_Writer_computeModel(long jarg1, IGESControl_Writer jarg1_);\r
- public final static native void delete_IGESControl_Writer(long jarg1);\r
- public final static native long new_IGESControl_Controller();\r
- public final static native void IGESControl_Controller_init(long jarg1, IGESControl_Controller jarg1_);\r
- public final static native void delete_IGESControl_Controller(long jarg1);\r
- public final static native void ShapeFix_Root_setPrecision(long jarg1, ShapeFix_Root jarg1_, double jarg2);\r
- public final static native double ShapeFix_Root_getPrecision(long jarg1, ShapeFix_Root jarg1_);\r
- public final static native void ShapeFix_Root_setContext(long jarg1, ShapeFix_Root jarg1_, long jarg2, ShapeBuild_ReShape jarg2_);\r
- public final static native long ShapeFix_Root_getContext(long jarg1, ShapeFix_Root jarg1_);\r
- public final static native void delete_ShapeFix_Root(long jarg1);\r
- public final static native long new_ShapeFix_Wireframe(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native boolean ShapeFix_Wireframe_fixWireGaps(long jarg1, ShapeFix_Wireframe jarg1_);\r
- public final static native boolean ShapeFix_Wireframe_fixSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_);\r
- public final static native void ShapeFix_Wireframe_setLimitAngle(long jarg1, ShapeFix_Wireframe jarg1_, double jarg2);\r
- public final static native double ShapeFix_Wireframe_getLimitAngle(long jarg1, ShapeFix_Wireframe jarg1_);\r
- public final static native long ShapeFix_Wireframe_shape(long jarg1, ShapeFix_Wireframe jarg1_);\r
- public final static native void ShapeFix_Wireframe_setDropSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_, boolean jarg2);\r
- public final static native boolean ShapeFix_Wireframe_getDropSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_);\r
- public final static native void delete_ShapeFix_Wireframe(long jarg1);\r
- public final static native long new_APIHeaderSection_MakeHeader(long jarg1);\r
- public final static native void APIHeaderSection_MakeHeader_setName(long jarg1, APIHeaderSection_MakeHeader jarg1_, long jarg2);\r
- public final static native void APIHeaderSection_MakeHeader_setAuthorValue(long jarg1, APIHeaderSection_MakeHeader jarg1_, int jarg2, long jarg3);\r
- public final static native void APIHeaderSection_MakeHeader_setOrganizationValue(long jarg1, APIHeaderSection_MakeHeader jarg1_, int jarg2, long jarg3);\r
- public final static native void APIHeaderSection_MakeHeader_setOriginatingSystem(long jarg1, APIHeaderSection_MakeHeader jarg1_, long jarg2);\r
- public final static native void APIHeaderSection_MakeHeader_setDescriptionValue(long jarg1, APIHeaderSection_MakeHeader jarg1_, int jarg2, long jarg3);\r
- public final static native void delete_APIHeaderSection_MakeHeader(long jarg1);\r
- public final static native void delete_ShapeUpgrade_Tool(long jarg1);\r
- public final static native long new_ShapeUpgrade_RemoveInternalWires(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native boolean ShapeUpgrade_RemoveInternalWires_perform(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);\r
- public final static native long ShapeUpgrade_RemoveInternalWires_getResult(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);\r
- public final static native void ShapeUpgrade_RemoveInternalWires_setMinArea(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_, double jarg2);\r
- public final static native double ShapeUpgrade_RemoveInternalWires_getMinArea(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);\r
- public final static native void ShapeUpgrade_RemoveInternalWires_setRemoveFaceMode(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_, boolean jarg2);\r
- public final static native boolean ShapeUpgrade_RemoveInternalWires_getRemoveFaceMode(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);\r
- public final static native void delete_ShapeUpgrade_RemoveInternalWires(long jarg1);\r
- public final static native long ShapeUpgrade_ShapeDivide_getResult(long jarg1, ShapeUpgrade_ShapeDivide jarg1_);\r
- public final static native boolean ShapeUpgrade_ShapeDivide_perform__SWIG_0(long jarg1, ShapeUpgrade_ShapeDivide jarg1_, boolean jarg2);\r
- public final static native boolean ShapeUpgrade_ShapeDivide_perform__SWIG_1(long jarg1, ShapeUpgrade_ShapeDivide jarg1_);\r
- public final static native long new_ShapeUpgrade_ShapeDivide();\r
- public final static native void delete_ShapeUpgrade_ShapeDivide(long jarg1);\r
- public final static native long new_ShapeUpgrade_ShapeDivideArea(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native void ShapeUpgrade_ShapeDivideArea_setMaxArea(long jarg1, ShapeUpgrade_ShapeDivideArea jarg1_, double jarg2);\r
- public final static native double ShapeUpgrade_ShapeDivideArea_getMaxArea(long jarg1, ShapeUpgrade_ShapeDivideArea jarg1_);\r
- public final static native void delete_ShapeUpgrade_ShapeDivideArea(long jarg1);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_0();\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_1(double[] jarg1, int jarg2, int jarg3, int jarg4, double jarg5);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_2(double[] jarg1, int jarg2, int jarg3, int jarg4);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_3(double[] jarg1, int jarg2, int jarg3);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_4(double[] jarg1, int jarg2);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_5(double[] jarg1);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_6(double[] jarg1, double[] jarg2, int jarg3, int jarg4, int jarg5, double jarg6);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_7(double[] jarg1, double[] jarg2, int jarg3, int jarg4, int jarg5);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_8(double[] jarg1, double[] jarg2, int jarg3, int jarg4);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_9(double[] jarg1, double[] jarg2, int jarg3);\r
- public final static native long new_GeomAPI_PointsToBSpline__SWIG_10(double[] jarg1, double[] jarg2);\r
- public final static native long GeomAPI_PointsToBSpline_Curve(long jarg1, GeomAPI_PointsToBSpline jarg1_);\r
- public final static native void delete_GeomAPI_PointsToBSpline(long jarg1);\r
- public final static native long new_GeomAPI_Interpolate(double[] jarg1, boolean jarg2, double jarg3);\r
- public final static native void GeomAPI_Interpolate_Load__SWIG_0(long jarg1, GeomAPI_Interpolate jarg1_, double[] jarg2, boolean[] jarg3, boolean jarg4);\r
- public final static native void GeomAPI_Interpolate_Load__SWIG_1(long jarg1, GeomAPI_Interpolate jarg1_, double[] jarg2, boolean[] jarg3);\r
- public final static native void GeomAPI_Interpolate_Perform(long jarg1, GeomAPI_Interpolate jarg1_);\r
- public final static native long GeomAPI_Interpolate_Curve(long jarg1, GeomAPI_Interpolate jarg1_);\r
- public final static native void delete_GeomAPI_Interpolate(long jarg1);\r
- public final static native boolean GC_Root_isDone(long jarg1, GC_Root jarg1_);\r
- public final static native long new_GC_Root();\r
- public final static native void delete_GC_Root(long jarg1);\r
- public final static native long new_GC_MakeArcOfCircle__SWIG_0(double[] jarg1, double[] jarg2, double[] jarg3);\r
- public final static native long new_GC_MakeArcOfCircle__SWIG_1(long jarg1, GP_Circ jarg1_, double[] jarg2, double[] jarg3, boolean jarg4);\r
- public final static native long GC_MakeArcOfCircle_value(long jarg1, GC_MakeArcOfCircle jarg1_);\r
- public final static native long new_GC_MakeArcOfCircle__SWIG_2(long jarg1, GP_Circ jarg1_, double jarg2, double jarg3, boolean jarg4);\r
- public final static native long new_GC_MakeArcOfCircle__SWIG_3(long jarg1, GP_Circ jarg1_, double[] jarg2, double jarg3, boolean jarg4);\r
- public final static native void delete_GC_MakeArcOfCircle(long jarg1);\r
- public final static native long new_GC_MakeSegment__SWIG_0(double[] jarg1, double[] jarg2);\r
- public final static native long new_GC_MakeSegment__SWIG_1(long jarg1, GP_Lin jarg1_, double jarg2, double jarg3);\r
- public final static native long new_GC_MakeSegment__SWIG_2(long jarg1, GP_Lin jarg1_, double[] jarg2, double jarg3);\r
- public final static native long new_GC_MakeSegment__SWIG_3(long jarg1, GP_Lin jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native long GC_MakeSegment_value(long jarg1, GC_MakeSegment jarg1_);\r
- public final static native void delete_GC_MakeSegment(long jarg1);\r
- public final static native long new_GC_MakeArcOfEllipse__SWIG_0(long jarg1, GP_Elips jarg1_, double jarg2, double jarg3, boolean jarg4);\r
- public final static native long new_GC_MakeArcOfEllipse__SWIG_1(long jarg1, GP_Elips jarg1_, double[] jarg2, double jarg3, boolean jarg4);\r
- public final static native long new_GC_MakeArcOfEllipse__SWIG_2(long jarg1, GP_Elips jarg1_, double[] jarg2, double[] jarg3, boolean jarg4);\r
- public final static native long GC_MakeArcOfEllipse_value(long jarg1, GC_MakeArcOfEllipse jarg1_);\r
- public final static native void delete_GC_MakeArcOfEllipse(long jarg1);\r
- public final static native boolean TopLoc_Location_isIdentity(long jarg1, TopLoc_Location jarg1_);\r
- public final static native long TopLoc_Location_transformation(long jarg1, TopLoc_Location jarg1_);\r
- public final static native long new_TopLoc_Location();\r
- public final static native void delete_TopLoc_Location(long jarg1);\r
- public final static native void TopExp_vertices__SWIG_0(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_, boolean jarg4);\r
- public final static native void TopExp_vertices__SWIG_1(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);\r
- public final static native long new_TopExp();\r
- public final static native void delete_TopExp(long jarg1);\r
- public final static native long new_TopExp_Explorer__SWIG_0();\r
- public final static native long new_TopExp_Explorer__SWIG_1(long jarg1, TopoDS_Shape jarg1_, int jarg2, int jarg3);\r
- public final static native long new_TopExp_Explorer__SWIG_2(long jarg1, TopoDS_Shape jarg1_, int jarg2);\r
- public final static native void TopExp_Explorer_init__SWIG_0(long jarg1, TopExp_Explorer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3, int jarg4);\r
- public final static native void TopExp_Explorer_init__SWIG_1(long jarg1, TopExp_Explorer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);\r
- public final static native boolean TopExp_Explorer_more(long jarg1, TopExp_Explorer jarg1_);\r
- public final static native void TopExp_Explorer_next(long jarg1, TopExp_Explorer jarg1_);\r
- public final static native long TopExp_Explorer_current(long jarg1, TopExp_Explorer jarg1_);\r
- public final static native void delete_TopExp_Explorer(long jarg1);\r
- public final static native long new_Bnd_Box();\r
- public final static native boolean Bnd_Box_isVoid(long jarg1, Bnd_Box jarg1_);\r
- public final static native void Bnd_Box_get(long jarg1, Bnd_Box jarg1_, double[] jarg2);\r
- public final static native void delete_Bnd_Box(long jarg1);\r
- public final static native void BRepBndLib_add(long jarg1, TopoDS_Shape jarg1_, long jarg2, Bnd_Box jarg2_);\r
- public final static native long new_BRepBndLib();\r
- public final static native void delete_BRepBndLib(long jarg1);\r
- public final static native double[] Adaptor2d_Curve2d_value(long jarg1, Adaptor2d_Curve2d jarg1_, double jarg2);\r
- public final static native void delete_Adaptor2d_Curve2d(long jarg1);\r
- public final static native long new_Geom2dAdaptor_Curve__SWIG_0();\r
- public final static native long new_Geom2dAdaptor_Curve__SWIG_1(long jarg1, Geom2d_Curve jarg1_);\r
- public final static native long new_Geom2dAdaptor_Curve__SWIG_2(long jarg1, Geom2d_Curve jarg1_, double jarg2, double jarg3);\r
- public final static native void Geom2dAdaptor_Curve_load__SWIG_0(long jarg1, Geom2dAdaptor_Curve jarg1_, long jarg2, Geom2d_Curve jarg2_);\r
- public final static native void Geom2dAdaptor_Curve_load__SWIG_1(long jarg1, Geom2dAdaptor_Curve jarg1_, long jarg2, Geom2d_Curve jarg2_, double jarg3, double jarg4);\r
- public final static native void delete_Geom2dAdaptor_Curve(long jarg1);\r
- public final static native double[] Adaptor3d_Curve_value(long jarg1, Adaptor3d_Curve jarg1_, double jarg2);\r
- public final static native void Adaptor3d_Curve_arrayValues(long jarg1, Adaptor3d_Curve jarg1_, int jarg2, double[] jarg3);\r
- public final static native void delete_Adaptor3d_Curve(long jarg1);\r
- public final static native long new_GeomAdaptor_Curve__SWIG_0();\r
- public final static native long new_GeomAdaptor_Curve__SWIG_1(long jarg1, Geom_Curve jarg1_);\r
- public final static native long new_GeomAdaptor_Curve__SWIG_2(long jarg1, Geom_Curve jarg1_, double jarg2, double jarg3);\r
- public final static native void GeomAdaptor_Curve_load__SWIG_0(long jarg1, GeomAdaptor_Curve jarg1_, long jarg2, Geom_Curve jarg2_);\r
- public final static native void GeomAdaptor_Curve_load__SWIG_1(long jarg1, GeomAdaptor_Curve jarg1_, long jarg2, Geom_Curve jarg2_, double jarg3, double jarg4);\r
- public final static native void delete_GeomAdaptor_Curve(long jarg1);\r
- public final static native long new_GProp_GProps();\r
- public final static native double GProp_GProps_mass(long jarg1, GProp_GProps jarg1_);\r
- public final static native double[] GProp_GProps_centreOfMass(long jarg1, GProp_GProps jarg1_);\r
- public final static native double[] GProp_GProps_matrixOfInertia(long jarg1, GProp_GProps jarg1_);\r
- public final static native void delete_GProp_GProps(long jarg1);\r
- public final static native long new_GProp_PGProps();\r
- public final static native void delete_GProp_PGProps(long jarg1);\r
- public final static native long new_GProp_CelGProps();\r
- public final static native void delete_GProp_CelGProps(long jarg1);\r
- public final static native long new_GProp_SelGProps();\r
- public final static native void delete_GProp_SelGProps(long jarg1);\r
- public final static native long new_GProp_VelGProps();\r
- public final static native void delete_GProp_VelGProps(long jarg1);\r
- public final static native void BRepGProp_linearProperties(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);\r
- public final static native void BRepGProp_volumeProperties__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, boolean jarg3);\r
- public final static native void BRepGProp_volumeProperties__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);\r
- public final static native double BRepGProp_volumeProperties__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4);\r
- public final static native double BRepGProp_volumeProperties__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);\r
- public final static native void BRepGProp_surfaceProperties__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);\r
- public final static native double BRepGProp_surfaceProperties__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);\r
- public final static native double BRepGProp_volumePropertiesGK__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5, boolean jarg6, boolean jarg7);\r
- public final static native double BRepGProp_volumePropertiesGK__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5, boolean jarg6);\r
- public final static native double BRepGProp_volumePropertiesGK__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5);\r
- public final static native double BRepGProp_volumePropertiesGK__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4);\r
- public final static native double BRepGProp_volumePropertiesGK__SWIG_4(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);\r
- public final static native long new_BRepGProp();\r
- public final static native void delete_BRepGProp(long jarg1);\r
- public final static native long new_ShapeAnalysis_FreeBounds__SWIG_0(long jarg1, TopoDS_Shape jarg1_, boolean jarg2, boolean jarg3);\r
- public final static native long new_ShapeAnalysis_FreeBounds__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);\r
- public final static native long new_ShapeAnalysis_FreeBounds__SWIG_2(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native long ShapeAnalysis_FreeBounds_getClosedWires(long jarg1, ShapeAnalysis_FreeBounds jarg1_);\r
- public final static native long ShapeAnalysis_FreeBounds_getOpenWires(long jarg1, ShapeAnalysis_FreeBounds jarg1_);\r
- public final static native void delete_ShapeAnalysis_FreeBounds(long jarg1);\r
- public final static native long new_GCPnts_UniformDeflection();\r
- public final static native void GCPnts_UniformDeflection_initialize__SWIG_0(long jarg1, GCPnts_UniformDeflection jarg1_, long jarg2, Adaptor3d_Curve jarg2_, double jarg3, double jarg4, double jarg5, boolean jarg6);\r
- public final static native void GCPnts_UniformDeflection_initialize__SWIG_1(long jarg1, GCPnts_UniformDeflection jarg1_, long jarg2, Adaptor3d_Curve jarg2_, double jarg3, double jarg4, double jarg5);\r
- public final static native int GCPnts_UniformDeflection_nbPoints(long jarg1, GCPnts_UniformDeflection jarg1_);\r
- public final static native double GCPnts_UniformDeflection_parameter(long jarg1, GCPnts_UniformDeflection jarg1_, int jarg2);\r
- public final static native void delete_GCPnts_UniformDeflection(long jarg1);\r
- public final static native void BRepMesh_DiscretRoot_setDeflection(long jarg1, BRepMesh_DiscretRoot jarg1_, double jarg2);\r
- public final static native void BRepMesh_DiscretRoot_setAngle(long jarg1, BRepMesh_DiscretRoot jarg1_, double jarg2);\r
- public final static native double BRepMesh_DiscretRoot_deflection(long jarg1, BRepMesh_DiscretRoot jarg1_);\r
- public final static native double BRepMesh_DiscretRoot_angle(long jarg1, BRepMesh_DiscretRoot jarg1_);\r
- public final static native void BRepMesh_DiscretRoot_perform(long jarg1, BRepMesh_DiscretRoot jarg1_);\r
- public final static native void delete_BRepMesh_DiscretRoot(long jarg1);\r
- public final static native long new_BRepMesh_IncrementalMesh__SWIG_0();\r
- public final static native long new_BRepMesh_IncrementalMesh__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double jarg2, boolean jarg3, double jarg4);\r
- public final static native long new_BRepMesh_IncrementalMesh__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double jarg2, boolean jarg3);\r
- public final static native long new_BRepMesh_IncrementalMesh__SWIG_3(long jarg1, TopoDS_Shape jarg1_, double jarg2);\r
- public final static native void BRepMesh_IncrementalMesh_perform(long jarg1, BRepMesh_IncrementalMesh jarg1_);\r
- public final static native void BRepMesh_IncrementalMesh_update(long jarg1, BRepMesh_IncrementalMesh jarg1_, long jarg2, TopoDS_Shape jarg2_);\r
- public final static native boolean BRepMesh_IncrementalMesh_isModified(long jarg1, BRepMesh_IncrementalMesh jarg1_);\r
- public final static native void delete_BRepMesh_IncrementalMesh(long jarg1);\r
- public final static native long new_GeomAPI_ProjectPointOnSurf(double[] jarg1, long jarg2, Geom_Surface jarg2_);\r
- public final static native void GeomAPI_ProjectPointOnSurf_init(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, double[] jarg2, long jarg3, Geom_Surface jarg3_);\r
- public final static native int GeomAPI_ProjectPointOnSurf_nbPoints(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);\r
- public final static native double GeomAPI_ProjectPointOnSurf_lowerDistance(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);\r
- public final static native double[] GeomAPI_ProjectPointOnSurf_point(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, int jarg2);\r
- public final static native void GeomAPI_ProjectPointOnSurf_lowerDistanceParameters(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, double[] jarg2, double[] jarg3);\r
- public final static native void GeomAPI_ProjectPointOnSurf_parameters(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, int jarg2, double[] jarg3, double[] jarg4);\r
- public final static native double[] GeomAPI_ProjectPointOnSurf_nearestPoint(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);\r
- public final static native void delete_GeomAPI_ProjectPointOnSurf(long jarg1);\r
- public final static native boolean BRepAlgo_isValid(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native boolean BRepAlgo_isTopologicallyValid(long jarg1, TopoDS_Shape jarg1_);\r
- public final static native long new_BRepAlgo();\r
- public final static native void delete_BRepAlgo(long jarg1);\r
- public final static native long TopoDS_Compound_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_CompSolid_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Solid_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Shell_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Face_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Wire_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Edge_SWIGUpcast(long jarg1);\r
- public final static native long TopoDS_Vertex_SWIGUpcast(long jarg1);\r
- public final static native long BRep_Builder_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_ModifyShape_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_Transform_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeVertex_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeWire_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeEdge_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeFace_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeSolid_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_NurbsConvert_SWIGUpcast(long jarg1);\r
- public final static native long BRepBuilderAPI_MakeShell_SWIGUpcast(long jarg1);\r
- public final static native long BRepOffsetAPI_NormalProjection_SWIGUpcast(long jarg1);\r
- public final static native long BRepOffsetAPI_ThruSections_SWIGUpcast(long jarg1);\r
- public final static native long BRepOffsetAPI_MakeThickSolid_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeBox_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeCone_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeCylinder_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeTorus_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeSphere_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeSweep_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakePrism_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeRevol_SWIGUpcast(long jarg1);\r
- public final static native long BRepOffsetAPI_MakePipe_SWIGUpcast(long jarg1);\r
- public final static native long BRepPrimAPI_MakeWedge_SWIGUpcast(long jarg1);\r
- public final static native long BRepAlgoAPI_BooleanOperation_SWIGUpcast(long jarg1);\r
- public final static native long BRepAlgoAPI_Fuse_SWIGUpcast(long jarg1);\r
- public final static native long BRepAlgoAPI_Common_SWIGUpcast(long jarg1);\r
- public final static native long BRepAlgoAPI_Cut_SWIGUpcast(long jarg1);\r
- public final static native long BRepAlgoAPI_Section_SWIGUpcast(long jarg1);\r
- public final static native long Geom_Curve_SWIGUpcast(long jarg1);\r
- public final static native long Geom_Surface_SWIGUpcast(long jarg1);\r
- public final static native long Geom2d_Curve_SWIGUpcast(long jarg1);\r
- public final static native long Geom_BoundedCurve_SWIGUpcast(long jarg1);\r
- public final static native long Geom_BSplineCurve_SWIGUpcast(long jarg1);\r
- public final static native long Geom_TrimmedCurve_SWIGUpcast(long jarg1);\r
- public final static native long BRepFilletAPI_LocalOperation_SWIGUpcast(long jarg1);\r
- public final static native long BRepFilletAPI_MakeFillet_SWIGUpcast(long jarg1);\r
- public final static native long BRepFilletAPI_MakeChamfer_SWIGUpcast(long jarg1);\r
- public final static native long STEPControl_Reader_SWIGUpcast(long jarg1);\r
- public final static native long IGESControl_Reader_SWIGUpcast(long jarg1);\r
- public final static native long ShapeFix_Wireframe_SWIGUpcast(long jarg1);\r
- public final static native long ShapeUpgrade_RemoveInternalWires_SWIGUpcast(long jarg1);\r
- public final static native long ShapeUpgrade_ShapeDivideArea_SWIGUpcast(long jarg1);\r
- public final static native long GC_MakeArcOfCircle_SWIGUpcast(long jarg1);\r
- public final static native long GC_MakeSegment_SWIGUpcast(long jarg1);\r
- public final static native long GC_MakeArcOfEllipse_SWIGUpcast(long jarg1);\r
- public final static native long Geom2dAdaptor_Curve_SWIGUpcast(long jarg1);\r
- public final static native long GeomAdaptor_Curve_SWIGUpcast(long jarg1);\r
- public final static native long GProp_PGProps_SWIGUpcast(long jarg1);\r
- public final static native long GProp_CelGProps_SWIGUpcast(long jarg1);\r
- public final static native long GProp_SelGProps_SWIGUpcast(long jarg1);\r
- public final static native long GProp_VelGProps_SWIGUpcast(long jarg1);\r
- public final static native long BRepMesh_IncrementalMesh_SWIGUpcast(long jarg1);\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class OccJavaJNI {
+
+ static
+ {
+ System.loadLibrary("TKERNEL");
+ System.loadLibrary("TKMATH");
+ System.loadLibrary("TKG2D");
+ System.loadLibrary("TKG3D");
+ System.loadLibrary("TKGEOMBASE");
+ System.loadLibrary("TKBREP");
+ System.loadLibrary("TKGEOMALGO");
+ System.loadLibrary("TKTOPALGO");
+ System.loadLibrary("TKMESH");
+
+ System.loadLibrary("TKPRIM");
+ System.loadLibrary("TKSHHEALING");
+ System.loadLibrary("TKBO");
+
+ System.loadLibrary("TKBOOL");
+ System.loadLibrary("TKFILLET");
+ System.loadLibrary("TKOFFSET");
+
+ System.loadLibrary("TKXSBASE");
+ System.loadLibrary("TKIGES");
+ System.loadLibrary("TKSTEPBASE");
+ System.loadLibrary("TKSTEPATTR");
+ System.loadLibrary("TKSTEP209");
+ System.loadLibrary("TKSTEP");
+
+ System.loadLibrary("OccJava");
+ String mmg_opt= System.getenv("MMGT_OPT");
+ if(mmg_opt != null && !"0".equals(mmg_opt))
+ throw new RuntimeException("The MMGT_OPT environement variable must be set to 0 before using occjava.");
+ }
+
+ public final static native long new_GP_Trsf();
+ public final static native void GP_Trsf_setRotation(long jarg1, GP_Trsf jarg1_, double[] jarg2, double jarg3);
+ public final static native void GP_Trsf_setTranslation(long jarg1, GP_Trsf jarg1_, double[] jarg2);
+ public final static native void GP_Trsf_setValues(long jarg1, GP_Trsf jarg1_, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6, double jarg7, double jarg8, double jarg9, double jarg10, double jarg11, double jarg12, double jarg13);
+ public final static native void GP_Trsf_getValues(long jarg1, GP_Trsf jarg1_, double[] jarg2);
+ public final static native void delete_GP_Trsf(long jarg1);
+ public final static native long new_GP_Circ(double[] jarg1, double jarg2);
+ public final static native void delete_GP_Circ(long jarg1);
+ public final static native long new_GP_Parab__SWIG_0(double[] jarg1, double jarg2);
+ public final static native long new_GP_Parab__SWIG_1(double[] jarg1, double[] jarg2);
+ public final static native void delete_GP_Parab(long jarg1);
+ public final static native long new_GP_Elips(double[] jarg1, double jarg2, double jarg3);
+ public final static native void delete_GP_Elips(long jarg1);
+ public final static native long new_GP_Lin(double[] jarg1);
+ public final static native void delete_GP_Lin(long jarg1);
+ public final static native void delete_Handle_TColStd_HArray1OfBoolean(long jarg1);
+ public final static native void delete_Handle_TColgp_HArray1OfPnt(long jarg1);
+ public final static native int TopoDS_Shape_shapeType(long jarg1, TopoDS_Shape jarg1_);
+ public final static native boolean TopoDS_Shape_nativeIsSame(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native int TopoDS_Shape_orientation(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void TopoDS_Shape_reverse(long jarg1, TopoDS_Shape jarg1_);
+ public final static native long TopoDS_Shape_reversed(long jarg1, TopoDS_Shape jarg1_);
+ public final static native int TopoDS_Shape_hashCode(long jarg1, TopoDS_Shape jarg1_, int jarg2);
+ public final static native boolean TopoDS_Shape_free__SWIG_0(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void TopoDS_Shape_free__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);
+ public final static native long TopoDS_Shape_getTShape(long jarg1, TopoDS_Shape jarg1_);
+ public final static native long new_TopoDS_Shape();
+ public final static native void delete_TopoDS_Shape(long jarg1);
+ public final static native long new_TopoDS_Compound();
+ public final static native void delete_TopoDS_Compound(long jarg1);
+ public final static native long new_TopoDS_CompSolid();
+ public final static native void delete_TopoDS_CompSolid(long jarg1);
+ public final static native long new_TopoDS_Solid();
+ public final static native void delete_TopoDS_Solid(long jarg1);
+ public final static native long new_TopoDS_Shell();
+ public final static native void delete_TopoDS_Shell(long jarg1);
+ public final static native long new_TopoDS_Face();
+ public final static native void delete_TopoDS_Face(long jarg1);
+ public final static native long new_TopoDS_Wire();
+ public final static native void delete_TopoDS_Wire(long jarg1);
+ public final static native long new_TopoDS_Edge();
+ public final static native void delete_TopoDS_Edge(long jarg1);
+ public final static native long new_TopoDS_Vertex();
+ public final static native void delete_TopoDS_Vertex(long jarg1);
+ public final static native long new_TopoDS_Iterator__SWIG_0();
+ public final static native long new_TopoDS_Iterator__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2, boolean jarg3);
+ public final static native long new_TopoDS_Iterator__SWIG_2(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);
+ public final static native long new_TopoDS_Iterator__SWIG_3(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void TopoDS_Iterator_initialize__SWIG_0(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3, boolean jarg4);
+ public final static native void TopoDS_Iterator_initialize__SWIG_1(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);
+ public final static native void TopoDS_Iterator_initialize__SWIG_2(long jarg1, TopoDS_Iterator jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean TopoDS_Iterator_more(long jarg1, TopoDS_Iterator jarg1_);
+ public final static native void TopoDS_Iterator_next(long jarg1, TopoDS_Iterator jarg1_);
+ public final static native long TopoDS_Iterator_value(long jarg1, TopoDS_Iterator jarg1_);
+ public final static native void delete_TopoDS_Iterator(long jarg1);
+ public final static native void TopoDS_Builder_makeWire(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Wire jarg2_);
+ public final static native void TopoDS_Builder_makeCompound(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Compound jarg2_);
+ public final static native void TopoDS_Builder_add(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);
+ public final static native void TopoDS_Builder_remove(long jarg1, TopoDS_Builder jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);
+ public final static native void delete_TopoDS_Builder(long jarg1);
+ public final static native double[] BRep_Tool_pnt(long jarg1, TopoDS_Vertex jarg1_);
+ public final static native double[] BRep_Tool_parameters(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Face jarg2_);
+ public final static native double BRep_Tool_parameter(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native boolean BRep_Tool_degenerated(long jarg1, TopoDS_Edge jarg1_);
+ public final static native boolean BRep_Tool_hasContinuity(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, long jarg3, TopoDS_Face jarg3_);
+ public final static native int BRep_Tool_continuity(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, long jarg3, TopoDS_Face jarg3_);
+ public final static native double BRep_Tool_tolerance__SWIG_0(long jarg1, TopoDS_Face jarg1_);
+ public final static native double BRep_Tool_tolerance__SWIG_1(long jarg1, TopoDS_Edge jarg1_);
+ public final static native double BRep_Tool_tolerance__SWIG_2(long jarg1, TopoDS_Vertex jarg1_);
+ public final static native long BRep_Tool_triangulation(long jarg1, TopoDS_Face jarg1_, long jarg2, TopLoc_Location jarg2_);
+ public final static native void BRep_Tool_range(long jarg1, TopoDS_Edge jarg1_, double[] jarg2);
+ public final static native long BRep_Tool_curve(long jarg1, TopoDS_Edge jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long BRep_Tool_surface(long jarg1, TopoDS_Face jarg1_);
+ public final static native long BRep_Tool_curveOnSurface(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Face jarg2_, double[] jarg3, double[] jarg4);
+ public final static native long new_BRep_Tool();
+ public final static native void delete_BRep_Tool(long jarg1);
+ public final static native long new_BRep_Builder();
+ public final static native void BRep_Builder_updateVertex__SWIG_0(long jarg1, BRep_Builder jarg1_, long jarg2, TopoDS_Vertex jarg2_, double jarg3, double jarg4, long jarg5, TopoDS_Face jarg5_, double jarg6);
+ public final static native void BRep_Builder_updateVertex__SWIG_1(long jarg1, BRep_Builder jarg1_, long jarg2, TopoDS_Vertex jarg2_, double jarg3);
+ public final static native void delete_BRep_Builder(long jarg1);
+ public final static native long new_GeomLProp_SLProps(int jarg1, double jarg2);
+ public final static native void GeomLProp_SLProps_setParameters(long jarg1, GeomLProp_SLProps jarg1_, double jarg2, double jarg3);
+ public final static native double[] GeomLProp_SLProps_value(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double[] GeomLProp_SLProps_d1U(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double[] GeomLProp_SLProps_d1V(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double[] GeomLProp_SLProps_d2U(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double[] GeomLProp_SLProps_d2V(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double[] GeomLProp_SLProps_dUV(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native boolean GeomLProp_SLProps_isTangentUDefined(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native void GeomLProp_SLProps_tangentU(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);
+ public final static native boolean GeomLProp_SLProps_isTangentVDefined(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native void GeomLProp_SLProps_tangentV(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);
+ public final static native boolean GeomLProp_SLProps_isNormalDefined(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native boolean GeomLProp_SLProps_isCurvatureDefined(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native boolean GeomLProp_SLProps_isUmbilic(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double GeomLProp_SLProps_meanCurvature(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double GeomLProp_SLProps_gaussianCurvature(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native void GeomLProp_SLProps_setSurface(long jarg1, GeomLProp_SLProps jarg1_, long jarg2, Geom_Surface jarg2_);
+ public final static native void GeomLProp_SLProps_normal(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2);
+ public final static native void GeomLProp_SLProps_normalArray(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2, double[] jarg3, int jarg4);
+ public final static native double GeomLProp_SLProps_minCurvature(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native double GeomLProp_SLProps_maxCurvature(long jarg1, GeomLProp_SLProps jarg1_);
+ public final static native void GeomLProp_SLProps_curvatureDirection(long jarg1, GeomLProp_SLProps jarg1_, double[] jarg2, double[] jarg3);
+ public final static native void delete_GeomLProp_SLProps(long jarg1);
+ public final static native boolean BRepTools_read__SWIG_0(long jarg1, TopoDS_Shape jarg1_, String jarg2, long jarg3, BRep_Builder jarg3_);
+ public final static native boolean BRepTools_write__SWIG_0(long jarg1, TopoDS_Shape jarg1_, String jarg2);
+ public final static native void BRepTools_write__SWIG_1(long jarg1, TopoDS_Shape jarg1_, java.nio.channels.WritableByteChannel jarg2);
+ public final static native void BRepTools_clean(long jarg1, TopoDS_Shape jarg1_);
+ public final static native boolean BRepTools_read__SWIG_1(long jarg1, TopoDS_Shape jarg1_, java.nio.channels.ReadableByteChannel jarg2, long jarg3, BRep_Builder jarg3_);
+ public final static native void delete_BRepTools(long jarg1);
+ public final static native long new_BRepTools_WireExplorer__SWIG_0();
+ public final static native long new_BRepTools_WireExplorer__SWIG_1(long jarg1, TopoDS_Wire jarg1_);
+ public final static native long new_BRepTools_WireExplorer__SWIG_2(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Face jarg2_);
+ public final static native void BRepTools_WireExplorer_init__SWIG_0(long jarg1, BRepTools_WireExplorer jarg1_, long jarg2, TopoDS_Wire jarg2_);
+ public final static native void BRepTools_WireExplorer_init__SWIG_1(long jarg1, BRepTools_WireExplorer jarg1_, long jarg2, TopoDS_Wire jarg2_, long jarg3, TopoDS_Face jarg3_);
+ public final static native boolean BRepTools_WireExplorer_more(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native void BRepTools_WireExplorer_next(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native long BRepTools_WireExplorer_current(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native int BRepTools_WireExplorer_orientation(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native long BRepTools_WireExplorer_currentVertex(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native void BRepTools_WireExplorer_clear(long jarg1, BRepTools_WireExplorer jarg1_);
+ public final static native void delete_BRepTools_WireExplorer(long jarg1);
+ public final static native long new_BRepTools_Quilt();
+ public final static native void BRepTools_Quilt_bind__SWIG_0(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_);
+ public final static native void BRepTools_Quilt_bind__SWIG_1(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native void BRepTools_Quilt_add(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean BRepTools_Quilt_isCopied(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long BRepTools_Quilt_copy(long jarg1, BRepTools_Quilt jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long BRepTools_Quilt_shells(long jarg1, BRepTools_Quilt jarg1_);
+ public final static native void delete_BRepTools_Quilt(long jarg1);
+ public final static native boolean BRepBuilderAPI_Command_isDone(long jarg1, BRepBuilderAPI_Command jarg1_);
+ public final static native void delete_BRepBuilderAPI_Command(long jarg1);
+ public final static native void BRepBuilderAPI_MakeShape_build(long jarg1, BRepBuilderAPI_MakeShape jarg1_);
+ public final static native long BRepBuilderAPI_MakeShape_shape(long jarg1, BRepBuilderAPI_MakeShape jarg1_);
+ public final static native void delete_BRepBuilderAPI_MakeShape(long jarg1);
+ public final static native long BRepBuilderAPI_ModifyShape_modifiedShape(long jarg1, BRepBuilderAPI_ModifyShape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepBuilderAPI_ModifyShape(long jarg1);
+ public final static native long new_BRepBuilderAPI_Transform__SWIG_0(long jarg1, GP_Trsf jarg1_);
