org.simantics.views.swt;bundle-version="1.0.0",
org.simantics.selectionview;bundle-version="1.0.0",
org.simantics.utils.thread.swt;bundle-version="1.1.0",
- org.eclipse.e4.core.contexts;bundle-version="1.1.0",
- org.slf4j.api;bundle-version="1.7.25"
+ org.eclipse.e4.core.contexts;bundle-version="1.1.0"
Bundle-ActivationPolicy: lazy
Bundle-RequiredExecutionEnvironment: JavaSE-1.8
Export-Package: org.simantics.browsing.ui.platform
/*******************************************************************************
- * Copyright (c) 2007, 2018 Association for Decentralized Information Management
+ * Copyright (c) 2007, 2010 Association for Decentralized Information Management
* in Industry THTH ry.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
*******************************************************************************/
package org.simantics.browsing.ui.platform;
+import java.util.HashSet;
import java.util.Map;
+import java.util.Set;
import java.util.WeakHashMap;
import java.util.function.Consumer;
+import org.eclipse.core.runtime.IConfigurationElement;
+import org.eclipse.core.runtime.IExtension;
+import org.eclipse.core.runtime.IExtensionPoint;
+import org.eclipse.core.runtime.IExtensionRegistry;
+import org.eclipse.core.runtime.RegistryFactory;
import org.eclipse.jface.resource.ImageDescriptor;
import org.eclipse.jface.resource.JFaceResources;
import org.eclipse.jface.resource.LocalResourceManager;
import org.eclipse.ui.IWorkbenchPart;
import org.eclipse.ui.IWorkbenchPart3;
import org.eclipse.ui.PartInitException;
+import org.eclipse.ui.PlatformUI;
import org.eclipse.ui.contexts.IContextService;
import org.eclipse.ui.part.IContributedContentsView;
import org.eclipse.ui.part.IPage;
import org.simantics.selectionview.PropertyPage;
import org.simantics.ui.workbench.IPropertyPage;
import org.simantics.ui.workbench.ResourceInput;
+import org.simantics.utils.threads.SWTThread;
+import org.simantics.utils.threads.Throttler;
import org.simantics.utils.ui.BundleUtils;
import org.simantics.utils.ui.SWTUtils;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
/**
* This is a version of the standard eclipse <code>PropertySheet</code> view a
* @see IPropertyPage
* @see PropertyPage
*/
-public class PropertyPageView extends PageBookView implements IContributedContentsView {
+public class PropertyPageView extends PageBookView implements ISelectionListener, IContributedContentsView {
- private static final Logger LOGGER = LoggerFactory.getLogger(PropertyPageView.class);
+ /**
+ * Extension point used to modify behavior of the view
+ */
+ private static final String EXT_POINT = "org.eclipse.ui.propertiesView"; //$NON-NLS-1$
private static final String PROPERTY_VIEW_CONTEXT = "org.simantics.modeling.ui.properties";
private static final String PROP_PINNED = "pinned";
+ protected static final long SELECTION_CHANGE_THRESHOLD = 500;
+
private ISessionContextProvider contextProvider;
/**
private IWorkbenchPart lastPart;
private ISelection lastSelection;
- private final Map<IWorkbenchPart, ISelection> lastSelections = new WeakHashMap<>();
+ private final Map<IWorkbenchPart, ISelection> lastSelections = new WeakHashMap<IWorkbenchPart, ISelection>();
private ResourceManager resourceManager;
private ImageDescriptor pinned;
/**
- * The workbench post-selection listener for this view that changes the
- * input of the pagebook page for the part which changed its selection.
+ * Set of workbench parts, which should not be used as a source for PropertySheet
*/
- private ISelectionListener selectionListener = this::doSelectionChanged;
+ private Set<String> ignoredViews;
@Override
public void createPartControl(Composite parent) {
//System.out.println("PPV init: " + this);
super.init(site);
+ // This prevents the Properties view from providing a selection to other
+ // workbench parts, thus making them lose their selections which is not
+ // desirable.
+// site.setSelectionProvider(null);
+
contextProvider = Simantics.getSessionContextProvider();
if (!bootstrapOnly) {
- site.getPage().addPostSelectionListener(selectionListener);
+ site.getPage().addSelectionListener(immediateSelectionListener);
+ site.getPage().addPostSelectionListener(this);
}
}
// Remove ourselves as a workbench selection listener.
if (!bootstrapOnly) {
- getSite().getPage().removePostSelectionListener(selectionListener);
+ getSite().getPage().removePostSelectionListener(this);
+ getSite().getPage().removeSelectionListener(immediateSelectionListener);
}
if (resourceManager != null) {
page.createControl(book);
page.setMessage(Messages.PropertyPageView_noPropertiesAvailable);
return page;
- */
+ */
PropertyPage page = new PropertyPage(getSite());
initPage(page);
@Override
protected PageRec doCreatePage(IWorkbenchPart part) {
+
// NOTE: If the default page should be shown, this method must return null.
if (part == null)
return null;
return this == part || ignore;
}
+ private Set<String> getIgnoredViews() {
+ if (ignoredViews == null) {
+ ignoredViews = new HashSet<String>();
+ IExtensionRegistry registry = RegistryFactory.getRegistry();
+ IExtensionPoint ep = registry.getExtensionPoint(EXT_POINT);
+ if (ep != null) {
+ IExtension[] extensions = ep.getExtensions();
+ for (int i = 0; i < extensions.length; i++) {
+ IConfigurationElement[] elements = extensions[i].getConfigurationElements();
+ for (int j = 0; j < elements.length; j++) {
+ if ("excludeSources".equalsIgnoreCase(elements[j].getName())) { //$NON-NLS-1$
+ String id = elements[j].getAttribute("id"); //$NON-NLS-1$
+ if (id != null)
+ ignoredViews.add(id);
+ }
+ }
+ }
+ }
+ }
+ return ignoredViews;
+ }
+
+ private boolean isViewIgnored(String partID) {
+ return getIgnoredViews().contains(partID);
+ }
+
@Override
protected boolean isImportant(IWorkbenchPart part) {
- //System.out.println("isImportant(" + part.getSite().getId() + ")");
- return !isWorkbenchSelectionPinned() && !isPropertyView(part);
+ String partID = part.getSite().getId();
+ //System.out.println("isImportant(" + partID + ")");
+ return !isWorkbenchSelectionPinned() && !isPropertyView(part) && !isViewIgnored(partID);
}
/**
// super.partHidden(part);
}
+ ISelectionListener immediateSelectionListener = new ISelectionListener() {
+
+ private Throttler throttler = new Throttler(SWTThread.getThreadAccess(PlatformUI.getWorkbench().getDisplay()), 500, 3);
+
+ @Override
+ public void selectionChanged(final IWorkbenchPart part, final ISelection selection) {
+
+ // Do not process selections from self
+ if(PropertyPageView.this == part) return;
+
+ throttler.schedule(new Runnable() {
+
+ @Override
+ public void run() {
+ PropertyPageView.this.doSelectionChanged(part, selection);
+ }
+
+ });
+
+ }
+ };
+
public ISelection getLastSelection() {
return lastSelection;
}
+ /*
+ * (non-Javadoc)
+ *
+ * @see org.eclipse.ui.ISelectionListener#selectionChanged(org.eclipse.ui.IWorkbenchPart,
+ * org.eclipse.jface.viewers.ISelection)
+ */
+ @Override
public void selectionChanged(IWorkbenchPart part, ISelection sel) {
doSelectionChanged(part, sel);
}
* <code>false</code> otherwise
*/
boolean doSelectionChanged(IWorkbenchPart part, ISelection sel) {
- LOGGER.trace("doSelectionChanged({}): incoming selection {}", part, sel);
-
+
// we ignore our own selection or null selection
if (isPropertyView(part) || sel == null) {
return false;
lastPart.addPropertyListener(partPropertyListener);
}
+ updatePartName(ppage, sel);
if (!sameSelection) {
- LOGGER.trace("doSelectionChanged({}): updating page input selection to {}", part, sel);
- updatePartName(ppage, sel);
ppage.selectionChanged(part, sel);
return true;
}
// This check is not safe - there might be a burst of changes incoming
//if (getPartName().equals(parameter)) return;
//System.out.println("partNameUpdateCallback : " + parameter);
- SWTUtils.asyncExec(getPageBook(), () -> {
- if (!getPageBook().isDisposed()) {
- if (getPartName().equals(parameter)) return;
- //System.out.println("doSetParameterName : " + parameter);
- doSetPartName(parameter);
+ SWTUtils.asyncExec(getPageBook(), new Runnable() {
+ @Override
+ public void run() {
+ if (!getPageBook().isDisposed()) {
+ if (getPartName().equals(parameter)) return;
+ //System.out.println("doSetParameterName : " + parameter);
+ doSetPartName(parameter);
+ }
}
});
};
import org.eclipse.jface.resource.JFaceResources;
import org.eclipse.jface.resource.LocalResourceManager;
import org.eclipse.jface.resource.ResourceManager;
-import org.eclipse.jface.util.OpenStrategy;
import org.eclipse.jface.viewers.IPostSelectionProvider;
import org.eclipse.jface.viewers.ISelection;
import org.eclipse.jface.viewers.ISelectionChangedListener;
import org.eclipse.swt.events.KeyListener;
import org.eclipse.swt.events.MouseEvent;
import org.eclipse.swt.events.MouseListener;
+import org.eclipse.swt.events.SelectionEvent;
import org.eclipse.swt.events.SelectionListener;
import org.eclipse.swt.graphics.Color;
import org.eclipse.swt.graphics.Font;
import org.simantics.utils.ui.jface.BasePostSelectionProvider;
import org.simantics.utils.ui.widgets.VetoingEventHandler;
import org.simantics.utils.ui.workbench.WorkbenchUtils;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
import gnu.trove.map.hash.THashMap;
import gnu.trove.procedure.TObjectProcedure;
*/
class GraphExplorerImpl extends GraphExplorerImplBase implements Listener, GraphExplorer /*, IPostSelectionProvider*/ {
- private static final Logger LOGGER = LoggerFactory.getLogger(GraphExplorerImpl.class);
-
private static class GraphExplorerPostSelectionProvider implements IPostSelectionProvider {
private GraphExplorerImpl ge;
public static final int DEFAULT_MAX_CHILDREN = 1000;
+ private static final long POST_SELECTION_DELAY = 300;
+
+ /**
+ * The time in milliseconds that must elapse between consecutive
+ * {@link Tree} {@link SelectionListener#widgetSelected(SelectionEvent)}
+ * invocations in order for this class to construct a new selection.
+ *
+ * <p>
+ * This is done because selection construction can be very expensive as the
+ * selected set grows larger when the user is pressing shift+arrow keys.
+ * GraphExplorerImpl will naturally listen to all changes in the tree
+ * selection, but as an optimization will not construct new
+ * StructuredSelection instances for every selection change event. A new
+ * selection will be constructed and set only if the selection hasn't
+ * changed for the amount of milliseconds specified by this constant.
+ */
+ private static final long SELECTION_CHANGE_QUIET_TIME = 150;
+
private final IThreadWorkQueue thread;
/**
Tree tree;
@SuppressWarnings({ "rawtypes" })
- final HashMap<CacheKey<?>, NodeQueryProcessor> processors = new HashMap<>();
+ final HashMap<CacheKey<?>, NodeQueryProcessor> processors = new HashMap<CacheKey<?>, NodeQueryProcessor>();
@SuppressWarnings({ "rawtypes" })
- final HashMap<Object, PrimitiveQueryProcessor> primitiveProcessors = new HashMap<>();
+ final HashMap<Object, PrimitiveQueryProcessor> primitiveProcessors = new HashMap<Object, PrimitiveQueryProcessor>();
@SuppressWarnings({ "rawtypes" })
- final HashMap<Class, DataSource> dataSources = new HashMap<>();
+ final HashMap<Class, DataSource> dataSources = new HashMap<Class, DataSource>();
class GraphExplorerContext extends AbstractDisposable implements IGraphExplorerContext {
// This is for query debugging only.
* <code>null</code> there's nothing scheduled yet in which case
* scheduling can commence. Otherwise the update should be skipped.
*/
- AtomicReference<Runnable> currentQueryUpdater = new AtomicReference<>();
+ AtomicReference<Runnable> currentQueryUpdater = new AtomicReference<Runnable>();
/**
* Keeps track of nodes that have already been auto-expanded. After
* expanded state after that. This makes it possible for the user to
* close auto-expanded nodes.