+ public final static native long new_BRepBuilderAPI_Transform__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GP_Trsf jarg2_, boolean jarg3);
+ public final static native long new_BRepBuilderAPI_Transform__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GP_Trsf jarg2_);
+ public final static native void BRepBuilderAPI_Transform_perform__SWIG_0(long jarg1, BRepBuilderAPI_Transform jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);
+ public final static native void BRepBuilderAPI_Transform_perform__SWIG_1(long jarg1, BRepBuilderAPI_Transform jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepBuilderAPI_Transform(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeVertex(double[] jarg1);
+ public final static native void delete_BRepBuilderAPI_MakeVertex(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_0();
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_1(long jarg1, TopoDS_Edge jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_2(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_3(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_4(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Edge jarg2_, long jarg3, TopoDS_Edge jarg3_, long jarg4, TopoDS_Edge jarg4_);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_5(long jarg1, TopoDS_Wire jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeWire__SWIG_6(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native void BRepBuilderAPI_MakeWire_add__SWIG_0(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native void BRepBuilderAPI_MakeWire_add__SWIG_1(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long jarg2, TopoDS_Wire jarg2_);
+ public final static native void BRepBuilderAPI_MakeWire_add__SWIG_2(long jarg1, BRepBuilderAPI_MakeWire jarg1_, long[] jarg2);
+ public final static native boolean BRepBuilderAPI_MakeWire_isDone(long jarg1, BRepBuilderAPI_MakeWire jarg1_);
+ public final static native long BRepBuilderAPI_MakeWire_wire(long jarg1, BRepBuilderAPI_MakeWire jarg1_);
+ public final static native void delete_BRepBuilderAPI_MakeWire(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_0();
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_1(long jarg1, Geom_Curve jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_2(long jarg1, TopoDS_Vertex jarg1_, long jarg2, TopoDS_Vertex jarg2_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_3(double[] jarg1, double[] jarg2);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_4(long jarg1, GP_Circ jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_5(long jarg1, GP_Circ jarg1_, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_6(long jarg1, GP_Circ jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_7(long jarg1, GP_Circ jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_8(long jarg1, GP_Parab jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_9(long jarg1, GP_Parab jarg1_, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_10(long jarg1, GP_Parab jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_11(long jarg1, GP_Parab jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_12(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_13(long jarg1, Geom_TrimmedCurve jarg1_);
+ public final static native boolean BRepBuilderAPI_MakeEdge_isDone(long jarg1, BRepBuilderAPI_MakeEdge jarg1_);
+ public final static native long BRepBuilderAPI_MakeEdge_edge(long jarg1, BRepBuilderAPI_MakeEdge jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_14(long jarg1, GP_Lin jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_15(long jarg1, GP_Lin jarg1_, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_16(long jarg1, GP_Lin jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_17(long jarg1, GP_Lin jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_18(long jarg1, GP_Elips jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_19(long jarg1, GP_Elips jarg1_, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_20(long jarg1, GP_Elips jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_21(long jarg1, GP_Elips jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_22(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_23(long jarg1, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_24(long jarg1, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_25(long jarg1, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_26(long jarg1, Geom_Curve jarg1_, double jarg2, double jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_27(long jarg1, Geom_Curve jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_28(long jarg1, Geom_Curve jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_29(long jarg1, Geom_Curve jarg1_, double[] jarg2, double[] jarg3, double jarg4, double jarg5);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_30(long jarg1, Geom_Curve jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_, double jarg4, double jarg5);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_31(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_32(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double[] jarg3, double[] jarg4);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_33(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, long jarg3, TopoDS_Vertex jarg3_, long jarg4, TopoDS_Vertex jarg4_);
+ public final static native long new_BRepBuilderAPI_MakeEdge__SWIG_34(long jarg1, Geom2d_Curve jarg1_, long jarg2, Geom_Surface jarg2_, double[] jarg3, double[] jarg4, double jarg5, double jarg6);
+ public final static native void delete_BRepBuilderAPI_MakeEdge(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeFace__SWIG_0(long jarg1, TopoDS_Wire jarg1_, boolean jarg2);
+ public final static native long new_BRepBuilderAPI_MakeFace__SWIG_1(long jarg1, TopoDS_Wire jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeFace__SWIG_2(long jarg1, TopoDS_Face jarg1_, long jarg2, TopoDS_Wire jarg2_);
+ public final static native void delete_BRepBuilderAPI_MakeFace(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_0();
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_1(long jarg1, TopoDS_CompSolid jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_2(long jarg1, TopoDS_Shell jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_3(long jarg1, TopoDS_Shell jarg1_, long jarg2, TopoDS_Shell jarg2_);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_4(long jarg1, TopoDS_Shell jarg1_, long jarg2, TopoDS_Shell jarg2_, long jarg3, TopoDS_Shell jarg3_);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_5(long jarg1, TopoDS_Solid jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeSolid__SWIG_6(long jarg1, TopoDS_Solid jarg1_, long jarg2, TopoDS_Shell jarg2_);
+ public final static native void BRepBuilderAPI_MakeSolid_add(long jarg1, BRepBuilderAPI_MakeSolid jarg1_, long jarg2, TopoDS_Shell jarg2_);
+ public final static native boolean BRepBuilderAPI_MakeSolid_isDone(long jarg1, BRepBuilderAPI_MakeSolid jarg1_);
+ public final static native boolean BRepBuilderAPI_MakeSolid_isDeleted(long jarg1, BRepBuilderAPI_MakeSolid jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepBuilderAPI_MakeSolid(long jarg1);
+ public final static native long new_BRepBuilderAPI_Sewing__SWIG_0(double jarg1, boolean jarg2, boolean jarg3, boolean jarg4);
+ public final static native long new_BRepBuilderAPI_Sewing__SWIG_1(double jarg1, boolean jarg2, boolean jarg3);
+ public final static native long new_BRepBuilderAPI_Sewing__SWIG_2(double jarg1, boolean jarg2);
+ public final static native long new_BRepBuilderAPI_Sewing__SWIG_3(double jarg1);
+ public final static native long new_BRepBuilderAPI_Sewing__SWIG_4();
+ public final static native void BRepBuilderAPI_Sewing_init__SWIG_0(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3, boolean jarg4, boolean jarg5);
+ public final static native void BRepBuilderAPI_Sewing_init__SWIG_1(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3, boolean jarg4);
+ public final static native void BRepBuilderAPI_Sewing_init__SWIG_2(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2, boolean jarg3);
+ public final static native void BRepBuilderAPI_Sewing_init__SWIG_3(long jarg1, BRepBuilderAPI_Sewing jarg1_, double jarg2);
+ public final static native void BRepBuilderAPI_Sewing_load(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void BRepBuilderAPI_Sewing_add(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void BRepBuilderAPI_Sewing_perform(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native long BRepBuilderAPI_Sewing_sewedShape(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native int BRepBuilderAPI_Sewing_nbFreeEdges(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native long BRepBuilderAPI_Sewing_freeEdge(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);
+ public final static native int BRepBuilderAPI_Sewing_nbMultipleEdges(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native long BRepBuilderAPI_Sewing_multipleEdge(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);
+ public final static native int BRepBuilderAPI_Sewing_nbDegeneratedShapes(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native long BRepBuilderAPI_Sewing_degeneratedShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);
+ public final static native int BRepBuilderAPI_Sewing_nbDeletedFaces(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native long BRepBuilderAPI_Sewing_deletedFace(long jarg1, BRepBuilderAPI_Sewing jarg1_, int jarg2);
+ public final static native boolean BRepBuilderAPI_Sewing_isDegenerated(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean BRepBuilderAPI_Sewing_isModified(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long BRepBuilderAPI_Sewing_modified(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void BRepBuilderAPI_Sewing_dump(long jarg1, BRepBuilderAPI_Sewing jarg1_);
+ public final static native boolean BRepBuilderAPI_Sewing_isModifiedSubShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long BRepBuilderAPI_Sewing_modifiedSubShape(long jarg1, BRepBuilderAPI_Sewing jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepBuilderAPI_Sewing(long jarg1);
+ public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_0();
+ public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);
+ public final static native long new_BRepBuilderAPI_NurbsConvert__SWIG_2(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void BRepBuilderAPI_NurbsConvert_perform__SWIG_0(long jarg1, BRepBuilderAPI_NurbsConvert jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);
+ public final static native void BRepBuilderAPI_NurbsConvert_perform__SWIG_1(long jarg1, BRepBuilderAPI_NurbsConvert jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepBuilderAPI_NurbsConvert(long jarg1);
+ public final static native long new_BRepOffsetAPI_ThruSections__SWIG_0(boolean jarg1, boolean jarg2, double jarg3);
+ public final static native long new_BRepOffsetAPI_ThruSections__SWIG_1(boolean jarg1, boolean jarg2);
+ public final static native long new_BRepOffsetAPI_ThruSections__SWIG_2(boolean jarg1);
+ public final static native long new_BRepOffsetAPI_ThruSections__SWIG_3();
+ public final static native void BRepOffsetAPI_ThruSections_addWire(long jarg1, BRepOffsetAPI_ThruSections jarg1_, long jarg2, TopoDS_Wire jarg2_);
+ public final static native void BRepOffsetAPI_ThruSections_checkCompatibility__SWIG_0(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2);
+ public final static native void BRepOffsetAPI_ThruSections_checkCompatibility__SWIG_1(long jarg1, BRepOffsetAPI_ThruSections jarg1_);
+ public final static native long BRepOffsetAPI_ThruSections_shape(long jarg1, BRepOffsetAPI_ThruSections jarg1_);
+ public final static native void BRepOffsetAPI_ThruSections_init__SWIG_0(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2, boolean jarg3, double jarg4);
+ public final static native void BRepOffsetAPI_ThruSections_init__SWIG_1(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2, boolean jarg3);
+ public final static native void BRepOffsetAPI_ThruSections_init__SWIG_2(long jarg1, BRepOffsetAPI_ThruSections jarg1_, boolean jarg2);
+ public final static native void BRepOffsetAPI_ThruSections_init__SWIG_3(long jarg1, BRepOffsetAPI_ThruSections jarg1_);
+ public final static native void BRepOffsetAPI_ThruSections_addVertex(long jarg1, BRepOffsetAPI_ThruSections jarg1_, long jarg2, TopoDS_Vertex jarg2_);
+ public final static native void BRepOffsetAPI_ThruSections_build(long jarg1, BRepOffsetAPI_ThruSections jarg1_);
+ public final static native void delete_BRepOffsetAPI_ThruSections(long jarg1);
+ public final static native long new_BRepBuilderAPI_MakeShell__SWIG_0();
+ public final static native long new_BRepBuilderAPI_MakeShell__SWIG_1(long jarg1, Geom_Surface jarg1_, boolean jarg2);
+ public final static native long new_BRepBuilderAPI_MakeShell__SWIG_2(long jarg1, Geom_Surface jarg1_);
+ public final static native long new_BRepBuilderAPI_MakeShell__SWIG_3(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3, double jarg4, double jarg5, boolean jarg6);
+ public final static native long new_BRepBuilderAPI_MakeShell__SWIG_4(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3, double jarg4, double jarg5);
+ public final static native void BRepBuilderAPI_MakeShell_init__SWIG_0(long jarg1, BRepBuilderAPI_MakeShell jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4, double jarg5, double jarg6, boolean jarg7);
+ public final static native void BRepBuilderAPI_MakeShell_init__SWIG_1(long jarg1, BRepBuilderAPI_MakeShell jarg1_, long jarg2, Geom_Surface jarg2_, double jarg3, double jarg4, double jarg5, double jarg6);
+ public final static native boolean BRepBuilderAPI_MakeShell_isDone(long jarg1, BRepBuilderAPI_MakeShell jarg1_);
+ public final static native long BRepBuilderAPI_MakeShell_error(long jarg1, BRepBuilderAPI_MakeShell jarg1_);
+ public final static native long BRepBuilderAPI_MakeShell_Shell(long jarg1, BRepBuilderAPI_MakeShell jarg1_);
+ public final static native void delete_BRepBuilderAPI_MakeShell(long jarg1);
+ public final static native long new_BRepOffsetAPI_NormalProjection__SWIG_0();
+ public final static native long new_BRepOffsetAPI_NormalProjection__SWIG_1(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void BRepOffsetAPI_NormalProjection_init(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void BRepOffsetAPI_NormalProjection_add(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void BRepOffsetAPI_NormalProjection_setParams(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, double jarg2, double jarg3, int jarg4, int jarg5, int jarg6);
+ public final static native void BRepOffsetAPI_NormalProjection_setMaxDistance(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, double jarg2);
+ public final static native void BRepOffsetAPI_NormalProjection_setLimit__SWIG_0(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, boolean jarg2);
+ public final static native void BRepOffsetAPI_NormalProjection_setLimit__SWIG_1(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);
+ public final static native void BRepOffsetAPI_NormalProjection_compute3d__SWIG_0(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, boolean jarg2);
+ public final static native void BRepOffsetAPI_NormalProjection_compute3d__SWIG_1(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);
+ public final static native void BRepOffsetAPI_NormalProjection_build(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);
+ public final static native boolean BRepOffsetAPI_NormalProjection_isDone(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);
+ public final static native long BRepOffsetAPI_NormalProjection_projection(long jarg1, BRepOffsetAPI_NormalProjection jarg1_);
+ public final static native long BRepOffsetAPI_NormalProjection_couple(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native long[] BRepOffsetAPI_NormalProjection_generated(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long BRepOffsetAPI_NormalProjection_ancestor(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2, TopoDS_Edge jarg2_);
+ public final static native boolean BRepOffsetAPI_NormalProjection_buildWire(long jarg1, BRepOffsetAPI_NormalProjection jarg1_, long jarg2);
+ public final static native void delete_BRepOffsetAPI_NormalProjection(long jarg1);
+ public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6, boolean jarg7, long jarg8);
+ public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6, boolean jarg7);
+ public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5, boolean jarg6);
+ public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4, int jarg5);
+ public final static native long new_BRepOffsetAPI_MakeThickSolid__SWIG_4(long jarg1, TopoDS_Shape jarg1_, long[] jarg2, double jarg3, double jarg4);
+ public final static native void delete_BRepOffsetAPI_MakeThickSolid(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeBox(double[] jarg1, double[] jarg2);
+ public final static native void delete_BRepPrimAPI_MakeBox(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeCone(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);
+ public final static native void delete_BRepPrimAPI_MakeCone(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeCylinder(double[] jarg1, double jarg2, double jarg3, double jarg4);
+ public final static native void delete_BRepPrimAPI_MakeCylinder(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeTorus__SWIG_0(double[] jarg1, double jarg2, double jarg3);
+ public final static native long new_BRepPrimAPI_MakeTorus__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6);
+ public final static native void delete_BRepPrimAPI_MakeTorus(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeSphere__SWIG_0(double[] jarg1, double jarg2);
+ public final static native long new_BRepPrimAPI_MakeSphere__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);
+ public final static native void delete_BRepPrimAPI_MakeSphere(long jarg1);
+ public final static native void delete_BRepPrimAPI_MakeSweep(long jarg1);
+ public final static native long new_BRepPrimAPI_MakePrism__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3, boolean jarg4);
+ public final static native long new_BRepPrimAPI_MakePrism__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3);
+ public final static native long new_BRepPrimAPI_MakePrism__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double[] jarg2);
+ public final static native void delete_BRepPrimAPI_MakePrism(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeRevol__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, double jarg3, boolean jarg4);
+ public final static native long new_BRepPrimAPI_MakeRevol__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, double jarg3);
+ public final static native long new_BRepPrimAPI_MakeRevol__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double[] jarg2, boolean jarg3);
+ public final static native long new_BRepPrimAPI_MakeRevol__SWIG_3(long jarg1, TopoDS_Shape jarg1_, double[] jarg2);
+ public final static native void delete_BRepPrimAPI_MakeRevol(long jarg1);
+ public final static native long new_BRepOffsetAPI_MakePipe(long jarg1, TopoDS_Wire jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepOffsetAPI_MakePipe(long jarg1);
+ public final static native long new_BRepPrimAPI_MakeWedge__SWIG_0(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5, double jarg6, double jarg7, double jarg8);
+ public final static native long new_BRepPrimAPI_MakeWedge__SWIG_1(double[] jarg1, double jarg2, double jarg3, double jarg4, double jarg5);
+ public final static native void delete_BRepPrimAPI_MakeWedge(long jarg1);
+ public final static native long[] BRepAlgoAPI_BooleanOperation_modified(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean BRepAlgoAPI_BooleanOperation_isDeleted(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long[] BRepAlgoAPI_BooleanOperation_generated(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean BRepAlgoAPI_BooleanOperation_hasModified(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);
+ public final static native boolean BRepAlgoAPI_BooleanOperation_hasGenerated(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);
+ public final static native boolean BRepAlgoAPI_BooleanOperation_hasDeleted(long jarg1, BRepAlgoAPI_BooleanOperation jarg1_);
+ public final static native void delete_BRepAlgoAPI_BooleanOperation(long jarg1);
+ public final static native long new_BRepAlgoAPI_Fuse(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepAlgoAPI_Fuse(long jarg1);
+ public final static native long new_BRepAlgoAPI_Common(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepAlgoAPI_Common(long jarg1);
+ public final static native long new_BRepAlgoAPI_Cut(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepAlgoAPI_Cut(long jarg1);
+ public final static native long new_BRepAlgoAPI_Section(long jarg1, TopoDS_Shape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_BRepAlgoAPI_Section(long jarg1);
+ public final static native long new_Poly_Triangulation(int jarg1, int jarg2, boolean jarg3);
+ public final static native double Poly_Triangulation_deflection__SWIG_0(long jarg1, Poly_Triangulation jarg1_);
+ public final static native void Poly_Triangulation_deflection__SWIG_1(long jarg1, Poly_Triangulation jarg1_, double jarg2);
+ public final static native void Poly_Triangulation_removeUVNodes(long jarg1, Poly_Triangulation jarg1_);
+ public final static native int Poly_Triangulation_nbNodes(long jarg1, Poly_Triangulation jarg1_);
+ public final static native int Poly_Triangulation_nbTriangles(long jarg1, Poly_Triangulation jarg1_);
+ public final static native boolean Poly_Triangulation_hasUVNodes(long jarg1, Poly_Triangulation jarg1_);
+ public final static native int[] Poly_Triangulation_triangles(long jarg1, Poly_Triangulation jarg1_);
+ public final static native double[] Poly_Triangulation_nodes(long jarg1, Poly_Triangulation jarg1_);
+ public final static native double[] Poly_Triangulation_uvNodes(long jarg1, Poly_Triangulation jarg1_);
+ public final static native void delete_Poly_Triangulation(long jarg1);
+ public final static native void delete_Geom_Geometry(long jarg1);
+ public final static native double Geom_Curve_firstParameter(long jarg1, Geom_Curve jarg1_);
+ public final static native double Geom_Curve_lastParameter(long jarg1, Geom_Curve jarg1_);
+ public final static native boolean Geom_Curve_isClosed(long jarg1, Geom_Curve jarg1_);
+ public final static native boolean Geom_Curve_isPeriodic(long jarg1, Geom_Curve jarg1_);
+ public final static native double Geom_Curve_period(long jarg1, Geom_Curve jarg1_);
+ public final static native void delete_Geom_Curve(long jarg1);
+ public final static native double[] Geom_Surface_value(long jarg1, Geom_Surface jarg1_, double jarg2, double jarg3);
+ public final static native void Geom_Surface_bounds__SWIG_0(long jarg1, Geom_Surface jarg1_, double[] jarg2);
+ public final static native void Geom_Surface_bounds__SWIG_1(long jarg1, Geom_Surface jarg1_, double[] jarg2, double[] jarg3, double[] jarg4, double[] jarg5);
+ public final static native boolean Geom_Surface_isUClosed(long jarg1, Geom_Surface jarg1_);
+ public final static native boolean Geom_Surface_isVClosed(long jarg1, Geom_Surface jarg1_);
+ public final static native long Geom_Surface_uIso(long jarg1, Geom_Surface jarg1_, double jarg2);
+ public final static native long Geom_Surface_vIso(long jarg1, Geom_Surface jarg1_, double jarg2);
+ public final static native void delete_Geom_Surface(long jarg1);
+ public final static native void delete_Geom2d_Geometry(long jarg1);
+ public final static native void delete_Geom2d_Curve(long jarg1);
+ public final static native void delete_Geom_BoundedCurve(long jarg1);
+ public final static native long new_Geom_BSplineCurve__SWIG_0(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5, boolean jarg6, boolean jarg7);
+ public final static native long new_Geom_BSplineCurve__SWIG_1(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5, boolean jarg6);
+ public final static native long new_Geom_BSplineCurve__SWIG_2(double[] jarg1, double[] jarg2, double[] jarg3, long jarg4, int jarg5);
+ public final static native void Geom_BSplineCurve_setKnot__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double jarg3);
+ public final static native void Geom_BSplineCurve_setKnot__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double jarg3, int jarg4);
+ public final static native void Geom_BSplineCurve_setPeriodic(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native void Geom_BSplineCurve_setNotPeriodic(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native void Geom_BSplineCurve_setOrigin__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);
+ public final static native void Geom_BSplineCurve_setOrigin__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double jarg3);
+ public final static native void Geom_BSplineCurve_setPole__SWIG_0(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double[] jarg3);
+ public final static native void Geom_BSplineCurve_setPole__SWIG_1(long jarg1, Geom_BSplineCurve jarg1_, int jarg2, double[] jarg3, double jarg4);
+ public final static native void Geom_BSplineCurve_movePoint(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double[] jarg3, int jarg4, int jarg5, long jarg6, long jarg7);
+ public final static native void Geom_BSplineCurve_movePointAndTangent(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, double[] jarg3, double[] jarg4, double jarg5, int jarg6, int jarg7);
+ public final static native boolean Geom_BSplineCurve_isClosed(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native boolean Geom_BSplineCurve_isPeriodic(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native boolean Geom_BSplineCurve_isRational(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native int Geom_BSplineCurve_continuity(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native int Geom_BSplineCurve_Degree(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native double[] Geom_BSplineCurve_localValue(long jarg1, Geom_BSplineCurve jarg1_, double jarg2, int jarg3, int jarg4);
+ public final static native double[] Geom_BSplineCurve_endPoint(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native double[] Geom_BSplineCurve_startPoint(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native int Geom_BSplineCurve_nbKnots(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native int Geom_BSplineCurve_nbPoles(long jarg1, Geom_BSplineCurve jarg1_);
+ public final static native double[] Geom_BSplineCurve_pole(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);
+ public final static native double Geom_BSplineCurve_weight(long jarg1, Geom_BSplineCurve jarg1_, int jarg2);
+ public final static native void delete_Geom_BSplineCurve(long jarg1);
+ public final static native void delete_Geom_TrimmedCurve(long jarg1);
+ public final static native void BRepLib_encodeRegularity__SWIG_0(long jarg1, TopoDS_Shape jarg1_, double jarg2);
+ public final static native void BRepLib_encodeRegularity__SWIG_1(long jarg1, TopoDS_Shape jarg1_);
+ public final static native long new_BRepLib();
+ public final static native void delete_BRepLib(long jarg1);
+ public final static native void delete_BRepFilletAPI_LocalOperation(long jarg1);
+ public final static native long new_BRepFilletAPI_MakeFillet__SWIG_0(long jarg1, TopoDS_Shape jarg1_, int jarg2);
+ public final static native long new_BRepFilletAPI_MakeFillet__SWIG_1(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void BRepFilletAPI_MakeFillet_add(long jarg1, BRepFilletAPI_MakeFillet jarg1_, double jarg2, long jarg3, TopoDS_Edge jarg3_);
+ public final static native void delete_BRepFilletAPI_MakeFillet(long jarg1);
+ public final static native long new_BRepFilletAPI_MakeChamfer(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void BRepFilletAPI_MakeChamfer_add(long jarg1, BRepFilletAPI_MakeChamfer jarg1_, double jarg2, long jarg3, TopoDS_Edge jarg3_, long jarg4, TopoDS_Face jarg4_);
+ public final static native void delete_BRepFilletAPI_MakeChamfer(long jarg1);
+ public final static native long new_BRepCheck_Analyzer__SWIG_0(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);
+ public final static native long new_BRepCheck_Analyzer__SWIG_1(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void BRepCheck_Analyzer_init__SWIG_0(long jarg1, BRepCheck_Analyzer jarg1_, long jarg2, TopoDS_Shape jarg2_, boolean jarg3);
+ public final static native void BRepCheck_Analyzer_init__SWIG_1(long jarg1, BRepCheck_Analyzer jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native boolean BRepCheck_Analyzer_isValid(long jarg1, BRepCheck_Analyzer jarg1_);
+ public final static native void delete_BRepCheck_Analyzer(long jarg1);
+ public final static native long new_ShapeBuild_ReShape();
+ public final static native void ShapeBuild_ReShape_replace(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_, long jarg3, TopoDS_Shape jarg3_);
+ public final static native long ShapeBuild_ReShape_apply__SWIG_0(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);
+ public final static native long ShapeBuild_ReShape_apply__SWIG_1(long jarg1, ShapeBuild_ReShape jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_ShapeBuild_ReShape(long jarg1);
+ public final static native int XSControl_Reader_readFile__SWIG_0(long jarg1, XSControl_Reader jarg1_, String jarg2);
+ public final static native int XSControl_Reader_transferRoots(long jarg1, XSControl_Reader jarg1_);
+ public final static native void XSControl_Reader_clearShapes(long jarg1, XSControl_Reader jarg1_);
+ public final static native int XSControl_Reader_nbRootsForTransfer(long jarg1, XSControl_Reader jarg1_);
+ public final static native long XSControl_Reader_oneShape(long jarg1, XSControl_Reader jarg1_);
+ public final static native int XSControl_Reader_readFile__SWIG_1(long jarg1, XSControl_Reader jarg1_, byte[] jarg2);
+ public final static native boolean XSControl_Reader_setReadUnitM(long jarg1, XSControl_Reader jarg1_);
+ public final static native boolean XSControl_Reader_setReadUnitMM(long jarg1, XSControl_Reader jarg1_);
+ public final static native void delete_XSControl_Reader(long jarg1);
+ public final static native long new_STEPControl_Reader();
+ public final static native String STEPControl_Reader_getLabel(long jarg1, STEPControl_Reader jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void delete_STEPControl_Reader(long jarg1);
+ public final static native long new_IGESControl_Reader();
+ public final static native String IGESControl_Reader_getLabel(long jarg1, IGESControl_Reader jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native long IGESControl_Reader_getShape(long jarg1, IGESControl_Reader jarg1_, String jarg2);
+ public final static native void IGESControl_Reader_dumpLabels(long jarg1, IGESControl_Reader jarg1_);
+ public final static native void delete_IGESControl_Reader(long jarg1);
+ public final static native long new_STEPControl_Writer();
+ public final static native int STEPControl_Writer_write(long jarg1, STEPControl_Writer jarg1_, String jarg2);
+ public final static native int STEPControl_Writer_transfer(long jarg1, STEPControl_Writer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);
+ public final static native void delete_STEPControl_Writer(long jarg1);
+ public final static native long new_IGESControl_Writer__SWIG_0();
+ public final static native long new_IGESControl_Writer__SWIG_1(String jarg1, int jarg2);
+ public final static native long new_IGESControl_Writer__SWIG_2(String jarg1);
+ public final static native boolean IGESControl_Writer_write(long jarg1, IGESControl_Writer jarg1_, String jarg2);
+ public final static native boolean IGESControl_Writer_addShape(long jarg1, IGESControl_Writer jarg1_, long jarg2, TopoDS_Shape jarg2_);
+ public final static native void IGESControl_Writer_computeModel(long jarg1, IGESControl_Writer jarg1_);
+ public final static native void delete_IGESControl_Writer(long jarg1);
+ public final static native long new_IGESControl_Controller();
+ public final static native void IGESControl_Controller_init(long jarg1, IGESControl_Controller jarg1_);
+ public final static native void delete_IGESControl_Controller(long jarg1);
+ public final static native void ShapeFix_Root_setPrecision(long jarg1, ShapeFix_Root jarg1_, double jarg2);
+ public final static native double ShapeFix_Root_getPrecision(long jarg1, ShapeFix_Root jarg1_);
+ public final static native void ShapeFix_Root_setContext(long jarg1, ShapeFix_Root jarg1_, long jarg2, ShapeBuild_ReShape jarg2_);
+ public final static native long ShapeFix_Root_getContext(long jarg1, ShapeFix_Root jarg1_);
+ public final static native void delete_ShapeFix_Root(long jarg1);
+ public final static native long new_ShapeFix_Wireframe(long jarg1, TopoDS_Shape jarg1_);
+ public final static native boolean ShapeFix_Wireframe_fixWireGaps(long jarg1, ShapeFix_Wireframe jarg1_);
+ public final static native boolean ShapeFix_Wireframe_fixSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_);
+ public final static native void ShapeFix_Wireframe_setLimitAngle(long jarg1, ShapeFix_Wireframe jarg1_, double jarg2);
+ public final static native double ShapeFix_Wireframe_getLimitAngle(long jarg1, ShapeFix_Wireframe jarg1_);
+ public final static native long ShapeFix_Wireframe_shape(long jarg1, ShapeFix_Wireframe jarg1_);
+ public final static native void ShapeFix_Wireframe_setDropSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_, boolean jarg2);
+ public final static native boolean ShapeFix_Wireframe_getDropSmallEdges(long jarg1, ShapeFix_Wireframe jarg1_);
+ public final static native void delete_ShapeFix_Wireframe(long jarg1);
+ public final static native void delete_ShapeUpgrade_Tool(long jarg1);
+ public final static native long new_ShapeUpgrade_RemoveInternalWires(long jarg1, TopoDS_Shape jarg1_);
+ public final static native boolean ShapeUpgrade_RemoveInternalWires_perform(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);
+ public final static native long ShapeUpgrade_RemoveInternalWires_getResult(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);
+ public final static native void ShapeUpgrade_RemoveInternalWires_setMinArea(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_, double jarg2);
+ public final static native double ShapeUpgrade_RemoveInternalWires_getMinArea(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);
+ public final static native void ShapeUpgrade_RemoveInternalWires_setRemoveFaceMode(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_, boolean jarg2);
+ public final static native boolean ShapeUpgrade_RemoveInternalWires_getRemoveFaceMode(long jarg1, ShapeUpgrade_RemoveInternalWires jarg1_);
+ public final static native void delete_ShapeUpgrade_RemoveInternalWires(long jarg1);
+ public final static native long ShapeUpgrade_ShapeDivide_getResult(long jarg1, ShapeUpgrade_ShapeDivide jarg1_);
+ public final static native boolean ShapeUpgrade_ShapeDivide_perform__SWIG_0(long jarg1, ShapeUpgrade_ShapeDivide jarg1_, boolean jarg2);
+ public final static native boolean ShapeUpgrade_ShapeDivide_perform__SWIG_1(long jarg1, ShapeUpgrade_ShapeDivide jarg1_);
+ public final static native long new_ShapeUpgrade_ShapeDivide();
+ public final static native void delete_ShapeUpgrade_ShapeDivide(long jarg1);
+ public final static native long new_ShapeUpgrade_ShapeDivideArea(long jarg1, TopoDS_Shape jarg1_);
+ public final static native void ShapeUpgrade_ShapeDivideArea_setMaxArea(long jarg1, ShapeUpgrade_ShapeDivideArea jarg1_, double jarg2);
+ public final static native double ShapeUpgrade_ShapeDivideArea_getMaxArea(long jarg1, ShapeUpgrade_ShapeDivideArea jarg1_);
+ public final static native void delete_ShapeUpgrade_ShapeDivideArea(long jarg1);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_0();
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_1(double[] jarg1, int jarg2, int jarg3, int jarg4, double jarg5);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_2(double[] jarg1, int jarg2, int jarg3, int jarg4);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_3(double[] jarg1, int jarg2, int jarg3);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_4(double[] jarg1, int jarg2);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_5(double[] jarg1);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_6(double[] jarg1, double[] jarg2, int jarg3, int jarg4, int jarg5, double jarg6);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_7(double[] jarg1, double[] jarg2, int jarg3, int jarg4, int jarg5);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_8(double[] jarg1, double[] jarg2, int jarg3, int jarg4);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_9(double[] jarg1, double[] jarg2, int jarg3);
+ public final static native long new_GeomAPI_PointsToBSpline__SWIG_10(double[] jarg1, double[] jarg2);
+ public final static native long GeomAPI_PointsToBSpline_Curve(long jarg1, GeomAPI_PointsToBSpline jarg1_);
+ public final static native void delete_GeomAPI_PointsToBSpline(long jarg1);
+ public final static native long new_GeomAPI_Interpolate(double[] jarg1, boolean jarg2, double jarg3);
+ public final static native void GeomAPI_Interpolate_Load__SWIG_0(long jarg1, GeomAPI_Interpolate jarg1_, double[] jarg2, boolean[] jarg3, boolean jarg4);
+ public final static native void GeomAPI_Interpolate_Load__SWIG_1(long jarg1, GeomAPI_Interpolate jarg1_, double[] jarg2, boolean[] jarg3);
+ public final static native void GeomAPI_Interpolate_Perform(long jarg1, GeomAPI_Interpolate jarg1_);
+ public final static native long GeomAPI_Interpolate_Curve(long jarg1, GeomAPI_Interpolate jarg1_);
+ public final static native void delete_GeomAPI_Interpolate(long jarg1);
+ public final static native boolean GC_Root_isDone(long jarg1, GC_Root jarg1_);
+ public final static native long new_GC_Root();
+ public final static native void delete_GC_Root(long jarg1);
+ public final static native long new_GC_MakeArcOfCircle__SWIG_0(double[] jarg1, double[] jarg2, double[] jarg3);
+ public final static native long new_GC_MakeArcOfCircle__SWIG_1(long jarg1, GP_Circ jarg1_, double[] jarg2, double[] jarg3, boolean jarg4);
+ public final static native long GC_MakeArcOfCircle_value(long jarg1, GC_MakeArcOfCircle jarg1_);
+ public final static native long new_GC_MakeArcOfCircle__SWIG_2(long jarg1, GP_Circ jarg1_, double jarg2, double jarg3, boolean jarg4);
+ public final static native long new_GC_MakeArcOfCircle__SWIG_3(long jarg1, GP_Circ jarg1_, double[] jarg2, double jarg3, boolean jarg4);
+ public final static native void delete_GC_MakeArcOfCircle(long jarg1);
+ public final static native long new_GC_MakeSegment__SWIG_0(double[] jarg1, double[] jarg2);
+ public final static native long new_GC_MakeSegment__SWIG_1(long jarg1, GP_Lin jarg1_, double jarg2, double jarg3);