*/
- Map<NodeContext, Boolean> autoExpanded = new WeakHashMap<>();
+ Map<NodeContext, Boolean> autoExpanded = new WeakHashMap<NodeContext, Boolean>();
@Override
GraphExplorerContext explorerContext = new GraphExplorerContext();
- HashSet<TreeItem> pendingItems = new HashSet<>();
+ HashSet<TreeItem> pendingItems = new HashSet<TreeItem>();
boolean updating = false;
boolean pendingRoot = false;
* Access this map only in the SWT thread to keep it thread-safe.
* </p>
*/
- BijectionMap<NodeContext, TreeItem> contextToItem = new BijectionMap<>();
+ BijectionMap<NodeContext, TreeItem> contextToItem = new BijectionMap<NodeContext, TreeItem>();
/**
* Columns of the UI viewer. Use {@link #setColumns(Column[])} to
* initialize.
*/
Column[] columns = new Column[0];
- Map<String, Integer> columnKeyToIndex = new HashMap<>();
+ Map<String, Integer> columnKeyToIndex = new HashMap<String, Integer>();
boolean refreshingColumnSizes = false;
boolean columnsAreVisible = true;
/** Set to true when the Tree widget is disposed. */
private boolean disposed = false;
- private final CopyOnWriteArrayList<FocusListener> focusListeners = new CopyOnWriteArrayList<>();
- private final CopyOnWriteArrayList<MouseListener> mouseListeners = new CopyOnWriteArrayList<>();
- private final CopyOnWriteArrayList<KeyListener> keyListeners = new CopyOnWriteArrayList<>();
+ private final CopyOnWriteArrayList<FocusListener> focusListeners = new CopyOnWriteArrayList<FocusListener>();
+ private final CopyOnWriteArrayList<MouseListener> mouseListeners = new CopyOnWriteArrayList<MouseListener>();
+ private final CopyOnWriteArrayList<KeyListener> keyListeners = new CopyOnWriteArrayList<KeyListener>();
/** Selection provider */
- private GraphExplorerPostSelectionProvider postSelectionProvider = new GraphExplorerPostSelectionProvider(this);
+ private GraphExplorerPostSelectionProvider postSelectionProvider = new GraphExplorerPostSelectionProvider(this);
protected BasePostSelectionProvider selectionProvider = new BasePostSelectionProvider();
protected SelectionDataResolver selectionDataResolver;
protected SelectionFilter selectionFilter;
* item was a part of the current selection in which case the selection must
* be updated.
*/
- private final Map<TreeItem, NodeContext> selectedItems = new HashMap<>();
+ private final Map<TreeItem, NodeContext> selectedItems = new HashMap<TreeItem, NodeContext>();
/**
* TODO: specify what this is for
*/
- private final Set<NodeContext> selectionRefreshContexts = new HashSet<>();
+ private final Set<NodeContext> selectionRefreshContexts = new HashSet<NodeContext>();
/**
* If this field is non-null, it means that if {@link #setData(Event)}
*
* @see #setPendingImages(IProgressMonitor)
*/
- Map<TreeItem, ImageTask> imageTasks = new THashMap<>();
+ Map<TreeItem, ImageTask> imageTasks = new THashMap<TreeItem, ImageTask>();
/**
* A state flag indicating whether the vertical scroll bar was visible for
updateCounter = 0;
uiUpdateScheduler.schedule(this, 50, TimeUnit.MILLISECONDS);
} else {
- tree.getDisplay().asyncExec(new UpdateRunner(GraphExplorerImpl.this));
+ tree.getDisplay().asyncExec(new UpdateRunner(GraphExplorerImpl.this, GraphExplorerImpl.this.explorerContext));
}
}
* modified. These are used internally to prevent duplicate edits from being
* initiated which should always be a sensible thing to do.
*/
- private Set<NodeContext> currentlyModifiedNodes = new THashSet<>();
+ private Set<NodeContext> currentlyModifiedNodes = new THashSet<NodeContext>();
private final TreeEditor editor;
private Color invalidModificationColor = null;
// Keep track of the previous single selection to help
// decide whether to start editing a tree node on mouse
// downs or not.
- tree.addListener(SWT.Selection, event -> {
- TreeItem[] selection = tree.getSelection();
- if (selection.length == 1) {
- //for (TreeItem item : selection)
- // System.out.println("selection: " + item);
- previousSingleSelection = selection[0];
- } else {
- previousSingleSelection = null;
+ tree.addListener(SWT.Selection, new Listener() {
+ @Override
+ public void handleEvent(Event event) {
+ TreeItem[] selection = tree.getSelection();
+ if (selection.length == 1) {
+ //for (TreeItem item : selection)
+ // System.out.println("selection: " + item);
+ previousSingleSelection = selection[0];
+ } else {
+ previousSingleSelection = null;
+ }
}
});
};
tree.addListener(SWT.MouseDown, mouseEditListener);
tree.addListener(SWT.DragDetect, mouseEditListener);
- tree.addListener(SWT.DragDetect, event -> {
- Point test = new Point(event.x, event.y);
- TreeItem item = tree.getItem(test);
- if(item != null) {
- for(int i=0;i<tree.getColumnCount();i++) {
- Rectangle rect = item.getBounds(i);
- if(rect.contains(test)) {
- tree.setData(KEY_DRAG_COLUMN, i);
- return;
+ tree.addListener(SWT.DragDetect, new Listener() {
+ @Override
+ public void handleEvent(Event event) {
+ Point test = new Point(event.x, event.y);
+ TreeItem item = tree.getItem(test);
+ if(item != null) {
+ for(int i=0;i<tree.getColumnCount();i++) {
+ Rectangle rect = item.getBounds(i);
+ if(rect.contains(test)) {
+ tree.setData(KEY_DRAG_COLUMN, i);
+ return;
+ }
}
}
+ tree.setData(KEY_DRAG_COLUMN, -1);
}
- tree.setData(KEY_DRAG_COLUMN, -1);
});
- tree.addListener(SWT.MouseMove, event -> {
- Point test = new Point(event.x, event.y);
- TreeItem item = tree.getItem(test);
- if(item != null) {
- for(int i=0;i<tree.getColumnCount();i++) {
- Rectangle rect = item.getBounds(i);
- if(rect.contains(test)) {
- transientState.setActiveColumn(i);
- return;
+ tree.addListener(SWT.MouseMove, new Listener() {
+ @Override
+ public void handleEvent(Event event) {
+ Point test = new Point(event.x, event.y);
+ TreeItem item = tree.getItem(test);
+ if(item != null) {
+ for(int i=0;i<tree.getColumnCount();i++) {
+ Rectangle rect = item.getBounds(i);
+ if(rect.contains(test)) {
+ transientState.setActiveColumn(i);
+ return;
+ }
}
}
+ transientState.setActiveColumn(null);
}
- transientState.setActiveColumn(null);
});
// Add focus/mouse/key listeners for supporting the respective
}
});
- OpenStrategy os = new OpenStrategy(tree);
- os.addSelectionListener(SelectionListener.widgetSelectedAdapter(e -> {
- ISelection s = resetSelectionFromWidget();
- if (s != null) {
- LOGGER.trace("Fire selection change: {}", s);
- selectionProvider.fireSelection(s);
+ // Add a tree selection listener for keeping the selection of
+ // GraphExplorer's ISelectionProvider up-to-date.
+ tree.addSelectionListener(new SelectionListener() {
+ @Override
+ public void widgetDefaultSelected(SelectionEvent e) {
+ widgetSelected(e);
+ }
+ @Override
+ public void widgetSelected(SelectionEvent e) {
+ widgetSelectionChanged(false);
}
- }));
- os.addPostSelectionListener(SelectionListener.widgetSelectedAdapter(e -> {
- LOGGER.trace("Fire post-selection change: {}", selectionProvider.getSelection());
- resetSelectionFromWidgetAndFirePostSelection(true);
- }));
+ });
// This listener takes care of updating the set of currently selected
// TreeItem instances. This set is needed because we need to know in
}
/**
- * @return the new selection if it was different from the old selection in
- * {@link #selectionProvider}
+ * Mod count for delaying post selection changed events.
*/
- private ISelection resetSelectionFromWidget() {
- ISelection widgetSelection = getWidgetSelection();
-// System.out.println("resetSelection()");
-// System.out.println(" provider selection: " + selectionProvider.getSelection());
-// System.out.println(" widget selection: " + widgetSelection);
- boolean equals = selectionProvider.selectionEquals(widgetSelection);
- selectionProvider.setSelectionWithoutFiring(widgetSelection);
- return equals ? null : widgetSelection;
- }
+ int postSelectionModCount = 0;
+
+ /**
+ * Last tree selection modification time for implementing a quiet
+ * time for selection changes.
+ */
+ long lastSelectionModTime = System.currentTimeMillis() - 10000;
/**
- * @return the new selection if it was different from the old selection in
- * {@link #selectionProvider}
+ * Current target time for the selection to be set. Calculated
+ * according to the set quiet time and last selection modification
+ * time.
*/
- private boolean resetSelectionFromWidgetAndFirePostSelection(boolean force) {
- ISelection s = resetSelectionFromWidget();
- boolean fire = s != null || force;
- if (fire) {
- //System.out.println("FIRING POST-SELECTION: " + selectionProvider.getSelection());
- selectionProvider.firePostSelection(selectionProvider.getSelection());
+ long selectionSetTargetTime = 0;
+
+ /**
+ * <code>true</code> if delayed selection runnable is current scheduled or
+ * running.
+ */
+ boolean delayedSelectionScheduled = false;
+
+ Runnable SELECTION_DELAY = new Runnable() {
+ @Override
+ public void run() {
+ if (tree.isDisposed())
+ return;
+ long now = System.currentTimeMillis();
+ long waitTimeLeft = selectionSetTargetTime - now;
+ if (waitTimeLeft > 0) {
+ // Not enough quiet time, reschedule.
+ delayedSelectionScheduled = true;
+ tree.getDisplay().timerExec((int) waitTimeLeft, this);
+ } else {
+ // Time to perform selection, stop rescheduling.
+ delayedSelectionScheduled = false;
+ resetSelection();
+ }
+ }
+ };
+
+ private void widgetSelectionChanged(boolean forceSelectionChange) {
+ long modTime = System.currentTimeMillis();
+ long delta = modTime - lastSelectionModTime;
+ lastSelectionModTime = modTime;
+ if (!forceSelectionChange && delta < SELECTION_CHANGE_QUIET_TIME) {
+ long msToWait = SELECTION_CHANGE_QUIET_TIME - delta;
+ selectionSetTargetTime = modTime + msToWait;
+ if (!delayedSelectionScheduled) {
+ delayedSelectionScheduled = true;
+ tree.getDisplay().timerExec((int) msToWait, SELECTION_DELAY);
+ }
+ // Make sure that post selection change events do not fire.
+ ++postSelectionModCount;
+ return;
}
- return fire;
+
+ // Immediate selection reconstruction.
+ resetSelection();
}
+ private void resetSelection() {
+ final ISelection selection = getWidgetSelection();
+
+ //System.out.println("resetSelection(" + postSelectionModCount + ")");
+ //System.out.println(" provider selection: " + selectionProvider.getSelection());
+ //System.out.println(" widget selection: " + selection);
+
+ selectionProvider.setAndFireNonEqualSelection(selection);
+
+ // Implement deferred firing of post selection events
+ final int count = ++postSelectionModCount;
+ //System.out.println("[" + System.currentTimeMillis() + "] scheduling postSelectionChanged " + count + ": " + selection);
+ ThreadUtils.getNonBlockingWorkExecutor().schedule(new Runnable() {
+ @Override
+ public void run() {
+ int newCount = postSelectionModCount;
+ // Don't publish selection yet, there's another change incoming.
+ //System.out.println("[" + System.currentTimeMillis() + "] checking post selection publish: " + count + " vs. " + newCount + ": " + selection);
+ if (newCount != count)
+ return;
+ //System.out.println("[" + System.currentTimeMillis() + "] " + count + " count equals, firing post selection listeners: " + selection);
+
+ if (tree.isDisposed())
+ return;
+
+ //System.out.println("scheduling fire post selection changed: " + selection);
+ tree.getDisplay().asyncExec(new Runnable() {
+ @Override
+ public void run() {
+ if (tree.isDisposed() || selectionProvider == null)
+ return;
+ //System.out.println("firing post selection changed: " + selection);
+ selectionProvider.firePostSelection(selection);
+ }
+ });
+ }
+ }, POST_SELECTION_DELAY, TimeUnit.MILLISECONDS);
+ }
+
protected void setDefaultProcessors() {
// Add a simple IMAGER query processor that always returns null.
// With this processor no images will ever be shown.
// System.out.println("MODCOUNT: " + modCount + " vs. " + count);
if (modCount != count)
return;
- resetSelectionFromWidgetAndFirePostSelection(false);
+ widgetSelectionChanged(true);
}
});
}
import org.simantics.browsing.ui.NodeContext;
import org.simantics.browsing.ui.NodeQueryManager;
import org.simantics.browsing.ui.common.internal.GENodeQueryManager;
+import org.simantics.browsing.ui.common.internal.IGraphExplorerContext;
import org.simantics.browsing.ui.content.PrunedChildrenResult;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
/**
* This class is responsible for updating the {@link TreeItem}s contained by the
*/
class UpdateRunner implements Runnable {
- private static final Logger LOGGER = LoggerFactory.getLogger(UpdateRunner.class);
-
final GraphExplorerImpl ge;
+ //final IGraphExplorerContext geContext;
- UpdateRunner(GraphExplorerImpl ge) {
+ UpdateRunner(GraphExplorerImpl ge, IGraphExplorerContext geContext) {
this.ge = ge;
+ // this.geContext = geContext;
}
public void run() {
try {
doRun();
} catch (Throwable t) {
- LOGGER.error("", t);
+ t.printStackTrace();
}
+
}
public void doRun() {
private InputKey() {}
@Override
public String toString() {
- return "INPUT";
+ return "INPUT"; //$NON-NLS-1$
}
};
private UIContextKey() {}
@Override
public String toString() {
- return "UI_CONTEXT";
+ return "UI_CONTEXT"; //$NON-NLS-1$
}
};
private BrowseContextKey() {}
@Override
public String toString() {
- return "BROWSE_CONTEXT";
+ return "BROWSE_CONTEXT"; //$NON-NLS-1$
}
};
private ActionBrowseContextKey() {}
@Override
public String toString() {
- return "ACTION_BROWSE_CONTEXT";
+ return "ACTION_BROWSE_CONTEXT"; //$NON-NLS-1$
}
};
private FilterKey() {}
@Override
public String toString() {
- return "FILTER";
+ return "FILTER"; //$NON-NLS-1$
}
};
public static final QueryKey<Viewpoint> SELECTED_VIEWPOINT = new QueryKey<Viewpoint>() {
@Override
public String toString() {
- return "SELECTED_VIEWPOINT";
+ return "SELECTED_VIEWPOINT"; //$NON-NLS-1$
}
};
public static final QueryKey<String> ACTIVE_FILTER = new QueryKey<String>() {
@Override
public String toString() {
- return "ACTIVE_FILTER";
+ return "ACTIVE_FILTER"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<ViewpointContribution>> VIEWPOINT_CONTRIBUTIONS = new QueryKey<Collection<ViewpointContribution>>() {
@Override
public String toString() {
- return "VIEWPOINT_CONTRIBUTIONS";
+ return "VIEWPOINT_CONTRIBUTIONS"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<ViewpointFactory>> VIEWPOINT_FACTORIES = new QueryKey<Collection<ViewpointFactory>>() {
@Override
public String toString() {
- return "VIEWPOINT_FACTORIES";
+ return "VIEWPOINT_FACTORIES"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "SELECTED_VIEWPOINT_FACTORY";
+ return "SELECTED_VIEWPOINT_FACTORY"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "VIEWPOINT";
+ return "VIEWPOINT"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "VIEWPOINT_CONTRIBUTION";
+ return "VIEWPOINT_CONTRIBUTION"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<LabelDecoratorFactory>> LABEL_DECORATOR_FACTORIES = new QueryKey<Collection<LabelDecoratorFactory>>() {
@Override
public String toString() {
- return "LABEL_DECORATOR_FACTORIES";
+ return "LABEL_DECORATOR_FACTORIES"; //$NON-NLS-1$
}
};
/**
public static final QueryKey<Collection<LabelDecorator>> LABEL_DECORATORS = new QueryKey<Collection<LabelDecorator>>() {
@Override
public String toString() {
- return "LABEL_DECORATORS";
+ return "LABEL_DECORATORS"; //$NON-NLS-1$
}
};
/**
public static final QueryKey<Collection<ImageDecoratorFactory>> IMAGE_DECORATOR_FACTORIES = new QueryKey<Collection<ImageDecoratorFactory>>() {
@Override
public String toString() {
- return "IMAGE_DECORATOR_FACTORIES";
+ return "IMAGE_DECORATOR_FACTORIES"; //$NON-NLS-1$
}
};
/**
public static final QueryKey<Collection<ImageDecorator>> IMAGE_DECORATORS = new QueryKey<Collection<ImageDecorator>>() {
@Override
public String toString() {
- return "IMAGE_DECORATORS";
+ return "IMAGE_DECORATORS"; //$NON-NLS-1$
}
};
public static final QueryKey<Labeler> SELECTED_LABELER = new QueryKey<Labeler>() {
@Override
public String toString() {
- return "SELECTED_LABELER";
+ return "SELECTED_LABELER"; //$NON-NLS-1$
}
};
public static final QueryKey<Imager> SELECTED_IMAGER = new QueryKey<Imager>() {
@Override
public String toString() {
- return "SELECTED_IMAGER";
+ return "SELECTED_IMAGER"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<LabelDecoratorFactory>> SELECTED_LABEL_DECORATOR_FACTORIES = new QueryKey<Collection<LabelDecoratorFactory>>() {
@Override
public String toString() {
- return "SELECTED_LABEL_DECORATOR_FACTORIES";
+ return "SELECTED_LABEL_DECORATOR_FACTORIES"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<ImageDecoratorFactory>> SELECTED_IMAGE_DECORATOR_FACTORIES = new QueryKey<Collection<ImageDecoratorFactory>>() {
@Override
public String toString() {
- return "SELECTED_IMAGE_DECORATOR_FACTORIES";
+ return "SELECTED_IMAGE_DECORATOR_FACTORIES"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<LabelerFactory>> LABELER_FACTORIES = new QueryKey<Collection<LabelerFactory>>() {
@Override
public String toString() {
- return "LABELER_FACTORIES";
+ return "LABELER_FACTORIES"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<ImagerFactory>> IMAGER_FACTORIES = new QueryKey<Collection<ImagerFactory>>() {
@Override
public String toString() {
- return "IMAGER_FACTORIES";
+ return "IMAGER_FACTORIES"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "LABELER";
+ return "LABELER"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "CHECK_STATE";
+ return "CHECK_STATE"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "LABEL_DECORATOR";
+ return "LABEL_DECORATOR"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "IMAGER";
+ return "IMAGER"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "IMAGE_DECORATOR";
+ return "IMAGE_DECORATOR"; //$NON-NLS-1$
}
};
public static final PrimitiveQueryKey<Collection<SelectionRequest>> SELECTION_REQUESTS = new PrimitiveQueryKey<Collection<SelectionRequest>>() {
@Override
public String toString() {
- return "SELECTION_REQUEST";
+ return "SELECTION_REQUEST"; //$NON-NLS-1$
}
};
public static final QueryKey<PrunedChildrenResult> PRUNED_CHILDREN = new QueryKey<PrunedChildrenResult>() {
@Override
public String toString() {
- return "PRUNED_CHILDREN";
+ return "PRUNED_CHILDREN"; //$NON-NLS-1$
}
};
public static final QueryKey<ComparableContext[]> COMPARABLE_CHILDREN = new QueryKey<ComparableContext[]>() {
@Override
public String toString() {
- return "COMPARABLE_CHILDREN";
+ return "COMPARABLE_CHILDREN"; //$NON-NLS-1$
}
};
public static final QueryKey<Collection<ComparableContextFactory>> COMPARABLE_FACTORIES = new QueryKey<Collection<ComparableContextFactory>>() {
@Override
public String toString() {
- return "COMPARABLE_FACTORIES";
+ return "COMPARABLE_FACTORIES"; //$NON-NLS-1$
}
};
}
@Override
public String getKeyName() {
- return "SELECTED_COMPARABLE_FACTORY";
+ return "SELECTED_COMPARABLE_FACTORY"; //$NON-NLS-1$
}
}
public static final QueryKey<NodeContext[]> FINAL_CHILDREN = new QueryKey<NodeContext[]>() {
@Override
public String toString() {
- return "FINAL_CHILDREN";
+ return "FINAL_CHILDREN"; //$NON-NLS-1$
}
};
public static final PrimitiveQueryKey<Boolean> IS_EXPANDED = new PrimitiveQueryKey<Boolean>() {
@Override
public String toString() {
- return "IS_EXPANDED";
+ return "IS_EXPANDED"; //$NON-NLS-1$
}
};
public static final QueryKey<CheckedState> IS_CHECKED = new QueryKey<CheckedState>() {
@Override
public String toString() {
- return "IS_CHECKED";
+ return "IS_CHECKED"; //$NON-NLS-1$
}
};
public static final PrimitiveQueryKey<Integer> SHOW_MAX_CHILDREN = new PrimitiveQueryKey<Integer>() {
@Override
public String toString() {
- return "SHOW_MAX_CHILDREN";
+ return "SHOW_MAX_CHILDREN"; //$NON-NLS-1$
}
};
private IsRootKey() {}
@Override
public String toString() {
- return "IS_ROOT";
+ return "IS_ROOT"; //$NON-NLS-1$
}
};
public Column(String key, String label, Align alignment, int width, String tooltip, boolean grab, int weight) {
if (alignment == null)
- throw new IllegalArgumentException("null alignment");
+ throw new IllegalArgumentException("null alignment"); //$NON-NLS-1$
if (key == null)
- throw new IllegalArgumentException("null key");
+ throw new IllegalArgumentException("null key"); //$NON-NLS-1$
this.key = key;
this.label = label;
@Override
public String toString() {
StringBuilder sb = new StringBuilder();
- sb.append("Column[key=");
+ sb.append("Column[key="); //$NON-NLS-1$
sb.append(key);
if (!key.equals(label))
- sb.append(", label=");
+ sb.append(", label="); //$NON-NLS-1$
sb.append(label);
- sb.append(", align=");
+ sb.append(", align="); //$NON-NLS-1$
sb.append(alignment);
- sb.append(", width=");
+ sb.append(", width="); //$NON-NLS-1$
sb.append(width);
if (!label.equals(tooltip)) {
- sb.append(", tooltip=");
+ sb.append(", tooltip="); //$NON-NLS-1$
sb.append(tooltip);
}
- sb.append(", grab=");
+ sb.append(", grab="); //$NON-NLS-1$
sb.append(grab);
- sb.append(", weight=");
+ sb.append(", weight="); //$NON-NLS-1$
sb.append(weight);
- sb.append("]");
+ sb.append("]"); //$NON-NLS-1$
return sb.toString();
}
*/
public ExplorerState(NodeContext[] topNodePath, int[] topNodePathChildIndex, Collection<NodeContext> expandedNodes, Map<String, Integer> columnWidths) {
if (expandedNodes == null)
- throw new IllegalArgumentException("null expanded nodes");
+ throw new IllegalArgumentException("null expanded nodes"); //$NON-NLS-1$
this.topNodePath = topNodePath;
this.topNodePathChildIndex = topNodePathChildIndex;
this.expandedNodes = expandedNodes;
@Override
public String toString() {
- return getClass().getSimpleName() + "[topNodePath="
- + Arrays.toString(topNodePath) + ", topNodePathChildIndex="
- + Arrays.toString(topNodePathChildIndex) + ", expandedNodes="
- + expandedNodes + ", " + columnWidths + "]";
+ return getClass().getSimpleName() + "[topNodePath=" //$NON-NLS-1$
+ + Arrays.toString(topNodePath) + ", topNodePathChildIndex=" //$NON-NLS-1$
+ + Arrays.toString(topNodePathChildIndex) + ", expandedNodes=" //$NON-NLS-1$
+ + expandedNodes + ", " + columnWidths + "]"; //$NON-NLS-1$ //$NON-NLS-2$
}
}
* A key that can be used to associate GraphExplorer instances with other
* objects in, e.g. SWT widgets using Widget.setData(String, Object).