+ public final static native long new_GC_MakeSegment__SWIG_2(long jarg1, GP_Lin jarg1_, double[] jarg2, double jarg3);
+ public final static native long new_GC_MakeSegment__SWIG_3(long jarg1, GP_Lin jarg1_, double[] jarg2, double[] jarg3);
+ public final static native long GC_MakeSegment_value(long jarg1, GC_MakeSegment jarg1_);
+ public final static native void delete_GC_MakeSegment(long jarg1);
+ public final static native long new_GC_MakeArcOfEllipse__SWIG_0(long jarg1, GP_Elips jarg1_, double jarg2, double jarg3, boolean jarg4);
+ public final static native long new_GC_MakeArcOfEllipse__SWIG_1(long jarg1, GP_Elips jarg1_, double[] jarg2, double jarg3, boolean jarg4);
+ public final static native long new_GC_MakeArcOfEllipse__SWIG_2(long jarg1, GP_Elips jarg1_, double[] jarg2, double[] jarg3, boolean jarg4);
+ public final static native long GC_MakeArcOfEllipse_value(long jarg1, GC_MakeArcOfEllipse jarg1_);
+ public final static native void delete_GC_MakeArcOfEllipse(long jarg1);
+ public final static native boolean TopLoc_Location_isIdentity(long jarg1, TopLoc_Location jarg1_);
+ public final static native long TopLoc_Location_transformation(long jarg1, TopLoc_Location jarg1_);
+ public final static native long new_TopLoc_Location();
+ public final static native void delete_TopLoc_Location(long jarg1);
+ public final static native void TopExp_vertices__SWIG_0(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_, boolean jarg4);
+ public final static native void TopExp_vertices__SWIG_1(long jarg1, TopoDS_Edge jarg1_, long jarg2, TopoDS_Vertex jarg2_, long jarg3, TopoDS_Vertex jarg3_);
+ public final static native long new_TopExp();
+ public final static native void delete_TopExp(long jarg1);
+ public final static native long new_TopExp_Explorer__SWIG_0();
+ public final static native long new_TopExp_Explorer__SWIG_1(long jarg1, TopoDS_Shape jarg1_, int jarg2, int jarg3);
+ public final static native long new_TopExp_Explorer__SWIG_2(long jarg1, TopoDS_Shape jarg1_, int jarg2);
+ public final static native void TopExp_Explorer_init__SWIG_0(long jarg1, TopExp_Explorer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3, int jarg4);
+ public final static native void TopExp_Explorer_init__SWIG_1(long jarg1, TopExp_Explorer jarg1_, long jarg2, TopoDS_Shape jarg2_, int jarg3);
+ public final static native boolean TopExp_Explorer_more(long jarg1, TopExp_Explorer jarg1_);
+ public final static native void TopExp_Explorer_next(long jarg1, TopExp_Explorer jarg1_);
+ public final static native long TopExp_Explorer_current(long jarg1, TopExp_Explorer jarg1_);
+ public final static native void delete_TopExp_Explorer(long jarg1);
+ public final static native long new_Bnd_Box();
+ public final static native boolean Bnd_Box_isVoid(long jarg1, Bnd_Box jarg1_);
+ public final static native void Bnd_Box_get(long jarg1, Bnd_Box jarg1_, double[] jarg2);
+ public final static native void delete_Bnd_Box(long jarg1);
+ public final static native void BRepBndLib_add(long jarg1, TopoDS_Shape jarg1_, long jarg2, Bnd_Box jarg2_);
+ public final static native long new_BRepBndLib();
+ public final static native void delete_BRepBndLib(long jarg1);
+ public final static native double[] Adaptor2d_Curve2d_value(long jarg1, Adaptor2d_Curve2d jarg1_, double jarg2);
+ public final static native void delete_Adaptor2d_Curve2d(long jarg1);
+ public final static native long new_Geom2dAdaptor_Curve__SWIG_0();
+ public final static native long new_Geom2dAdaptor_Curve__SWIG_1(long jarg1, Geom2d_Curve jarg1_);
+ public final static native long new_Geom2dAdaptor_Curve__SWIG_2(long jarg1, Geom2d_Curve jarg1_, double jarg2, double jarg3);
+ public final static native void Geom2dAdaptor_Curve_load__SWIG_0(long jarg1, Geom2dAdaptor_Curve jarg1_, long jarg2, Geom2d_Curve jarg2_);
+ public final static native void Geom2dAdaptor_Curve_load__SWIG_1(long jarg1, Geom2dAdaptor_Curve jarg1_, long jarg2, Geom2d_Curve jarg2_, double jarg3, double jarg4);
+ public final static native void delete_Geom2dAdaptor_Curve(long jarg1);
+ public final static native double[] Adaptor3d_Curve_value(long jarg1, Adaptor3d_Curve jarg1_, double jarg2);
+ public final static native void Adaptor3d_Curve_arrayValues(long jarg1, Adaptor3d_Curve jarg1_, int jarg2, double[] jarg3);
+ public final static native void delete_Adaptor3d_Curve(long jarg1);
+ public final static native long new_GeomAdaptor_Curve__SWIG_0();
+ public final static native long new_GeomAdaptor_Curve__SWIG_1(long jarg1, Geom_Curve jarg1_);
+ public final static native long new_GeomAdaptor_Curve__SWIG_2(long jarg1, Geom_Curve jarg1_, double jarg2, double jarg3);
+ public final static native void GeomAdaptor_Curve_load__SWIG_0(long jarg1, GeomAdaptor_Curve jarg1_, long jarg2, Geom_Curve jarg2_);
+ public final static native void GeomAdaptor_Curve_load__SWIG_1(long jarg1, GeomAdaptor_Curve jarg1_, long jarg2, Geom_Curve jarg2_, double jarg3, double jarg4);
+ public final static native void delete_GeomAdaptor_Curve(long jarg1);
+ public final static native long new_GProp_GProps();
+ public final static native double GProp_GProps_mass(long jarg1, GProp_GProps jarg1_);
+ public final static native double[] GProp_GProps_centreOfMass(long jarg1, GProp_GProps jarg1_);
+ public final static native double[] GProp_GProps_matrixOfInertia(long jarg1, GProp_GProps jarg1_);
+ public final static native void delete_GProp_GProps(long jarg1);
+ public final static native long new_GProp_PGProps();
+ public final static native void delete_GProp_PGProps(long jarg1);
+ public final static native long new_GProp_CelGProps();
+ public final static native void delete_GProp_CelGProps(long jarg1);
+ public final static native long new_GProp_SelGProps();
+ public final static native void delete_GProp_SelGProps(long jarg1);
+ public final static native long new_GProp_VelGProps();
+ public final static native void delete_GProp_VelGProps(long jarg1);
+ public final static native void BRepGProp_linearProperties(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);
+ public final static native void BRepGProp_volumeProperties__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, boolean jarg3);
+ public final static native void BRepGProp_volumeProperties__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);
+ public final static native double BRepGProp_volumeProperties__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4);
+ public final static native double BRepGProp_volumeProperties__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);
+ public final static native void BRepGProp_surfaceProperties__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_);
+ public final static native double BRepGProp_surfaceProperties__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);
+ public final static native double BRepGProp_volumePropertiesGK__SWIG_0(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5, boolean jarg6, boolean jarg7);
+ public final static native double BRepGProp_volumePropertiesGK__SWIG_1(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5, boolean jarg6);
+ public final static native double BRepGProp_volumePropertiesGK__SWIG_2(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4, boolean jarg5);
+ public final static native double BRepGProp_volumePropertiesGK__SWIG_3(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3, boolean jarg4);
+ public final static native double BRepGProp_volumePropertiesGK__SWIG_4(long jarg1, TopoDS_Shape jarg1_, long jarg2, GProp_GProps jarg2_, double jarg3);
+ public final static native long new_BRepGProp();
+ public final static native void delete_BRepGProp(long jarg1);
+ public final static native long new_ShapeAnalysis_FreeBounds__SWIG_0(long jarg1, TopoDS_Shape jarg1_, boolean jarg2, boolean jarg3);
+ public final static native long new_ShapeAnalysis_FreeBounds__SWIG_1(long jarg1, TopoDS_Shape jarg1_, boolean jarg2);
+ public final static native long new_ShapeAnalysis_FreeBounds__SWIG_2(long jarg1, TopoDS_Shape jarg1_);
+ public final static native long ShapeAnalysis_FreeBounds_getClosedWires(long jarg1, ShapeAnalysis_FreeBounds jarg1_);
+ public final static native long ShapeAnalysis_FreeBounds_getOpenWires(long jarg1, ShapeAnalysis_FreeBounds jarg1_);
+ public final static native void delete_ShapeAnalysis_FreeBounds(long jarg1);
+ public final static native long new_GCPnts_UniformDeflection();
+ public final static native void GCPnts_UniformDeflection_initialize__SWIG_0(long jarg1, GCPnts_UniformDeflection jarg1_, long jarg2, Adaptor3d_Curve jarg2_, double jarg3, double jarg4, double jarg5, boolean jarg6);
+ public final static native void GCPnts_UniformDeflection_initialize__SWIG_1(long jarg1, GCPnts_UniformDeflection jarg1_, long jarg2, Adaptor3d_Curve jarg2_, double jarg3, double jarg4, double jarg5);
+ public final static native int GCPnts_UniformDeflection_nbPoints(long jarg1, GCPnts_UniformDeflection jarg1_);
+ public final static native double GCPnts_UniformDeflection_parameter(long jarg1, GCPnts_UniformDeflection jarg1_, int jarg2);
+ public final static native void delete_GCPnts_UniformDeflection(long jarg1);
+ public final static native void BRepMesh_DiscretRoot_perform(long jarg1, BRepMesh_DiscretRoot jarg1_);
+ public final static native void delete_BRepMesh_DiscretRoot(long jarg1);
+ public final static native long new_BRepMesh_IncrementalMesh__SWIG_0();
+ public final static native long new_BRepMesh_IncrementalMesh__SWIG_1(long jarg1, TopoDS_Shape jarg1_, double jarg2, boolean jarg3, double jarg4);
+ public final static native long new_BRepMesh_IncrementalMesh__SWIG_2(long jarg1, TopoDS_Shape jarg1_, double jarg2, boolean jarg3);
+ public final static native long new_BRepMesh_IncrementalMesh__SWIG_3(long jarg1, TopoDS_Shape jarg1_, double jarg2);
+ public final static native void BRepMesh_IncrementalMesh_perform(long jarg1, BRepMesh_IncrementalMesh jarg1_);
+ public final static native boolean BRepMesh_IncrementalMesh_isModified(long jarg1, BRepMesh_IncrementalMesh jarg1_);
+ public final static native void delete_BRepMesh_IncrementalMesh(long jarg1);
+ public final static native long new_GeomAPI_ProjectPointOnSurf(double[] jarg1, long jarg2, Geom_Surface jarg2_);
+ public final static native void GeomAPI_ProjectPointOnSurf_init(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, double[] jarg2, long jarg3, Geom_Surface jarg3_);
+ public final static native int GeomAPI_ProjectPointOnSurf_nbPoints(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);
+ public final static native double GeomAPI_ProjectPointOnSurf_lowerDistance(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);
+ public final static native double[] GeomAPI_ProjectPointOnSurf_point(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, int jarg2);
+ public final static native void GeomAPI_ProjectPointOnSurf_lowerDistanceParameters(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, double[] jarg2, double[] jarg3);
+ public final static native void GeomAPI_ProjectPointOnSurf_parameters(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_, int jarg2, double[] jarg3, double[] jarg4);
+ public final static native double[] GeomAPI_ProjectPointOnSurf_nearestPoint(long jarg1, GeomAPI_ProjectPointOnSurf jarg1_);
+ public final static native void delete_GeomAPI_ProjectPointOnSurf(long jarg1);
+ public final static native boolean BRepAlgo_isValid(long jarg1, TopoDS_Shape jarg1_);
+ public final static native boolean BRepAlgo_isTopologicallyValid(long jarg1, TopoDS_Shape jarg1_);
+ public final static native long new_BRepAlgo();
+ public final static native void delete_BRepAlgo(long jarg1);
+ public final static native long TopoDS_Compound_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_CompSolid_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Solid_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Shell_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Face_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Wire_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Edge_SWIGUpcast(long jarg1);
+ public final static native long TopoDS_Vertex_SWIGUpcast(long jarg1);
+ public final static native long BRep_Builder_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeShape_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_ModifyShape_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_Transform_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeVertex_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeWire_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeEdge_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeFace_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeSolid_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_NurbsConvert_SWIGUpcast(long jarg1);
+ public final static native long BRepOffsetAPI_ThruSections_SWIGUpcast(long jarg1);
+ public final static native long BRepBuilderAPI_MakeShell_SWIGUpcast(long jarg1);
+ public final static native long BRepOffsetAPI_NormalProjection_SWIGUpcast(long jarg1);
+ public final static native long BRepOffsetAPI_MakeThickSolid_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeBox_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeCone_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeCylinder_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeTorus_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeSphere_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeSweep_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakePrism_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeRevol_SWIGUpcast(long jarg1);
+ public final static native long BRepOffsetAPI_MakePipe_SWIGUpcast(long jarg1);
+ public final static native long BRepPrimAPI_MakeWedge_SWIGUpcast(long jarg1);
+ public final static native long BRepAlgoAPI_BooleanOperation_SWIGUpcast(long jarg1);
+ public final static native long BRepAlgoAPI_Fuse_SWIGUpcast(long jarg1);
+ public final static native long BRepAlgoAPI_Common_SWIGUpcast(long jarg1);
+ public final static native long BRepAlgoAPI_Cut_SWIGUpcast(long jarg1);
+ public final static native long BRepAlgoAPI_Section_SWIGUpcast(long jarg1);
+ public final static native long BRepFilletAPI_LocalOperation_SWIGUpcast(long jarg1);
+ public final static native long BRepFilletAPI_MakeFillet_SWIGUpcast(long jarg1);
+ public final static native long BRepFilletAPI_MakeChamfer_SWIGUpcast(long jarg1);
+ public final static native long STEPControl_Reader_SWIGUpcast(long jarg1);
+ public final static native long IGESControl_Reader_SWIGUpcast(long jarg1);
+ public final static native long ShapeFix_Wireframe_SWIGUpcast(long jarg1);
+ public final static native long ShapeUpgrade_RemoveInternalWires_SWIGUpcast(long jarg1);
+ public final static native long ShapeUpgrade_ShapeDivideArea_SWIGUpcast(long jarg1);
+ public final static native long GC_MakeArcOfCircle_SWIGUpcast(long jarg1);
+ public final static native long GC_MakeSegment_SWIGUpcast(long jarg1);
+ public final static native long GC_MakeArcOfEllipse_SWIGUpcast(long jarg1);
+ public final static native long Geom2dAdaptor_Curve_SWIGUpcast(long jarg1);
+ public final static native long GeomAdaptor_Curve_SWIGUpcast(long jarg1);
+ public final static native long GProp_PGProps_SWIGUpcast(long jarg1);
+ public final static native long GProp_CelGProps_SWIGUpcast(long jarg1);
+ public final static native long GProp_SelGProps_SWIGUpcast(long jarg1);
+ public final static native long GProp_VelGProps_SWIGUpcast(long jarg1);
+ public final static native long BRepMesh_IncrementalMesh_SWIGUpcast(long jarg1);
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class Poly_Triangulation {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public Poly_Triangulation(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(Poly_Triangulation obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_Poly_Triangulation(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public Poly_Triangulation(int nbNodes, int nbTriangles, boolean UVNodes) {\r
- this(OccJavaJNI.new_Poly_Triangulation(nbNodes, nbTriangles, UVNodes), true);\r
- }\r
-\r
- public double deflection() {\r
- return OccJavaJNI.Poly_Triangulation_deflection__SWIG_0(swigCPtr, this);\r
- }\r
-\r
- public void deflection(double D) {\r
- OccJavaJNI.Poly_Triangulation_deflection__SWIG_1(swigCPtr, this, D);\r
- }\r
-\r
- public void removeUVNodes() {\r
- OccJavaJNI.Poly_Triangulation_removeUVNodes(swigCPtr, this);\r
- }\r
-\r
- public int nbNodes() {\r
- return OccJavaJNI.Poly_Triangulation_nbNodes(swigCPtr, this);\r
- }\r
-\r
- public int nbTriangles() {\r
- return OccJavaJNI.Poly_Triangulation_nbTriangles(swigCPtr, this);\r
- }\r
-\r
- public boolean hasUVNodes() {\r
- return OccJavaJNI.Poly_Triangulation_hasUVNodes(swigCPtr, this);\r
-}\r
-\r
- public int[] triangles() {\r
- return OccJavaJNI.Poly_Triangulation_triangles(swigCPtr, this);\r
-}\r
-\r
- public double[] nodes() {\r
- return OccJavaJNI.Poly_Triangulation_nodes(swigCPtr, this);\r
-}\r
-\r
- public double[] uvNodes() {\r
- return OccJavaJNI.Poly_Triangulation_uvNodes(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class Poly_Triangulation {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected Poly_Triangulation(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(Poly_Triangulation obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_Poly_Triangulation(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public Poly_Triangulation(int nbNodes, int nbTriangles, boolean UVNodes) {
+ this(OccJavaJNI.new_Poly_Triangulation(nbNodes, nbTriangles, UVNodes), true);
+ }
+
+ public double deflection() {
+ return OccJavaJNI.Poly_Triangulation_deflection__SWIG_0(swigCPtr, this);
+ }
+
+ public void deflection(double D) {
+ OccJavaJNI.Poly_Triangulation_deflection__SWIG_1(swigCPtr, this, D);
+ }
+
+ public void removeUVNodes() {
+ OccJavaJNI.Poly_Triangulation_removeUVNodes(swigCPtr, this);
+ }
+
+ public int nbNodes() {
+ return OccJavaJNI.Poly_Triangulation_nbNodes(swigCPtr, this);
+ }
+
+ public int nbTriangles() {
+ return OccJavaJNI.Poly_Triangulation_nbTriangles(swigCPtr, this);
+ }
+
+ public boolean hasUVNodes() {
+ return OccJavaJNI.Poly_Triangulation_hasUVNodes(swigCPtr, this);
+}
+
+ public int[] triangles() {
+ return OccJavaJNI.Poly_Triangulation_triangles(swigCPtr, this);
+}
+
+ public double[] nodes() {
+ return OccJavaJNI.Poly_Triangulation_nodes(swigCPtr, this);
+}
+
+ public double[] uvNodes() {
+ return OccJavaJNI.Poly_Triangulation_uvNodes(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class STEPControl_Reader extends XSControl_Reader {\r
- private long swigCPtr;\r
-\r
- public STEPControl_Reader(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.STEPControl_Reader_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(STEPControl_Reader obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_STEPControl_Reader(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public STEPControl_Reader() {\r
- this(OccJavaJNI.new_STEPControl_Reader(), true);\r
- }\r
-\r
- public String getLabel(TopoDS_Shape theShape) {\r
- return OccJavaJNI.STEPControl_Reader_getLabel(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class STEPControl_Reader extends XSControl_Reader {
+ private transient long swigCPtr;
+
+ protected STEPControl_Reader(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.STEPControl_Reader_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(STEPControl_Reader obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_STEPControl_Reader(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public STEPControl_Reader() {
+ this(OccJavaJNI.new_STEPControl_Reader(), true);
+ }
+
+ public String getLabel(TopoDS_Shape theShape) {
+ return OccJavaJNI.STEPControl_Reader_getLabel(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum STEPControl_StepModelType {\r
- AsIs,\r
- ManifoldSolidBrep,\r
- BrepWithVoids,\r
- FacetedBrep,\r
- FacetedBrepAndBrepWithVoids,\r
- ShellBasedSurfaceModel,\r
- GeometricCurveSet,\r
- Hybrid;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static STEPControl_StepModelType swigToEnum(int swigValue) {\r
- STEPControl_StepModelType[] swigValues = STEPControl_StepModelType.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (STEPControl_StepModelType swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + STEPControl_StepModelType.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private STEPControl_StepModelType() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private STEPControl_StepModelType(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private STEPControl_StepModelType(STEPControl_StepModelType swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum STEPControl_StepModelType {
+ AsIs,
+ ManifoldSolidBrep,
+ BrepWithVoids,
+ FacetedBrep,
+ FacetedBrepAndBrepWithVoids,
+ ShellBasedSurfaceModel,
+ GeometricCurveSet,
+ Hybrid;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static STEPControl_StepModelType swigToEnum(int swigValue) {
+ STEPControl_StepModelType[] swigValues = STEPControl_StepModelType.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (STEPControl_StepModelType swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + STEPControl_StepModelType.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private STEPControl_StepModelType() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private STEPControl_StepModelType(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private STEPControl_StepModelType(STEPControl_StepModelType swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class STEPControl_Writer {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public STEPControl_Writer(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(STEPControl_Writer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_STEPControl_Writer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public STEPControl_Writer() {\r
- this(OccJavaJNI.new_STEPControl_Writer(), true);\r
- }\r
-\r
- public IFSelect_ReturnStatus write(String filename) {\r
- return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.STEPControl_Writer_write(swigCPtr, this, filename));\r
- }\r
-\r
- public IFSelect_ReturnStatus transfer(TopoDS_Shape theShape, STEPControl_StepModelType mode) {\r
- return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.STEPControl_Writer_transfer(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape, mode.swigValue()));\r
- }\r
-\r
- public SWIGTYPE_p_Handle_StepData_StepModel model(boolean newone) {\r
- return new SWIGTYPE_p_Handle_StepData_StepModel(OccJavaJNI.STEPControl_Writer_model(swigCPtr, this, newone), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class STEPControl_Writer {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected STEPControl_Writer(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(STEPControl_Writer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_STEPControl_Writer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public STEPControl_Writer() {
+ this(OccJavaJNI.new_STEPControl_Writer(), true);
+ }
+
+ public IFSelect_ReturnStatus write(String filename) {
+ return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.STEPControl_Writer_write(swigCPtr, this, filename));
+ }
+
+ public IFSelect_ReturnStatus transfer(TopoDS_Shape theShape, STEPControl_StepModelType mode) {
+ return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.STEPControl_Writer_transfer(swigCPtr, this, TopoDS_Shape.getCPtr(theShape), theShape, mode.swigValue()));
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_BRepBuilderAPI_FaceError {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_BRepBuilderAPI_FaceError(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_BRepBuilderAPI_FaceError() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_BRepBuilderAPI_FaceError obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 4.0.0
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_BRepBuilderAPI_FaceError {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_BRepBuilderAPI_FaceError(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_BRepBuilderAPI_FaceError() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_BRepBuilderAPI_FaceError obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_BRepBuilderAPI_ShellError {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_BRepBuilderAPI_ShellError(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_BRepBuilderAPI_ShellError() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_BRepBuilderAPI_ShellError obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_BRepBuilderAPI_ShellError {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_BRepBuilderAPI_ShellError(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_BRepBuilderAPI_ShellError() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_BRepBuilderAPI_ShellError obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_GeomAbs_JoinType {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_GeomAbs_JoinType(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_GeomAbs_JoinType() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_GeomAbs_JoinType obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_GeomAbs_JoinType {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_GeomAbs_JoinType(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_GeomAbs_JoinType() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_GeomAbs_JoinType obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
--- /dev/null
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_Handle_Geom_BoundedCurve {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_Handle_Geom_BoundedCurve(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_Handle_Geom_BoundedCurve() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_Handle_Geom_BoundedCurve obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_Handle_StepData_StepModel {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_Handle_StepData_StepModel(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_Handle_StepData_StepModel() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_Handle_StepData_StepModel obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_Handle_StepData_StepModel {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_Handle_StepData_StepModel(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_Handle_StepData_StepModel() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_Handle_StepData_StepModel obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_Handle_TCollection_HAsciiString {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_Handle_TCollection_HAsciiString(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_Handle_TCollection_HAsciiString() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_Handle_TCollection_HAsciiString obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_Handle_TCollection_HAsciiString {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_Handle_TCollection_HAsciiString(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_Handle_TCollection_HAsciiString() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_Handle_TCollection_HAsciiString obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
--- /dev/null
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_Standard_Realr {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_Standard_Realr(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_Standard_Realr() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_Standard_Realr obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_TColStd_Array1OfInteger {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_TColStd_Array1OfInteger(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_TColStd_Array1OfInteger() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_TColStd_Array1OfInteger obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_TColStd_Array1OfInteger {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_TColStd_Array1OfInteger(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_TColStd_Array1OfInteger() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_TColStd_Array1OfInteger obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_TopTools_ListOfShape {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_TopTools_ListOfShape(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_TopTools_ListOfShape() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_TopTools_ListOfShape obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_TopTools_ListOfShape {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_TopTools_ListOfShape(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_TopTools_ListOfShape() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_TopTools_ListOfShape obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_gp_Hypr {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_gp_Hypr(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_gp_Hypr() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_gp_Hypr obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_gp_Hypr {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_gp_Hypr(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_gp_Hypr() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_gp_Hypr obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class SWIGTYPE_p_int {\r
- private long swigCPtr;\r
-\r
- protected SWIGTYPE_p_int(long cPtr, boolean futureUse) {\r
- swigCPtr = cPtr;\r
- }\r
-\r
- protected SWIGTYPE_p_int() {\r
- swigCPtr = 0;\r
- }\r
-\r
- protected static long getCPtr(SWIGTYPE_p_int obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class SWIGTYPE_p_int {
+ private transient long swigCPtr;
+
+ protected SWIGTYPE_p_int(long cPtr, @SuppressWarnings("unused") boolean futureUse) {
+ swigCPtr = cPtr;
+ }
+
+ protected SWIGTYPE_p_int() {
+ swigCPtr = 0;
+ }
+
+ protected static long getCPtr(SWIGTYPE_p_int obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeAnalysis_FreeBounds {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public ShapeAnalysis_FreeBounds(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeAnalysis_FreeBounds obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeAnalysis_FreeBounds(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public ShapeAnalysis_FreeBounds(TopoDS_Shape shape, boolean splitclosed, boolean splitopen) {\r
- this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, splitclosed, splitopen), true);\r
- }\r
-\r
- public ShapeAnalysis_FreeBounds(TopoDS_Shape shape, boolean splitclosed) {\r
- this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, splitclosed), true);\r
- }\r
-\r
- public ShapeAnalysis_FreeBounds(TopoDS_Shape shape) {\r
- this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_2(TopoDS_Shape.getCPtr(shape), shape), true);\r
- }\r
-\r
- public TopoDS_Compound getClosedWires() {\r
- long cPtr = OccJavaJNI.ShapeAnalysis_FreeBounds_getClosedWires(swigCPtr, this);\r
- return (TopoDS_Compound)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public TopoDS_Compound getOpenWires() {\r
- long cPtr = OccJavaJNI.ShapeAnalysis_FreeBounds_getOpenWires(swigCPtr, this);\r
- return (TopoDS_Compound)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeAnalysis_FreeBounds {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected ShapeAnalysis_FreeBounds(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeAnalysis_FreeBounds obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeAnalysis_FreeBounds(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public ShapeAnalysis_FreeBounds(TopoDS_Shape shape, boolean splitclosed, boolean splitopen) {
+ this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_0(TopoDS_Shape.getCPtr(shape), shape, splitclosed, splitopen), true);
+ }
+
+ public ShapeAnalysis_FreeBounds(TopoDS_Shape shape, boolean splitclosed) {
+ this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_1(TopoDS_Shape.getCPtr(shape), shape, splitclosed), true);
+ }
+
+ public ShapeAnalysis_FreeBounds(TopoDS_Shape shape) {
+ this(OccJavaJNI.new_ShapeAnalysis_FreeBounds__SWIG_2(TopoDS_Shape.getCPtr(shape), shape), true);
+ }
+
+ public TopoDS_Compound getClosedWires() {
+ long cPtr = OccJavaJNI.ShapeAnalysis_FreeBounds_getClosedWires(swigCPtr, this);
+ return (TopoDS_Compound)TopoDS_Shape.create(cPtr);
+}
+
+ public TopoDS_Compound getOpenWires() {
+ long cPtr = OccJavaJNI.ShapeAnalysis_FreeBounds_getOpenWires(swigCPtr, this);
+ return (TopoDS_Compound)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeBuild_ReShape {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public ShapeBuild_ReShape(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeBuild_ReShape obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeBuild_ReShape(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public ShapeBuild_ReShape() {\r
- this(OccJavaJNI.new_ShapeBuild_ReShape(), true);\r
- }\r
-\r
- public void replace(TopoDS_Shape shape, TopoDS_Shape newshape, boolean oriented) {\r
- OccJavaJNI.ShapeBuild_ReShape_replace__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape, TopoDS_Shape.getCPtr(newshape), newshape, oriented);\r
- }\r
-\r
- public void replace(TopoDS_Shape shape, TopoDS_Shape newshape) {\r
- OccJavaJNI.ShapeBuild_ReShape_replace__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape, TopoDS_Shape.getCPtr(newshape), newshape);\r
- }\r
-\r
- public TopoDS_Shape apply(TopoDS_Shape shape, TopAbs_ShapeEnum until) {\r
- long cPtr = OccJavaJNI.ShapeBuild_ReShape_apply__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape, until.swigValue());\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public TopoDS_Shape apply(TopoDS_Shape shape) {\r
- long cPtr = OccJavaJNI.ShapeBuild_ReShape_apply__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeBuild_ReShape {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected ShapeBuild_ReShape(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeBuild_ReShape obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeBuild_ReShape(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public ShapeBuild_ReShape() {
+ this(OccJavaJNI.new_ShapeBuild_ReShape(), true);
+ }
+
+ public void replace(TopoDS_Shape shape, TopoDS_Shape newshape) {
+ OccJavaJNI.ShapeBuild_ReShape_replace(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape, TopoDS_Shape.getCPtr(newshape), newshape);
+ }
+
+ public TopoDS_Shape apply(TopoDS_Shape shape, TopAbs_ShapeEnum until) {
+ long cPtr = OccJavaJNI.ShapeBuild_ReShape_apply__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape, until.swigValue());
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public TopoDS_Shape apply(TopoDS_Shape shape) {
+ long cPtr = OccJavaJNI.ShapeBuild_ReShape_apply__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(shape), shape);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeFix_Root {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public ShapeFix_Root(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeFix_Root obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeFix_Root(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public void setPrecision(double preci) {\r
- OccJavaJNI.ShapeFix_Root_setPrecision(swigCPtr, this, preci);\r
- }\r
-\r
- public double getPrecision() {\r
- return OccJavaJNI.ShapeFix_Root_getPrecision(swigCPtr, this);\r
- }\r
-\r
- public void setContext(ShapeBuild_ReShape context) {\r
- OccJavaJNI.ShapeFix_Root_setContext(swigCPtr, this, ShapeBuild_ReShape.getCPtr(context), context);\r
- }\r
-\r
- public ShapeBuild_ReShape getContext() {\r
- long cPtr = OccJavaJNI.ShapeFix_Root_getContext(swigCPtr, this);\r
- return (cPtr == 0) ? null : new ShapeBuild_ReShape(cPtr, false);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeFix_Root {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected ShapeFix_Root(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeFix_Root obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeFix_Root(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public void setPrecision(double preci) {
+ OccJavaJNI.ShapeFix_Root_setPrecision(swigCPtr, this, preci);
+ }
+
+ public double getPrecision() {
+ return OccJavaJNI.ShapeFix_Root_getPrecision(swigCPtr, this);
+ }
+
+ public void setContext(ShapeBuild_ReShape context) {
+ OccJavaJNI.ShapeFix_Root_setContext(swigCPtr, this, ShapeBuild_ReShape.getCPtr(context), context);
+ }
+
+ public ShapeBuild_ReShape getContext() {
+ long cPtr = OccJavaJNI.ShapeFix_Root_getContext(swigCPtr, this);
+ return (cPtr == 0) ? null : new ShapeBuild_ReShape(cPtr, false);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeFix_Wireframe extends ShapeFix_Root {\r
- private long swigCPtr;\r
-\r
- public ShapeFix_Wireframe(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.ShapeFix_Wireframe_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeFix_Wireframe obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeFix_Wireframe(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public ShapeFix_Wireframe(TopoDS_Shape shape) {\r
- this(OccJavaJNI.new_ShapeFix_Wireframe(TopoDS_Shape.getCPtr(shape), shape), true);\r
- }\r
-\r
- \r
- /** \r
- * Fixes gaps between ends of curves of adjacent edges (both 3d and pcurves)\r
- * in wires. If precision is 0.0, uses Precision::Confusion().\r
- */\r
- public boolean fixWireGaps() {\r
- return OccJavaJNI.ShapeFix_Wireframe_fixWireGaps(swigCPtr, this);\r
-}\r
-\r
- \r
- /**\r
- * Fixes small edges in shape by merging adjacent edges.\r
- * If precision is 0.0, uses Precision::Confusion().\r
- */\r
- public boolean fixSmallEdges() {\r
- return OccJavaJNI.ShapeFix_Wireframe_fixSmallEdges(swigCPtr, this);\r
-}\r
-\r
- \r
- /**\r
- * If two edges makes an angle greater this angle, these two edges\r
- * will be not merged.\r
- */\r
- public void setLimitAngle(double theLimitAngle) {\r
- OccJavaJNI.ShapeFix_Wireframe_setLimitAngle(swigCPtr, this, theLimitAngle);\r
- }\r
-\r
- public double getLimitAngle() {\r
- return OccJavaJNI.ShapeFix_Wireframe_getLimitAngle(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape shape() {\r
- long cPtr = OccJavaJNI.ShapeFix_Wireframe_shape(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public void setDropSmallEdges(boolean b) {\r
- OccJavaJNI.ShapeFix_Wireframe_setDropSmallEdges(swigCPtr, this, b);\r
- }\r
-\r
- public boolean getDropSmallEdges() {\r
- return OccJavaJNI.ShapeFix_Wireframe_getDropSmallEdges(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeFix_Wireframe extends ShapeFix_Root {
+ private transient long swigCPtr;
+
+ protected ShapeFix_Wireframe(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.ShapeFix_Wireframe_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeFix_Wireframe obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeFix_Wireframe(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public ShapeFix_Wireframe(TopoDS_Shape shape) {
+ this(OccJavaJNI.new_ShapeFix_Wireframe(TopoDS_Shape.getCPtr(shape), shape), true);
+ }
+
+
+ /**
+ * Fixes gaps between ends of curves of adjacent edges (both 3d and pcurves)
+ * in wires. If precision is 0.0, uses Precision::Confusion().