*/
- public static final String KEY_GRAPH_EXPLORER = "GraphExplorer";
+ public static final String KEY_GRAPH_EXPLORER = "GraphExplorer"; //$NON-NLS-1$
/**
* @see #setAutoExpandLevel(int)
public static final Object EMPTY_INPUT = new Object() {
@Override
- public String toString() { return "GraphExplorer.EMPTY_INPUT"; };
+ public String toString() { return "GraphExplorer.EMPTY_INPUT"; }; //$NON-NLS-1$
};
Consumer<String> applyCallback);
}
- String NO_LABEL = "<no label>";
+ String NO_LABEL = "<no label>"; //$NON-NLS-1$
/**
* Use this map as a return value of {@link #getLabels()} to indicate no
@Override
public String toString() {
- return "PrunedChildrenResult [original count=" + originalChildCount + ", pruned children=" + prunedChildren.length + "]";
+ return "PrunedChildrenResult [original count=" + originalChildCount + ", pruned children=" + prunedChildren.length + "]"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
private static final long serialVersionUID = -2394930587477837261L;
public NoDataSourceException(Class<?> clazz) {
- super("No DataSource available for class " + clazz);
+ super("No DataSource available for class " + clazz); //$NON-NLS-1$
}
}
private static final long serialVersionUID = -5612824339530755041L;
public NoQueryProcessorException(CacheKey<?> key) {
- super("No Query Processor found for key " + key);
+ super("No Query Processor found for key " + key); //$NON-NLS-1$
}
}
}
Serializer serializer = binding.serializer();
byte[] bytes = serializer.serialize(initialValue);
+ // In case the file has been previously accessed and was larger we set the correct size now
+ rd.binaryFile.setLength(bytes.length);
rd.binaryFile.write(bytes);
ravs.put(resource, rd);
return rd;
org.eclipse.core.runtime,
org.eclipse.jface.dialogs,
org.eclipse.jface.operation,
+ org.eclipse.osgi.util;version="1.1.0",
org.eclipse.swt.widgets,
org.osgi.framework;version="1.3.0",
org.simantics.db,
* @return true if server can be started.
*/
public static boolean beforeStart(Shell shell, File folder) throws InternalException {
- boolean skipPurge = "true".equals(System.getProperty("org.simantics.db.procore.ui.skipPurge"));
+ boolean skipPurge = "true".equals(System.getProperty("org.simantics.db.procore.ui.skipPurge")); //$NON-NLS-1$ //$NON-NLS-2$
if (skipPurge)
return true;
return UI.purge(shell, folder);
import org.eclipse.jface.dialogs.MessageDialog;
import org.eclipse.jface.dialogs.ProgressMonitorDialog;
import org.eclipse.jface.operation.IRunnableWithProgress;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.widgets.Display;
import org.eclipse.swt.widgets.Shell;
import org.simantics.db.common.utils.Logger;
import org.simantics.db.server.ProCoreException;
abstract class Handler {
- protected final String title = "Database Server";
+ protected final String title = Messages.Handler_DatabaseServer;
abstract boolean start(Shell shell, ProCoreException e) throws ProCoreException;
protected void checkFolderGiven(Shell shell, ProCoreException e) throws ProCoreException {
if (null == e.getDbFolder()) {
- String msg = "No database folder given.";
+ String msg = Messages.Handler_NoDatabaseFolderGiven;
MessageDialog.openWarning(shell, title, msg);
throw new ProCoreException(msg);
}
}
}
class HandlerUtil {
- private static String NL = System.getProperty("line.separator");
+ private static String NL = System.getProperty("line.separator"); //$NON-NLS-1$
private static boolean isFolder(final Shell shell, final File dbFolder, String title) {
if (dbFolder.isDirectory())
return true;
- MessageDialog.openWarning(shell, title, "Database folder does not exist. folder=" + dbFolder);
+ MessageDialog.openWarning(shell, title, Messages.Handler_WarningMsgDatabaseFolderNotExists + dbFolder);
return false;
}
public static boolean saveWithQuestion(final Shell shell, final File dbFolder, String title, String msg) {
if (!isFolder(shell, dbFolder, title))
return false; // Save not possible.
- String question = ((null != msg) ? (msg + NL) : "")
- + "Do you want to save database?" + NL + "folder=" + dbFolder;
+ String question = NLS.bind(Messages.Handler_SaveDatabase,new Object[] {((null != msg) ? (msg + NL) : ""), //$NON-NLS-1$
+ NL , dbFolder});
boolean yes = MessageDialog.openQuestion(shell, title, question);
if (!yes)
return true;
Path saveFolder;
SaveDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Saving database.";
- okMessage = "Database has been saved.";
- failMessage = "Failed to save database.";
- cancelMessage = "Save cancelled.";
+ beginMessage = Messages.Handler_SavingDatabaseBeginMsg;
+ okMessage = Messages.Handler_SavingDatabaseOkMsg;
+ failMessage = Messages.Handler_SavingDatabaseFailMsg;
+ cancelMessage = Messages.Handler_SavingDatabaseCancelledMsg;
}
@Override
public void execute() throws Throwable {
saveFolder = Auxiliary.saveDatabase(dbFolder);
if (null == saveFolder || !Files.isDirectory(saveFolder))
- throw new ProCoreException("Save folder not ok.");
+ throw new ProCoreException("Save folder not ok."); //$NON-NLS-1$
}
@Override
public String getMessage() {
- return NL + "folder=" + saveFolder;
+ return NLS.bind( Messages.Handler_FolderEquals ,new Object[] { NL , saveFolder});
}
}
SaveDatabase save = new SaveDatabase(dbFolder);
boolean ok = saveWithQuestion(shell, dbFolder, title, msg);
if (ok)
return true;
- String question = "Save failed. Do you want me to contine?";
+ String question = Messages.Handler_SaveContinue;
return Util.confirm(shell, title, question);
}
public static boolean delete(final Shell shell, final File dbFolder, String title, String msg) {
if (!isFolder(shell, dbFolder, title))
return false; // Delete not possible.
- String question = ((null != msg) ? (msg + NL) : "")
- + "Do you want to delete database?" + NL + "folder=" + dbFolder;
+ String question = NLS.bind(Messages.Handler_DeleteDatabase, new Object[] {((null != msg) ? (msg + NL) : ""), NL , dbFolder}); //$NON-NLS-1$
boolean yes = MessageDialog.openQuestion(shell, title, question);
if (!yes)
return false;
final class DeleteDatabase extends ExecutorDatabase {
DeleteDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Deleting database.";
- okMessage = "Database has been deleted.";
- failMessage = "Failed to delete database.";
- cancelMessage = "Delete cancelled.";
+ beginMessage = Messages.Handler_DeletingDatabase;
+ okMessage = Messages.Handler_DatabaseHasBeenDeleted;
+ failMessage = Messages.Handler_FailedDeleteDatabase;
+ cancelMessage = Messages.Handler_DeleteCancelled;
}
@Override
public void execute() throws Throwable {
return false; // Purge not possible.
try {
if (Auxiliary.purgeDatabaseDone(dbFolder)) {
- MessageDialog.openInformation(shell, title, "Database already purged." + NL + "folder=" + dbFolder);
+ MessageDialog.openInformation(shell, title, NLS.bind(Messages.Handler_DatabaseAlreadyPurged, new Object[] { NL, dbFolder}));
return true; // Already clean.
}
} catch (ProCoreException e) {
- Logger.defaultLogError("Failed to query database purge state.", e);
+ Logger.defaultLogError("Failed to query database purge state.", e); //$NON-NLS-1$
}
- String question = ((null != msg) ? (msg + NL) : "")
- + "Do you want to purge database?";
+ String question = ((null != msg) ? (msg + NL) : "") //$NON-NLS-1$
+ + Messages.Handler_PurgeDatabaseQuestion;
boolean yes = MessageDialog.openQuestion(shell, title, question);
if (!yes)
return false;
final class PurgeDatabase extends ExecutorDatabase {
PurgeDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Purging database.";
- okMessage = "Database has been purged.";
- failMessage = "Failed to purge database.";
- cancelMessage = "Purge cancelled.";
+ beginMessage = Messages.Handler_PurgingDatabase;
+ okMessage = Messages.Handler_DatabaseHasBeenPurged;
+ failMessage = Messages.Handler_FailedToPurgeDatabase;
+ cancelMessage = Messages.Handler_PurgeCancelled;
}
@Override
public void execute() throws Throwable {
}
public static boolean recoverFromGuardFileVersion(final Shell shell, final File dbFolder, String title, String msg)
throws ProCoreException {
- String question = ((null != msg) ? msg : "")
- + NL + "Guard file version mismatch indicates that the database was made with different server version."
- + "It would be best to open the database with the same version it was made.";
+ String question = NLS.bind(Messages.Handler_GuardFileMisMatchQuestion, new Object[] { ((null != msg) ? msg : ""), //$NON-NLS-1$
+ NL});
MessageDialog.openWarning(shell, title, question);
return false;
}
public static boolean recoverFromDatabaseLastExit(final Shell shell, final File dbFolder, String title, String msg)
throws ProCoreException {
- String message = ((null != msg) ? msg : "") + NL + "What should I try to do?";
+ String message = NLS.bind(Messages.Handler_MessageWhatToDo, new Object[] {((null != msg) ? msg : "") , NL }) ; //$NON-NLS-1$
ArrayList<Util.Choice> choices = new ArrayList<Util.Choice>();
- choices.add(new Util.Choice("Cancel", "Cancel i.e. do nothing. Choose this if you want to manually analyze and correct the situation. This is the safest choice."));
- choices.add(new Util.Choice("Ignore", "Ignore the exit status. Choose this if you do not know what you are doing. This is fast way to recover and is the safest choice except for cancel."));
- choices.add(new Util.Choice("Remove", "Remove history. Choose this you know what you are doing. This is fast way to recover but can leave tricky semantic errors in the database. Furhermore, depending on the reason for the non clean exit status, this can fail and corrupt data. However, depending on how the client and/or server died, this could be the right choice."));
- choices.add(new Util.Choice("Recover", "Recover using journal. Choose this if you are willing to wait and know that the other choices won't work."));
+ choices.add(new Util.Choice(Messages.Handler_Cancel, Messages.Handler_CancelDescription));
+ choices.add(new Util.Choice(Messages.Handler_Ignore, Messages.Handler_IgnoreDescription));
+ choices.add(new Util.Choice(Messages.Handler_Remove, Messages.Handler_RemoveDescription));
+ choices.add(new Util.Choice(Messages.Handler_Recover, Messages.Handler_RecoverDescription));
Util.Choice[] t = new Util.Choice[choices.size()];
int choice = Util.select(shell, title, message, choices.toArray(t), 0);
switch (choice) {
final class IgnoreExitDatabase extends ExecutorDatabase {
IgnoreExitDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Ignoring last exit status.";
- okMessage = "Ignore done.";
- failMessage = "Failed to start.";
- cancelMessage = "Ignore cancelled.";
+ beginMessage = Messages.Handler_IgnoreExitDatabaseBeginMsg;
+ okMessage = Messages.Handler_IgnoreExitDatabaseOkMsg;
+ failMessage = Messages.Handler_IgnoreExitDatabaseBeginFailMsg;
+ cancelMessage = Messages.Handler_IgnoreExitDatabaseCancelMsg;
}
@Override
public void execute() throws Throwable {
final class IgnoreProtocolDatabase extends ExecutorDatabase {
IgnoreProtocolDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Ignoring protocol version mismatch.";
- okMessage = "Ignore done.";
- failMessage = "Failed to start.";
- cancelMessage = "Ignore cancelled.";
+ beginMessage = Messages.Handler_IgnoreProtocolDatabaseBeginMsg;
+ okMessage = Messages.Handler_IgnoreProtocolDatabaseOkMsg;
+ failMessage = Messages.Handler_IgnoreProtocolDatabaseFailMsg;
+ cancelMessage = Messages.Handler_IgnoreProtocolDatabaseCancelMsg;
}
@Override
public void execute() throws Throwable {
}
public static boolean recoverFromProtocol(final Shell shell, final File dbFolder, String title, String msg)
throws ProCoreException {
- String question = ((null != msg) ? msg : "")
- + NL + "Protocol version mismatch indicates that server and client versions differ."
- + " It would be best to open the database using the same server and client version."
- + " But if you insist I can ignore the mismatch and try to muddle along."
- + " If this works then you should export the data and get matching client and server versions."
- + " Otherwise there could later be strange errors caused by this version mismatch."
- + " Shoud I try?";
+ String question = ((null != msg) ? msg : "") + NL + Messages.Handler_ProCoreExceptionQuestion; //$NON-NLS-1$
boolean yes = Util.openDefaultNo(shell, title, question, MessageDialog.QUESTION);
if (!yes)
return false;
// }
public static boolean recoverFromDatabaseVersion(final Shell shell, final File dbFolder, String title, String msg)
throws ProCoreException {
- String question = ((null != msg) ? msg : "")
- + NL + "Database version mismatch indicates that the database was made with different server version."
- + " It would be best to open the database with the same version it was made."
- + " But if you insist I can try to recover database from journal.";
+ String question = ((null != msg) ? msg : "") + NL + Messages.Handler_ProCoreException2; //$NON-NLS-1$
boolean yes = Util.openDefaultNo(shell, title, question, MessageDialog.QUESTION);
if (!yes)
return false;
if (!isFolder(shell, dbFolder, title))
return false; // Recovery not possible.
if (!Auxiliary.canReadJournal(dbFolder)) {
- MessageDialog.openWarning(shell, title, "Journal file does not exist or isn't readable." + NL + "folder=" + dbFolder);
+ MessageDialog.openWarning(shell, title, NLS.bind(Messages.Handler_JournalFileNotExists ,new Object[] { NL , dbFolder}));
return false; // Recovery not possible.
}
- String question = ((null != msg) ? msg : "")
- + NL + "Do you want me to try to recreate the database from journal?";
+ String question = ((null != msg) ? msg : "") //$NON-NLS-1$
+ + NL + Messages.Handler_RecreateDatabaseFromJournalQuestion;
boolean yes = MessageDialog.openQuestion(shell, title, question);
if (!yes)
return false;
final class RecoverDatabase extends ExecutorDatabase {
RecoverDatabase(File dbFolder) {
super(dbFolder);
- beginMessage = "Recovering database.";
- okMessage = "Database has been recovered.";
- failMessage = "Failed to recover database.";
- cancelMessage = "Recovery cancelled.";
+ beginMessage = Messages.Handler_RecoveringDatabaseBeginMsg;
+ okMessage = Messages.Handler_RecoveringDatabaseRecoverdMsg;
+ failMessage = Messages.Handler_RecoveringDatabaseFailedMsg;
+ cancelMessage = Messages.Handler_RecoveringDatabaseCancelledMsg;
}
@Override
public void execute() throws Throwable {
public void showDone(Shell shell);
}
static abstract class ExecutorBase implements Executor {
- protected String beginMessage = "Task begin.";
- protected String okMessage = "Task ok.";
- protected String failMessage = "Task failed.";
- protected String cancelMessage = "Task cancelled.";
+ protected String beginMessage = Messages.Handler_ExecutorBaseBeginMsg;
+ protected String okMessage = Messages.Handler_ExecutorBaseOkMsg;
+ protected String failMessage = Messages.Handler_ExecutorBaseFailedMsg;
+ protected String cancelMessage = Messages.Handler_ExecutorBaseCancelledMsg;
protected boolean done = false;
protected boolean ok = false;
protected boolean cancelled = false;
this.dbFolder = dbFolder;
}
String getMessage() {
- return NL + "folder=" + dbFolder;
+ return NLS.bind( Messages.Handler_FolderEquals ,new Object[] { NL , dbFolder});
}
@Override
public String getMessageBegin() {
return;
executor.setCancelled();
thread.interrupt();
- monitor.subTask("Waiting for cancellation to finish.");
+ monitor.subTask(Messages.Handler_MonitorWaitingForCancellationToFinish);
while (!executor.isDone())
sleep(100);
} finally {
--- /dev/null
+package org.simantics.db.procore.ui.internal;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.db.procore.ui.internal.messages"; //$NON-NLS-1$
+ public static String Handler_Cancel;
+ public static String Handler_CancelDescription;
+ public static String Handler_DatabaseAlreadyPurged;
+ public static String Handler_DatabaseHasBeenDeleted;
+ public static String Handler_DatabaseHasBeenPurged;
+ public static String Handler_DatabaseServer;
+ public static String Handler_DeleteCancelled;
+ public static String Handler_DeleteDatabase;
+ public static String Handler_DeletingDatabase;
+ public static String Handler_ExecutorBaseBeginMsg;
+ public static String Handler_ExecutorBaseCancelledMsg;
+ public static String Handler_ExecutorBaseFailedMsg;
+ public static String Handler_ExecutorBaseOkMsg;
+ public static String Handler_FailedDeleteDatabase;
+ public static String Handler_FailedToPurgeDatabase;
+ public static String Handler_FolderEquals;
+ public static String Handler_GuardFileMisMatchQuestion;
+ public static String Handler_Ignore;
+ public static String Handler_IgnoreDescription;
+ public static String Handler_IgnoreExitDatabaseBeginFailMsg;
+ public static String Handler_IgnoreExitDatabaseBeginMsg;
+ public static String Handler_IgnoreExitDatabaseCancelMsg;
+ public static String Handler_IgnoreExitDatabaseOkMsg;
+ public static String Handler_IgnoreProtocolDatabaseBeginMsg;
+ public static String Handler_IgnoreProtocolDatabaseCancelMsg;
+ public static String Handler_IgnoreProtocolDatabaseFailMsg;
+ public static String Handler_IgnoreProtocolDatabaseOkMsg;
+ public static String Handler_JournalFileNotExists;
+ public static String Handler_MessageWhatToDo;
+ public static String Handler_MonitorWaitingForCancellationToFinish;
+ public static String Handler_NoDatabaseFolderGiven;
+ public static String Handler_ProCoreException2;
+ public static String Handler_ProCoreExceptionQuestion;
+ public static String Handler_PurgeCancelled;
+ public static String Handler_PurgeDatabaseQuestion;
+ public static String Handler_PurgingDatabase;
+ public static String Handler_Recover;
+ public static String Handler_RecoverDescription;
+ public static String Handler_RecoveringDatabaseBeginMsg;
+ public static String Handler_RecoveringDatabaseCancelledMsg;
+ public static String Handler_RecoveringDatabaseFailedMsg;
+ public static String Handler_RecoveringDatabaseRecoverdMsg;
+ public static String Handler_RecreateDatabaseFromJournalQuestion;
+ public static String Handler_Remove;
+ public static String Handler_RemoveDescription;
+ public static String Handler_SaveContinue;
+ public static String Handler_SaveDatabase;
+ public static String Handler_SavingDatabaseBeginMsg;
+ public static String Handler_SavingDatabaseCancelledMsg;
+ public static String Handler_SavingDatabaseFailMsg;
+ public static String Handler_SavingDatabaseOkMsg;
+ public static String Handler_WarningMsgDatabaseFolderNotExists;
+ public static String UI_DatabaseDelete;
+ public static String UI_DatabasePurge;
+ public static String Util_Error;
+ public static String Util_Information;
+ public static String Util_No;
+ public static String Util_Warning;
+ public static String Util_Yes;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public class UI {
public static boolean delete(Shell shell, File folder) {
- return HandlerUtil.delete(shell, folder, "Database Delete", null);
+ return HandlerUtil.delete(shell, folder, Messages.UI_DatabaseDelete, null);
}
public static boolean purge(Shell shell, File folder) {
- return HandlerUtil.purge(shell, folder, "Database Purge", null);
+ return HandlerUtil.purge(shell, folder, Messages.UI_DatabasePurge, null);
}
public static boolean handleStart(Shell shell, InternalException e) throws ProCoreException {
if (!(e instanceof ProCoreException))
private static <E extends ProCoreException> long getId(E pe) {
long id = 0;
try {
- Method m = pe.getClass().getMethod("getHandlerId");
+ Method m = pe.getClass().getMethod("getHandlerId"); //$NON-NLS-1$
Object value = m.invoke(null);
id = (long)value;
} catch (RuntimeException e) {
public class Util {
static void showInfo(Shell shell, String message) {
- MessageDialog.openInformation(shell, "Information", message);
+ MessageDialog.openInformation(shell, Messages.Util_Information, message);
}
static void showWarning(Shell shell, String message) {
- MessageDialog.openWarning(shell, "Warning", message);
+ MessageDialog.openWarning(shell, Messages.Util_Warning, message);
}
public static void showError(Shell shell, String message) {
Util.showError(shell, message, null);
static void showError(Shell shell, String message, Throwable t) {
Logger.defaultLogError(message, t);
if (null != t)
- message += "\n" + t.getMessage();
- MessageDialog.openError(shell, "Error", message);
+ message += "\n" + t.getMessage(); //$NON-NLS-1$
+ MessageDialog.openError(shell, Messages.Util_Error, message);
}
public static void logError(String message) {
Util.logError(message, null);
trace(null, message);
}
public static void trace(Class<?> clazz, String message) {
- String s = "";
+ String s = ""; //$NON-NLS-1$
if (null != clazz)
- s += clazz.getSimpleName() + " called.\n";
+ s += clazz.getSimpleName() + " called.\n"; //$NON-NLS-1$
if (null != message)
s += message;
Logger.defaultLogInfo(s);
}
- private static String NL = System.getProperty("line.separator");
+ private static String NL = System.getProperty("line.separator"); //$NON-NLS-1$
static class Choice {
public Choice(String button, String text) {
this.button = button;
}
public static boolean confirm(Shell shell, String title, String message) {
String[] labels = new String[2];
- labels[0] = "Yes";
- labels[1] = "No";
+ labels[0] = Messages.Util_Yes;
+ labels[1] = Messages.Util_No;
MessageDialog dialog = new MessageDialog(shell, title, null, message, MessageDialog.QUESTION, labels, 1);
int answer = dialog.open();
return answer == 0;
}
public static boolean openDefaultNo(Shell shell, String title, String message, int style) {
String[] labels = new String[2];
- labels[0] = "Yes";
- labels[1] = "No";
+ labels[0] = Messages.Util_Yes;
+ labels[1] = Messages.Util_No;
MessageDialog dialog = new MessageDialog(shell, title, null, message, style, labels, 1);
int answer = dialog.open();
return answer == 0;
final int LIMIT = 10;
int i = 0;
for (Throwable c = t.getCause(); null != c && i < LIMIT; ++i, c = c.getCause())
- s.append(NL + "cause: " + c.getMessage());
+ s.append(NL + "cause: " + c.getMessage()); //$NON-NLS-1$
return s.toString();
}
}
--- /dev/null
+Handler_Cancel=Cancel\r
+Handler_CancelDescription=Cancel i.e. do nothing. Choose this if you want to manually analyze and correct the situation. This is the safest choice.\r
+Handler_DatabaseAlreadyPurged=Database already purged.{0}folder={1}\r
+Handler_DatabaseHasBeenDeleted=Database has been deleted.\r
+Handler_DatabaseHasBeenPurged=Database has been purged.\r
+Handler_DatabaseServer=Database Server\r
+Handler_DeleteCancelled=Delete cancelled.\r
+Handler_DeleteDatabase={0}Do you want to delete database?{1}folder={2}\r
+Handler_DeletingDatabase=Deleting database.\r
+Handler_ExecutorBaseBeginMsg=Task begin.\r
+Handler_ExecutorBaseCancelledMsg=Task cancelled.\r
+Handler_ExecutorBaseFailedMsg=Task failed.\r
+Handler_ExecutorBaseOkMsg=Task ok.\r
+Handler_FailedDeleteDatabase=Failed to delete database.\r
+Handler_FailedToPurgeDatabase=Failed to purge database.\r
+Handler_FolderEquals={0}folder={1}\r
+Handler_GuardFileMisMatchQuestion={0}{1}Guard file version mismatch indicates that the database was made with different server version.It would be best to open the database with the same version it was made.\r
+Handler_Ignore=Ignore\r
+Handler_IgnoreDescription=Ignore the exit status. Choose this if you do not know what you are doing. This is fast way to recover and is the safest choice except for cancel.\r
+Handler_IgnoreExitDatabaseBeginFailMsg=Failed to start.\r
+Handler_IgnoreExitDatabaseBeginMsg=Ignoring last exit status.\r
+Handler_IgnoreExitDatabaseCancelMsg=Ignore cancelled.\r
+Handler_IgnoreExitDatabaseOkMsg=Ignore done.\r
+Handler_IgnoreProtocolDatabaseBeginMsg=Ignoring protocol version mismatch.\r
+Handler_IgnoreProtocolDatabaseCancelMsg=Ignore cancelled.\r
+Handler_IgnoreProtocolDatabaseFailMsg=Failed to start.\r
+Handler_IgnoreProtocolDatabaseOkMsg=Ignore done.\r
+Handler_JournalFileNotExists=Journal file does not exist or isn't readable.{0}folder={1}\r
+Handler_MessageWhatToDo={0}{1}What should I try to do?\r
+Handler_MonitorWaitingForCancellationToFinish=Waiting for cancellation to finish.\r
+Handler_NoDatabaseFolderGiven=No database folder given.\r
+Handler_ProCoreExceptionQuestion=Protocol version mismatch indicates that server and client versions differ. It would be best to open the database using the same server and client version. But if you insist I can ignore the mismatch and try to muddle along. If this works then you should export the data and get matching client and server versions. Otherwise there could later be strange errors caused by this version mismatch. Shoud I try?\r
+Handler_ProCoreException2=Database version mismatch indicates that the database was made with different server version. It would be best to open the database with the same version it was made. But if you insist I can try to recover database from journal.Journal file does not exist or isn't readable.\r
+Handler_PurgeCancelled=Purge cancelled.\r
+Handler_PurgeDatabaseQuestion=Do you want to purge database?\r
+Handler_PurgingDatabase=Purging database.\r
+Handler_Recover=Recover\r
+Handler_RecoverDescription=Recover using journal. Choose this if you are willing to wait and know that the other choices won't work.\r
+Handler_RecoveringDatabaseBeginMsg=Recovering database.\r
+Handler_RecoveringDatabaseCancelledMsg=Recovery cancelled.\r
+Handler_RecoveringDatabaseFailedMsg=Failed to recover database.\r
+Handler_RecoveringDatabaseRecoverdMsg=Database has been recovered.\r
+Handler_RecreateDatabaseFromJournalQuestion=Do you want me to try to recreate the database from journal?\r
+Handler_Remove=Remove\r
+Handler_RemoveDescription=Remove history. Choose this you know what you are doing. This is fast way to recover but can leave tricky semantic errors in the database. Furhermore, depending on the reason for the non clean exit status, this can fail and corrupt data. However, depending on how the client and/or server died, this could be the right choice.\r
+Handler_SaveContinue=Save failed. Do you want me to contine?\r
+Handler_SaveDatabase={0}Do you want to save database?{1}folder={2}\r
+Handler_SavingDatabaseBeginMsg=Saving database.\r
+Handler_SavingDatabaseCancelledMsg=Save cancelled.\r
+Handler_SavingDatabaseFailMsg=Failed to save database.\r
+Handler_SavingDatabaseOkMsg=Database has been saved.\r
+Handler_WarningMsgDatabaseFolderNotExists=Database folder does not exist. folder=\r
+UI_DatabaseDelete=Database Delete\r
+UI_DatabasePurge=Database Purge\r
+Util_Error=Error\r
+Util_Information=Information\r
+Util_No=No\r
+Util_Warning=Warning\r
+Util_Yes=Yes\r
left -= written;
checkBufferSpace(12);
}
+ // Possibly truncate file
+ modiValue(ri, length_, new byte[0], 0, 0);
return sum;
}
import org.eclipse.jface.resource.ColorDescriptor;
import org.eclipse.jface.resource.JFaceResources;
import org.eclipse.jface.resource.LocalResourceManager;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.SWTError;
import org.eclipse.swt.browser.Browser;
void historyChanged();
}
- private static final String STATEMENT_PART_SEPARATOR = ",";
- private final static String DEFAULT_DEBUGGER_CSS_FILE = "debugger.css";
- private final static String DEFAULT_DEBUGGER_CSS_PATH = "css/" + DEFAULT_DEBUGGER_CSS_FILE;
+ private static final String STATEMENT_PART_SEPARATOR = ","; //$NON-NLS-1$
+ private final static String DEFAULT_DEBUGGER_CSS_FILE = "debugger.css"; //$NON-NLS-1$
+ private final static String DEFAULT_DEBUGGER_CSS_PATH = "css/" + DEFAULT_DEBUGGER_CSS_FILE; //$NON-NLS-1$
private static int RESOURCE_NAME_MAX_LENGTH = 1000;
private static int RESOURCE_VALUE_MAX_SIZE = 16384;
*/
public GraphDebugger(Composite parent, int style, final Session session, Resource resource) {
super(parent, style);
- Assert.isNotNull(session, "session is null");
+ Assert.isNotNull(session, "session is null"); //$NON-NLS-1$
this.session = session;
this.currentElement = resource;
this.resourceManager = new LocalResourceManager(JFaceResources.getResources(), parent);
* When given to setStatus, indicates that the message shouldn't be touched
* since <code>null</code> has a different meaning.