+ */
+ public boolean fixWireGaps() {
+ return OccJavaJNI.ShapeFix_Wireframe_fixWireGaps(swigCPtr, this);
+}
+
+
+ /**
+ * Fixes small edges in shape by merging adjacent edges.
+ * If precision is 0.0, uses Precision::Confusion().
+ */
+ public boolean fixSmallEdges() {
+ return OccJavaJNI.ShapeFix_Wireframe_fixSmallEdges(swigCPtr, this);
+}
+
+
+ /**
+ * If two edges makes an angle greater this angle, these two edges
+ * will be not merged.
+ */
+ public void setLimitAngle(double theLimitAngle) {
+ OccJavaJNI.ShapeFix_Wireframe_setLimitAngle(swigCPtr, this, theLimitAngle);
+ }
+
+ public double getLimitAngle() {
+ return OccJavaJNI.ShapeFix_Wireframe_getLimitAngle(swigCPtr, this);
+ }
+
+ public TopoDS_Shape shape() {
+ long cPtr = OccJavaJNI.ShapeFix_Wireframe_shape(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public void setDropSmallEdges(boolean b) {
+ OccJavaJNI.ShapeFix_Wireframe_setDropSmallEdges(swigCPtr, this, b);
+ }
+
+ public boolean getDropSmallEdges() {
+ return OccJavaJNI.ShapeFix_Wireframe_getDropSmallEdges(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeUpgrade_RemoveInternalWires extends ShapeUpgrade_Tool {\r
- private long swigCPtr;\r
-\r
- public ShapeUpgrade_RemoveInternalWires(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.ShapeUpgrade_RemoveInternalWires_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeUpgrade_RemoveInternalWires obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeUpgrade_RemoveInternalWires(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public ShapeUpgrade_RemoveInternalWires(TopoDS_Shape theShape) {\r
- this(OccJavaJNI.new_ShapeUpgrade_RemoveInternalWires(TopoDS_Shape.getCPtr(theShape), theShape), true);\r
- }\r
-\r
- public boolean perform() {\r
- return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_perform(swigCPtr, this);\r
-}\r
-\r
- public TopoDS_Shape getResult() {\r
- long cPtr = OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getResult(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public void setMinArea(double d) {\r
- OccJavaJNI.ShapeUpgrade_RemoveInternalWires_setMinArea(swigCPtr, this, d);\r
- }\r
-\r
- public double getMinArea() {\r
- return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getMinArea(swigCPtr, this);\r
- }\r
-\r
- public void setRemoveFaceMode(boolean b) {\r
- OccJavaJNI.ShapeUpgrade_RemoveInternalWires_setRemoveFaceMode(swigCPtr, this, b);\r
- }\r
-\r
- public boolean getRemoveFaceMode() {\r
- return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getRemoveFaceMode(swigCPtr, this);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeUpgrade_RemoveInternalWires extends ShapeUpgrade_Tool {
+ private transient long swigCPtr;
+
+ protected ShapeUpgrade_RemoveInternalWires(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.ShapeUpgrade_RemoveInternalWires_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeUpgrade_RemoveInternalWires obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeUpgrade_RemoveInternalWires(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public ShapeUpgrade_RemoveInternalWires(TopoDS_Shape theShape) {
+ this(OccJavaJNI.new_ShapeUpgrade_RemoveInternalWires(TopoDS_Shape.getCPtr(theShape), theShape), true);
+ }
+
+ public boolean perform() {
+ return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_perform(swigCPtr, this);
+}
+
+ public TopoDS_Shape getResult() {
+ long cPtr = OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getResult(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public void setMinArea(double d) {
+ OccJavaJNI.ShapeUpgrade_RemoveInternalWires_setMinArea(swigCPtr, this, d);
+ }
+
+ public double getMinArea() {
+ return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getMinArea(swigCPtr, this);
+ }
+
+ public void setRemoveFaceMode(boolean b) {
+ OccJavaJNI.ShapeUpgrade_RemoveInternalWires_setRemoveFaceMode(swigCPtr, this, b);
+ }
+
+ public boolean getRemoveFaceMode() {
+ return OccJavaJNI.ShapeUpgrade_RemoveInternalWires_getRemoveFaceMode(swigCPtr, this);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeUpgrade_ShapeDivide {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public ShapeUpgrade_ShapeDivide(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeUpgrade_ShapeDivide obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeUpgrade_ShapeDivide(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public TopoDS_Shape getResult() {\r
- long cPtr = OccJavaJNI.ShapeUpgrade_ShapeDivide_getResult(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public boolean perform(boolean newContext) {\r
- return OccJavaJNI.ShapeUpgrade_ShapeDivide_perform__SWIG_0(swigCPtr, this, newContext);\r
-}\r
-\r
- public boolean perform() {\r
- return OccJavaJNI.ShapeUpgrade_ShapeDivide_perform__SWIG_1(swigCPtr, this);\r
-}\r
-\r
- public ShapeUpgrade_ShapeDivide() {\r
- this(OccJavaJNI.new_ShapeUpgrade_ShapeDivide(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeUpgrade_ShapeDivide {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected ShapeUpgrade_ShapeDivide(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeUpgrade_ShapeDivide obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeUpgrade_ShapeDivide(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public TopoDS_Shape getResult() {
+ long cPtr = OccJavaJNI.ShapeUpgrade_ShapeDivide_getResult(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public boolean perform(boolean newContext) {
+ return OccJavaJNI.ShapeUpgrade_ShapeDivide_perform__SWIG_0(swigCPtr, this, newContext);
+}
+
+ public boolean perform() {
+ return OccJavaJNI.ShapeUpgrade_ShapeDivide_perform__SWIG_1(swigCPtr, this);
+}
+
+ public ShapeUpgrade_ShapeDivide() {
+ this(OccJavaJNI.new_ShapeUpgrade_ShapeDivide(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeUpgrade_ShapeDivideArea extends ShapeUpgrade_ShapeDivide {\r
- private long swigCPtr;\r
-\r
- public ShapeUpgrade_ShapeDivideArea(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.ShapeUpgrade_ShapeDivideArea_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeUpgrade_ShapeDivideArea obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeUpgrade_ShapeDivideArea(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public ShapeUpgrade_ShapeDivideArea(TopoDS_Shape S) {\r
- this(OccJavaJNI.new_ShapeUpgrade_ShapeDivideArea(TopoDS_Shape.getCPtr(S), S), true);\r
- }\r
-\r
- public void setMaxArea(double d) {\r
- OccJavaJNI.ShapeUpgrade_ShapeDivideArea_setMaxArea(swigCPtr, this, d);\r
- }\r
-\r
- public double getMaxArea() {\r
- return OccJavaJNI.ShapeUpgrade_ShapeDivideArea_getMaxArea(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeUpgrade_ShapeDivideArea extends ShapeUpgrade_ShapeDivide {
+ private transient long swigCPtr;
+
+ protected ShapeUpgrade_ShapeDivideArea(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.ShapeUpgrade_ShapeDivideArea_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeUpgrade_ShapeDivideArea obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeUpgrade_ShapeDivideArea(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public ShapeUpgrade_ShapeDivideArea(TopoDS_Shape S) {
+ this(OccJavaJNI.new_ShapeUpgrade_ShapeDivideArea(TopoDS_Shape.getCPtr(S), S), true);
+ }
+
+ public void setMaxArea(double d) {
+ OccJavaJNI.ShapeUpgrade_ShapeDivideArea_setMaxArea(swigCPtr, this, d);
+ }
+
+ public double getMaxArea() {
+ return OccJavaJNI.ShapeUpgrade_ShapeDivideArea_getMaxArea(swigCPtr, this);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class ShapeUpgrade_Tool {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public ShapeUpgrade_Tool(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(ShapeUpgrade_Tool obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_ShapeUpgrade_Tool(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class ShapeUpgrade_Tool {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected ShapeUpgrade_Tool(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(ShapeUpgrade_Tool obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_ShapeUpgrade_Tool(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum TopAbs_Orientation {\r
- FORWARD,\r
- REVERSED,\r
- INTERNAL,\r
- EXTERNAL;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static TopAbs_Orientation swigToEnum(int swigValue) {\r
- TopAbs_Orientation[] swigValues = TopAbs_Orientation.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (TopAbs_Orientation swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + TopAbs_Orientation.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_Orientation() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_Orientation(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_Orientation(TopAbs_Orientation swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum TopAbs_Orientation {
+ FORWARD,
+ REVERSED,
+ INTERNAL,
+ EXTERNAL;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static TopAbs_Orientation swigToEnum(int swigValue) {
+ TopAbs_Orientation[] swigValues = TopAbs_Orientation.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (TopAbs_Orientation swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + TopAbs_Orientation.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_Orientation() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_Orientation(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_Orientation(TopAbs_Orientation swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public enum TopAbs_ShapeEnum {\r
- COMPOUND,\r
- COMPSOLID,\r
- SOLID,\r
- SHELL,\r
- FACE,\r
- WIRE,\r
- EDGE,\r
- VERTEX,\r
- SHAPE;\r
-\r
- public final int swigValue() {\r
- return swigValue;\r
- }\r
-\r
- public static TopAbs_ShapeEnum swigToEnum(int swigValue) {\r
- TopAbs_ShapeEnum[] swigValues = TopAbs_ShapeEnum.class.getEnumConstants();\r
- if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)\r
- return swigValues[swigValue];\r
- for (TopAbs_ShapeEnum swigEnum : swigValues)\r
- if (swigEnum.swigValue == swigValue)\r
- return swigEnum;\r
- throw new IllegalArgumentException("No enum " + TopAbs_ShapeEnum.class + " with value " + swigValue);\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_ShapeEnum() {\r
- this.swigValue = SwigNext.next++;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_ShapeEnum(int swigValue) {\r
- this.swigValue = swigValue;\r
- SwigNext.next = swigValue+1;\r
- }\r
-\r
- @SuppressWarnings("unused")\r
- private TopAbs_ShapeEnum(TopAbs_ShapeEnum swigEnum) {\r
- this.swigValue = swigEnum.swigValue;\r
- SwigNext.next = this.swigValue+1;\r
- }\r
-\r
- private final int swigValue;\r
-\r
- private static class SwigNext {\r
- private static int next = 0;\r
- }\r
-}\r
-\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public enum TopAbs_ShapeEnum {
+ COMPOUND,
+ COMPSOLID,
+ SOLID,
+ SHELL,
+ FACE,
+ WIRE,
+ EDGE,
+ VERTEX,
+ SHAPE;
+
+ public final int swigValue() {
+ return swigValue;
+ }
+
+ public static TopAbs_ShapeEnum swigToEnum(int swigValue) {
+ TopAbs_ShapeEnum[] swigValues = TopAbs_ShapeEnum.class.getEnumConstants();
+ if (swigValue < swigValues.length && swigValue >= 0 && swigValues[swigValue].swigValue == swigValue)
+ return swigValues[swigValue];
+ for (TopAbs_ShapeEnum swigEnum : swigValues)
+ if (swigEnum.swigValue == swigValue)
+ return swigEnum;
+ throw new IllegalArgumentException("No enum " + TopAbs_ShapeEnum.class + " with value " + swigValue);
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_ShapeEnum() {
+ this.swigValue = SwigNext.next++;
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_ShapeEnum(int swigValue) {
+ this.swigValue = swigValue;
+ SwigNext.next = swigValue+1;
+ }
+
+ @SuppressWarnings("unused")
+ private TopAbs_ShapeEnum(TopAbs_ShapeEnum swigEnum) {
+ this.swigValue = swigEnum.swigValue;
+ SwigNext.next = this.swigValue+1;
+ }
+
+ private final int swigValue;
+
+ private static class SwigNext {
+ private static int next = 0;
+ }
+}
+
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopExp {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopExp(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopExp obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopExp(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public static TopoDS_Vertex[] vertices(TopoDS_Edge edge)\r
- {\r
- TopoDS_Vertex first=new TopoDS_Vertex();\r
- TopoDS_Vertex second=new TopoDS_Vertex();\r
- vertices(edge, first, second);\r
- return new TopoDS_Vertex[]{first, second};\r
- }\r
-\r
- public static void vertices(TopoDS_Edge E, TopoDS_Vertex Vfirst, TopoDS_Vertex Vlast, boolean CumOri) {\r
- OccJavaJNI.TopExp_vertices__SWIG_0(TopoDS_Edge.getCPtr(E), E, TopoDS_Vertex.getCPtr(Vfirst), Vfirst, TopoDS_Vertex.getCPtr(Vlast), Vlast, CumOri);\r
- }\r
-\r
- public static void vertices(TopoDS_Edge E, TopoDS_Vertex Vfirst, TopoDS_Vertex Vlast) {\r
- OccJavaJNI.TopExp_vertices__SWIG_1(TopoDS_Edge.getCPtr(E), E, TopoDS_Vertex.getCPtr(Vfirst), Vfirst, TopoDS_Vertex.getCPtr(Vlast), Vlast);\r
- }\r
-\r
- public TopExp() {\r
- this(OccJavaJNI.new_TopExp(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopExp {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopExp(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopExp obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopExp(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public static TopoDS_Vertex[] vertices(TopoDS_Edge edge)
+ {
+ TopoDS_Vertex first=new TopoDS_Vertex();
+ TopoDS_Vertex second=new TopoDS_Vertex();
+ vertices(edge, first, second);
+ return new TopoDS_Vertex[]{first, second};
+ }
+
+ public static void vertices(TopoDS_Edge E, TopoDS_Vertex Vfirst, TopoDS_Vertex Vlast, boolean CumOri) {
+ OccJavaJNI.TopExp_vertices__SWIG_0(TopoDS_Edge.getCPtr(E), E, TopoDS_Vertex.getCPtr(Vfirst), Vfirst, TopoDS_Vertex.getCPtr(Vlast), Vlast, CumOri);
+ }
+
+ public static void vertices(TopoDS_Edge E, TopoDS_Vertex Vfirst, TopoDS_Vertex Vlast) {
+ OccJavaJNI.TopExp_vertices__SWIG_1(TopoDS_Edge.getCPtr(E), E, TopoDS_Vertex.getCPtr(Vfirst), Vfirst, TopoDS_Vertex.getCPtr(Vlast), Vlast);
+ }
+
+ public TopExp() {
+ this(OccJavaJNI.new_TopExp(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopExp_Explorer {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopExp_Explorer(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopExp_Explorer obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopExp_Explorer(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public TopExp_Explorer() {\r
- this(OccJavaJNI.new_TopExp_Explorer__SWIG_0(), true);\r
- }\r
-\r
- public TopExp_Explorer(TopoDS_Shape S, TopAbs_ShapeEnum ToFind, TopAbs_ShapeEnum ToAvoid) {\r
- this(OccJavaJNI.new_TopExp_Explorer__SWIG_1(TopoDS_Shape.getCPtr(S), S, ToFind.swigValue(), ToAvoid.swigValue()), true);\r
- }\r
-\r
- public TopExp_Explorer(TopoDS_Shape S, TopAbs_ShapeEnum ToFind) {\r
- this(OccJavaJNI.new_TopExp_Explorer__SWIG_2(TopoDS_Shape.getCPtr(S), S, ToFind.swigValue()), true);\r
- }\r
-\r
- public void init(TopoDS_Shape S, TopAbs_ShapeEnum ToFind, TopAbs_ShapeEnum ToAvoid) {\r
- OccJavaJNI.TopExp_Explorer_init__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, ToFind.swigValue(), ToAvoid.swigValue());\r
- }\r
-\r
- public void init(TopoDS_Shape S, TopAbs_ShapeEnum ToFind) {\r
- OccJavaJNI.TopExp_Explorer_init__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, ToFind.swigValue());\r
- }\r
-\r
- public boolean more() {\r
- return OccJavaJNI.TopExp_Explorer_more(swigCPtr, this);\r
-}\r
-\r
- public void next() {\r
- OccJavaJNI.TopExp_Explorer_next(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape current() {\r
- long cPtr = OccJavaJNI.TopExp_Explorer_current(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopExp_Explorer {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopExp_Explorer(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopExp_Explorer obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopExp_Explorer(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public TopExp_Explorer() {
+ this(OccJavaJNI.new_TopExp_Explorer__SWIG_0(), true);
+ }
+
+ public TopExp_Explorer(TopoDS_Shape S, TopAbs_ShapeEnum ToFind, TopAbs_ShapeEnum ToAvoid) {
+ this(OccJavaJNI.new_TopExp_Explorer__SWIG_1(TopoDS_Shape.getCPtr(S), S, ToFind.swigValue(), ToAvoid.swigValue()), true);
+ }
+
+ public TopExp_Explorer(TopoDS_Shape S, TopAbs_ShapeEnum ToFind) {
+ this(OccJavaJNI.new_TopExp_Explorer__SWIG_2(TopoDS_Shape.getCPtr(S), S, ToFind.swigValue()), true);
+ }
+
+ public void init(TopoDS_Shape S, TopAbs_ShapeEnum ToFind, TopAbs_ShapeEnum ToAvoid) {
+ OccJavaJNI.TopExp_Explorer_init__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, ToFind.swigValue(), ToAvoid.swigValue());
+ }
+
+ public void init(TopoDS_Shape S, TopAbs_ShapeEnum ToFind) {
+ OccJavaJNI.TopExp_Explorer_init__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, ToFind.swigValue());
+ }
+
+ public boolean more() {
+ return OccJavaJNI.TopExp_Explorer_more(swigCPtr, this);
+}
+
+ public void next() {
+ OccJavaJNI.TopExp_Explorer_next(swigCPtr, this);
+ }
+
+ public TopoDS_Shape current() {
+ long cPtr = OccJavaJNI.TopExp_Explorer_current(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopLoc_Location {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopLoc_Location(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopLoc_Location obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopLoc_Location(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public boolean isIdentity() {\r
- return OccJavaJNI.TopLoc_Location_isIdentity(swigCPtr, this);\r
-}\r
-\r
- public GP_Trsf transformation() {\r
- return new GP_Trsf(OccJavaJNI.TopLoc_Location_transformation(swigCPtr, this), false);\r
- }\r
-\r
- public TopLoc_Location() {\r
- this(OccJavaJNI.new_TopLoc_Location(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopLoc_Location {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopLoc_Location(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopLoc_Location obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopLoc_Location(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public boolean isIdentity() {
+ return OccJavaJNI.TopLoc_Location_isIdentity(swigCPtr, this);
+}
+
+ public GP_Trsf transformation() {
+ return new GP_Trsf(OccJavaJNI.TopLoc_Location_transformation(swigCPtr, this), false);
+ }
+
+ public TopLoc_Location() {
+ this(OccJavaJNI.new_TopLoc_Location(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Builder {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopoDS_Builder(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Builder obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Builder(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public void makeWire(TopoDS_Wire W) {\r
- OccJavaJNI.TopoDS_Builder_makeWire(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);\r
- }\r
-\r
- public void makeCompound(TopoDS_Compound C) {\r
- OccJavaJNI.TopoDS_Builder_makeCompound(swigCPtr, this, TopoDS_Compound.getCPtr(C), C);\r
- }\r
-\r
- public void add(TopoDS_Shape S, TopoDS_Shape C) {\r
- OccJavaJNI.TopoDS_Builder_add(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.getCPtr(C), C);\r
- }\r
-\r
- public void remove(TopoDS_Shape S, TopoDS_Shape C) {\r
- OccJavaJNI.TopoDS_Builder_remove(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.getCPtr(C), C);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Builder {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopoDS_Builder(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Builder obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Builder(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public void makeWire(TopoDS_Wire W) {
+ OccJavaJNI.TopoDS_Builder_makeWire(swigCPtr, this, TopoDS_Wire.getCPtr(W), W);
+ }
+
+ public void makeCompound(TopoDS_Compound C) {
+ OccJavaJNI.TopoDS_Builder_makeCompound(swigCPtr, this, TopoDS_Compound.getCPtr(C), C);
+ }
+
+ public void add(TopoDS_Shape S, TopoDS_Shape C) {
+ OccJavaJNI.TopoDS_Builder_add(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.getCPtr(C), C);
+ }
+
+ public void remove(TopoDS_Shape S, TopoDS_Shape C) {
+ OccJavaJNI.TopoDS_Builder_remove(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, TopoDS_Shape.getCPtr(C), C);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_CompSolid extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_CompSolid(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_CompSolid_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_CompSolid obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_CompSolid(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_CompSolid() {\r
- this(OccJavaJNI.new_TopoDS_CompSolid(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_CompSolid extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_CompSolid(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_CompSolid_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_CompSolid obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_CompSolid(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_CompSolid() {
+ this(OccJavaJNI.new_TopoDS_CompSolid(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Compound extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Compound(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Compound_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Compound obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Compound(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Compound() {\r
- this(OccJavaJNI.new_TopoDS_Compound(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Compound extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Compound(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Compound_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Compound obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Compound(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Compound() {
+ this(OccJavaJNI.new_TopoDS_Compound(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Edge extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Edge(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Edge_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Edge obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Edge(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Edge() {\r
- this(OccJavaJNI.new_TopoDS_Edge(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Edge extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Edge(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Edge_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Edge obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Edge(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Edge() {
+ this(OccJavaJNI.new_TopoDS_Edge(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Face extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Face(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Face_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Face obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Face(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Face() {\r
- this(OccJavaJNI.new_TopoDS_Face(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Face extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Face(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Face_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Face obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Face(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Face() {
+ this(OccJavaJNI.new_TopoDS_Face(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Iterator {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopoDS_Iterator(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Iterator obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Iterator(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- public TopoDS_Iterator() {\r
- this(OccJavaJNI.new_TopoDS_Iterator__SWIG_0(), true);\r
- }\r
-\r
- public TopoDS_Iterator(TopoDS_Shape S, boolean cumOri, boolean cumLoc) {\r
- this(OccJavaJNI.new_TopoDS_Iterator__SWIG_1(TopoDS_Shape.getCPtr(S), S, cumOri, cumLoc), true);\r
- }\r
-\r
- public TopoDS_Iterator(TopoDS_Shape S, boolean cumOri) {\r
- this(OccJavaJNI.new_TopoDS_Iterator__SWIG_2(TopoDS_Shape.getCPtr(S), S, cumOri), true);\r
- }\r
-\r
- public TopoDS_Iterator(TopoDS_Shape S) {\r
- this(OccJavaJNI.new_TopoDS_Iterator__SWIG_3(TopoDS_Shape.getCPtr(S), S), true);\r
- }\r
-\r
- public void initialize(TopoDS_Shape S, boolean cumOri, boolean cumLoc) {\r
- OccJavaJNI.TopoDS_Iterator_initialize__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, cumOri, cumLoc);\r
- }\r
-\r
- public void initialize(TopoDS_Shape S, boolean cumOri) {\r
- OccJavaJNI.TopoDS_Iterator_initialize__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, cumOri);\r
- }\r
-\r
- public void initialize(TopoDS_Shape S) {\r
- OccJavaJNI.TopoDS_Iterator_initialize__SWIG_2(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);\r
- }\r
-\r
- public boolean more() {\r
- return OccJavaJNI.TopoDS_Iterator_more(swigCPtr, this);\r
-}\r
-\r
- public void next() {\r
- OccJavaJNI.TopoDS_Iterator_next(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape value() {\r
- long cPtr = OccJavaJNI.TopoDS_Iterator_value(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Iterator {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopoDS_Iterator(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Iterator obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Iterator(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ public TopoDS_Iterator() {
+ this(OccJavaJNI.new_TopoDS_Iterator__SWIG_0(), true);
+ }
+
+ public TopoDS_Iterator(TopoDS_Shape S, boolean cumOri, boolean cumLoc) {
+ this(OccJavaJNI.new_TopoDS_Iterator__SWIG_1(TopoDS_Shape.getCPtr(S), S, cumOri, cumLoc), true);
+ }
+
+ public TopoDS_Iterator(TopoDS_Shape S, boolean cumOri) {
+ this(OccJavaJNI.new_TopoDS_Iterator__SWIG_2(TopoDS_Shape.getCPtr(S), S, cumOri), true);
+ }
+
+ public TopoDS_Iterator(TopoDS_Shape S) {
+ this(OccJavaJNI.new_TopoDS_Iterator__SWIG_3(TopoDS_Shape.getCPtr(S), S), true);
+ }
+
+ public void initialize(TopoDS_Shape S, boolean cumOri, boolean cumLoc) {
+ OccJavaJNI.TopoDS_Iterator_initialize__SWIG_0(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, cumOri, cumLoc);
+ }
+
+ public void initialize(TopoDS_Shape S, boolean cumOri) {
+ OccJavaJNI.TopoDS_Iterator_initialize__SWIG_1(swigCPtr, this, TopoDS_Shape.getCPtr(S), S, cumOri);
+ }
+
+ public void initialize(TopoDS_Shape S) {
+ OccJavaJNI.TopoDS_Iterator_initialize__SWIG_2(swigCPtr, this, TopoDS_Shape.getCPtr(S), S);
+ }
+
+ public boolean more() {
+ return OccJavaJNI.TopoDS_Iterator_more(swigCPtr, this);
+}
+
+ public void next() {
+ OccJavaJNI.TopoDS_Iterator_next(swigCPtr, this);
+ }
+
+ public TopoDS_Shape value() {
+ long cPtr = OccJavaJNI.TopoDS_Iterator_value(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Shape {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public TopoDS_Shape(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Shape obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Shape(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- private long myTShape;\r
- protected static TopoDS_Shape downcast(TopoDS_Shape in)\r
- {\r
- TopoDS_Shape toReturn = create(getCPtr(in));\r
- in.swigCMemOwn=false;\r
- return toReturn;\r
- }\r
-\r
- protected static TopoDS_Shape create(long in)\r
- {\r
- if(in==0)\r
- return null;\r
- //second argument is not use in swig\r
- TopAbs_ShapeEnum type = TopAbs_ShapeEnum.swigToEnum(OccJavaJNI.TopoDS_Shape_shapeType(in, null));\r
- return create(in, type);\r
- }\r
-\r
- protected static TopoDS_Shape create(long in, TopAbs_ShapeEnum type)\r
- {\r
- TopoDS_Shape toReturn=null;\r
- if(in==0)\r
- return null;\r
- switch(type)\r
- {\r
- case COMPOUND:\r
- toReturn=new TopoDS_Compound(in, true);\r
- break;\r
- case COMPSOLID:\r
- toReturn=new TopoDS_CompSolid(in, true);\r
- break;\r
- case SOLID:\r
- toReturn=new TopoDS_Solid(in, true);\r
- break;\r
- case SHELL:\r
- toReturn=new TopoDS_Shell(in, true);\r
- break;\r
- case FACE:\r
- toReturn=new TopoDS_Face(in, true);\r
- break;\r
- case WIRE:\r
- toReturn=new TopoDS_Wire(in, true);\r
- break;\r
- case EDGE:\r
- toReturn=new TopoDS_Edge(in, true);\r
- break;\r
- case VERTEX:\r
- toReturn=new TopoDS_Vertex(in, true);\r
- break;\r
- }\r
- toReturn.myTShape=toReturn.getTShape();\r
- return toReturn;\r
- }\r
- public boolean isSame(TopoDS_Shape s)\r
- {\r
- /*if(myTShape==0)\r
- myTShape=getTShape();\r
- \r
- if(s.myTShape==0)\r
- s.myTShape=s.getTShape();\r
- \r
- if(myTShape==s.myTShape)\r
- {\r
- return nativeIsSame(s);\r
- }\r
- else return false;*/\r
- return nativeIsSame(s);\r
- }\r
- \r
- /**\r
- * Alias on the isSame method for an easy use of this class in java\r
- * collections\r
- */\r
- public boolean equals(Object o)\r
- {\r
- if (o instanceof TopoDS_Shape)\r
- {\r
- return isSame((TopoDS_Shape)o);\r
- }\r
- else return false;\r
- }\r
-\r
- public int hashCode()\r
- {\r
- return hashCode(Integer.MAX_VALUE);\r
- }\r
-\r
- protected static TopoDS_Shape[] cArrayWrap(long[] ptrs)\r
- {\r
- TopoDS_Shape[] toReturn = new TopoDS_Shape[ptrs.length/2];\r
- long ptr;\r
- int type;\r
- for (int i=0, j=0; i<toReturn.length; i++)\r
- { \r
- ptr = ptrs[j++];\r
- type = (int)ptrs[j++];\r
- toReturn[i] = create(ptr, TopAbs_ShapeEnum.swigToEnum(type));\r
- }\r
- return toReturn;\r
- }\r
-\r
- protected static long[] cArrayUnwrap(TopoDS_Shape[] arrayWrapper)\r
- {\r
- long[] cArray = new long[arrayWrapper.length];\r
- for (int i=0; i<arrayWrapper.length; i++)\r
- cArray[i] = TopoDS_Shape.getCPtr(arrayWrapper[i]);\r
- return cArray;\r
- }\r
-\r
- public TopAbs_ShapeEnum shapeType() {\r
- return TopAbs_ShapeEnum.swigToEnum(OccJavaJNI.TopoDS_Shape_shapeType(swigCPtr, this));\r
- }\r
-\r
- public boolean nativeIsSame(TopoDS_Shape other) {\r
- return OccJavaJNI.TopoDS_Shape_nativeIsSame(swigCPtr, this, TopoDS_Shape.getCPtr(other), other);\r
-}\r
-\r
- public TopAbs_Orientation orientation() {\r
- return TopAbs_Orientation.swigToEnum(OccJavaJNI.TopoDS_Shape_orientation(swigCPtr, this));\r
- }\r
-\r
- public void reverse() {\r
- OccJavaJNI.TopoDS_Shape_reverse(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape reversed() {\r
- long cPtr = OccJavaJNI.TopoDS_Shape_reversed(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public int hashCode(int Upper) {\r
- return OccJavaJNI.TopoDS_Shape_hashCode(swigCPtr, this, Upper);\r
- }\r
-\r
- public boolean free() {\r
- return OccJavaJNI.TopoDS_Shape_free__SWIG_0(swigCPtr, this);\r
-}\r
-\r
- public void free(boolean F) {\r
- OccJavaJNI.TopoDS_Shape_free__SWIG_1(swigCPtr, this, F);\r
- }\r
-\r
- public long getTShape() {\r
- return OccJavaJNI.TopoDS_Shape_getTShape(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape() {\r
- this(OccJavaJNI.new_TopoDS_Shape(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Shape {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected TopoDS_Shape(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Shape obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Shape(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+ private long myTShape;
+ protected static TopoDS_Shape downcast(TopoDS_Shape in)
+ {
+ TopoDS_Shape toReturn = create(getCPtr(in));
+ in.swigCMemOwn=false;
+ return toReturn;
+ }
+
+ protected static TopoDS_Shape create(long in)
+ {
+ if(in==0)
+ return null;
+ //second argument is not use in swig
+ TopAbs_ShapeEnum type = TopAbs_ShapeEnum.swigToEnum(OccJavaJNI.TopoDS_Shape_shapeType(in, null));
+ return create(in, type);
+ }
+
+ protected static TopoDS_Shape create(long in, TopAbs_ShapeEnum type)
+ {
+ TopoDS_Shape toReturn=null;
+ if(in==0)
+ return null;
+ switch(type)
+ {
+ case COMPOUND:
+ toReturn=new TopoDS_Compound(in, true);
+ break;
+ case COMPSOLID:
+ toReturn=new TopoDS_CompSolid(in, true);
+ break;
+ case SOLID:
+ toReturn=new TopoDS_Solid(in, true);
+ break;
+ case SHELL:
+ toReturn=new TopoDS_Shell(in, true);
+ break;
+ case FACE:
+ toReturn=new TopoDS_Face(in, true);
+ break;
+ case WIRE:
+ toReturn=new TopoDS_Wire(in, true);
+ break;
+ case EDGE:
+ toReturn=new TopoDS_Edge(in, true);
+ break;
+ case VERTEX:
+ toReturn=new TopoDS_Vertex(in, true);
+ break;
+ }
+ toReturn.myTShape=toReturn.getTShape();
+ return toReturn;
+ }
+ public boolean isSame(TopoDS_Shape s)
+ {
+ /*if(myTShape==0)
+ myTShape=getTShape();
+
+ if(s.myTShape==0)
+ s.myTShape=s.getTShape();
+
+ if(myTShape==s.myTShape)
+ {
+ return nativeIsSame(s);
+ }
+ else return false;*/
+ return nativeIsSame(s);
+ }
+
+ /**
+ * Alias on the isSame method for an easy use of this class in java
+ * collections
+ */
+ public boolean equals(Object o)
+ {
+ if (o instanceof TopoDS_Shape)
+ {
+ return isSame((TopoDS_Shape)o);
+ }
+ else return false;
+ }
+
+ public int hashCode()
+ {
+ return hashCode(Integer.MAX_VALUE);
+ }
+
+ protected static TopoDS_Shape[] cArrayWrap(long[] ptrs)
+ {
+ TopoDS_Shape[] toReturn = new TopoDS_Shape[ptrs.length/2];
+ long ptr;
+ int type;
+ for (int i=0, j=0; i<toReturn.length; i++)
+ {
+ ptr = ptrs[j++];
+ type = (int)ptrs[j++];
+ toReturn[i] = create(ptr, TopAbs_ShapeEnum.swigToEnum(type));
+ }
+ return toReturn;
+ }
+
+ protected static long[] cArrayUnwrap(TopoDS_Shape[] arrayWrapper)
+ {
+ long[] cArray = new long[arrayWrapper.length];
+ for (int i=0; i<arrayWrapper.length; i++)
+ cArray[i] = TopoDS_Shape.getCPtr(arrayWrapper[i]);
+ return cArray;
+ }
+
+ public TopAbs_ShapeEnum shapeType() {
+ return TopAbs_ShapeEnum.swigToEnum(OccJavaJNI.TopoDS_Shape_shapeType(swigCPtr, this));
+ }
+
+ public boolean nativeIsSame(TopoDS_Shape other) {
+ return OccJavaJNI.TopoDS_Shape_nativeIsSame(swigCPtr, this, TopoDS_Shape.getCPtr(other), other);
+}
+
+ public TopAbs_Orientation orientation() {
+ return TopAbs_Orientation.swigToEnum(OccJavaJNI.TopoDS_Shape_orientation(swigCPtr, this));
+ }
+
+ public void reverse() {
+ OccJavaJNI.TopoDS_Shape_reverse(swigCPtr, this);
+ }
+
+ public TopoDS_Shape reversed() {
+ long cPtr = OccJavaJNI.TopoDS_Shape_reversed(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public int hashCode(int Upper) {
+ return OccJavaJNI.TopoDS_Shape_hashCode(swigCPtr, this, Upper);
+ }
+
+ public boolean free() {
+ return OccJavaJNI.TopoDS_Shape_free__SWIG_0(swigCPtr, this);
+}
+
+ public void free(boolean F) {
+ OccJavaJNI.TopoDS_Shape_free__SWIG_1(swigCPtr, this, F);
+ }
+
+ public long getTShape() {
+ return OccJavaJNI.TopoDS_Shape_getTShape(swigCPtr, this);
+ }
+
+ public TopoDS_Shape() {
+ this(OccJavaJNI.new_TopoDS_Shape(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Shell extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Shell(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Shell_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Shell obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Shell(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Shell() {\r
- this(OccJavaJNI.new_TopoDS_Shell(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Shell extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Shell(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Shell_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Shell obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Shell(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Shell() {
+ this(OccJavaJNI.new_TopoDS_Shell(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Solid extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Solid(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Solid_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Solid obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Solid(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Solid() {\r
- this(OccJavaJNI.new_TopoDS_Solid(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Solid extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Solid(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Solid_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Solid obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Solid(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Solid() {
+ this(OccJavaJNI.new_TopoDS_Solid(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Vertex extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Vertex(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Vertex_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Vertex obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Vertex(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Vertex() {\r
- this(OccJavaJNI.new_TopoDS_Vertex(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Vertex extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Vertex(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Vertex_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Vertex obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Vertex(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Vertex() {
+ this(OccJavaJNI.new_TopoDS_Vertex(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class TopoDS_Wire extends TopoDS_Shape {\r
- private long swigCPtr;\r
-\r
- public TopoDS_Wire(long cPtr, boolean cMemoryOwn) {\r
- super(OccJavaJNI.TopoDS_Wire_SWIGUpcast(cPtr), cMemoryOwn);\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(TopoDS_Wire obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_TopoDS_Wire(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- super.delete();\r
- }\r
-\r
- public TopoDS_Wire() {\r
- this(OccJavaJNI.new_TopoDS_Wire(), true);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class TopoDS_Wire extends TopoDS_Shape {
+ private transient long swigCPtr;
+
+ protected TopoDS_Wire(long cPtr, boolean cMemoryOwn) {
+ super(OccJavaJNI.TopoDS_Wire_SWIGUpcast(cPtr), cMemoryOwn);
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(TopoDS_Wire obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_TopoDS_Wire(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ super.delete();
+ }
+
+ public TopoDS_Wire() {
+ this(OccJavaJNI.new_TopoDS_Wire(), true);
+ }
+
+}
-/* ----------------------------------------------------------------------------\r
- * This file was automatically generated by SWIG (http://www.swig.org).\r
- * Version 2.0.4\r
- *\r
- * Do not make changes to this file unless you know what you are doing--modify\r
- * the SWIG interface file instead.\r
- * ----------------------------------------------------------------------------- */\r
-\r
-package org.jcae.opencascade.jni;\r
-\r
-public class XSControl_Reader {\r
- private long swigCPtr;\r
- protected boolean swigCMemOwn;\r
-\r
- public XSControl_Reader(long cPtr, boolean cMemoryOwn) {\r
- swigCMemOwn = cMemoryOwn;\r
- swigCPtr = cPtr;\r
- }\r
-\r
- public static long getCPtr(XSControl_Reader obj) {\r
- return (obj == null) ? 0 : obj.swigCPtr;\r
- }\r
-\r
- protected void finalize() {\r
- delete();\r
- }\r
-\r
- public synchronized void delete() {\r
- if (swigCPtr != 0) {\r
- if (swigCMemOwn) {\r
- swigCMemOwn = false;\r
- OccJavaJNI.delete_XSControl_Reader(swigCPtr);\r
- }\r
- swigCPtr = 0;\r
- }\r
- }\r
-\r
- \r
- /**\r
- * @deprecated May segfault if path name include none-ASCII caracters. Use\r
- * readFile(stringPath.getBytes()) instead.\r
- */\r
- public IFSelect_ReturnStatus readFile(String filename) {\r
- return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.XSControl_Reader_readFile__SWIG_0(swigCPtr, this, filename));\r
- }\r
-\r
- public int transferRoots() {\r
- return OccJavaJNI.XSControl_Reader_transferRoots(swigCPtr, this);\r
- }\r
-\r
- public void clearShapes() {\r
- OccJavaJNI.XSControl_Reader_clearShapes(swigCPtr, this);\r
- }\r
-\r
- public int nbRootsForTransfer() {\r
- return OccJavaJNI.XSControl_Reader_nbRootsForTransfer(swigCPtr, this);\r
- }\r
-\r
- public TopoDS_Shape oneShape() {\r
- long cPtr = OccJavaJNI.XSControl_Reader_oneShape(swigCPtr, this);\r
- return (TopoDS_Shape)TopoDS_Shape.create(cPtr);\r
-}\r
-\r
- public IFSelect_ReturnStatus readFile(byte[] filename) {\r
- return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.XSControl_Reader_readFile__SWIG_1(swigCPtr, this, filename));\r
- }\r
-\r
- public boolean setReadUnitM() {\r
- return OccJavaJNI.XSControl_Reader_setReadUnitM(swigCPtr, this);\r
- }\r
-\r
- public boolean setReadUnitMM() {\r
- return OccJavaJNI.XSControl_Reader_setReadUnitMM(swigCPtr, this);\r
- }\r
-\r
-}\r
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 3.0.12
+ *
+ * Do not make changes to this file unless you know what you are doing--modify
+ * the SWIG interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+package org.jcae.opencascade.jni;
+
+public class XSControl_Reader {
+ private transient long swigCPtr;
+ protected transient boolean swigCMemOwn;
+
+ protected XSControl_Reader(long cPtr, boolean cMemoryOwn) {
+ swigCMemOwn = cMemoryOwn;
+ swigCPtr = cPtr;
+ }
+
+ protected static long getCPtr(XSControl_Reader obj) {
+ return (obj == null) ? 0 : obj.swigCPtr;
+ }
+
+ protected void finalize() {
+ delete();
+ }
+
+ public synchronized void delete() {
+ if (swigCPtr != 0) {
+ if (swigCMemOwn) {
+ swigCMemOwn = false;
+ OccJavaJNI.delete_XSControl_Reader(swigCPtr);
+ }
+ swigCPtr = 0;
+ }
+ }
+
+
+ /**
+ * @deprecated May segfault if path name include none-ASCII caracters. Use
+ * readFile(stringPath.getBytes()) instead.