*/
- private static final String DONT_TOUCH = "DONT_TOUCH";
+ private static final String DONT_TOUCH = "DONT_TOUCH"; //$NON-NLS-1$
protected void setStatus(String message, String error) {
IStatusLineManager status = WorkbenchUtils.getStatusLine(site);
if (!css.exists()) {
URL url = FileLocator.find(Activator.getDefault().getBundle(), new Path(DEFAULT_DEBUGGER_CSS_PATH), null);
if (url == null)
- throw new FileNotFoundException("Could not find '" + DEFAULT_DEBUGGER_CSS_PATH + "' in bundle '" + Activator.PLUGIN_ID + "'");
+ throw new FileNotFoundException("Could not find '" + DEFAULT_DEBUGGER_CSS_PATH + "' in bundle '" + Activator.PLUGIN_ID + "'"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
cssPath = FileUtils.copyResource(url, css, true).toURI().toString();
} else {
cssPath = css.toURI().toString();
}
}
- private static final String PROMPT_TEXT = "Enter resource ID (RID) or URI";
+ private static final String PROMPT_TEXT = Messages.GraphDebugger_EnterResourceIDorURI;
public void createResourceText(final Composite parent) {
final Text text = new Text(parent, SWT.BORDER);
text.addFocusListener(new FocusListener() {
@Override
public void focusLost(FocusEvent e) {
- if (text.getText().trim().equals("")) {
+ if (text.getText().trim().equals("")) { //$NON-NLS-1$
text.setForeground(parent.getDisplay().getSystemColor(SWT.COLOR_DARK_GRAY));
text.setText(PROMPT_TEXT);
}
public void focusGained(FocusEvent e) {
if (text.getText().trim().equals(PROMPT_TEXT)) {
text.setForeground(parent.getDisplay().getSystemColor(SWT.COLOR_BLACK));
- text.setText("");
+ text.setText(""); //$NON-NLS-1$
}
text.selectAll();
}
});
final Button button = new Button(parent, SWT.FLAT);
- button.setText("&Lookup");
+ button.setText(Messages.GraphDebugger_Lookup);
button.setEnabled(false);
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.FILL).grab(false, false).applyTo(button);
@Override
public void modifyText(ModifyEvent e) {
String input = text.getText().trim();
- if (!input.equals(PROMPT_TEXT) && !input.equals(""))
+ if (!input.equals(PROMPT_TEXT) && !input.equals("")) //$NON-NLS-1$
button.setEnabled(true);
else
button.setEnabled(false);
input = input.trim();
SerialisationSupport support = session.getService(SerialisationSupport.class);
- if (input.startsWith("$")) {
+ if (input.startsWith("$")) { //$NON-NLS-1$
try {
Resource r = support.getResource(Long.parseLong(input.substring(1)));
changeLocation(r);
} catch (NumberFormatException e1) {
// Ignore, may happen for crap input
- setStatus(DONT_TOUCH, "Invalid '$'-prefixed input, expected resource ID");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusInvalidPrefixedInput);
} catch (Exception e1) {
ErrorLogger.defaultLogError(e1);
- setStatus(DONT_TOUCH, "Resource ID lookup failed. See Error Log.");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusResourceIDFailed);
}
return;
}
- String[] parts = input.split("-");
+ String[] parts = input.split("-"); //$NON-NLS-1$
if (parts.length == 1) {
try {
}
} catch (NumberFormatException e1) {
// Ignore, may happen for crap input
- setStatus(DONT_TOUCH, "Invalid input, expected transient resource ID");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusInvalidInput);
} catch (Exception e1) {
ErrorLogger.defaultLogError(e1);
- setStatus(DONT_TOUCH, "Transient resource ID lookup failed. See Error Log.");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusTransientResourceID);
}
} else if (parts.length == 2) {
try {
changeLocation(r);
} catch (NumberFormatException e1) {
// Ignore, may happen for crap input
- setStatus(DONT_TOUCH, "Invalid input, expected index & cluster IDs");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusInvalidInputExpectIdxClusterIds);
} catch (Exception e1) {
ErrorLogger.defaultLogError(e1);
- setStatus(DONT_TOUCH, "Index & cluster -based lookup failed. See Error Log.");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusIndexLookpuFailed);
}
}
try {
// First check that the input really is a proper URI.
String uri = input;
- if (!input.equals("http:/") && input.endsWith("/"))
+ if (!input.equals("http:/") && input.endsWith("/")) //$NON-NLS-1$ //$NON-NLS-2$
uri = input.substring(0, input.length() - 1);
new URI(uri);
Resource r = session.syncRequest( Queries.resource( uri ) );
// Ignore, this is not a proper URI at all.
} catch (ResourceNotFoundException e1) {
// Ok, this was an URI, but no resource was found.
- setStatus(DONT_TOUCH, "Resource for URI '" + input + "' not found");
+ setStatus(DONT_TOUCH, NLS.bind( Messages.GraphDebugger_StatusResourceforURI , input ));
return;
} catch (DatabaseException e1) {
- setStatus(DONT_TOUCH, "URI lookup failed. See Error Log.");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusURIlookupFailed);
ErrorLogger.defaultLogError(e1);
}
- setStatus(DONT_TOUCH, "Invalid input, resource ID or URI expected");
+ setStatus(DONT_TOUCH, Messages.GraphDebugger_StatusInvalidInputResIdORURIExpected);
}
public Label createDropLabel(Composite parent) {
final Label label = new Label(parent, SWT.BORDER);
label.setAlignment(SWT.CENTER);
- label.setText("Drag a resource here to examine it in this debugger!");
+ label.setText(Messages.GraphDebugger_LabelDragResource);
label.setForeground(parent.getDisplay().getSystemColor(SWT.COLOR_DARK_GRAY));
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.FILL).hint(SWT.DEFAULT, 20).span(2, 1).grab(true, false).applyTo(label);
@Override
public void changing(LocationEvent event) {
String location = event.location;
- if (location.startsWith("simantics:browser"))
- location = "about:" + location.substring(17);
+ if (location.startsWith("simantics:browser")) //$NON-NLS-1$
+ location = "about:" + location.substring(17); //$NON-NLS-1$
//System.out.println("changing: location=" + location);
// Do not follow links that are meant as actions that are
// handled below.
event.doit = false;
- if ("about:blank".equals(location)) {
+ if ("about:blank".equals(location)) { //$NON-NLS-1$
// Just changing to the same old blank url is ok since it
// allows the browser to refresh itself.
event.doit = true;
}
- if (location.startsWith("about:-link")) {
- String target = location.replace("about:-link", "");
+ if (location.startsWith("about:-link")) { //$NON-NLS-1$
+ String target = location.replace("about:-link", ""); //$NON-NLS-1$ //$NON-NLS-2$
Resource element = links.getRight(target);
if (element == currentElement) {
event.doit = false;
return;
}
changeLocation(element);
- } else if (location.startsWith("about:-remove")) {
- String target = location.replace("about:-remove", "");
+ } else if (location.startsWith("about:-remove")) { //$NON-NLS-1$
+ String target = location.replace("about:-remove", ""); //$NON-NLS-1$ //$NON-NLS-2$
String n[] = target.split(STATEMENT_PART_SEPARATOR);
if (n.length != 3)
return;
// Make sure this is what the use wants.
MessageDialog md = new MessageDialog(
getShell(),
- "Confirm action...",
+ Messages.GraphDebugger_ConfirmActionsDots,
null,
- "This action will remove the selected statement.\nAre you sure you want to proceed with this action?",
- MessageDialog.QUESTION, new String[] { "Cancel", "Continue" }, 0);
+ Messages.GraphDebugger_ConfirmActionsDotsMsg,
+ MessageDialog.QUESTION, new String[] { Messages.GraphDebugger_Cancel, Messages.GraphDebugger_Continue }, 0);
if (md.open() != 1) {
return;
}
}, parameter -> refreshBrowser()
);
- } else if (location.startsWith("about:-edit-value")) {
- String target = location.replace("about:-edit-value", "");
+ } else if (location.startsWith("about:-edit-value")) { //$NON-NLS-1$
+ String target = location.replace("about:-edit-value", ""); //$NON-NLS-1$ //$NON-NLS-2$
final Resource o = links.getRight(target);
session.asyncRequest(new ReadRequest() {
public void run() {
InputDialog dialog = new InputDialog(
getShell(),
- "Edit Value",
+ Messages.GraphDebugger_EditValue,
null,
previousValue,
new IInputValidator() {
{
Label label = new Label(composite, SWT.NONE);
label.moveAbove(getText());
- label.setText("Input new property value. For numeric vector values, separate numbers with comma (',').");
+ label.setText(Messages.GraphDebugger_InputNewPropertyValue);
GridData data = new GridData(GridData.GRAB_HORIZONTAL
| GridData.HORIZONTAL_ALIGN_FILL
| GridData.VERTICAL_ALIGN_CENTER);
if (o instanceof byte[]) {
byte[] arr = (byte[]) o;
byte[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("byte", Arrays.toString(arr2), arr.length);
+ return truncated("byte", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof int[]) {
int[] arr = (int[]) o;
int[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("int", Arrays.toString(arr2), arr.length);
+ return truncated("int", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof long[]) {
long[] arr = (long[]) o;
long[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("long", Arrays.toString(arr2), arr.length);
+ return truncated("long", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof float[]) {
float[] arr = (float[]) o;
float[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("float", Arrays.toString(arr2), arr.length);
+ return truncated("float", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof double[]) {
double[] arr = (double[]) o;
double[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("double", Arrays.toString(arr2), arr.length);
+ return truncated("double", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof boolean[]) {
boolean[] arr = (boolean[]) o;
boolean[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("boolean", Arrays.toString(arr2), arr.length);
+ return truncated("boolean", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof Object[]) {
Object[] arr = (Object[]) o;
Object[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("Object", Arrays.toString(arr2), arr.length);
+ return truncated("Object", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else {
- return "Unknown big array " + o.getClass();
+ return "Unknown big array " + o.getClass(); //$NON-NLS-1$
}
} else {
- return o.getClass().getComponentType() + "[" + length + "] = " + ObjectUtils.toString(o);
+ return o.getClass().getComponentType() + "[" + length + "] = " + ObjectUtils.toString(o); //$NON-NLS-1$ //$NON-NLS-2$
}
}
return null;
}
protected String truncated(String type, String string, int originalLength) {
- return type + "[" + RESOURCE_NAME_MAX_LENGTH + "/" + originalLength + "] = " + string;
+ return type + "[" + RESOURCE_NAME_MAX_LENGTH + "/" + originalLength + "] = " + string; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
public static String htmlEscape(String s)
{
- return s.replace("&", "&").replace("<", "<").replace(">", ">").replace("\n", "<br/>");
+ return s.replace("&", "&").replace("<", "<").replace(">", ">").replace("\n", "<br/>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$ //$NON-NLS-6$ //$NON-NLS-7$ //$NON-NLS-8$
}
/**
// Object v = graph.getValue(r, b);
// Serializer s = Bindings.getSerializerUnchecked(b);
// int size = s.getSize(v);
- name = "Approx. " + valueSize + " byte literal of type " + type.toSingleLineString();
+ name = "Approx. " + valueSize + " byte literal of type " + type.toSingleLineString(); //$NON-NLS-1$ //$NON-NLS-2$
} else {
Binding b = Bindings.getBinding(type);
Object v = graph.getValue(r, b);
}
if(name.isEmpty()) {
- name = "<empty value>";
+ name = "<empty value>"; //$NON-NLS-1$
}
}
//if(name.isEmpty())
name = DebugUtils.getSafeLabel(graph, r);
if (name.isEmpty())
- name = "<empty name>";
+ name = "<empty name>"; //$NON-NLS-1$
}
// ClusteringSupport support = graph.getSession().getService(ClusteringSupport.class);
// if(name == null)
// Don't know how I encountered this but it seems to be possible in some cases..
// Resource obj = graph.getSingleObject(r, L0.HasObject);
Resource obj = graph.getPossibleObject(r, L0.HasObject);
- String tmp = htmlEscape( (pred == null ? "No predicate ?" : getResourceName(graph, pred)) + " -> " + (obj == null ? "No object ?" : getResourceName(graph, obj)) + " (Assertion)" );
+ String tmp = htmlEscape( (pred == null ? "No predicate ?" : getResourceName(graph, pred)) + " -> " + (obj == null ? "No object ?" : getResourceName(graph, obj)) + " (Assertion)" ); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
name = tmp.substring(0, Math.min(80, tmp.length()));
} else {
String resourceName = getResourceName(graph, r);
- if(resourceName.equals("Inverse")) {
+ if(resourceName.equals("Inverse")) { //$NON-NLS-1$
Resource inverse = graph.getPossibleInverse(r);
if(inverse != null && graph.hasStatement(inverse, L0.ConsistsOf, r))
- resourceName = getResourceName(graph, inverse) + "/Inverse";
+ resourceName = getResourceName(graph, inverse) + "/Inverse"; //$NON-NLS-1$
}
String tmp = htmlEscape( resourceName );
name = tmp.substring(0, Math.min(80, tmp.length()));
}
} catch (OutOfMemoryError e) {
- name = "OutOfMemoryError";
+ name = "OutOfMemoryError"; //$NON-NLS-1$
}
- String ret = "<a href=\"simantics:browser-link" + getLinkString(r) + "\">"
+ String ret = "<a href=\"simantics:browser-link" + getLinkString(r) + "\">" //$NON-NLS-1$ //$NON-NLS-2$
+ name
- + "</a>";
+ + "</a>"; //$NON-NLS-1$
if (graph.isInstanceOf(r, L0.Literal)) {
- ret += " <a class=\"edit-link\" href=\"simantics:browser-edit-value" + getLinkString(r) + "\">"
- + "(edit)"
- + "</a>";
+ ret += " <a class=\"edit-link\" href=\"simantics:browser-edit-value" + getLinkString(r) + "\">" //$NON-NLS-1$ //$NON-NLS-2$
+ + "(edit)" //$NON-NLS-1$
+ + "</a>"; //$NON-NLS-1$
}
return ret;
}
private String getStatementRemoveRef(Resource s, Resource p, Resource o) {
- return "<a href=\"simantics:browser-remove" + getStatementString(s, p, o)
- + "\" title=\"Remove this statement\">X</a>";
+ return "<a href=\"simantics:browser-remove" + getStatementString(s, p, o) //$NON-NLS-1$
+ + "\" title=\"Remove this statement\">X</a>"; //$NON-NLS-1$
}
private void updatePred(StringBuffer content, ReadGraph graph, Resource subj, Resource pred, List<Resource[]> stats) throws DatabaseException {
// Make a note if the statement was acquired.
if(!stmSubject.equals(subj)) {
- objects[i][3] = " (in " + getResourceRef(graph, stmSubject) + ")";
+ objects[i][3] = " (in " + getResourceRef(graph, stmSubject) + ")"; //$NON-NLS-1$ //$NON-NLS-2$
}
}
// Output table rows
for (int i = 0; i < objects.length; ++i) {
- content.append("<tr>");
+ content.append("<tr>"); //$NON-NLS-1$
// Predicate column
if (i == 0)
- content.append("<td rowspan=\"").append(objects.length).append("\" valign=\"top\">").append(getResourceRef(graph, pred)).append("</td>");
+ content.append("<td rowspan=\"").append(objects.length).append("\" valign=\"top\">").append(getResourceRef(graph, pred)).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
// Object column
- if (objects[i][3] == null) content.append("<td>");
- else content.append("<td class=\"acquired\">");
+ if (objects[i][3] == null) content.append("<td>"); //$NON-NLS-1$
+ else content.append("<td class=\"acquired\">"); //$NON-NLS-1$
content.append(objects[i][2]);
if (objects[i][3] != null)
content.append(objects[i][3]);
- content.append("</td>");
+ content.append("</td>"); //$NON-NLS-1$
VirtualGraphSupport vgs = graph.getService(VirtualGraphSupport.class);
VirtualGraph vg = vgs.getGraph(graph, subj, pred, links.getRight(objects[i][0]));
if(vg != null) {
- content.append("<td>").append(vg.toString()).append("</td>");
+ content.append("<td>").append(vg.toString()).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
- content.append("<td>DB</td>");
+ content.append("<td>DB</td>"); //$NON-NLS-1$
}
// Statement remove -link column
// Only allowed for non-acquired statements.
if (objects[i][3] == null) {
- content.append("<td class=\"remove\">");
+ content.append("<td class=\"remove\">"); //$NON-NLS-1$
content.append(getStatementRemoveRef(subj, pred, links.getRight(objects[i][0])));
- content.append("</td>");
+ content.append("</td>"); //$NON-NLS-1$
}
- content.append("</tr>");
+ content.append("</tr>"); //$NON-NLS-1$
}
}
// Generate output content from statements
String ref = getResourceRef(graph, tag);
- content.append("<tr>");
- content.append("<td rowspan=\"1\" colspan=\"3\" valign=\"top\">").append(ref).append("</td>");
+ content.append("<tr>"); //$NON-NLS-1$
+ content.append("<td rowspan=\"1\" colspan=\"3\" valign=\"top\">").append(ref).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$
//content.append("<td>" + name + "</td>");
- content.append("<td class=\"remove\">");
+ content.append("<td class=\"remove\">"); //$NON-NLS-1$
content.append(getStatementRemoveRef(subj, tag, subj));
- content.append("</td>");
- content.append("</tr>");
+ content.append("</td>"); //$NON-NLS-1$
+ content.append("</tr>"); //$NON-NLS-1$
}
try {
cur = OrderedSetUtils.next(graph, subj, cur);
} catch(DatabaseException e) {
- list.add("<span style=\"color:red;font-weight:bold\">BROKEN ORDERED SET:<br/></span><span style=\"color:red\">" + e.getMessage() + "</span>");
+ list.add("<span style=\"color:red;font-weight:bold\">BROKEN ORDERED SET:<br/></span><span style=\"color:red\">" + e.getMessage() + "</span>"); //$NON-NLS-1$ //$NON-NLS-2$
Resource inv = graph.getPossibleInverse(subj);
for(Statement stat : graph.getStatements(cur, L0.IsRelatedTo)) {
if(stat.getSubject().equals(cur)) {
if(stat.getPredicate().equals(subj)) {
- list.add("next " + getResourceRef(graph, stat.getObject()));
+ list.add("next " + getResourceRef(graph, stat.getObject())); //$NON-NLS-1$
}
else if(stat.getPredicate().equals(inv)) {
- list.add("prev " + getResourceRef(graph, stat.getObject()));
+ list.add("prev " + getResourceRef(graph, stat.getObject())); //$NON-NLS-1$
}
}
}
// Output table rows
for (int i = 0; i < list.size() ; ++i) {
- content.append("<tr>");
+ content.append("<tr>"); //$NON-NLS-1$
// Predicate column
if (i == 0)
- content.append("<td rowspan=\"").append(list.size()).append("\" valign=\"top\">Ordered Set Elements</td>");
+ content.append("<td rowspan=\"").append(list.size()).append("\" valign=\"top\">Ordered Set Elements</td>"); //$NON-NLS-1$ //$NON-NLS-2$
// Object column
- content.append("<td>");
+ content.append("<td>"); //$NON-NLS-1$
content.append(list.get(i));
- content.append("</td>");
+ content.append("</td>"); //$NON-NLS-1$
// Statement remove -link column
// Only allowed for non-acquired statements.
content.append(getStatementRemoveRef(subj, pred, links.getRight(objects[i][0])));
content.append("</td>");
}*/
- content.append("</tr>");
+ content.append("</tr>"); //$NON-NLS-1$
}
}
// Output table rows
for (int i = 0; i < list.size() ; ++i) {
- content.append("<tr>");
+ content.append("<tr>"); //$NON-NLS-1$
// Predicate column
if (i == 0)
- content.append("<td rowspan=\"").append(list.size()).append("\" valign=\"top\">Linked List Elements</td>");
+ content.append("<td rowspan=\"").append(list.size()).append("\" valign=\"top\">Linked List Elements</td>"); //$NON-NLS-1$ //$NON-NLS-2$
// Object column
- content.append("<td>");
+ content.append("<td>"); //$NON-NLS-1$
content.append(list.get(i));
- content.append("</td><td>DB</td>");
+ content.append("</td><td>DB</td>"); //$NON-NLS-1$
// Statement remove -link column
// Only allowed for non-acquired statements.