+ */
+ public IFSelect_ReturnStatus readFile(String filename) {
+ return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.XSControl_Reader_readFile__SWIG_0(swigCPtr, this, filename));
+ }
+
+ public int transferRoots() {
+ return OccJavaJNI.XSControl_Reader_transferRoots(swigCPtr, this);
+ }
+
+ public void clearShapes() {
+ OccJavaJNI.XSControl_Reader_clearShapes(swigCPtr, this);
+ }
+
+ public int nbRootsForTransfer() {
+ return OccJavaJNI.XSControl_Reader_nbRootsForTransfer(swigCPtr, this);
+ }
+
+ public TopoDS_Shape oneShape() {
+ long cPtr = OccJavaJNI.XSControl_Reader_oneShape(swigCPtr, this);
+ return (TopoDS_Shape)TopoDS_Shape.create(cPtr);
+}
+
+ public IFSelect_ReturnStatus readFile(byte[] filename) {
+ return IFSelect_ReturnStatus.swigToEnum(OccJavaJNI.XSControl_Reader_readFile__SWIG_1(swigCPtr, this, filename));
+ }
+
+ public boolean setReadUnitM() {
+ return OccJavaJNI.XSControl_Reader_setReadUnitM(swigCPtr, this);
+ }
+
+ public boolean setReadUnitMM() {
+ return OccJavaJNI.XSControl_Reader_setReadUnitMM(swigCPtr, this);
+ }
+
+}
-%{\r
-#include <APIHeaderSection_MakeHeader.hxx>\r
-%}\r
-\r
-class APIHeaderSection_MakeHeader{\r
- %rename(setName) SetName;\r
- %rename(setAuthorValue) SetAuthorValue;\r
- %rename(setOrganizationValue) SetOrganizationValue;\r
- %rename(setOriginatingSystem) SetOriginatingSystem;\r
- %rename(setDescriptionValue) SetDescriptionValue;\r
- \r
- public:\r
- APIHeaderSection_MakeHeader(const Handle_StepData_StepModel& model);\r
- void SetName(const Handle_TCollection_HAsciiString& aName);\r
- void SetAuthorValue (const Standard_Integer num,const Handle_TCollection_HAsciiString& aAuthor);\r
- void SetOrganizationValue (const Standard_Integer num,const Handle_TCollection_HAsciiString& aOrganization);\r
- void SetOriginatingSystem(const Handle_TCollection_HAsciiString& aOriginatingSystem);\r
- void SetDescriptionValue(const Standard_Integer num,const Handle_TCollection_HAsciiString& description);\r
-};
\ No newline at end of file
+// FIXME: 7.3.0 Handle_StepData_StepModel cannot be resolved
+//%{
+//#include <APIHeaderSection_MakeHeader.hxx>
+//%}
+//
+//class APIHeaderSection_MakeHeader{
+// %rename(setName) SetName;
+// %rename(setAuthorValue) SetAuthorValue;
+// %rename(setOrganizationValue) SetOrganizationValue;
+// %rename(setOriginatingSystem) SetOriginatingSystem;
+// %rename(setDescriptionValue) SetDescriptionValue;
+//
+// public:
+// APIHeaderSection_MakeHeader(const Handle_StepData_StepModel& model);
+// void SetName(const Handle_TCollection_HAsciiString& aName);
+// void SetAuthorValue (const Standard_Integer num,const Handle_TCollection_HAsciiString& aAuthor);
+// void SetOrganizationValue (const Standard_Integer num,const Handle_TCollection_HAsciiString& aOrganization);
+// void SetOriginatingSystem(const Handle_TCollection_HAsciiString& aOriginatingSystem);
+// void SetDescriptionValue(const Standard_Integer num,const Handle_TCollection_HAsciiString& description);
+//};
\ No newline at end of file
if(hgc.IsNull())
return NULL;
else
- return (Poly_Triangulation*)(Standard_Transient*)hgc;
+ // FIXME: 7.3.0
+ //return (Poly_Triangulation*)(Standard_Transient*)hgc;
+ return (Poly_Triangulation*)(Standard_Transient*)(hgc->This());
}
static void range(const TopoDS_Edge& E, double range[2])
{
%rename(modified) Modified;
%rename(isDeleted) IsDeleted;
- %rename(modified2) Modified2;
+ %rename(modified) Modified;
%rename(generated) Generated;
%rename(hasModified) HasModified;
%rename(hasGenerated) HasGenerated;
public:
virtual const TopTools_ListOfShape& Modified(const TopoDS_Shape& aS) ;
virtual Standard_Boolean IsDeleted(const TopoDS_Shape& aS) ;
- virtual const TopTools_ListOfShape& Modified2(const TopoDS_Shape& aS) ;
+ //virtual const TopTools_ListOfShape& Modified2(const TopoDS_Shape& aS) ;
virtual const TopTools_ListOfShape& Generated(const TopoDS_Shape& S) ;
virtual Standard_Boolean HasModified() const;
virtual Standard_Boolean HasGenerated() const;
-/*\r
- * Project Info: http://jcae.sourceforge.net\r
- * \r
- * This program is free software; you can redistribute it and/or modify it under\r
- * the terms of the GNU Lesser General Public License as published by the Free\r
- * Software Foundation; either version 2.1 of the License, or (at your option)\r
- * any later version.\r
- *\r
- * This program is distributed in the hope that it will be useful, but WITHOUT\r
- * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS\r
- * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more\r
- * details.\r
- *\r
- * You should have received a copy of the GNU Lesser General Public License\r
- * along with this program; if not, write to the Free Software Foundation, Inc.,\r
- * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.\r
- *\r
- * (C) Copyright 2005, by EADS CRC\r
- */\r
-\r
-%{\r
-#include <BRepBuilderAPI_Transform.hxx>\r
-#include <BRepBuilderAPI_ModifyShape.hxx>\r
-#include <BRepBuilderAPI_MakeShape.hxx>\r
-#include <BRepBuilderAPI_MakeWire.hxx>\r
-#include <BRepBuilderAPI_MakeVertex.hxx>\r
-#include <BRepBuilderAPI_MakeEdge.hxx>\r
-#include <BRepBuilderAPI_MakeFace.hxx>\r
-#include <BRepBuilderAPI_MakeShell.hxx>\r
-#include <BRepBuilderAPI_MakeSolid.hxx>\r
-#include <BRepBuilderAPI_NurbsConvert.hxx>\r
-#include <Standard_Version.hxx>\r
-#if OCC_VERSION_MAJOR >= 6\r
-#include <BRepBuilderAPI_Sewing.hxx>\r
-#else\r
-#include <BRepAlgo_Sewing.hxx>\r
-#define BRepBuilderAPI_Sewing BRepAlgo_Sewing\r
-#endif\r
-%}\r
-\r
-class BRepBuilderAPI_MakeShape\r
-{\r
- //Hide the constructor to make this class abstract\r
- BRepBuilderAPI_MakeShape()=0;\r
- public:\r
- %rename(shape) Shape;\r
- const TopoDS_Shape& Shape() const;\r
-};\r
-\r
-class BRepBuilderAPI_ModifyShape: public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(modifiedShape) ModifiedShape;\r
- BRepBuilderAPI_ModifyShape()=0;\r
- public:\r
- virtual const TopoDS_Shape& ModifiedShape(const TopoDS_Shape& S) const;\r
-};\r
-\r
-class BRepBuilderAPI_Transform : public BRepBuilderAPI_ModifyShape\r
-{\r
- %rename(perform) Perform;\r
- public:\r
- BRepBuilderAPI_Transform(const gp_Trsf& T);\r
- BRepBuilderAPI_Transform(const TopoDS_Shape& S, const gp_Trsf& T,\r
- const Standard_Boolean Copy = Standard_False);\r
- void Perform(const TopoDS_Shape& S,\r
- const Standard_Boolean Copy = Standard_False) ;\r
-};\r
-\r
-class BRepBuilderAPI_MakeVertex: public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(vertex) Vertex;\r
- public:\r
- BRepBuilderAPI_MakeVertex(const gp_Pnt& P);\r
- //const TopoDS_Vertex& Vertex() const;\r
-};\r
-\r
-class BRepBuilderAPI_MakeWire : public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(wire) Wire;\r
- %rename(add) Add;\r
- %rename(isDone) IsDone;\r
- public:\r
- BRepBuilderAPI_MakeWire();\r
- BRepBuilderAPI_MakeWire(const TopoDS_Edge& E);\r
- BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2);\r
- BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2,\r
- const TopoDS_Edge& E3);\r
- BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2,\r
- const TopoDS_Edge& E3,const TopoDS_Edge& E4);\r
- BRepBuilderAPI_MakeWire(const TopoDS_Wire& W);\r
- BRepBuilderAPI_MakeWire(const TopoDS_Wire& W,const TopoDS_Edge& E);\r
- void Add(const TopoDS_Edge& E) ;\r
- void Add(const TopoDS_Wire& W) ;\r
- void Add(const TopTools_ListOfShape & shapes);\r
- Standard_Boolean IsDone() const;\r
- //const TopoDS_Wire& Wire() const;\r
-};\r
-\r
-class BRepBuilderAPI_MakeEdge : public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(edge) Edge;\r
- %rename(isDone) IsDone;\r
- public:\r
- BRepBuilderAPI_MakeEdge();\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L);\r
- BRepBuilderAPI_MakeEdge(const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Circ& L);\r
- BRepBuilderAPI_MakeEdge(const gp_Circ& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const gp_Circ& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Circ& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const gp_Parab& L);\r
- BRepBuilderAPI_MakeEdge(const gp_Parab& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const gp_Parab& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Parab& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- Standard_Boolean IsDone() const;\r
- //const TopoDS_Edge& Edge() const;\r
-\r
-\r
-\r
-\r
- BRepBuilderAPI_MakeEdge(const gp_Lin& L);\r
- BRepBuilderAPI_MakeEdge(const gp_Lin& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const gp_Lin& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Lin& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const gp_Elips& L);\r
- BRepBuilderAPI_MakeEdge(const gp_Elips& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const gp_Elips& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Elips& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const gp_Hypr& L);\r
- BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const gp_Pnt& P1,const gp_Pnt& P2,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const Standard_Real p1,const Standard_Real p2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const gp_Pnt& P1,const gp_Pnt& P2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);\r
- BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const gp_Pnt& P1,const gp_Pnt& P2,const Standard_Real p1,const Standard_Real p2);\r
-\r
-\r
-};\r
-\r
-class BRepBuilderAPI_MakeFace : public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(face) Face;\r
- %rename(isDone) IsDone;\r
- %rename(error) Error;\r
- public:\r
- BRepBuilderAPI_MakeFace(const TopoDS_Wire& W,\r
- const Standard_Boolean OnlyPlane = Standard_False);\r
- BRepBuilderAPI_MakeFace(const TopoDS_Face& F,const TopoDS_Wire& W);\r
- //const TopoDS_Face& Face() const;\r
-\r
- Standard_Boolean IsDone() const;\r
- BRepBuilderAPI_FaceError Error() const;\r
-};\r
-\r
-class BRepBuilderAPI_MakeSolid: public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(add) Add;\r
- %rename(isDone) IsDone;\r
- %rename(isDeleted) IsDeleted;\r
- public:\r
- BRepBuilderAPI_MakeSolid();\r
- BRepBuilderAPI_MakeSolid(const TopoDS_CompSolid& S);\r
- BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S);\r
- BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S1,const TopoDS_Shell& S2);\r
- BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S1,const TopoDS_Shell& S2,const TopoDS_Shell& S3);\r
- BRepBuilderAPI_MakeSolid(const TopoDS_Solid& So);\r
- BRepBuilderAPI_MakeSolid(const TopoDS_Solid& So,const TopoDS_Shell& S);\r
- void Add(const TopoDS_Shell& S) ;\r
- Standard_Boolean IsDone() const;\r
- Standard_Boolean IsDeleted(const TopoDS_Shape& S) ;\r
-};\r
-\r
-class BRepBuilderAPI_Sewing\r
-{\r
- public:\r
- \r
- %rename(init) Init;\r
- %rename(add) Add;\r
- %rename(perform) Perform;\r
- %rename(sewedShape) SewedShape;\r
-\r
- %rename(load) Load;\r
- %rename(nbFreeEdges) NbFreeEdges;\r
- %rename(freeEdge) FreeEdge;\r
- %rename(nbMultipleEdges) NbMultipleEdges;\r
- %rename(multipleEdge) MultipleEdge;\r
- %rename(nbDegeneratedShapes) NbDegeneratedShapes;\r
- %rename(degeneratedShape) DegeneratedShape;\r
- %rename(nbDeletedFaces) NbDeletedFaces;\r
- %rename(deletedFace) DeletedFace;\r
- %rename(isDegenerated) IsDegenerated;\r
- %rename(isModified) IsModified;\r
- %rename(modified) Modified;\r
- %rename(dump) Dump;\r
-\r
- %rename(isModifiedSubShape) IsModifiedSubShape;\r
- %rename(modifiedSubShape) ModifiedSubShape;\r
-\r
- BRepBuilderAPI_Sewing(const Standard_Real tolerance = 1.0e-06,\r
- const Standard_Boolean option = Standard_True,\r
- const Standard_Boolean cutting = Standard_True,\r
- const Standard_Boolean nonmanifold = Standard_False);\r
- void Init(const Standard_Real tolerance,\r
- const Standard_Boolean option = Standard_True,\r
- const Standard_Boolean cutting = Standard_True,\r
- const Standard_Boolean nonmanifold = Standard_False) ;\r
- void Load(const TopoDS_Shape& shape) ;\r
- void Add(const TopoDS_Shape& shape) ;\r
- void Perform() ;\r
- const TopoDS_Shape& SewedShape() const;\r
- Standard_Integer NbFreeEdges() const;\r
- const TopoDS_Edge& FreeEdge(const Standard_Integer index) const;\r
- Standard_Integer NbMultipleEdges() const;\r
- const TopoDS_Edge& MultipleEdge(const Standard_Integer index) const;\r
- Standard_Integer NbDegeneratedShapes() const;\r
- const TopoDS_Shape& DegeneratedShape(const Standard_Integer index) const;\r
- Standard_Integer NbDeletedFaces() const;\r
- const TopoDS_Face& DeletedFace(const Standard_Integer index) const;\r
- Standard_Boolean IsDegenerated(const TopoDS_Shape& shape) const;\r
- Standard_Boolean IsModified(const TopoDS_Shape& shape) const;\r
- const TopoDS_Shape& Modified(const TopoDS_Shape& shape) const;\r
- void Dump() const;\r
-\r
- Standard_Boolean IsModifiedSubShape(const TopoDS_Shape& shape) const;\r
- TopoDS_Shape ModifiedSubShape(const TopoDS_Shape& shape) const;\r
-};\r
-\r
-class BRepBuilderAPI_NurbsConvert : public BRepBuilderAPI_ModifyShape\r
-{\r
- %rename(perform) Perform;\r
- public:\r
- BRepBuilderAPI_NurbsConvert();\r
- BRepBuilderAPI_NurbsConvert(const TopoDS_Shape& S,\r
- const Standard_Boolean Copy = Standard_False);\r
- void Perform(const TopoDS_Shape& S,\r
- const Standard_Boolean Copy = Standard_False) ;\r
-};\r
-\r
-/**\r
- * VTT\r
-*/\r
-\r
-class BRepBuilderAPI_MakeShell : public BRepBuilderAPI_MakeShape {\r
- %rename(init) Init;\r
- %rename(isDone) IsDone;\r
- %rename(error) Error;\r
- public:\r
- BRepBuilderAPI_MakeShell();\r
- BRepBuilderAPI_MakeShell(const Handle_Geom_Surface& S,const Standard_Boolean Segment = Standard_False);\r
- BRepBuilderAPI_MakeShell(const Handle_Geom_Surface& S,const Standard_Real UMin,const Standard_Real UMax,const Standard_Real VMin,const Standard_Real VMax,const Standard_Boolean Segment = Standard_False);\r
- void Init(const Handle_Geom_Surface& S,const Standard_Real UMin,const Standard_Real UMax,const Standard_Real VMin,const Standard_Real VMax,const Standard_Boolean Segment = Standard_False) ;\r
- Standard_Boolean IsDone() const;\r
- BRepBuilderAPI_ShellError Error();\r
- const TopoDS_Shell& Shell();\r
+/*/*
+ * Project Info: http://jcae.sourceforge.net
+ *
+ * This program is free software; you can redistribute it and/or modify it under
+ * the terms of the GNU Lesser General Public License as published by the Free
+ * Software Foundation; either version 2.1 of the License, or (at your option)
+ * any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but WITHOUT
+ * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+ * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more
+ * details.
+ *
+ * You should have received a copy of the GNU Lesser General Public License
+ * along with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.
+ *
+ * (C) Copyright 2005, by EADS CRC
+ */
+
+%{
+#include <BRepBuilderAPI_Transform.hxx>
+#include <BRepBuilderAPI_ModifyShape.hxx>
+#include <BRepBuilderAPI_MakeShape.hxx>
+#include <BRepBuilderAPI_MakeWire.hxx>
+#include <BRepBuilderAPI_MakeVertex.hxx>
+#include <BRepBuilderAPI_MakeEdge.hxx>
+#include <BRepBuilderAPI_MakeFace.hxx>
+#include <BRepBuilderAPI_MakeShell.hxx>
+#include <BRepBuilderAPI_MakeSolid.hxx>
+#include <BRepBuilderAPI_NurbsConvert.hxx>
+#include <BRepOffsetAPI_ThruSections.hxx>
+#include <Standard_Version.hxx>
+#if OCC_VERSION_MAJOR >= 6
+#include <BRepBuilderAPI_Sewing.hxx>
+#else
+#include <BRepAlgo_Sewing.hxx>
+#define BRepBuilderAPI_Sewing BRepAlgo_Sewing
+#endif
+%}
+
+class BRepBuilderAPI_Command
+{
+ %rename(isDone) IsDone;
+ BRepBuilderAPI_Command()=0;
+ public:
+ virtual Standard_Boolean IsDone() const;
+};
+
+class BRepBuilderAPI_MakeShape: public BRepBuilderAPI_Command
+{
+ //Hide the constructor to make this class abstract
+ BRepBuilderAPI_MakeShape()=0;
+ public:
+ %rename(build) Build;
+ %rename(shape) Shape;
+ virtual void Build();
+ // FIXME: 7.3.0
+ //const TopoDS_Shape& Shape() const;
+ const TopoDS_Shape& Shape();
+};
+
+class BRepBuilderAPI_ModifyShape: public BRepBuilderAPI_MakeShape
+{
+ BRepBuilderAPI_ModifyShape()=0;
+ public:
+};
+
+%extend BRepBuilderAPI_ModifyShape {
+ // Use %extend to be compatible with OCE < 0.18 and OCE >= 0.18
+ TopoDS_Shape modifiedShape(const TopoDS_Shape& S) const {
+ return self->ModifiedShape(S);
+ }
+}
+
+class BRepBuilderAPI_Transform : public BRepBuilderAPI_ModifyShape
+{
+ %rename(perform) Perform;
+ public:
+ BRepBuilderAPI_Transform(const gp_Trsf& T);
+ BRepBuilderAPI_Transform(const TopoDS_Shape& S, const gp_Trsf& T,
+ const Standard_Boolean Copy = Standard_False);
+ void Perform(const TopoDS_Shape& S,
+ const Standard_Boolean Copy = Standard_False) ;
+};
+
+class BRepBuilderAPI_MakeVertex: public BRepBuilderAPI_MakeShape
+{
+ %rename(vertex) Vertex;
+ public:
+ BRepBuilderAPI_MakeVertex(const gp_Pnt& P);
+ //const TopoDS_Vertex& Vertex() const;
+};
+
+class BRepBuilderAPI_MakeWire : public BRepBuilderAPI_MakeShape
+{
+ %rename(wire) Wire;
+ %rename(add) Add;
+ %rename(isDone) IsDone;
+ public:
+ BRepBuilderAPI_MakeWire();
+ BRepBuilderAPI_MakeWire(const TopoDS_Edge& E);
+ BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2);
+ BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2,
+ const TopoDS_Edge& E3);
+ BRepBuilderAPI_MakeWire(const TopoDS_Edge& E1,const TopoDS_Edge& E2,
+ const TopoDS_Edge& E3,const TopoDS_Edge& E4);
+ BRepBuilderAPI_MakeWire(const TopoDS_Wire& W);
+ BRepBuilderAPI_MakeWire(const TopoDS_Wire& W,const TopoDS_Edge& E);
+ void Add(const TopoDS_Edge& E) ;
+ void Add(const TopoDS_Wire& W) ;
+ void Add(const TopTools_ListOfShape & shapes);
+ Standard_Boolean IsDone() const;
+ const TopoDS_Wire& Wire();
+};
+
+class BRepBuilderAPI_MakeEdge : public BRepBuilderAPI_MakeShape
+{
+ %rename(edge) Edge;
+ %rename(isDone) IsDone;
+ public:
+ BRepBuilderAPI_MakeEdge();
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L);
+ BRepBuilderAPI_MakeEdge(const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Circ& L);
+ BRepBuilderAPI_MakeEdge(const gp_Circ& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const gp_Circ& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Circ& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const gp_Parab& L);
+ BRepBuilderAPI_MakeEdge(const gp_Parab& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const gp_Parab& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Parab& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L, const Handle_Geom_Surface& S);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_TrimmedCurve& L);
+ Standard_Boolean IsDone() const;
+ // FIXME: 7.3.0
+ //const TopoDS_Edge& Edge() const;
+ const TopoDS_Edge& Edge();
+
+ BRepBuilderAPI_MakeEdge(const gp_Lin& L);
+ BRepBuilderAPI_MakeEdge(const gp_Lin& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const gp_Lin& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Lin& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const gp_Elips& L);
+ BRepBuilderAPI_MakeEdge(const gp_Elips& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const gp_Elips& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Elips& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const gp_Hypr& L);
+ BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const gp_Hypr& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const gp_Pnt& P1,const gp_Pnt& P2,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom_Curve& L,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const Standard_Real p1,const Standard_Real p2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const gp_Pnt& P1,const gp_Pnt& P2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const TopoDS_Vertex& V1,const TopoDS_Vertex& V2);
+ BRepBuilderAPI_MakeEdge(const Handle_Geom2d_Curve& L,const Handle_Geom_Surface& S,const gp_Pnt& P1,const gp_Pnt& P2,const Standard_Real p1,const Standard_Real p2);
+
+};
+
+class BRepBuilderAPI_MakeFace : public BRepBuilderAPI_MakeShape
+{
+ %rename(face) Face;
+ public:
+ BRepBuilderAPI_MakeFace(const TopoDS_Wire& W,
+ const Standard_Boolean OnlyPlane = Standard_False);
+ BRepBuilderAPI_MakeFace(const TopoDS_Face& F,const TopoDS_Wire& W);
+ //const TopoDS_Face& Face() const;
+};
+
+class BRepBuilderAPI_MakeSolid: public BRepBuilderAPI_MakeShape
+{
+ %rename(add) Add;
+ %rename(isDone) IsDone;
+ %rename(isDeleted) IsDeleted;
+ public:
+ BRepBuilderAPI_MakeSolid();
+ BRepBuilderAPI_MakeSolid(const TopoDS_CompSolid& S);
+ BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S);
+ BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S1,const TopoDS_Shell& S2);
+ BRepBuilderAPI_MakeSolid(const TopoDS_Shell& S1,const TopoDS_Shell& S2,const TopoDS_Shell& S3);
+ BRepBuilderAPI_MakeSolid(const TopoDS_Solid& So);
+ BRepBuilderAPI_MakeSolid(const TopoDS_Solid& So,const TopoDS_Shell& S);
+ void Add(const TopoDS_Shell& S) ;
+ Standard_Boolean IsDone() const;
+ Standard_Boolean IsDeleted(const TopoDS_Shape& S) ;
+};
+
+class BRepBuilderAPI_Sewing
+{
+ public:
+
+ %rename(init) Init;
+ %rename(add) Add;
+ %rename(perform) Perform;
+ %rename(sewedShape) SewedShape;
+
+ %rename(load) Load;
+ %rename(nbFreeEdges) NbFreeEdges;
+ %rename(freeEdge) FreeEdge;
+ %rename(nbMultipleEdges) NbMultipleEdges;
+ %rename(multipleEdge) MultipleEdge;
+ %rename(nbDegeneratedShapes) NbDegeneratedShapes;
+ %rename(degeneratedShape) DegeneratedShape;
+ %rename(nbDeletedFaces) NbDeletedFaces;
+ %rename(deletedFace) DeletedFace;
+ %rename(isDegenerated) IsDegenerated;
+ %rename(isModified) IsModified;
+ %rename(modified) Modified;
+ %rename(dump) Dump;
+
+ %rename(isModifiedSubShape) IsModifiedSubShape;
+ %rename(modifiedSubShape) ModifiedSubShape;
+
+ BRepBuilderAPI_Sewing(const Standard_Real tolerance = 1.0e-06,
+ const Standard_Boolean option = Standard_True,
+ const Standard_Boolean cutting = Standard_True,
+ const Standard_Boolean nonmanifold = Standard_False);
+ void Init(const Standard_Real tolerance,
+ const Standard_Boolean option = Standard_True,
+ const Standard_Boolean cutting = Standard_True,
+ const Standard_Boolean nonmanifold = Standard_False) ;
+ void Load(const TopoDS_Shape& shape) ;
+ void Add(const TopoDS_Shape& shape) ;
+ void Perform() ;
+ const TopoDS_Shape& SewedShape() const;
+ Standard_Integer NbFreeEdges() const;
+ const TopoDS_Edge& FreeEdge(const Standard_Integer index) const;
+ Standard_Integer NbMultipleEdges() const;
+ const TopoDS_Edge& MultipleEdge(const Standard_Integer index) const;
+ Standard_Integer NbDegeneratedShapes() const;
+ const TopoDS_Shape& DegeneratedShape(const Standard_Integer index) const;
+ Standard_Integer NbDeletedFaces() const;
+ const TopoDS_Face& DeletedFace(const Standard_Integer index) const;
+ Standard_Boolean IsDegenerated(const TopoDS_Shape& shape) const;
+ Standard_Boolean IsModified(const TopoDS_Shape& shape) const;
+ const TopoDS_Shape& Modified(const TopoDS_Shape& shape) const;
+ void Dump() const;
+
+ Standard_Boolean IsModifiedSubShape(const TopoDS_Shape& shape) const;
+ TopoDS_Shape ModifiedSubShape(const TopoDS_Shape& shape) const;
+};
+
+class BRepBuilderAPI_NurbsConvert : public BRepBuilderAPI_ModifyShape
+{
+ %rename(perform) Perform;
+ public:
+ BRepBuilderAPI_NurbsConvert();
+ BRepBuilderAPI_NurbsConvert(const TopoDS_Shape& S,
+ const Standard_Boolean Copy = Standard_False);
+ void Perform(const TopoDS_Shape& S,
+ const Standard_Boolean Copy = Standard_False) ;
+};
+
+class BRepOffsetAPI_ThruSections : public BRepBuilderAPI_MakeShape
+{
+public:
+ %rename(addWire) AddWire;
+ %rename(checkCompatibility) CheckCompatibility;
+
+ %rename(init) Init;
+ %rename(addVertex) AddVertex;
+ %rename(build) Build;
+
+ BRepOffsetAPI_ThruSections(const Standard_Boolean isSolid = Standard_False, const Standard_Boolean ruled = Standard_False, const Standard_Real pres3d = 1.0e-06);
+ void AddWire (const TopoDS_Wire& wire) ;
+ void CheckCompatibility (const Standard_Boolean check = Standard_True) ;
+ const TopoDS_Shape& Shape();
+
+ void Init(const Standard_Boolean isSolid = Standard_False,const Standard_Boolean ruled = Standard_False,const Standard_Real pres3d = 1.0e-06) ;
+ void AddVertex(const TopoDS_Vertex& aVertex) ;
+ void Build();
+};
+
+/**
+ * VTT
+*/
+
+class BRepBuilderAPI_MakeShell : public BRepBuilderAPI_MakeShape {
+ %rename(init) Init;
+ %rename(isDone) IsDone;
+ %rename(error) Error;
+ public:
+ BRepBuilderAPI_MakeShell();
+ BRepBuilderAPI_MakeShell(const Handle_Geom_Surface& S,const Standard_Boolean Segment = Standard_False);
+ BRepBuilderAPI_MakeShell(const Handle_Geom_Surface& S,const Standard_Real UMin,const Standard_Real UMax,const Standard_Real VMin,const Standard_Real VMax,const Standard_Boolean Segment = Standard_False);
+ void Init(const Handle_Geom_Surface& S,const Standard_Real UMin,const Standard_Real UMax,const Standard_Real VMin,const Standard_Real VMax,const Standard_Boolean Segment = Standard_False) ;
+ Standard_Boolean IsDone() const;
+ BRepBuilderAPI_ShellError Error();
+ const TopoDS_Shell& Shell();
};
\ No newline at end of file
};
-/*\r
- * \r
- * (C) Copyright 2006, by VTT\r
- */ \r
-\r
-\r
-%{#include <BRepOffsetAPI_ThruSections.hxx>%}\r
-class BRepOffsetAPI_ThruSections : public BRepBuilderAPI_MakeShape\r
-{\r
- %rename(init) Init;\r
- %rename(addWire) AddWire;\r
- %rename(addVertex) AddVertex;\r
- %rename(build) Build;\r
-\r
- public:\r
- BRepOffsetAPI_ThruSections(const Standard_Boolean isSolid = Standard_False,const Standard_Boolean ruled = Standard_False,const Standard_Real pres3d = 1.0e-06);\r
- void Init(const Standard_Boolean isSolid = Standard_False,const Standard_Boolean ruled = Standard_False,const Standard_Real pres3d = 1.0e-06) ;\r
- void AddWire(const TopoDS_Wire& wire) ;\r
- void AddVertex(const TopoDS_Vertex& aVertex) ;\r
- void Build();\r
- \r
-\r
-};\r
-\r
-%{#include <BRepOffset_Mode.hxx>%}\r
-\r
-%rename(Skin) BRepOffset_Skin;\r
-%rename(Pipe) BRepOffset_Pipe;\r
-%rename(RectoVerso) BRepOffset_RectoVerso;\r
-\r
-enum BRepOffset_Mode { \r
- BRepOffset_Skin,\r
- BRepOffset_Pipe,\r
- BRepOffset_RectoVerso\r
-};\r
-\r
-%{#include <BRepOffsetAPI_MakeThickSolid.hxx>%}\r
-class BRepOffsetAPI_MakeThickSolid : public BRepBuilderAPI_MakeShape\r
-{\r
- public:\r
- BRepOffsetAPI_MakeThickSolid(const TopoDS_Shape& S,const TopTools_ListOfShape& ClosingFaces,const Standard_Real Offset,const Standard_Real Tol,const BRepOffset_Mode Mode = BRepOffset_Skin,const Standard_Boolean Intersection = Standard_False,const Standard_Boolean SelfInter = Standard_False,const GeomAbs_JoinType Join = GeomAbs_Arc);\r
-\r
+/*
+ *
+ * (C) Copyright 2006, by VTT
+ */
+
+
+
+%{#include <BRepOffset_Mode.hxx>%}
+
+%rename(Skin) BRepOffset_Skin;
+%rename(Pipe) BRepOffset_Pipe;
+%rename(RectoVerso) BRepOffset_RectoVerso;
+
+enum BRepOffset_Mode {
+ BRepOffset_Skin,
+ BRepOffset_Pipe,
+ BRepOffset_RectoVerso
+};
+
+%{#include <BRepOffsetAPI_MakeThickSolid.hxx>%}
+class BRepOffsetAPI_MakeThickSolid : public BRepBuilderAPI_MakeShape
+{
+ public:
+ BRepOffsetAPI_MakeThickSolid(const TopoDS_Shape& S,const TopTools_ListOfShape& ClosingFaces,const Standard_Real Offset,const Standard_Real Tol,const BRepOffset_Mode Mode = BRepOffset_Skin,const Standard_Boolean Intersection = Standard_False,const Standard_Boolean SelfInter = Standard_False,const GeomAbs_JoinType Join = GeomAbs_Arc);
+
};
\ No newline at end of file
Handle_Geom_Geometry()=0;
};
-class Handle_Geom_Curve: public Handle_Geom_Geometry
+//FIXME: 7.3.0: this is a major flaw, handles cannot be directly casted. I've now added downcast() methods without testing..
+//class Handle_Geom_Curve: public Handle_Geom_Geometry
+class Handle_Geom_Curve
{
- Handle_Geom_Curve()=0;
+ Handle_Geom_Curve()=0;
+
+ Handle_Geom_Curve downcast() {
+ return (*self);
+ }
};
%extend Handle_Geom_Curve
}
}
-class Handle_Geom_Surface: public Handle_Geom_Geometry
+//FIXME: 7.3.0
+//class Handle_Geom_Surface: public Handle_Geom_Geometry
+class Handle_Geom_Surface
{
Handle_Geom_Surface()=0;
+
+ Handle_Geom_Curve downcast() {
+ return (*self);
+ }
};
%extend Handle_Geom_Surface
Handle_Geom2d_Geometry()=0;
};
-class Handle_Geom2d_Curve: public Handle_Geom2d_Geometry
+//FIXME: 7.3.0
+//class Handle_Geom2d_Curve: public Handle_Geom2d_Geometry
+class Handle_Geom2d_Curve
{
Handle_Geom2d_Curve()=0;
+
+ Handle_Geom2d_Geometry downcast() {
+ return (*self);
+ }
};
-class Handle_Geom_BoundedCurve : public Handle_Geom_Curve {
+//FIXME: 7.3.0
+//class Handle_Geom_BoundedCurve : public Handle_Geom_Curve
+class Handle_Geom_BoundedCurve
+{
Handle_Geom_BoundedCurve()=0;
+
+ Handle_Geom_Curve downcast() {
+ return (*self);
+ }
};
-class Handle_Geom_BSplineCurve : public Handle_Geom_BoundedCurve {
+//FIXME: 7.3.0
+//class Handle_Geom_BSplineCurve : public Handle_Geom_BoundedCurve
+class Handle_Geom_BSplineCurve
+{
Handle_Geom_BSplineCurve()=0;
+
+ Handle_Geom_BoundedCurve downcast() {
+ return (*self);
+ }
};
%extend Handle_Geom_BSplineCurve
}
-class Handle_Geom_TrimmedCurve : public Handle_Geom_BoundedCurve {
+//FIXME: 7.3.0
+//class Handle_Geom_TrimmedCurve : public Handle_Geom_BoundedCurve
+class Handle_Geom_TrimmedCurve
+{
Handle_Geom_TrimmedCurve()=0;
+
+ Handle_Geom_BoundedCurve downcast() {
+ return (*self);
+ }
};
-/*\r
- * Project Info: http://jcae.sourceforge.net\r
- * \r
- * This program is free software; you can redistribute it and/or modify it under\r
- * the terms of the GNU Lesser General Public License as published by the Free\r
- * Software Foundation; either version 2.1 of the License, or (at your option)\r
- * any later version.\r
- *\r
- * This program is distributed in the hope that it will be useful, but WITHOUT\r
- * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS\r
- * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more\r
- * details.\r
- *\r
- * You should have received a copy of the GNU Lesser General Public License\r
- * along with this program; if not, write to the Free Software Foundation, Inc.,\r
- * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.\r
- *\r
- * (C) Copyright 2005, by EADS CRC\r
- * (C) Copyright 2008, 2009, by EADS France\r
- */\r
-\r
-%module OccJava\r
-\r
-%{\r
-#ifdef HAVE_CONFIG_H\r
-//config.h generated by autotools from config.h.in (see an example in Opencascade).\r
-#include "config.h"\r
-#endif\r
-#include <Adaptor3d_Curve.hxx>\r
-#include <TopExp.hxx>\r
-#include <Poly_Triangulation.hxx>\r
-%}\r
-\r
-// Handle enums with Java enums\r
-%javaconst(1);\r
-%include "enums.swg"\r
-\r
-// Handle C arrays as Java arrays\r
-%include "arrays_java.i";\r
-%apply double[] {double *};\r
-%apply double[] {double &};\r
-\r
-// load the native library\r
-%pragma(java) jniclasscode=%{\r
- static\r
- {\r
- System.loadLibrary("TKERNEL");\r
- System.loadLibrary("TKMATH");\r
- System.loadLibrary("TKG2D");\r
- System.loadLibrary("TKG3D"); \r
- System.loadLibrary("TKGEOMBASE");\r
- System.loadLibrary("TKBREP");\r
- System.loadLibrary("TKGEOMALGO"); \r
- System.loadLibrary("TKTOPALGO");\r
- System.loadLibrary("TKMESH");\r
- \r
- System.loadLibrary("TKBO"); \r
- System.loadLibrary("TKSHHEALING");\r
- \r
- System.loadLibrary("TKPRIM");\r
- System.loadLibrary("TKBOOL");\r
- System.loadLibrary("TKFILLET");\r
- System.loadLibrary("TKOFFSET"); \r
- \r
- System.loadLibrary("TKXSBASE");\r
- System.loadLibrary("TKIGES");\r
- System.loadLibrary("TKSTEPBASE");\r
- System.loadLibrary("TKSTEPATTR");\r
- System.loadLibrary("TKSTEP209");\r
- System.loadLibrary("TKSTEP");\r
-\r
- System.loadLibrary("OccJava");\r
- if(!"0".equals(System.getenv("MMGT_OPT")))\r
- throw new RuntimeException("The MMGT_OPT environement variable must be set to 0 before using occjava.");\r
- }\r
-%}\r
-\r
-%include "Standard.i"\r
-%include "gp.i"\r
-%include "TCol.i"\r
-%include "TopAbs.i"\r
-%include "TopoDS.i"\r
-%include "GeomAbs.i"\r
-%include "TopTools.i"\r
-%include "BRep.i"\r
-%include "GeomLProp_SLProps.i"\r
-%include "BRepTools.i"\r
-%include "BRepBuilderAPI.i"\r
-%include "BRepOffsetAPI.i"\r
-%include "BRepPrimAPI.i"\r
-%include "BRepAlgoAPI.i"\r
-%include "Poly.i"\r
-%include "Geom.i"\r
-%include "BRepLib.i"\r
-%include "BRepFilletAPI.i"\r
-%include "BRepCheck.i"\r
-%include "ShapeBuild.i"\r
-%include "XSControl.i"\r
-%include "ShapeFix.i"\r
-%include "APIHeaderSection_MakeHeader.i"\r
-// This one require Opencascade 6.2\r
-%include "ShapeUpgrade.i"\r
-//Jens Schmidt, req. f. Thesis\r
-%include "GeomAPI.i"\r
-%include "GC.i"\r
-\r
-\r
-%typemap(javacode) TopExp\r
-%{\r
- public static TopoDS_Vertex[] vertices(TopoDS_Edge edge)\r
- {\r
- TopoDS_Vertex first=new TopoDS_Vertex();\r
- TopoDS_Vertex second=new TopoDS_Vertex();\r
- vertices(edge, first, second);\r
- return new TopoDS_Vertex[]{first, second};\r
- }\r
-%}\r
-\r
-class TopLoc_Location\r
-{\r
- %rename(isIdentity) IsIdentity;\r
- %rename(transformation) Transformation;\r
- public:\r
- Standard_Boolean IsIdentity();\r
- const gp_Trsf& Transformation();\r
-};\r
-\r
-class TopExp\r
-{\r
- public:\r
- %rename(vertices) Vertices;\r
- static void Vertices(const TopoDS_Edge& E,TopoDS_Vertex& Vfirst,TopoDS_Vertex& Vlast,const Standard_Boolean CumOri = Standard_False) ;\r
-};\r
-\r
-/**\r
- * TopExp_Explorer\r
- */\r
-%{#include "TopExp_Explorer.hxx"%}\r
-class TopExp_Explorer\r
-{\r
- public:\r
- TopExp_Explorer();\r
- TopExp_Explorer(const TopoDS_Shape& S,const TopAbs_ShapeEnum ToFind,\r
- const TopAbs_ShapeEnum ToAvoid = TopAbs_SHAPE);\r
- %rename(init) Init;\r
- %rename(more) More;\r
- %rename(next) Next;\r
- %rename(current) Current;\r
- void Init(const TopoDS_Shape& S, const TopAbs_ShapeEnum ToFind, \r
- const TopAbs_ShapeEnum ToAvoid = TopAbs_SHAPE) ;\r
- Standard_Boolean More() const;\r
- void Next() ;\r
- const TopoDS_Shape & Current();\r
-};\r
-\r
-/**\r
- * Bnd_Box\r
- */\r
-%{#include "Bnd_Box.hxx"%}\r
-%typemap(javacode) Bnd_Box\r
-%{\r
- /**\r
- * Return the array { Xmin, Ymin, Zmin, Xmax, Ymax, Zmax }\r
- */ \r
- public double[] get()\r
- {\r
- double[] toReturn=new double[6];\r
- get(toReturn);\r
- return toReturn;\r
- }\r
-%}\r
-\r
-class Bnd_Box\r
-{\r
- %rename(isVoid) IsVoid;\r
- public:\r
- Bnd_Box();\r
- Standard_Boolean IsVoid() const;\r
-};\r
-\r
-%extend Bnd_Box\r
-{\r
- void get(double box[6])\r
- {\r
- if(!self->IsVoid())\r
- self->Get(box[0], box[1], box[2], box[3], box[4], box[5]);\r
- }\r
-};\r
-\r
-/**\r
- * BRepBndLib\r
- */\r
-%{#include "BRepBndLib.hxx"%}\r
-class BRepBndLib\r
-{\r
- public:\r
- %rename(add) Add;\r
- static void Add(const TopoDS_Shape& shape,Bnd_Box& bndBox);\r
-};\r
-\r
-/**\r
- * Adaptor2d_Curve2d\r
- */\r
-%{#include "Adaptor2d_Curve2d.hxx"%}\r
-\r
-class Adaptor2d_Curve2d\r
-{ \r
- Adaptor2d_Curve2d()=0;\r
- public:\r
- %rename(value) Value;\r
- virtual gp_Pnt2d Value(const Standard_Real U) const;\r
-};\r
-\r
-/**\r
- * Geom2dAdaptor_Curve\r
- */\r
-%{#include "Geom2dAdaptor_Curve.hxx"%}\r
-class Geom2dAdaptor_Curve: public Adaptor2d_Curve2d\r
-{\r
- %rename(load) Load;\r
- public:\r
- Geom2dAdaptor_Curve();\r
- Geom2dAdaptor_Curve(const Handle_Geom2d_Curve & C);\r
- Geom2dAdaptor_Curve(const Handle_Geom2d_Curve & C,const Standard_Real UFirst,const Standard_Real ULast);\r
- void Load(const Handle_Geom2d_Curve & C) ;\r
- void Load(const Handle_Geom2d_Curve & C,const Standard_Real UFirst,const Standard_Real ULast) ;\r
-};\r
-\r
-/**\r
- * Adaptor3d_Curve\r
- */\r
-%{#include "Adaptor3d_Curve.hxx"%}\r
-\r
-class Adaptor3d_Curve\r
-{ \r
- Adaptor3d_Curve()=0;\r
- public:\r
- %rename(value) Value;\r
- const gp_Pnt Value(const Standard_Real U) const;\r
-};\r
-\r
-//extends the Adaptor3d_Curve class to reduce the JNI overhead when\r
-//calling a lot of Adaptor3d_Curve.Value\r
-%extend Adaptor3d_Curve\r
-{\r
- public:\r
- void arrayValues(int size, double u[])\r
- {\r
- for (int i = 0; i < size; i++)\r
- {\r
- gp_Pnt gp=self->Value(u[3*i]);\r
- u[3*i] = gp.X();\r
- u[3*i+1] = gp.Y();\r
- u[3*i+2] = gp.Z();\r
- } \r
- }\r
-};\r
-\r
-/**\r
- * GeomAdaptor_Curve\r
- */\r
-%{#include "GeomAdaptor_Curve.hxx"%}\r
-\r
-class GeomAdaptor_Curve: public Adaptor3d_Curve\r
-{\r
- %rename(load) Load;\r
- public:\r
- GeomAdaptor_Curve();\r
- GeomAdaptor_Curve(const Handle_Geom_Curve & C);\r
- GeomAdaptor_Curve(const Handle_Geom_Curve & C,\r
- const Standard_Real UFirst,const Standard_Real ULast);\r
- void Load(const Handle_Geom_Curve & C) ;\r
- void Load(const Handle_Geom_Curve & C,\r
- const Standard_Real UFirst,const Standard_Real ULast) ;\r
-\r
-};\r
-\r
-\r
-/**\r
- * GProp_GProps\r
- */\r
- %{#include "GProp_GProps.hxx"%}\r
-// class GProp_GProps\r
-// {\r
-// public:\r
-// %rename(mass) Mass;\r
-// GProp_GProps();\r
-// Standard_Real Mass() const;\r
-//};\r
-class GProp_GProps\r
-{\r
- public:\r
- %rename(mass) Mass;\r
- %rename(centreOfMass) CentreOfMass;\r
- %rename(matrixOfInertia) MatrixOfInertia;\r
- GProp_GProps();\r
- Standard_Real Mass() const;\r
- gp_Pnt CentreOfMass() const;\r
- gp_Mat MatrixOfInertia() const;\r
-};\r
-\r
-%{#include "GProp_PGProps.hxx"%}\r
-class GProp_PGProps : public GProp_GProps\r
-{ \r
-};\r
-%{#include "GProp_CelGProps.hxx"%}\r
-class GProp_CelGProps: public GProp_GProps\r
-{ \r
-};\r
-\r
-%{#include "GProp_SelGProps.hxx"%}\r
-class GProp_SelGProps: public GProp_GProps\r
-{ \r
-};\r
-\r
-%{#include "GProp_VelGProps.hxx"%}\r
-class GProp_VelGProps: public GProp_GProps\r
-{\r
-};\r
-\r
-\r
-//%{#include "GProp_CGProps.gxx"%}\r
-//class GProp_CGProps: public GProp_GProps\r
-//{ \r
-//};\r
-\r
-//%{#include "GProp_SGProps.gxx"%}\r
-//class GProp_SGProps: public GProp_GProps\r
-//{ \r
-//};\r
-\r
-//%{#include "GProp_VGProps.gxx"%}\r
-//class GProp_VGProps\r
-//{\r
-//};\r
-\r
- \r
-/**\r
- * BRepGProp\r
- */\r
-%{#include "BRepGProp.hxx"%}\r
-class BRepGProp\r
-{\r
- public:\r
- %rename(linearProperties) LinearProperties;\r
- %rename(surfaceProperties) SurfaceProperties;\r
- %rename(volumeProperties) VolumeProperties;\r
- %rename(volumePropertiesGK) VolumePropertiesGK;\r
- static void LinearProperties(const TopoDS_Shape& shape, GProp_GProps& properties);\r
- static void VolumeProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Boolean onlyClosed = Standard_False) ;\r
- static Standard_Real VolumeProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps, const Standard_Boolean onlyClosed = Standard_False) ;\r
- static void SurfaceProperties(const TopoDS_Shape& shape, GProp_GProps& properties) ;\r
- static Standard_Real SurfaceProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps) ;\r
- static Standard_Real VolumePropertiesGK(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps, const Standard_Boolean onlyClosed = Standard_False, const Standard_Boolean isUseSpan = Standard_False, const Standard_Boolean cgFlag = Standard_False, const Standard_Boolean iFlag = Standard_False) ;\r
-};\r
-\r
-/**\r
- *\r
- */\r
-%rename(VOID) IFSelect_RetVoid;\r
-%rename(DONE) IFSelect_RetDone;\r
-%rename(ERROR) IFSelect_RetError;\r
-%rename(FAIL) IFSelect_RetFail;\r
-%rename(STOP) IFSelect_RetStop;\r
-enum IFSelect_ReturnStatus {\r
- IFSelect_RetVoid,\r
- IFSelect_RetDone,\r
- IFSelect_RetError,\r
- IFSelect_RetFail,\r
- IFSelect_RetStop\r
-};\r
- \r
-%{#include <ShapeAnalysis_FreeBounds.hxx>%}\r
-class ShapeAnalysis_FreeBounds\r
-{\r
- %rename(getClosedWires) GetClosedWires;\r
- %rename(getOpenWires) GetOpenWires;\r
- public:\r
- ShapeAnalysis_FreeBounds(const TopoDS_Shape& shape,\r
- const Standard_Boolean splitclosed = Standard_False,\r
- const Standard_Boolean splitopen = Standard_True);\r
- const TopoDS_Compound& GetClosedWires() const;\r
- const TopoDS_Compound& GetOpenWires() const;\r
-};\r
-\r
-%{#include <GCPnts_UniformDeflection.hxx>%}\r
-class GCPnts_UniformDeflection\r
-{\r
- %rename(initialize) Initialize;\r
- %rename(nbPoints) NbPoints;\r
- %rename(parameter) Parameter;\r
- public:\r
- GCPnts_UniformDeflection();\r
- void Initialize(Adaptor3d_Curve& C,const Standard_Real Deflection,\r
- const Standard_Real U1,const Standard_Real U2,\r
- const Standard_Boolean WithControl = Standard_True) ;\r
- Standard_Integer NbPoints() const;\r
- Standard_Real Parameter(const Standard_Integer Index) const;\r
-};\r
-\r
-%{#include <BRepMesh_DiscretRoot.hxx>%}\r
-class BRepMesh_DiscretRoot\r
-{\r
- %rename(setDeflection) SetDeflection;\r
- %rename(setAngle) SetAngle;\r
- %rename(deflection) Deflection;\r
- %rename(angle) Angle;\r
- %rename(perform) Perform;\r
- \r
- protected:\r
- BRepMesh_DiscretRoot();\r
- public:\r
- void SetDeflection(const Standard_Real D) ;\r
- void SetAngle(const Standard_Real Ang) ;\r
- Standard_Real Deflection() const;\r
- Standard_Real Angle() const;\r
- virtual void Perform();\r
-};\r
-\r
-%{#include <BRepMesh_IncrementalMesh.hxx>%}\r
-class BRepMesh_IncrementalMesh : public BRepMesh_DiscretRoot\r
-{\r
- %rename(perform) Perform;\r
- %rename(update) Update;\r
- %rename(isModified) IsModified;\r
- \r
- public:\r
- BRepMesh_IncrementalMesh();\r
- BRepMesh_IncrementalMesh(const TopoDS_Shape& S,const Standard_Real D,\r
- const Standard_Boolean Relatif = Standard_False,\r
- const Standard_Real Ang = 0.5);\r
- \r
- void Perform();\r
- void Update(const TopoDS_Shape& S) ;\r
- Standard_Boolean IsModified() const;\r
-};\r
-\r
-%{#include <GeomAPI_ProjectPointOnSurf.hxx>%}\r
-\r
-%typemap(javacode) GeomAPI_ProjectPointOnSurf\r
-%{\r
- public void lowerDistanceParameters(double[] uv)\r
- {\r
- double[] d2=new double[1];\r
- lowerDistanceParameters(uv, d2);\r
- uv[1]=d2[0];\r
- }\r
-%}\r
-\r
-class GeomAPI_ProjectPointOnSurf\r
-{\r
- %rename(init) Init;\r
- %rename(nbPoints) NbPoints;\r
- %rename(lowerDistanceParameters) LowerDistanceParameters;\r
- %rename(lowerDistance) LowerDistance;\r
- %rename(point) Point;\r
- %rename(parameters) Parameters;\r
- %rename(nearestPoint) NearestPoint;\r
- public:\r
- GeomAPI_ProjectPointOnSurf(const gp_Pnt& P,\r
- const Handle_Geom_Surface & Surface);\r
- void Init(const gp_Pnt& P,const Handle_Geom_Surface & surface);\r
- Standard_Integer NbPoints() const; \r
- Quantity_Length LowerDistance() const;\r
- const gp_Pnt Point(const Standard_Integer Index) const; \r
- void LowerDistanceParameters(Quantity_Parameter& U,Quantity_Parameter& V) const;\r
- void Parameters(const Standard_Integer Index,Quantity_Parameter& U,Quantity_Parameter& V) const;\r
- gp_Pnt NearestPoint() const;\r
-};\r
-\r
-/**\r
- * BRepAlgo\r
- */\r
-%{#include <BRepAlgo.hxx>%}\r
-class BRepAlgo\r
-{\r
- %rename(isValid) IsValid;\r
- %rename(isTopologicallyValid) IsTopologicallyValid;\r
- public: \r
- static Standard_Boolean IsValid(const TopoDS_Shape& S);\r
- static Standard_Boolean IsTopologicallyValid(const TopoDS_Shape& S);\r
-};\r
+/*
+ * Project Info: http://jcae.sourceforge.net
+ *
+ * This program is free software; you can redistribute it and/or modify it under
+ * the terms of the GNU Lesser General Public License as published by the Free
+ * Software Foundation; either version 2.1 of the License, or (at your option)
+ * any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but WITHOUT
+ * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+ * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more
+ * details.
+ *
+ * You should have received a copy of the GNU Lesser General Public License
+ * along with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.
+ *
+ * (C) Copyright 2005, by EADS CRC
+ * (C) Copyright 2008, 2009, by EADS France
+ */
+
+%module OccJava
+
+%{
+#ifdef HAVE_CONFIG_H
+//config.h generated by autotools from config.h.in (see an example in Opencascade).
+#include "config.h"
+#endif
+#include <Adaptor3d_Curve.hxx>
+#include <TopExp.hxx>
+#include <Poly_Triangulation.hxx>
+%}
+
+// Handle enums with Java enums
+%javaconst(1);
+%include "enums.swg"
+
+// Handle C arrays as Java arrays
+%include "arrays_java.i";
+%apply double[] {double *};
+%apply double[] {double &};
+
+// load the native library
+%pragma(java) jniclasscode=%{
+ static
+ {
+ System.loadLibrary("TKERNEL");
+ System.loadLibrary("TKMATH");
+ System.loadLibrary("TKG2D");
+ System.loadLibrary("TKG3D");
+ System.loadLibrary("TKGEOMBASE");
+ System.loadLibrary("TKBREP");
+ System.loadLibrary("TKGEOMALGO");
+ System.loadLibrary("TKTOPALGO");
+ System.loadLibrary("TKMESH");
+
+ System.loadLibrary("TKPRIM");
+ System.loadLibrary("TKSHHEALING");
+ System.loadLibrary("TKBO");
+
+ System.loadLibrary("TKBOOL");
+ System.loadLibrary("TKFILLET");
+ System.loadLibrary("TKOFFSET");
+
+ System.loadLibrary("TKXSBASE");
+ System.loadLibrary("TKIGES");
+ System.loadLibrary("TKSTEPBASE");
+ System.loadLibrary("TKSTEPATTR");
+ System.loadLibrary("TKSTEP209");
+ System.loadLibrary("TKSTEP");
+
+ System.loadLibrary("OccJava");
+ String mmg_opt= System.getenv("MMGT_OPT");
+ if(mmg_opt != null && !"0".equals(mmg_opt))
+ throw new RuntimeException("The MMGT_OPT environment variable must be set to 0 before using occjava.");
+ }
+%}
+
+%include "Standard.i"
+%include "gp.i"
+%include "TCol.i"
+%include "TopAbs.i"
+%include "TopoDS.i"
+%include "GeomAbs.i"
+%include "TopTools.i"
+%include "BRep.i"
+%include "GeomLProp_SLProps.i"
+%include "BRepTools.i"
+%include "BRepBuilderAPI.i"
+%include "BRepOffsetAPI.i"
+%include "BRepPrimAPI.i"
+%include "BRepAlgoAPI.i"
+%include "Poly.i"
+%include "Geom.i"
+%include "BRepLib.i"
+%include "BRepFilletAPI.i"
+%include "BRepCheck.i"
+%include "ShapeBuild.i"
+%include "XSControl.i"
+%include "ShapeFix.i"
+%include "APIHeaderSection_MakeHeader.i"
+// This one require Opencascade 6.2
+%include "ShapeUpgrade.i"
+//Jens Schmidt, req. f. Thesis
+%include "GeomAPI.i"
+%include "GC.i"
+
+
+%typemap(javacode) TopExp
+%{
+ public static TopoDS_Vertex[] vertices(TopoDS_Edge edge)
+ {
+ TopoDS_Vertex first=new TopoDS_Vertex();
+ TopoDS_Vertex second=new TopoDS_Vertex();
+ vertices(edge, first, second);
+ return new TopoDS_Vertex[]{first, second};
+ }
+%}
+
+class TopLoc_Location
+{
+ %rename(isIdentity) IsIdentity;
+ %rename(transformation) Transformation;
+ public:
+ Standard_Boolean IsIdentity();
+ const gp_Trsf& Transformation();
+};
+
+class TopExp
+{
+ public:
+ %rename(vertices) Vertices;
+ static void Vertices(const TopoDS_Edge& E,TopoDS_Vertex& Vfirst,TopoDS_Vertex& Vlast,const Standard_Boolean CumOri = Standard_False) ;
+};
+
+/**
+ * TopExp_Explorer
+ */
+%{#include "TopExp_Explorer.hxx"%}
+class TopExp_Explorer
+{
+ public:
+ TopExp_Explorer();
+ TopExp_Explorer(const TopoDS_Shape& S,const TopAbs_ShapeEnum ToFind,
+ const TopAbs_ShapeEnum ToAvoid = TopAbs_SHAPE);
+ %rename(init) Init;
+ %rename(more) More;
+ %rename(next) Next;
+ %rename(current) Current;
+ void Init(const TopoDS_Shape& S, const TopAbs_ShapeEnum ToFind,
+ const TopAbs_ShapeEnum ToAvoid = TopAbs_SHAPE) ;
+ Standard_Boolean More() const;
+ void Next() ;
+ const TopoDS_Shape & Current();
+};
+
+/**
+ * Bnd_Box
+ */
+%{#include "Bnd_Box.hxx"%}
+%typemap(javacode) Bnd_Box
+%{
+ /**
+ * Return the array { Xmin, Ymin, Zmin, Xmax, Ymax, Zmax }
+ */
+ public double[] get()
+ {
+ double[] toReturn=new double[6];
+ get(toReturn);
+ return toReturn;
+ }
+%}
+
+class Bnd_Box
+{
+ %rename(isVoid) IsVoid;
+ public:
+ Bnd_Box();
+ Standard_Boolean IsVoid() const;
+};
+
+%extend Bnd_Box
+{
+ void get(double box[6])
+ {
+ if(!self->IsVoid())
+ self->Get(box[0], box[1], box[2], box[3], box[4], box[5]);
+ }
+};
+
+/**
+ * BRepBndLib
+ */
+%{#include "BRepBndLib.hxx"%}
+class BRepBndLib
+{
+ public:
+ %rename(add) Add;
+ static void Add(const TopoDS_Shape& shape,Bnd_Box& bndBox);
+};
+
+/**
+ * Adaptor2d_Curve2d
+ */
+%{#include "Adaptor2d_Curve2d.hxx"%}
+
+class Adaptor2d_Curve2d
+{
+ Adaptor2d_Curve2d()=0;
+ public:
+ %rename(value) Value;
+ virtual gp_Pnt2d Value(const Standard_Real U) const;
+};
+
+/**
+ * Geom2dAdaptor_Curve
+ */
+%{#include "Geom2dAdaptor_Curve.hxx"%}
+class Geom2dAdaptor_Curve: public Adaptor2d_Curve2d
+{
+ %rename(load) Load;
+ public:
+ Geom2dAdaptor_Curve();
+ Geom2dAdaptor_Curve(const Handle_Geom2d_Curve & C);
+ Geom2dAdaptor_Curve(const Handle_Geom2d_Curve & C,const Standard_Real UFirst,const Standard_Real ULast);
+ void Load(const Handle_Geom2d_Curve & C) ;
+ void Load(const Handle_Geom2d_Curve & C,const Standard_Real UFirst,const Standard_Real ULast) ;
+};
+
+/**
+ * Adaptor3d_Curve
+ */
+%{#include "Adaptor3d_Curve.hxx"%}
+
+class Adaptor3d_Curve
+{
+ Adaptor3d_Curve()=0;
+ public:
+ %rename(value) Value;
+ const gp_Pnt Value(const Standard_Real U) const;
+};
+
+//extends the Adaptor3d_Curve class to reduce the JNI overhead when
+//calling a lot of Adaptor3d_Curve.Value
+%extend Adaptor3d_Curve
+{
+ public:
+ void arrayValues(int size, double u[])
+ {
+ for (int i = 0; i < size; i++)
+ {
+ gp_Pnt gp=self->Value(u[3*i]);
+ u[3*i] = gp.X();
+ u[3*i+1] = gp.Y();
+ u[3*i+2] = gp.Z();
+ }
+ }
+};
+
+/**
+ * GeomAdaptor_Curve
+ */
+%{#include "GeomAdaptor_Curve.hxx"%}
+
+class GeomAdaptor_Curve: public Adaptor3d_Curve
+{
+ %rename(load) Load;
+ public:
+ GeomAdaptor_Curve();
+ GeomAdaptor_Curve(const Handle_Geom_Curve & C);
+ GeomAdaptor_Curve(const Handle_Geom_Curve & C,
+ const Standard_Real UFirst,const Standard_Real ULast);
+ void Load(const Handle_Geom_Curve & C) ;
+ void Load(const Handle_Geom_Curve & C,
+ const Standard_Real UFirst,const Standard_Real ULast) ;
+
+};
+
+
+/**
+ * GProp_GProps
+ */
+ %{#include "GProp_GProps.hxx"%}
+// class GProp_GProps
+// {
+// public:
+// %rename(mass) Mass;
+// GProp_GProps();
+// Standard_Real Mass() const;
+//};
+class GProp_GProps
+{
+ public:
+ %rename(mass) Mass;
+ %rename(centreOfMass) CentreOfMass;
+ %rename(matrixOfInertia) MatrixOfInertia;
+ GProp_GProps();
+ Standard_Real Mass() const;
+ gp_Pnt CentreOfMass() const;
+ gp_Mat MatrixOfInertia() const;
+};
+
+%{#include "GProp_PGProps.hxx"%}
+class GProp_PGProps : public GProp_GProps
+{
+};
+%{#include "GProp_CelGProps.hxx"%}
+class GProp_CelGProps: public GProp_GProps
+{
+};
+
+%{#include "GProp_SelGProps.hxx"%}
+class GProp_SelGProps: public GProp_GProps
+{
+};
+
+%{#include "GProp_VelGProps.hxx"%}
+class GProp_VelGProps: public GProp_GProps
+{
+};
+
+
+//%{#include "GProp_CGProps.gxx"%}
+//class GProp_CGProps: public GProp_GProps
+//{
+//};
+
+//%{#include "GProp_SGProps.gxx"%}
+//class GProp_SGProps: public GProp_GProps
+//{
+//};
+
+//%{#include "GProp_VGProps.gxx"%}
+//class GProp_VGProps
+//{
+//};
+
+
+/**
+ * BRepGProp
+ */
+%{#include "BRepGProp.hxx"%}
+class BRepGProp
+{
+ public:
+ %rename(linearProperties) LinearProperties;
+ %rename(surfaceProperties) SurfaceProperties;
+ %rename(volumeProperties) VolumeProperties;
+ %rename(volumePropertiesGK) VolumePropertiesGK;
+ static void LinearProperties(const TopoDS_Shape& shape, GProp_GProps& properties);
+ static void VolumeProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Boolean onlyClosed = Standard_False) ;
+ static Standard_Real VolumeProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps, const Standard_Boolean onlyClosed = Standard_False) ;
+ static void SurfaceProperties(const TopoDS_Shape& shape, GProp_GProps& properties) ;
+ static Standard_Real SurfaceProperties(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps) ;
+ static Standard_Real VolumePropertiesGK(const TopoDS_Shape& shape, GProp_GProps& properties, const Standard_Real Eps, const Standard_Boolean onlyClosed = Standard_False, const Standard_Boolean isUseSpan = Standard_False, const Standard_Boolean cgFlag = Standard_False, const Standard_Boolean iFlag = Standard_False) ;
+};
+
+/**
+ *
+ */
+%rename(VOID) IFSelect_RetVoid;
+%rename(DONE) IFSelect_RetDone;
+%rename(ERROR) IFSelect_RetError;
+%rename(FAIL) IFSelect_RetFail;
+%rename(STOP) IFSelect_RetStop;
+enum IFSelect_ReturnStatus {
+ IFSelect_RetVoid,
+ IFSelect_RetDone,
+ IFSelect_RetError,
+ IFSelect_RetFail,
+ IFSelect_RetStop
+};
+
+%{#include <ShapeAnalysis_FreeBounds.hxx>%}
+class ShapeAnalysis_FreeBounds
+{
+ %rename(getClosedWires) GetClosedWires;
+ %rename(getOpenWires) GetOpenWires;
+ public:
+ ShapeAnalysis_FreeBounds(const TopoDS_Shape& shape,
+ const Standard_Boolean splitclosed = Standard_False,
+ const Standard_Boolean splitopen = Standard_True);
+ const TopoDS_Compound& GetClosedWires() const;
+ const TopoDS_Compound& GetOpenWires() const;
+};
+
+%{#include <GCPnts_UniformDeflection.hxx>%}
+class GCPnts_UniformDeflection
+{
+ %rename(initialize) Initialize;
+ %rename(nbPoints) NbPoints;
+ %rename(parameter) Parameter;
+ public:
+ GCPnts_UniformDeflection();
+ void Initialize(Adaptor3d_Curve& C,const Standard_Real Deflection,
+ const Standard_Real U1,const Standard_Real U2,
+ const Standard_Boolean WithControl = Standard_True) ;
+ Standard_Integer NbPoints() const;
+ Standard_Real Parameter(const Standard_Integer Index) const;
+};
+
+%{#include <BRepMesh_DiscretRoot.hxx>%}
+class BRepMesh_DiscretRoot
+{
+ //%rename(setDeflection) SetDeflection;
+ //%rename(setAngle) SetAngle;
+ //%rename(deflection) Deflection;
+ //%rename(angle) Angle;
+ %rename(perform) Perform;
+
+ protected:
+ BRepMesh_DiscretRoot();
+ public:
+ //void SetDeflection(const Standard_Real D) ;
+ //void SetAngle(const Standard_Real Ang) ;
+ //Standard_Real Deflection() const;
+ //Standard_Real Angle() const;
+ virtual void Perform();
+};
+
+%{#include <BRepMesh_IncrementalMesh.hxx>%}
+class BRepMesh_IncrementalMesh : public BRepMesh_DiscretRoot
+{
+ %rename(perform) Perform;
+ %rename(isModified) IsModified;
+
+ public:
+ BRepMesh_IncrementalMesh();
+ BRepMesh_IncrementalMesh(const TopoDS_Shape& S,const Standard_Real D,
+ const Standard_Boolean Relatif = Standard_False,
+ const Standard_Real Ang = 0.5);
+
+ void Perform();
+ Standard_Boolean IsModified() const;
+};
+
+%{#include <GeomAPI_ProjectPointOnSurf.hxx>%}
+
+%typemap(javacode) GeomAPI_ProjectPointOnSurf
+%{
+ public void lowerDistanceParameters(double[] uv)
+ {
+ double[] d2=new double[1];
+ lowerDistanceParameters(uv, d2);
+ uv[1]=d2[0];
+ }
+%}
+
+class GeomAPI_ProjectPointOnSurf
+{
+ %rename(init) Init;
+ %rename(nbPoints) NbPoints;
+ %rename(lowerDistanceParameters) LowerDistanceParameters;
+ %rename(lowerDistance) LowerDistance;
+ %rename(point) Point;
+ %rename(parameters) Parameters;
+ %rename(nearestPoint) NearestPoint;
+ public:
+ GeomAPI_ProjectPointOnSurf(const gp_Pnt& P,
+ const Handle_Geom_Surface & Surface);
+ void Init(const gp_Pnt& P,const Handle_Geom_Surface & surface);
+ Standard_Integer NbPoints() const;
+ Standard_Real LowerDistance() const;
+ const gp_Pnt Point(const Standard_Integer Index) const;
+ void LowerDistanceParameters(Standard_Real& U,Standard_Real& V) const;
+ void Parameters(const Standard_Integer Index,Standard_Real& U,Standard_Real& V) const;
+ gp_Pnt NearestPoint() const;
+};
+
+/**
+ * BRepAlgo
+ */
+%{#include <BRepAlgo.hxx>%}
+class BRepAlgo
+{
+ %rename(isValid) IsValid;
+ %rename(isTopologicallyValid) IsTopologicallyValid;
+ public:
+ static Standard_Boolean IsValid(const TopoDS_Shape& S);
+ static Standard_Boolean IsTopologicallyValid(const TopoDS_Shape& S);
+};
%rename(apply) Apply;
ShapeBuild_ReShape();
- void Replace(const TopoDS_Shape& shape,const TopoDS_Shape& newshape,const Standard_Boolean oriented = Standard_False) ;
+ void Replace(const TopoDS_Shape& shape,const TopoDS_Shape& newshape) ;
TopoDS_Shape Apply(const TopoDS_Shape& shape,const TopAbs_ShapeEnum until = TopAbs_SHAPE) ;
};
{
ShapeBuild_ReShape * getContext()
{
- Standard_Transient * p = self->Context();
+ // FIXME: 7.3.0
+ //Standard_Transient * p = self->Context();
+ Standard_Transient * p = self->This();
return dynamic_cast<ShapeBuild_ReShape *>(p);
}
}
%typedef double Standard_Real;
%typedef int Standard_Integer;
-%typedef double Quantity_Length;
-%typedef double Quantity_Parameter;
+//%typedef double Quantity_Length;
+//%typedef double Quantity_Parameter;
/**
* Standard_OStream
* aWriter.write("foo.stp")
*/
%{
+//#include <APIHeaderSection_MakeHeader.hxx>
#include <STEPControl_Writer.hxx>
%}
class STEPControl_Writer
STEPControl_Writer();
IFSelect_ReturnStatus Write(const Standard_CString filename);
IFSelect_ReturnStatus Transfer(TopoDS_Shape theShape, STEPControl_StepModelType mode);
- Handle_StepData_StepModel Model(const Standard_Boolean newone);
+ // FIXME: 7.3.0 Handle_StepData_StepModel cannot be resolved
+ //Handle_StepData_StepModel Model(const Standard_Boolean newone);
+ //Handle(StepData_StepModel) Model(const Standard_Boolean newone);
};
-/*\r
- * Project Info: http://jcae.sourceforge.net\r
- * \r
- * This program is free software; you can redistribute it and/or modify it under\r
- * the terms of the GNU Lesser General Public License as published by the Free\r
- * Software Foundation; either version 2.1 of the License, or (at your option)\r
- * any later version.\r
- *\r
- * This program is distributed in the hope that it will be useful, but WITHOUT\r
- * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS\r
- * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more\r
- * details.\r
- *\r
- * You should have received a copy of the GNU Lesser General Public License\r
- * along with this program; if not, write to the Free Software Foundation, Inc.,\r
- * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.\r
- *\r
- * (C) Copyright 2005, by EADS CRC\r
- */\r
-\r
-%{\r
- jdoubleArray XYZtoDoubleArray(JNIEnv* jenv, const gp_XYZ & xyz)\r
- {\r
- jdouble nativeArray[]={xyz.X(), xyz.Y(), xyz.Z()};\r
- jdoubleArray toReturn=jenv->NewDoubleArray(3);\r
- jenv->SetDoubleArrayRegion(toReturn, 0, 3, nativeArray);\r
- return toReturn;\r
- }\r
-%}\r
-\r
-/**\r
- * gp_Pnt\r
- */\r
-\r
-%typemap(jni) gp_Pnt, const gp_Pnt& "jdoubleArray"\r
-%typemap(jtype) gp_Pnt, const gp_Pnt& "double[]"\r
-%typemap(jstype) gp_Pnt, const gp_Pnt& "double[]"\r
-\r
-%typemap(in) gp_Pnt, const gp_Pnt&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=3)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Pnt(naxe[0],naxe[1],naxe[2]);\r
-}\r
-\r
-%typemap(out) const gp_Pnt&\r
-{\r
- $result=XYZtoDoubleArray(jenv, $1->XYZ());\r
-}\r
-\r
-%typemap(out) gp_Pnt\r
-{\r
- $result=XYZtoDoubleArray(jenv, $1.XYZ());\r
-}\r
-\r
-%typemap(freearg) gp_Pnt, const gp_Pnt&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(javain) gp_Pnt, const gp_Pnt& "$javainput"\r
-%typemap(javaout) gp_Pnt, const gp_Pnt&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-/**\r
- * gp_Pnt2d\r
- */\r
-\r
-%typemap(jni) gp_Pnt2d, const gp_Pnt2d& "jdoubleArray"\r
-%typemap(jtype) gp_Pnt2d, const gp_Pnt2d& "double[]"\r
-%typemap(jstype) gp_Pnt2d, const gp_Pnt2d& "double[]"\r
-\r
-%typemap(in) gp_Pnt2d, const gp_Pnt2d&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=2)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 2");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Pnt2d(naxe[0],naxe[1]);\r
-}\r
-\r
-%typemap(freearg) gp_Pnt2d, const gp_Pnt2d&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(javain) gp_Pnt2d, const gp_Pnt2d& "$javainput"\r
-%typemap(javaout) gp_Pnt2d, const gp_Pnt2d&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-%typemap(out) gp_Pnt2d, const gp_Pnt2d&\r
-{\r
- jdouble nativeArray[]={$1.X(), $1.Y()};\r
- jdoubleArray toReturn=JCALL1(NewDoubleArray, jenv, 2);\r
- JCALL4(SetDoubleArrayRegion, jenv, toReturn, 0, 2, nativeArray);\r
- $result=toReturn;\r
-}\r
-/**\r
- * gp_Pln\r
- */\r
-%typemap(jni) gp_Pln, const gp_Pln& "jdoubleArray"\r
-%typemap(jtype) gp_Pln, const gp_Pln& "double[]"\r
-%typemap(jstype) gp_Pln, const gp_Pln& "double[]"\r
-\r
-%typemap(in) gp_Pln, const gp_Pln&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=4)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 4");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Pln(naxe[0],naxe[1],naxe[2],naxe[4]);\r
-}\r
-\r
-%typemap(freearg) gp_Pln, const gp_Pln&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(javain) gp_Pln, const gp_Pln& "$javainput"\r
-%typemap(javaout) gp_Pln, const gp_Pln&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-%typemap(out) gp_Pln, const gp_Pln &\r
-{\r
- double a, b, c, d;\r
- $1.Coefficients(a, b, c, d);\r
- jdouble nativeArray[] = {a, b, c, d};\r
- jdoubleArray toReturn = JCALL1(NewDoubleArray, jenv, 4);\r
- JCALL4(SetDoubleArrayRegion, jenv, toReturn, 0, 4, nativeArray);\r
- $result=toReturn;\r
-}\r
-\r
-/**\r
- * gp_Vec\r
- */\r
-%typemap(jni) gp_Vec, const gp_Vec& "jdoubleArray"\r
-%typemap(jtype) gp_Vec, const gp_Vec& "double[]"\r
-%typemap(jstype) gp_Vec, const gp_Vec& "double[]"\r
-\r
-%typemap(in) gp_Vec, const gp_Vec&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=3)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Vec(naxe[0],naxe[1],naxe[2]);\r
-}\r
-\r
-%typemap(freearg) gp_Vec, const gp_Vec&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(javain) gp_Vec, const gp_Vec& "$javainput"\r
-%typemap(javaout) gp_Vec, const gp_Vec&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-%typemap(out) gp_Vec, const gp_Vec&\r
-{\r
- $result=XYZtoDoubleArray(jenv, $1->XYZ());\r
-}\r
-\r
-/**\r
- * gp_Dir\r
- */\r
-%typemap(jni) gp_Dir, const gp_Dir&, gp_Dir& "jdoubleArray"\r
-%typemap(jtype) gp_Dir, const gp_Dir&, gp_Dir& "double[]"\r
-%typemap(jstype) gp_Dir, const gp_Dir&, gp_Dir& "double[]"\r
-\r
-%typemap(in) gp_Dir, const gp_Dir&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=3)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Dir(naxe[0],naxe[1],naxe[2]);\r
-}\r
-\r
-%typemap(freearg) gp_Dir, const gp_Dir&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(out) const gp_Dir&\r
-{\r
- $result=XYZtoDoubleArray(jenv, $1->XYZ());\r
-}\r
-\r
-%typemap(out) gp_Dir\r
-{\r
- $result=XYZtoDoubleArray(jenv, $1.XYZ());\r
-}\r
-\r
-%typemap(javain) gp_Dir, const gp_Dir&, gp_Dir& "$javainput"\r
-%typemap(javaout) gp_Dir, const gp_Dir&, gp_Dir&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-/**\r
- * gp_Ax2\r
- */\r
-%typemap(jni) gp_Ax2, const gp_Ax2& "jdoubleArray"\r
-%typemap(jtype) gp_Ax2, const gp_Ax2& "double[]"\r
-%typemap(jstype) gp_Ax2, const gp_Ax2& "double[]"\r
-\r
-%typemap(in) gp_Ax2, const gp_Ax2&\r
-{\r
- int len = JCALL1(GetArrayLength, jenv, $input);\r
- if(len !=6 && len != 9)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 6 or 9");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- if (len == 6)\r
- $1=new gp_Ax2(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]));\r
- else\r
- $1=new gp_Ax2(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]), gp_Dir(naxe[6], naxe[7], naxe[8]));\r
-}\r
-\r
-%typemap(freearg) gp_Ax2, const gp_Ax2&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(out) gp_Ax2, const gp_Ax2&\r
-{\r
- ##error TODO\r
-}\r
-\r
-%typemap(javain) gp_Ax2, const gp_Ax2& "$javainput"\r
-%typemap(javaout) gp_Ax2, const gp_Ax2&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-/**\r
- * gp_Ax1\r
- */\r
-%typemap(jni) gp_Ax1, const gp_Ax1& "jdoubleArray"\r
-%typemap(jtype) gp_Ax1, const gp_Ax1& "double[]"\r
-%typemap(jstype) gp_Ax1, const gp_Ax1& "double[]"\r
-\r
-%typemap(in) gp_Ax1, const gp_Ax1&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=6)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 6");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Ax1(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]));\r
-}\r
-\r
-%typemap(freearg) gp_Ax1, const gp_Ax1&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(out) gp_Ax1, const gp_Ax1&\r
-{\r
- ##error TODO\r
-}\r
-\r
-%typemap(javain) gp_Ax1, const gp_Ax1& "$javainput"\r
-%typemap(javaout) gp_Ax1, const gp_Ax1&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-/**\r
- * gp_Trsf\r
- */\r
- %{#include <gp_Trsf.hxx>%}\r
- \r
-%rename(GP_Trsf) gp_Trsf;\r
-\r
-%typemap(javacode) gp_Trsf\r
-%{\r
- public void setValues(double[] matrix, double tolAng, double tolDist)\r
- {\r
- if(matrix.length!=12)\r
- throw new IllegalArgumentException("matrix length must be 12");\r
- setValues(\r
- matrix[0], matrix[1], matrix[2], matrix[3],\r
- matrix[4], matrix[5], matrix[6], matrix[7],\r
- matrix[8], matrix[9], matrix[10], matrix[11],\r
- tolAng, tolDist);\r
- } \r
-%}\r
-\r
-class gp_Trsf\r
-{\r
- %rename(setRotation) SetRotation;\r
- %rename(setTranslation) SetTranslation;\r
- %rename(setValues) SetValues;\r
- public:\r
- gp_Trsf();\r
- void SetRotation(const gp_Ax1& A1,const Standard_Real Ang) ;\r
- void SetTranslation(const gp_Vec& V) ;\r
- void SetValues(const Standard_Real a11,const Standard_Real a12,\r
- const Standard_Real a13,const Standard_Real a14,const Standard_Real a21,\r
- const Standard_Real a22,const Standard_Real a23,const Standard_Real a24,\r
- const Standard_Real a31,const Standard_Real a32,const Standard_Real a33,\r
- const Standard_Real a34,const Standard_Real Tolang,\r
- const Standard_Real TolDist);\r
-};\r
-\r
-%extend gp_Trsf\r
-{\r
- /** Easy to use with javax.vecmath.Matrix4D */\r
- void getValues(double matrix[16])\r
- {\r
- int k=0;\r
- for(int i=1; i<=3; i++)\r
- for(int j=1; j<=4; j++)\r
- matrix[k++]=self->Value(i,j);\r
- matrix[12]=0;\r
- matrix[13]=0;\r
- matrix[14]=0;\r
- matrix[15]=1;\r
- }\r
-}\r
-\r
-/**\r
- * GP_Circ\r
- */\r
-%{#include <gp_Circ.hxx>%}\r
-%rename(GP_Circ) gp_Circ;\r
-class gp_Circ\r
-{\r
- public:\r
- gp_Circ(const gp_Ax2& axis, const Standard_Real radius);\r
-};\r
-\r
-/**\r
- * GP_Parab\r
- */\r
-%{#include <gp_Parab.hxx>%}\r
-%rename(GP_Parab) gp_Parab;\r
-class gp_Parab\r
-{\r
- public:\r
- gp_Parab(const gp_Ax2& A2,const Standard_Real Focal);\r
- gp_Parab(const gp_Ax1& D,const gp_Pnt& F);\r
-};\r
-\r
-\r
-/*******************************************************************\r
- * *\r
- * VTT *\r
- * *\r
- *******************************************************************/\r
-\r
-/**\r
- * GP_Ellips\r
- */\r
-%{#include <gp_Elips.hxx>%}\r
- \r
- %rename(GP_Elips) gp_Elips;\r
- \r
- class gp_Elips\r
-{\r
-\r
- public:\r
- gp_Elips(const gp_Ax2& A2,const Standard_Real MajorRadius,const Standard_Real MinorRadius);\r
-};\r
-\r
-/**\r
- * GP_Lin\r
- */\r
-\r
- %{#include <gp_Lin.hxx>%}\r
- \r
- %rename(GP_Lin) gp_Lin;\r
- \r
- class gp_Lin\r
-{\r
- public:\r
- gp_Lin(const gp_Ax1& A1);\r
-};\r
-\r
-\r
-/**\r
- * gp_Mat\r
- */\r
- %{#include <gp_Mat.hxx>%}\r
-%typemap(jni) gp_Mat, const gp_Mat& "jdoubleArray"\r
-%typemap(jtype) gp_Mat, const gp_Mat& "double[]"\r
-%typemap(jstype) gp_Mat, const gp_Mat& "double[]"\r
-\r
-%typemap(in) gp_Mat, const gp_Mat&\r
-{\r
- if(JCALL1(GetArrayLength, jenv, $input)!=9)\r
- SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 9");\r
- jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);\r
- $1=new gp_Mat(naxe[0],naxe[1],naxe[2],naxe[3],naxe[4],naxe[5],naxe[6],naxe[7],naxe[8]);\r
-}\r
-\r
-%typemap(freearg) gp_Mat, const gp_Mat&\r
-{\r
- delete $1;\r
-}\r
-\r
-%typemap(javain) gp_Mat, const gp_Mat& "$javainput"\r
-%typemap(javaout) gp_Mat, const gp_Mat&\r
-{\r
- return $jnicall;\r
-}\r
-\r
-%{\r
- jdoubleArray MatToDoubleArray(JNIEnv* jenv, const gp_Mat & mat)\r
- {\r
- jdouble nativeArray[]={mat.Value(1,1), mat.Value(1,2), mat.Value(1,3),\r
- mat.Value(2,1), mat.Value(2,2), mat.Value(2,3),\r
- mat.Value(3,1), mat.Value(3,2), mat.Value(3,3)};\r
- jdoubleArray toReturn=jenv->NewDoubleArray(9);\r
- jenv->SetDoubleArrayRegion(toReturn, 0, 9, nativeArray);\r
- return toReturn;\r
- }\r
-%}\r
-\r
-%typemap(out) gp_Mat, const gp_Mat&\r
-{\r
- $result=MatToDoubleArray(jenv, $1);\r
+/*
+ * Project Info: http://jcae.sourceforge.net
+ *
+ * This program is free software; you can redistribute it and/or modify it under
+ * the terms of the GNU Lesser General Public License as published by the Free
+ * Software Foundation; either version 2.1 of the License, or (at your option)
+ * any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but WITHOUT
+ * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+ * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more
+ * details.
+ *
+ * You should have received a copy of the GNU Lesser General Public License
+ * along with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place, Suite 330, Boston, MA 02111-1307, USA.
+ *
+ * (C) Copyright 2005, by EADS CRC
+ */
+
+%{
+ jdoubleArray XYZtoDoubleArray(JNIEnv* jenv, const gp_XYZ & xyz)
+ {
+ jdouble nativeArray[]={xyz.X(), xyz.Y(), xyz.Z()};
+ jdoubleArray toReturn=jenv->NewDoubleArray(3);
+ jenv->SetDoubleArrayRegion(toReturn, 0, 3, nativeArray);
+ return toReturn;
+ }
+%}
+
+/**
+ * gp_Pnt
+ */
+
+%typemap(jni) gp_Pnt, const gp_Pnt& "jdoubleArray"
+%typemap(jtype) gp_Pnt, const gp_Pnt& "double[]"
+%typemap(jstype) gp_Pnt, const gp_Pnt& "double[]"
+
+%typemap(in) gp_Pnt, const gp_Pnt&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=3)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Pnt(naxe[0],naxe[1],naxe[2]);
+}
+
+%typemap(out) const gp_Pnt&
+{
+ $result=XYZtoDoubleArray(jenv, $1->XYZ());
+}
+
+%typemap(out) gp_Pnt
+{
+ $result=XYZtoDoubleArray(jenv, $1.XYZ());
+}
+
+%typemap(freearg) gp_Pnt, const gp_Pnt&
+{
+ delete $1;
+}
+
+%typemap(javain) gp_Pnt, const gp_Pnt& "$javainput"
+%typemap(javaout) gp_Pnt, const gp_Pnt&
+{
+ return $jnicall;
+}
+
+/**
+ * gp_Pnt2d
+ */
+
+%typemap(jni) gp_Pnt2d, const gp_Pnt2d& "jdoubleArray"
+%typemap(jtype) gp_Pnt2d, const gp_Pnt2d& "double[]"
+%typemap(jstype) gp_Pnt2d, const gp_Pnt2d& "double[]"
+
+%typemap(in) gp_Pnt2d, const gp_Pnt2d&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=2)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 2");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Pnt2d(naxe[0],naxe[1]);
+}
+
+%typemap(freearg) gp_Pnt2d, const gp_Pnt2d&
+{
+ delete $1;
+}
+
+%typemap(javain) gp_Pnt2d, const gp_Pnt2d& "$javainput"
+%typemap(javaout) gp_Pnt2d, const gp_Pnt2d&
+{
+ return $jnicall;
+}
+
+%typemap(out) gp_Pnt2d, const gp_Pnt2d&
+{
+ jdouble nativeArray[]={$1.X(), $1.Y()};
+ jdoubleArray toReturn=JCALL1(NewDoubleArray, jenv, 2);
+ JCALL4(SetDoubleArrayRegion, jenv, toReturn, 0, 2, nativeArray);
+ $result=toReturn;
+}
+/**
+ * gp_Pln
+ */
+%typemap(jni) gp_Pln, const gp_Pln& "jdoubleArray"
+%typemap(jtype) gp_Pln, const gp_Pln& "double[]"
+%typemap(jstype) gp_Pln, const gp_Pln& "double[]"
+
+%typemap(in) gp_Pln, const gp_Pln&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=4)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 4");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Pln(naxe[0],naxe[1],naxe[2],naxe[4]);
+}
+
+%typemap(freearg) gp_Pln, const gp_Pln&
+{
+ delete $1;
+}
+
+%typemap(javain) gp_Pln, const gp_Pln& "$javainput"
+%typemap(javaout) gp_Pln, const gp_Pln&
+{
+ return $jnicall;
+}
+
+%typemap(out) gp_Pln, const gp_Pln &
+{
+ double a, b, c, d;
+ $1.Coefficients(a, b, c, d);
+ jdouble nativeArray[] = {a, b, c, d};
+ jdoubleArray toReturn = JCALL1(NewDoubleArray, jenv, 4);
+ JCALL4(SetDoubleArrayRegion, jenv, toReturn, 0, 4, nativeArray);
+ $result=toReturn;
+}
+
+/**
+ * gp_Vec
+ */
+%typemap(jni) gp_Vec, const gp_Vec& "jdoubleArray"
+%typemap(jtype) gp_Vec, const gp_Vec& "double[]"
+%typemap(jstype) gp_Vec, const gp_Vec& "double[]"
+
+%typemap(in) gp_Vec, const gp_Vec&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=3)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Vec(naxe[0],naxe[1],naxe[2]);
+}
+
+%typemap(freearg) gp_Vec, const gp_Vec&
+{
+ delete $1;
+}
+
+%typemap(javain) gp_Vec, const gp_Vec& "$javainput"
+%typemap(javaout) gp_Vec, const gp_Vec&
+{
+ return $jnicall;
+}
+
+%typemap(out) gp_Vec, const gp_Vec&
+{
+ $result=XYZtoDoubleArray(jenv, $1->XYZ());
+}
+
+/**
+ * gp_Dir
+ */
+%typemap(jni) gp_Dir, const gp_Dir&, gp_Dir& "jdoubleArray"
+%typemap(jtype) gp_Dir, const gp_Dir&, gp_Dir& "double[]"
+%typemap(jstype) gp_Dir, const gp_Dir&, gp_Dir& "double[]"
+
+%typemap(in) gp_Dir, const gp_Dir&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=3)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 3");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Dir(naxe[0],naxe[1],naxe[2]);
+}
+
+%typemap(freearg) gp_Dir, const gp_Dir&
+{
+ delete $1;
+}
+
+%typemap(out) const gp_Dir&
+{
+ $result=XYZtoDoubleArray(jenv, $1->XYZ());
+}
+
+%typemap(out) gp_Dir
+{
+ $result=XYZtoDoubleArray(jenv, $1.XYZ());
+}
+
+%typemap(javain) gp_Dir, const gp_Dir&, gp_Dir& "$javainput"
+%typemap(javaout) gp_Dir, const gp_Dir&, gp_Dir&
+{
+ return $jnicall;
+}
+
+/**
+ * gp_Ax2
+ */
+%typemap(jni) gp_Ax2, const gp_Ax2& "jdoubleArray"
+%typemap(jtype) gp_Ax2, const gp_Ax2& "double[]"
+%typemap(jstype) gp_Ax2, const gp_Ax2& "double[]"
+
+%typemap(in) gp_Ax2, const gp_Ax2&
+{
+ int len = JCALL1(GetArrayLength, jenv, $input);
+ if(len !=6 && len != 9)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 6 or 9");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ if (len == 6)
+ $1=new gp_Ax2(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]));
+ else
+ $1=new gp_Ax2(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]), gp_Dir(naxe[6], naxe[7], naxe[8]));
+}
+
+%typemap(freearg) gp_Ax2, const gp_Ax2&
+{
+ delete $1;
+}
+
+%typemap(out) gp_Ax2, const gp_Ax2&
+{
+ ##error TODO
+}
+
+%typemap(javain) gp_Ax2, const gp_Ax2& "$javainput"
+%typemap(javaout) gp_Ax2, const gp_Ax2&
+{
+ return $jnicall;
+}
+
+/**
+ * gp_Ax1
+ */
+%typemap(jni) gp_Ax1, const gp_Ax1& "jdoubleArray"
+%typemap(jtype) gp_Ax1, const gp_Ax1& "double[]"
+%typemap(jstype) gp_Ax1, const gp_Ax1& "double[]"
+
+%typemap(in) gp_Ax1, const gp_Ax1&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=6)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 6");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Ax1(gp_Pnt(naxe[0],naxe[1],naxe[2]), gp_Dir(naxe[3], naxe[4], naxe[5]));
+}
+
+%typemap(freearg) gp_Ax1, const gp_Ax1&
+{
+ delete $1;
+}
+
+%typemap(out) gp_Ax1, const gp_Ax1&
+{
+ ##error TODO
+}
+
+%typemap(javain) gp_Ax1, const gp_Ax1& "$javainput"
+%typemap(javaout) gp_Ax1, const gp_Ax1&
+{
+ return $jnicall;
+}
+
+/**
+ * gp_Trsf
+ */
+ %{#include <gp_Trsf.hxx>%}
+
+%rename(GP_Trsf) gp_Trsf;
+
+%typemap(javacode) gp_Trsf
+%{
+ public void setValues(double[] matrix)
+ {
+ if(matrix.length!=12)
+ throw new IllegalArgumentException("matrix length must be 12");
+ setValues(
+ matrix[0], matrix[1], matrix[2], matrix[3],
+ matrix[4], matrix[5], matrix[6], matrix[7],
+ matrix[8], matrix[9], matrix[10], matrix[11]);
+ }
+%}
+
+class gp_Trsf
+{
+ %rename(setRotation) SetRotation;
+ %rename(setTranslation) SetTranslation;
+ %rename(setValues) SetValues;
+ public:
+ gp_Trsf();
+ void SetRotation(const gp_Ax1& A1,const Standard_Real Ang) ;
+ void SetTranslation(const gp_Vec& V) ;
+ void SetValues(const Standard_Real a11,const Standard_Real a12, const Standard_Real a13,const Standard_Real a14,
+ const Standard_Real a21,const Standard_Real a22,const Standard_Real a23,const Standard_Real a24,
+ const Standard_Real a31,const Standard_Real a32,const Standard_Real a33,const Standard_Real a34);
+};
+
+%extend gp_Trsf
+{
+ /** Easy to use with javax.vecmath.Matrix4D */
+ void getValues(double matrix[16])
+ {
+ int k=0;
+ for(int i=1; i<=3; i++)
+ for(int j=1; j<=4; j++)
+ matrix[k++]=self->Value(i,j);
+ matrix[12]=0;
+ matrix[13]=0;
+ matrix[14]=0;
+ matrix[15]=1;
+ }
+}
+
+/**
+ * GP_Circ
+ */
+%{#include <gp_Circ.hxx>%}
+%rename(GP_Circ) gp_Circ;
+class gp_Circ
+{
+ public:
+ gp_Circ(const gp_Ax2& axis, const Standard_Real radius);
+};
+
+/**
+ * GP_Parab
+ */
+%{#include <gp_Parab.hxx>%}
+%rename(GP_Parab) gp_Parab;
+class gp_Parab
+{
+ public:
+ gp_Parab(const gp_Ax2& A2,const Standard_Real Focal);
+ gp_Parab(const gp_Ax1& D,const gp_Pnt& F);
+};
+
+
+/*******************************************************************
+ * *
+ * VTT *
+ * *
+ *******************************************************************/
+
+/**
+ * GP_Ellips
+ */
+%{#include <gp_Elips.hxx>%}
+
+ %rename(GP_Elips) gp_Elips;
+
+ class gp_Elips
+{
+
+ public:
+ gp_Elips(const gp_Ax2& A2,const Standard_Real MajorRadius,const Standard_Real MinorRadius);
+};
+
+/**
+ * GP_Lin
+ */
+
+ %{#include <gp_Lin.hxx>%}
+
+ %rename(GP_Lin) gp_Lin;
+
+ class gp_Lin
+{
+ public:
+ gp_Lin(const gp_Ax1& A1);
+};
+
+
+/**
+ * gp_Mat
+ */
+ %{#include <gp_Mat.hxx>%}
+%typemap(jni) gp_Mat, const gp_Mat& "jdoubleArray"
+%typemap(jtype) gp_Mat, const gp_Mat& "double[]"
+%typemap(jstype) gp_Mat, const gp_Mat& "double[]"
+
+%typemap(in) gp_Mat, const gp_Mat&
+{
+ if(JCALL1(GetArrayLength, jenv, $input)!=9)
+ SWIG_JavaThrowException(jenv, SWIG_JavaIllegalArgumentException, "array length must be 9");
+ jdouble * naxe=JCALL2(GetDoubleArrayElements, jenv, $input, NULL);
+ $1=new gp_Mat(naxe[0],naxe[1],naxe[2],naxe[3],naxe[4],naxe[5],naxe[6],naxe[7],naxe[8]);
+}
+
+%typemap(freearg) gp_Mat, const gp_Mat&
+{
+ delete $1;
+}
+
+%typemap(javain) gp_Mat, const gp_Mat& "$javainput"
+%typemap(javaout) gp_Mat, const gp_Mat&
+{
+ return $jnicall;
+}
+
+%{
+ jdoubleArray MatToDoubleArray(JNIEnv* jenv, const gp_Mat & mat)
+ {
+ jdouble nativeArray[]={mat.Value(1,1), mat.Value(1,2), mat.Value(1,3),
+ mat.Value(2,1), mat.Value(2,2), mat.Value(2,3),
+ mat.Value(3,1), mat.Value(3,2), mat.Value(3,3)};
+ jdoubleArray toReturn=jenv->NewDoubleArray(9);
+ jenv->SetDoubleArrayRegion(toReturn, 0, 9, nativeArray);
+ return toReturn;
+ }
+%}
+
+%typemap(out) gp_Mat, const gp_Mat&
+{
+ $result=MatToDoubleArray(jenv, $1);
}
\ No newline at end of file
-package org.simantics.opencascade;\r
-\r
-/*******************************************************************************\r
- * Copyright (c) 2007, 2013- VTT Technical Research Centre of Finland.\r
- * All rights reserved. This program and the accompanying materials\r
- * are made available under the terms of the Eclipse Public License v1.0\r
- * which accompanies this distribution, and is available at\r
- * http://www.eclipse.org/legal/epl-v10.html\r
- *\r
- * Contributors:\r
- * VTT Technical Research Centre of Finland - initial API and implementation\r
- *******************************************************************************/\r
-\r
-import javax.vecmath.Vector2d;\r
-\r
-import org.jcae.opencascade.jni.BRepBuilderAPI_MakeEdge;\r
-import org.jcae.opencascade.jni.BRepBuilderAPI_MakeFace;\r
-import org.jcae.opencascade.jni.BRepBuilderAPI_MakeWire;\r
-import org.jcae.opencascade.jni.BRepBuilderAPI_Transform;\r
-import org.jcae.opencascade.jni.BRepPrimAPI_MakePrism;\r
-import org.jcae.opencascade.jni.BRepPrimAPI_MakeTorus;\r
-import org.jcae.opencascade.jni.BRep_Builder;\r
-import org.jcae.opencascade.jni.GP_Elips;\r
-import org.jcae.opencascade.jni.GP_Trsf;\r
-import org.jcae.opencascade.jni.TopoDS_Edge;\r
-import org.jcae.opencascade.jni.TopoDS_Face;\r
-import org.jcae.opencascade.jni.TopoDS_Shape;\r
-import org.jcae.opencascade.jni.TopoDS_Wire;\r
-\r
-\r
-public class OccTriangulator {\r
-\r
- \r
- public static final double MIN_VALUE = 0.001;\r
- \r
- public OccTriangulator() {\r
- \r
- }\r
-\r
-\r
- public static TopoDS_Shape getShapeFromFile(String filename) {\r
- assert (filename != null);\r
- String lowerFileName = filename.toLowerCase(); \r
- if (lowerFileName.endsWith(".stp") || lowerFileName.endsWith(".step")) {\r
- TopoDS_Shape shape = importSTEP(filename);\r
- return shape;\r
- } else if (lowerFileName.endsWith(".iges")) {\r
- TopoDS_Shape shape = importIGES(filename);\r
- return shape;\r
- } else if (lowerFileName.endsWith(".brep")) {\r
- TopoDS_Shape shape = importBREP(filename);\r
- return shape;\r
- } else {\r
- throw new UnsupportedOperationException("Unsupported format " + filename);\r
- }\r
- }\r
-\r
- public static TopoDS_Shape importBREP(String filename) {\r
- return importBREP(filename,1.0); // convert to meters.\r
- }\r
- public static TopoDS_Shape importBREP(String filename, double scale) {\r
- org.jcae.opencascade.jni.BRep_Builder aBuilder = new org.jcae.opencascade.jni.BRep_Builder();\r
- org.jcae.opencascade.jni.TopoDS_Shape myShape = org.jcae.opencascade.jni.BRepTools.read(filename, aBuilder);\r
- aBuilder.delete();\r
- if (Math.abs(scale-1.0) < 0.001)\r
- return myShape;\r
- TopoDS_Shape scaled = makeScale(myShape, scale);\r
- myShape.delete();\r
- return scaled;\r
- }\r
-\r
- public static TopoDS_Shape importIGES(String filename) {\r
- org.jcae.opencascade.jni.IGESControl_Reader aReader = new org.jcae.opencascade.jni.IGESControl_Reader();\r
- aReader.setReadUnitM();\r
- aReader.readFile(filename.getBytes());\r
- aReader.clearShapes();\r
- aReader.transferRoots();\r
- TopoDS_Shape result = aReader.oneShape();\r
- aReader.delete();\r
- return result;\r
- }\r
- \r
- public static TopoDS_Shape importSTEP(String filename) {\r
- org.jcae.opencascade.jni.STEPControl_Reader aReader = new org.jcae.opencascade.jni.STEPControl_Reader();\r
- aReader.setReadUnitM();\r
- aReader.readFile(filename.getBytes());\r
- aReader.clearShapes();\r
- aReader.transferRoots();\r
- TopoDS_Shape result = aReader.oneShape();\r
- aReader.delete();\r
- return result;\r
- }\r
-\r
-\r
-\r
- public static TopoDS_Shape makeTranslation(TopoDS_Shape aShape, double x, double y, double z) {\r
- GP_Trsf theTransformation = new GP_Trsf();\r
- theTransformation.setTranslation(new double[] { x, y, z });\r
- BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);\r
-\r
- TopoDS_Shape shape = bt.shape();\r
- bt.delete();\r
- theTransformation.delete();\r
- return shape;\r
- }\r
-\r
- public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double r1, double r2) {\r
- double[] axe = new double[6];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();\r
- torus.delete();\r
- return tds;\r
- }\r
- \r
-\r
- public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double[] dirStruct2, double r1, double r2) {\r
- double[] axe = new double[9];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- System.arraycopy(dirStruct2, 0, axe, 6, 3);\r
- BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();\r
- torus.delete();\r
- return tds;\r
- }\r
- \r
- public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double r1, double r2, double angle1, double angle2, double angle) {\r
- double[] axe = new double[6];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2,angle1,angle2,angle);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();\r
- torus.delete();\r
- return tds;\r
- }\r
- \r
- public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double[] dirStruct2, double r1, double r2, double angle1, double angle2, double angle) {\r
- double[] axe = new double[9];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- System.arraycopy(dirStruct2, 0, axe, 6, 3);\r
- BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2,angle1,angle2,angle);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();\r
- torus.delete();\r
- return tds;\r
- }\r
-\r
- public static TopoDS_Shape makeSphere(double x, double y, double z, double radius) {\r
- double[] c = new double[] { x, y, z };\r
- org.jcae.opencascade.jni.BRepPrimAPI_MakeSphere sphere = new org.jcae.opencascade.jni.BRepPrimAPI_MakeSphere(c, radius);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = sphere.shape();\r
- sphere.delete();\r
- return tds;\r
- }\r
-\r
-\r
- public static TopoDS_Shape makeRotation(TopoDS_Shape aShape, double[] axisStruct, double angle) {\r
-\r
- GP_Trsf theTransformation = new GP_Trsf();\r
- theTransformation.setRotation(axisStruct, angle);\r
- BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);\r
- TopoDS_Shape shape = bt.shape();\r
- bt.delete();\r
- theTransformation.delete();\r
- return shape;\r
- }\r
-\r
- public static TopoDS_Shape makeScale(TopoDS_Shape aShape, double s) {\r
-\r
- GP_Trsf theTransformation = new GP_Trsf();\r
- theTransformation.setValues(s, 0, 0, 0,\r
- 0, s, 0, 0, \r
- 0, 0, s, 0, 1, 1);\r
- BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);\r
- TopoDS_Shape shape = bt.shape();\r
- bt.delete();\r
- theTransformation.delete();\r
- return shape;\r
- }\r
-\r
-\r
- public static TopoDS_Shape makeCylinder(double[] pointStruct, double[] dirStruct, double radius, double height) {\r
- double[] axe = new double[6];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- org.jcae.opencascade.jni.BRepPrimAPI_MakeCylinder cyl = new org.jcae.opencascade.jni.BRepPrimAPI_MakeCylinder(axe, radius, height, 2 * Math.PI);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = cyl.shape();\r
- cyl.delete();\r
- return tds;\r
- }\r
-\r
- public static TopoDS_Shape makeCopy(TopoDS_Shape topoDS_Shape) {\r
- throw new UnsupportedOperationException();\r
- }\r
-\r
- public static TopoDS_Shape makeCone(double[] pointStruct, double[] dirStruct, double radius1, double radius2, double height) {\r
- double[] axe = new double[6];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- org.jcae.opencascade.jni.BRepPrimAPI_MakeCone cone = new org.jcae.opencascade.jni.BRepPrimAPI_MakeCone(axe, radius1, radius2, height, 2 * Math.PI);\r
- org.jcae.opencascade.jni.TopoDS_Shape tds = cone.shape();\r
- cone.delete();\r
- return tds;\r
- }\r
-\r
- public static TopoDS_Shape makeCompound(TopoDS_Shape[] shapes) {\r
- BRep_Builder builder = new BRep_Builder();\r
- org.jcae.opencascade.jni.TopoDS_Compound comp = new org.jcae.opencascade.jni.TopoDS_Compound();\r
- builder.makeCompound(comp);\r
- for (int i = 0; i < shapes.length; i++) {\r
-\r
- builder.add(comp, shapes[i]);\r
- }\r
- builder.delete();\r
- return comp;\r
- }\r
-\r
-\r
- public static TopoDS_Shape makeBox(double x1, double y1, double z1, double x2, double y2, double z2) {\r
- double[] p1 = new double[] { x1, y1, z1 };\r
- double[] p2 = new double[] { x2, y2, z2 };\r
- org.jcae.opencascade.jni.BRepPrimAPI_MakeBox box = new org.jcae.opencascade.jni.BRepPrimAPI_MakeBox(p1, p2); \r
- org.jcae.opencascade.jni.TopoDS_Shape tds = box.shape();\r
- box.delete();\r
- return tds;\r
- }\r
-\r
- public static TopoDS_Shape makeCut(TopoDS_Shape shape1, TopoDS_Shape shape2) {\r
- org.jcae.opencascade.jni.BRepAlgoAPI_Cut cut = new org.jcae.opencascade.jni.BRepAlgoAPI_Cut(shape1, shape2);\r
- org.jcae.opencascade.jni.TopoDS_Shape s = cut.shape();\r
- cut.delete();\r
- return s;\r
- }\r
- \r
- public static TopoDS_Shape makeCommon(TopoDS_Shape shape1, TopoDS_Shape shape2) {\r
- org.jcae.opencascade.jni.BRepAlgoAPI_Common common = new org.jcae.opencascade.jni.BRepAlgoAPI_Common(shape1, shape2); \r
- org.jcae.opencascade.jni.TopoDS_Shape s = common.shape();\r
- common.delete();\r
- return s;\r
- }\r
- \r
- public static TopoDS_Shape makeFuse(TopoDS_Shape shape1, TopoDS_Shape shape2) {\r
- org.jcae.opencascade.jni.BRepAlgoAPI_Fuse fuse = new org.jcae.opencascade.jni.BRepAlgoAPI_Fuse(shape1, shape2);\r
- org.jcae.opencascade.jni.TopoDS_Shape s = fuse.shape();\r
- fuse.delete();\r
- return s;\r
- }\r
-\r
- \r
- public static TopoDS_Shape makeWedge(double[] pointStruct, double[] dirStruct,double dx, double dy, double dz, double xmin, double zmin, double xmax, double zmax) {\r
- double[] axe = new double[6];\r
- System.arraycopy(pointStruct, 0, axe, 0, 3);\r
- System.arraycopy(dirStruct, 0, axe, 3, 3);\r
- \r
- org.jcae.opencascade.jni.BRepPrimAPI_MakeWedge wedge = new org.jcae.opencascade.jni.BRepPrimAPI_MakeWedge(axe, dx, dy, dz, xmin, zmin, xmax, zmax); \r
- org.jcae.opencascade.jni.TopoDS_Shape s = wedge.shape();\r
- wedge.delete();\r
- return s;\r
- }\r
- \r
- public static TopoDS_Shape makeEllipticCylinder(double h, double r1, double r2) {\r
- GP_Elips ellipse;\r
- if (r1 < r2) {\r
- // FIXME : ellipse should be rotated, but current JNI won't allow it since Ax2 is not separate object\r
- ellipse = new GP_Elips(new double[]{0.0,-h*0.5,0.0,0.0,1.0,0.0},r2,r1);\r
- } else {\r
- ellipse = new GP_Elips(new double[]{0.0,-h*0.5,0.0,0.0,1.0,0.0},r1,r2);\r
- }\r
- BRepBuilderAPI_MakeEdge edge = new BRepBuilderAPI_MakeEdge(ellipse);\r
- TopoDS_Edge ed = (TopoDS_Edge) edge.shape();\r
- BRepBuilderAPI_MakeWire wire = new BRepBuilderAPI_MakeWire(ed);\r
- TopoDS_Wire w = (TopoDS_Wire) wire.shape();\r
- BRepBuilderAPI_MakeFace face = new BRepBuilderAPI_MakeFace(w); \r
- TopoDS_Face F = (TopoDS_Face) face.shape();\r
- BRepPrimAPI_MakePrism prism = new BRepPrimAPI_MakePrism(F, new double[] { 0.0, h, 0.0 }); \r
- TopoDS_Shape shape = prism.shape();\r
- ellipse.delete();\r
- edge.delete();\r
- wire.delete();\r
- face.delete();\r
- ed.delete();\r
- w.delete();\r
- F.delete();\r
- prism.delete();\r
- return shape;\r
- }\r
-\r
- public static TopoDS_Shape makeReqularPrism(double h, double r, int n) {\r
- if (n < 3)\r
- n = 3;\r
- Vector2d vertices[] = new Vector2d[n];\r
- for (int i = 0; i < n; i++) {\r
- vertices[i] = new Vector2d(Math.sin(Math.PI * 2.0 * i / n)*r,Math.cos(Math.PI * 2.0 * i / n)*r);\r
- }\r
- BRepBuilderAPI_MakeWire wire = new BRepBuilderAPI_MakeWire();\r
- for (int i = 0; i < n; i++) {\r
- Vector2d v1 = vertices[i];\r
- Vector2d v2 = vertices[(i+1)%n];\r
- BRepBuilderAPI_MakeEdge edge = new BRepBuilderAPI_MakeEdge(new double[]{v1.x,-h*0.5,v1.y},new double[]{v2.x,-h*0.5,v2.y}); \r
- wire.add((TopoDS_Edge)edge.shape());\r
- edge.delete();\r
- }\r
- TopoDS_Wire w = (TopoDS_Wire)wire.shape();\r
- \r
- BRepBuilderAPI_MakeFace face = new BRepBuilderAPI_MakeFace(w);\r
- TopoDS_Face F = (TopoDS_Face) face.shape();\r
- face.delete();\r
- \r
- BRepPrimAPI_MakePrism prism = new BRepPrimAPI_MakePrism(F, new double[] { 0.0, h, 0.0 }); \r
- TopoDS_Shape shape = prism.shape(); \r
- prism.delete();\r
- \r
- wire.delete();\r
- w.delete();\r
- F.delete();\r
- return shape;\r
- }\r
- \r
-\r
- public static void exportBREP(TopoDS_Shape shape, String filename) {\r
- org.jcae.opencascade.jni.BRepTools.write(shape, filename);\r
- }\r
- \r
-}\r
+package org.simantics.opencascade;
+
+/*******************************************************************************
+ * Copyright (c) 2007, 2013- VTT Technical Research Centre of Finland.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * VTT Technical Research Centre of Finland - initial API and implementation
+ *******************************************************************************/
+
+import javax.vecmath.Vector2d;
+
+import org.jcae.opencascade.jni.BRepBuilderAPI_MakeEdge;
+import org.jcae.opencascade.jni.BRepBuilderAPI_MakeFace;
+import org.jcae.opencascade.jni.BRepBuilderAPI_MakeWire;
+import org.jcae.opencascade.jni.BRepBuilderAPI_Transform;
+import org.jcae.opencascade.jni.BRepPrimAPI_MakePrism;
+import org.jcae.opencascade.jni.BRepPrimAPI_MakeTorus;
+import org.jcae.opencascade.jni.BRep_Builder;
+import org.jcae.opencascade.jni.GP_Elips;
+import org.jcae.opencascade.jni.GP_Trsf;
+import org.jcae.opencascade.jni.TopoDS_Edge;
+import org.jcae.opencascade.jni.TopoDS_Face;
+import org.jcae.opencascade.jni.TopoDS_Shape;
+import org.jcae.opencascade.jni.TopoDS_Wire;
+
+
+public class OccTriangulator {
+
+
+ public static final double MIN_VALUE = 0.001;
+
+ public OccTriangulator() {
+
+ }
+
+
+ public static TopoDS_Shape getShapeFromFile(String filename) {
+ assert (filename != null);
+ String lowerFileName = filename.toLowerCase();
+ if (lowerFileName.endsWith(".stp") || lowerFileName.endsWith(".step")) {
+ TopoDS_Shape shape = importSTEP(filename);
+ return shape;
+ } else if (lowerFileName.endsWith(".iges")) {
+ TopoDS_Shape shape = importIGES(filename);
+ return shape;
+ } else if (lowerFileName.endsWith(".brep")) {
+ TopoDS_Shape shape = importBREP(filename);
+ return shape;
+ } else {
+ throw new UnsupportedOperationException("Unsupported format " + filename);
+ }
+ }
+
+ public static TopoDS_Shape importBREP(String filename) {
+ return importBREP(filename,1.0); // convert to meters.
+ }
+ public static TopoDS_Shape importBREP(String filename, double scale) {
+ org.jcae.opencascade.jni.BRep_Builder aBuilder = new org.jcae.opencascade.jni.BRep_Builder();
+ org.jcae.opencascade.jni.TopoDS_Shape myShape = org.jcae.opencascade.jni.BRepTools.read(filename, aBuilder);
+ aBuilder.delete();
+ if (Math.abs(scale-1.0) < 0.001)
+ return myShape;
+ TopoDS_Shape scaled = makeScale(myShape, scale);
+ myShape.delete();
+ return scaled;
+ }
+
+ public static TopoDS_Shape importIGES(String filename) {
+ org.jcae.opencascade.jni.IGESControl_Reader aReader = new org.jcae.opencascade.jni.IGESControl_Reader();
+ aReader.setReadUnitM();
+ aReader.readFile(filename.getBytes());
+ aReader.clearShapes();
+ aReader.transferRoots();
+ TopoDS_Shape result = aReader.oneShape();
+ aReader.delete();
+ return result;
+ }
+
+ public static TopoDS_Shape importSTEP(String filename) {
+ org.jcae.opencascade.jni.STEPControl_Reader aReader = new org.jcae.opencascade.jni.STEPControl_Reader();
+ aReader.setReadUnitM();
+ aReader.readFile(filename.getBytes());
+ aReader.clearShapes();
+ aReader.transferRoots();
+ TopoDS_Shape result = aReader.oneShape();
+ aReader.delete();
+ return result;
+ }
+
+
+
+ public static TopoDS_Shape makeTranslation(TopoDS_Shape aShape, double x, double y, double z) {
+ GP_Trsf theTransformation = new GP_Trsf();
+ theTransformation.setTranslation(new double[] { x, y, z });
+ BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);
+
+ TopoDS_Shape shape = bt.shape();
+ bt.delete();
+ theTransformation.delete();
+ return shape;
+ }
+
+ public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double r1, double r2) {
+ double[] axe = new double[6];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();
+ torus.delete();
+ return tds;
+ }
+
+
+ public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double[] dirStruct2, double r1, double r2) {
+ double[] axe = new double[9];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ System.arraycopy(dirStruct2, 0, axe, 6, 3);
+ BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();
+ torus.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double r1, double r2, double angle1, double angle2, double angle) {
+ double[] axe = new double[6];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2,angle1,angle2,angle);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();
+ torus.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeTorus(double[] pointStruct, double[] dirStruct, double[] dirStruct2, double r1, double r2, double angle1, double angle2, double angle) {
+ double[] axe = new double[9];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ System.arraycopy(dirStruct2, 0, axe, 6, 3);
+ BRepPrimAPI_MakeTorus torus = new BRepPrimAPI_MakeTorus(axe, r1, r2,angle1,angle2,angle);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = torus.shape();
+ torus.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeSphere(double x, double y, double z, double radius) {
+ double[] c = new double[] { x, y, z };
+ org.jcae.opencascade.jni.BRepPrimAPI_MakeSphere sphere = new org.jcae.opencascade.jni.BRepPrimAPI_MakeSphere(c, radius);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = sphere.shape();
+ sphere.delete();
+ return tds;
+ }
+
+
+ public static TopoDS_Shape makeRotation(TopoDS_Shape aShape, double[] axisStruct, double angle) {
+
+ GP_Trsf theTransformation = new GP_Trsf();
+ theTransformation.setRotation(axisStruct, angle);
+ BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);
+ TopoDS_Shape shape = bt.shape();
+ bt.delete();
+ theTransformation.delete();
+ return shape;
+ }
+
+ public static TopoDS_Shape makeScale(TopoDS_Shape aShape, double s) {
+
+ GP_Trsf theTransformation = new GP_Trsf();
+ theTransformation.setValues(s, 0, 0, 0,
+ 0, s, 0, 0,
+ 0, 0, s, 0);
+ BRepBuilderAPI_Transform bt = new BRepBuilderAPI_Transform(aShape, theTransformation, true);
+ TopoDS_Shape shape = bt.shape();
+ bt.delete();
+ theTransformation.delete();
+ return shape;
+ }
+
+
+ public static TopoDS_Shape makeCylinder(double[] pointStruct, double[] dirStruct, double radius, double height) {
+ double[] axe = new double[6];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ org.jcae.opencascade.jni.BRepPrimAPI_MakeCylinder cyl = new org.jcae.opencascade.jni.BRepPrimAPI_MakeCylinder(axe, radius, height, 2 * Math.PI);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = cyl.shape();
+ cyl.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeCopy(TopoDS_Shape topoDS_Shape) {
+ throw new UnsupportedOperationException();
+ }
+
+ public static TopoDS_Shape makeCone(double[] pointStruct, double[] dirStruct, double radius1, double radius2, double height) {
+ double[] axe = new double[6];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+ org.jcae.opencascade.jni.BRepPrimAPI_MakeCone cone = new org.jcae.opencascade.jni.BRepPrimAPI_MakeCone(axe, radius1, radius2, height, 2 * Math.PI);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = cone.shape();
+ cone.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeCompound(TopoDS_Shape[] shapes) {
+ BRep_Builder builder = new BRep_Builder();
+ org.jcae.opencascade.jni.TopoDS_Compound comp = new org.jcae.opencascade.jni.TopoDS_Compound();
+ builder.makeCompound(comp);
+ for (int i = 0; i < shapes.length; i++) {
+
+ builder.add(comp, shapes[i]);
+ }
+ builder.delete();
+ return comp;
+ }
+
+
+ public static TopoDS_Shape makeBox(double x1, double y1, double z1, double x2, double y2, double z2) {
+ double[] p1 = new double[] { x1, y1, z1 };
+ double[] p2 = new double[] { x2, y2, z2 };
+ org.jcae.opencascade.jni.BRepPrimAPI_MakeBox box = new org.jcae.opencascade.jni.BRepPrimAPI_MakeBox(p1, p2);
+ org.jcae.opencascade.jni.TopoDS_Shape tds = box.shape();
+ box.delete();
+ return tds;
+ }
+
+ public static TopoDS_Shape makeCut(TopoDS_Shape shape1, TopoDS_Shape shape2) {
+ org.jcae.opencascade.jni.BRepAlgoAPI_Cut cut = new org.jcae.opencascade.jni.BRepAlgoAPI_Cut(shape1, shape2);
+ org.jcae.opencascade.jni.TopoDS_Shape s = cut.shape();
+ cut.delete();
+ return s;
+ }
+
+ public static TopoDS_Shape makeCommon(TopoDS_Shape shape1, TopoDS_Shape shape2) {
+ org.jcae.opencascade.jni.BRepAlgoAPI_Common common = new org.jcae.opencascade.jni.BRepAlgoAPI_Common(shape1, shape2);
+ org.jcae.opencascade.jni.TopoDS_Shape s = common.shape();
+ common.delete();
+ return s;
+ }
+
+ public static TopoDS_Shape makeFuse(TopoDS_Shape shape1, TopoDS_Shape shape2) {
+ org.jcae.opencascade.jni.BRepAlgoAPI_Fuse fuse = new org.jcae.opencascade.jni.BRepAlgoAPI_Fuse(shape1, shape2);
+ org.jcae.opencascade.jni.TopoDS_Shape s = fuse.shape();
+ fuse.delete();
+ return s;
+ }
+
+
+ public static TopoDS_Shape makeWedge(double[] pointStruct, double[] dirStruct,double dx, double dy, double dz, double xmin, double zmin, double xmax, double zmax) {
+ double[] axe = new double[6];
+ System.arraycopy(pointStruct, 0, axe, 0, 3);
+ System.arraycopy(dirStruct, 0, axe, 3, 3);
+
+ org.jcae.opencascade.jni.BRepPrimAPI_MakeWedge wedge = new org.jcae.opencascade.jni.BRepPrimAPI_MakeWedge(axe, dx, dy, dz, xmin, zmin, xmax, zmax);
+ org.jcae.opencascade.jni.TopoDS_Shape s = wedge.shape();
+ wedge.delete();
+ return s;
+ }
+
+ public static TopoDS_Shape makeEllipticCylinder(double h, double r1, double r2) {
+ GP_Elips ellipse;
+ if (r1 < r2) {
+ // FIXME : ellipse should be rotated, but current JNI won't allow it since Ax2 is not separate object
+ ellipse = new GP_Elips(new double[]{0.0,-h*0.5,0.0,0.0,1.0,0.0},r2,r1);
+ } else {
+ ellipse = new GP_Elips(new double[]{0.0,-h*0.5,0.0,0.0,1.0,0.0},r1,r2);
+ }
+ BRepBuilderAPI_MakeEdge edge = new BRepBuilderAPI_MakeEdge(ellipse);
+ TopoDS_Edge ed = (TopoDS_Edge) edge.shape();
+ BRepBuilderAPI_MakeWire wire = new BRepBuilderAPI_MakeWire(ed);
+ TopoDS_Wire w = (TopoDS_Wire) wire.shape();
+ BRepBuilderAPI_MakeFace face = new BRepBuilderAPI_MakeFace(w);
+ TopoDS_Face F = (TopoDS_Face) face.shape();
+ BRepPrimAPI_MakePrism prism = new BRepPrimAPI_MakePrism(F, new double[] { 0.0, h, 0.0 });
+ TopoDS_Shape shape = prism.shape();
+ ellipse.delete();
+ edge.delete();
+ wire.delete();
+ face.delete();
+ ed.delete();
+ w.delete();
+ F.delete();
+ prism.delete();
+ return shape;
+ }
+
+ public static TopoDS_Shape makeReqularPrism(double h, double r, int n) {
+ if (n < 3)
+ n = 3;
+ Vector2d vertices[] = new Vector2d[n];
+ for (int i = 0; i < n; i++) {
+ vertices[i] = new Vector2d(Math.sin(Math.PI * 2.0 * i / n)*r,Math.cos(Math.PI * 2.0 * i / n)*r);
+ }
+ BRepBuilderAPI_MakeWire wire = new BRepBuilderAPI_MakeWire();
+ for (int i = 0; i < n; i++) {
+ Vector2d v1 = vertices[i];
+ Vector2d v2 = vertices[(i+1)%n];
+ BRepBuilderAPI_MakeEdge edge = new BRepBuilderAPI_MakeEdge(new double[]{v1.x,-h*0.5,v1.y},new double[]{v2.x,-h*0.5,v2.y});
+ wire.add((TopoDS_Edge)edge.shape());
+ edge.delete();
+ }
+ TopoDS_Wire w = (TopoDS_Wire)wire.shape();
+
+ BRepBuilderAPI_MakeFace face = new BRepBuilderAPI_MakeFace(w);
+ TopoDS_Face F = (TopoDS_Face) face.shape();
+ face.delete();
+
+ BRepPrimAPI_MakePrism prism = new BRepPrimAPI_MakePrism(F, new double[] { 0.0, h, 0.0 });
+ TopoDS_Shape shape = prism.shape();
+ prism.delete();
+
+ wire.delete();
+ w.delete();
+ F.delete();
+ return shape;
+ }
+
+
+ public static void exportBREP(TopoDS_Shape shape, String filename) {
+ org.jcae.opencascade.jni.BRepTools.write(shape, filename);
+ }
+
+}
@Override
public Collection<TopoDS_Shape> getModel() throws Exception {
- double p0[] = new double[]{-length*0.50, 0.0,0.0};
- double p1[] = new double[]{-length*0.488, radius*0.6,0.0};
- double p2[] = new double[]{-length*0.46, radius,0.0};
- double p3[] = new double[]{ length*0.46, radius,0.0};
- double p4[] = new double[]{ length*0.488, radius*0.6,0.0};
- double p5[] = new double[]{ length*0.50, 0.0,0.0};
+ double p0[] = new double[]{ length*0.50, 0.0,0.0};
+ double p1[] = new double[]{ length*0.488, radius*0.6,0.0};
+ double p2[] = new double[]{ length*0.46, radius,0.0};
+ double p3[] = new double[]{-length*0.46, radius,0.0};
+ double p4[] = new double[]{-length*0.488, radius*0.6,0.0};
+ double p5[] = new double[]{-length*0.50, 0.0,0.0};
GC_MakeArcOfCircle m1 = new GC_MakeArcOfCircle(p0,p1,p2);
GC_MakeSegment s1 = new GC_MakeSegment(p2,p3);
TopoDS_Shape shape2 = OccTriangulator.makeTranslation(shape, 0.0, radius, 0.0);
shape.delete();
- shape = shape2;
TopoDS_Shape box = OccTriangulator.makeBox(-length*0.4, 0.0, -radius*0.5, -length*0.3, radius, radius*0.5);
- shape2 = OccTriangulator.makeFuse(shape, box);
- shape.delete();
- box.delete();
- box = OccTriangulator.makeBox(length*0.3, 0.0, -radius*0.5, length*0.4, radius, radius*0.5);
shape = OccTriangulator.makeFuse(shape2, box);
shape2.delete();
box.delete();
+ box = OccTriangulator.makeBox(length*0.3, 0.0, -radius*0.5, length*0.4, radius, radius*0.5);
+ shape2 = OccTriangulator.makeFuse(shape, box);
+ shape.delete();
+ box.delete();
- return Collections.singletonList(shape);
+ return Collections.singletonList(shape2);
}
@Override
"vtkInteractionImage",
"vtkInteractionImageJava",
+ "vtkIOCore",
+ "vtkIOCoreJava",
+ "vtkIOXMLParser",
+ "vtkIOXMLParserJava",
+ "vtkIOXML",
+ "vtkIOXMLJava",
+
+
};
Code Review / simantics / 3d.git / commitdiff