content.append(getStatementRemoveRef(subj, pred, links.getRight(objects[i][0])));
content.append("</td>");
}*/
- content.append("</tr>");
+ content.append("</tr>"); //$NON-NLS-1$
}
}
StringBuffer content = new StringBuffer();
// Generate HTML -page
- content.append("<html>\n<head>\n")
+ content.append("<html>\n<head>\n") //$NON-NLS-1$
.append(getHead())
- .append("\n</head>\n")
- .append("<body>\n")
- .append("<div id=\"mainContent\">\n\n");
+ .append("\n</head>\n") //$NON-NLS-1$
+ .append("<body>\n") //$NON-NLS-1$
+ .append("<div id=\"mainContent\">\n\n"); //$NON-NLS-1$
for (Resource r : resources) {
if (r == null)
uri = graph.syncRequest(new ResourceToPossibleURI(r));
} catch (Exception e) {
ErrorLogger.defaultLogError(e);
- uri = "Cannot get URI: " + e.getMessage();
+ uri = "Cannot get URI: " + e.getMessage(); //$NON-NLS-1$
}
// Top DIV
- content.append("<div id=\"top\">\n");
- content.append("<table class=\"top\">\n");
+ content.append("<div id=\"top\">\n"); //$NON-NLS-1$
+ content.append("<table class=\"top\">\n"); //$NON-NLS-1$
if (uri != null) {
- content.append("<tr><td class=\"top_key\">URI</td><td class=\"top_value\"><span id=\"uri\">").append(uri).append("</span></td></tr>\n");
+ content.append("<tr><td class=\"top_key\">URI</td><td class=\"top_value\"><span id=\"uri\">").append(uri).append("</span></td></tr>\n"); //$NON-NLS-1$ //$NON-NLS-2$
}
XSupport xs = graph.getService(XSupport.class);
obj = statement.getObject();
map.add(predicate, new Resource[] {subject, obj});
} catch (Throwable e) {
- ErrorLogger.defaultLogError("Cannot find statement " + subject + " " + predicate + " " + obj, e);
+ ErrorLogger.defaultLogError("Cannot find statement " + subject + " " + predicate + " " + obj, e); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
SerialisationSupport ss = graph.getSession().getService(SerialisationSupport.class);
ClusteringSupport support = graph.getSession().getService(ClusteringSupport.class);
- content.append("<tr><td class=\"top_key\">Identifiers</td><td class=\"top_value\">");
- content.append("<span id=\"resource_id\">")
- .append(" RID = $").append(r.getResourceId())
- .append(" Resource Key = ").append(ss.getTransientId(r))
- .append(" CID = ").append(support.getCluster(r));
- content.append("</span></td>");
+ content.append("<tr><td class=\"top_key\">Identifiers</td><td class=\"top_value\">"); //$NON-NLS-1$
+ content.append("<span id=\"resource_id\">") //$NON-NLS-1$
+ .append(" RID = $").append(r.getResourceId()) //$NON-NLS-1$
+ .append(" Resource Key = ").append(ss.getTransientId(r)) //$NON-NLS-1$
+ .append(" CID = ").append(support.getCluster(r)); //$NON-NLS-1$
+ content.append("</span></td>"); //$NON-NLS-1$
if (immutable)
- content.append("<td class=\"remove\">[IMMUTABLE]</td>");
- content.append("</tr>\n");
+ content.append("<td class=\"remove\">[IMMUTABLE]</td>"); //$NON-NLS-1$
+ content.append("</tr>\n"); //$NON-NLS-1$
boolean isClusterSet = support.isClusterSet(r);
Resource parentSet = support.getClusterSetOfCluster(r);
String parentSetURI = parentSet != null ? graph.getPossibleURI(parentSet) : null;
- content.append("<tr><td class=\"top_key\">Clustering</td><td class=\"top_value\">");
- content.append("<span id=\"resource_id\">");
+ content.append("<tr><td class=\"top_key\">Clustering</td><td class=\"top_value\">"); //$NON-NLS-1$
+ content.append("<span id=\"resource_id\">"); //$NON-NLS-1$
if(parentSetURI != null)
- content.append(" Containing cluster set = ").append(parentSetURI);
+ content.append(" Containing cluster set = ").append(parentSetURI); //$NON-NLS-1$
else if (parentSet != null)
- content.append(" Containing cluster set = ").append(parentSet.toString());
+ content.append(" Containing cluster set = ").append(parentSet.toString()); //$NON-NLS-1$
else
- content.append(" Not in any cluster set ");
+ content.append(" Not in any cluster set "); //$NON-NLS-1$
- content.append("</span></td>");
+ content.append("</span></td>"); //$NON-NLS-1$
if (isClusterSet)
- content.append("<td class=\"remove\">[CLUSTER SET]</td>");
- content.append("</tr>\n");
+ content.append("<td class=\"remove\">[CLUSTER SET]</td>"); //$NON-NLS-1$
+ content.append("</tr>\n"); //$NON-NLS-1$
// If the resource has a value, show it.
String resourceValue = getResourceValue(graph, r);
if (resourceValue != null) {
content
- .append("<tr><td class=\"top_key\">Attached value</td><td class=\"top_value\">")
+ .append("<tr><td class=\"top_key\">Attached value</td><td class=\"top_value\">") //$NON-NLS-1$
.append(htmlEscape(resourceValue))
- .append("</td></tr>\n");
+ .append("</td></tr>\n"); //$NON-NLS-1$
}
// Close #top
- content.append("</table>\n");
- content.append("</div>\n");
+ content.append("</table>\n"); //$NON-NLS-1$
+ content.append("</div>\n"); //$NON-NLS-1$
- content.append("\n<div id=\"data\">\n");
- content.append("<table>\n")
- .append("<tr><th>Predicate</th><th>Object</th><th>Graph</th></tr>")
- .append("<tr><td class=\"subtitle\" colspan=\"3\">Basic information</td></tr>");
+ content.append("\n<div id=\"data\">\n"); //$NON-NLS-1$
+ content.append("<table>\n") //$NON-NLS-1$
+ .append("<tr><th>Predicate</th><th>Object</th><th>Graph</th></tr>") //$NON-NLS-1$
+ .append("<tr><td class=\"subtitle\" colspan=\"3\">Basic information</td></tr>"); //$NON-NLS-1$
boolean isOrderedSet = graph.isInstanceOf(r, L0.OrderedSet);
boolean isLinkedList = graph.isInstanceOf(r, L0.List);
updatePred(content, graph, r, pred, map.remove(pred));
// TAGS
- content.append("<tr><td class=\"subtitle\" colspan=\"3\">Tags</td></tr>");
+ content.append("<tr><td class=\"subtitle\" colspan=\"3\">Tags</td></tr>"); //$NON-NLS-1$
for(Statement stm : statements) {
if(stm.getSubject().equals(stm.getObject())) {
updateTag(content, graph, r, stm.getPredicate());
}
// ORDERED SETS
- content.append("<tr><td class=\"subtitle\" colspan=\"3\">Ordered Sets</td></tr>");
+ content.append("<tr><td class=\"subtitle\" colspan=\"3\">Ordered Sets</td></tr>"); //$NON-NLS-1$
for(Statement stm : statements) {
Resource predicate = stm.getPredicate();
if(graph.isInstanceOf(stm.getPredicate(), L0.OrderedSet)) {
}
// IS RELATED TO
- content.append("<tr><td class=\"subtitle\" colspan=\"3\">Is Related To</td></tr>");
+ content.append("<tr><td class=\"subtitle\" colspan=\"3\">Is Related To</td></tr>"); //$NON-NLS-1$
// ELEMENTS OF ORDERED SET
if(isOrderedSet) {
try {
updateOrderedSet(content, graph, r);
} catch (ValidationException e) {
- content.append("<td colspan=\"3\"><span style=\"color:red;font-weight:bold\">BROKEN ORDERED SET:<br/></span><span style=\"color:red\">").append(e.getMessage()).append("</span></td>");
+ content.append("<td colspan=\"3\"><span style=\"color:red;font-weight:bold\">BROKEN ORDERED SET:<br/></span><span style=\"color:red\">").append(e.getMessage()).append("</span></td>"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
try {
updateLinkedList(content, graph, r);
} catch (ValidationException e) {
- content.append("<td colspan=\"3\"><span style=\"color:red;font-weight:bold\">BROKEN LINKED LIST:<br/></span><span style=\"color:red\">").append(e.getMessage()).append("</span></td>");
+ content.append("<td colspan=\"3\"><span style=\"color:red;font-weight:bold\">BROKEN LINKED LIST:<br/></span><span style=\"color:red\">").append(e.getMessage()).append("</span></td>"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
for(Resource pred : preds) {
String str = htmlEscape( getResourceName(graph, pred) );
if(str == null)
- str = "<null>";
+ str = "<null>"; //$NON-NLS-1$
strmap.put(pred, str);
}
Arrays.sort(preds, new Comparator<Resource>() {
updatePred(content, graph, r, pred, map.get(pred));
// OTHER STATEMENTS
- content.append("<tr><td class=\"subtitle\" colspan=\"3\">Other statements</td></tr>");
+ content.append("<tr><td class=\"subtitle\" colspan=\"3\">Other statements</td></tr>"); //$NON-NLS-1$
for(Resource pred : preds)
if(!graph.isSubrelationOf(pred, L0.IsRelatedTo))
updatePred(content, graph, r, pred, map.get(pred));
- content.append("</table>\n");
+ content.append("</table>\n"); //$NON-NLS-1$
}
// Close #data
- content.append("</div>\n\n");
+ content.append("</div>\n\n"); //$NON-NLS-1$
// Close #mainContent
- content.append("</div>\n");
- content.append("</body>\n</html>\n");
+ content.append("</div>\n"); //$NON-NLS-1$
+ content.append("</body>\n</html>\n"); //$NON-NLS-1$
// Update content
final String finalContent = content.toString();
Serializer s = Bindings.getSerializerUnchecked(b);
int size = s.getSize(v);
if (size > RESOURCE_VALUE_MAX_SIZE) {
- return "Approx. " + size + " byte literal of type " + type.toSingleLineString();
+ return "Approx. " + size + " byte literal of type " + type.toSingleLineString(); //$NON-NLS-1$ //$NON-NLS-2$
} else {
return b.toString(v, false);
}
return NameUtils.getSafeName(g, r);
} catch(Throwable throwable) {
ErrorLogger.defaultLogError(throwable);
- return "<font color=\"red\"><i>"+throwable.getClass().getName()+"</i> "+throwable.getMessage()+"</font>";
+ return "<font color=\"red\"><i>"+throwable.getClass().getName()+"</i> "+throwable.getMessage()+"</font>"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
// }
private String getHead() {
- String result = "";
+ String result = ""; //$NON-NLS-1$
if (cssPath != null) {
- result = "<link href=\"" + cssPath + "\" rel=\"stylesheet\" type=\"text/css\">";
+ result = "<link href=\"" + cssPath + "\" rel=\"stylesheet\" type=\"text/css\">"; //$NON-NLS-1$ //$NON-NLS-2$
}
return result;
}
public class GraphDebuggerEditor extends ResourceEditorPart {
- public static final String EDITOR_ID = "org.simantics.debug.graphDebuggerEditor";
+ public static final String EDITOR_ID = "org.simantics.debug.graphDebuggerEditor"; //$NON-NLS-1$
private GraphDebugger debugger;
private IAction backAction;
class RefreshAction extends Action {
public RefreshAction() {
- super("Refresh", BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif"));
- setToolTipText("Refresh");
+ super(Messages.GraphDebuggerEditor_Refresh, BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerEditor_RefreshTT);
}
@Override
public void run() {
class FindAction extends Action {
public FindAction() {
- super("Find", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png"));
- setToolTipText("Find Resource");
+ super(Messages.GraphDebuggerEditor_Find, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerEditor_FindTT);
}
@Override
public void run() {
class AddStatementAction extends Action {
public AddStatementAction() {
- super("AddStatement", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add Statement Between Existing Resources");
+ super(Messages.GraphDebuggerEditor_AddStatement, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerEditor_AddStatementTT);
}
@Override
public void run() {
class AddResourceAction extends Action {
public AddResourceAction() {
- super("AddResource", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add New Related Resource");
+ super(Messages.GraphDebuggerEditor_AddResource, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerEditor_AddResourceTT);
}
@Override
public void run() {
class BackAction extends Action {
public BackAction() {
- super("Back", Action.AS_PUSH_BUTTON);
- setToolTipText("Back");
+ super(Messages.GraphDebuggerEditor_Back, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphDebuggerEditor_BackTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class ForwardAction extends Action {
public ForwardAction() {
- super("Forward", Action.AS_PUSH_BUTTON);
- setToolTipText("Forward");
+ super(Messages.GraphDebuggerEditor_Forward, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphDebuggerEditor_ForwardTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
public class GraphDebuggerView extends ViewPart {
- public static final String VIEW_ID = "org.simantics.debug.graphDebugger";
+ public static final String VIEW_ID = "org.simantics.debug.graphDebugger"; //$NON-NLS-1$
// private final boolean DEFAULT_RECYCLE_VIEW = true;
//
class RefreshAction extends Action {
public RefreshAction() {
- super("Refresh", BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif"));
- setToolTipText("Refresh");
+ super(Messages.GraphDebuggerView_Refresh, BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerView_Refresh);
}
@Override
public void run() {
class BackAction extends Action {
public BackAction() {
- super("Back", Action.AS_PUSH_BUTTON);
- setToolTipText("Back");
+ super(Messages.GraphDebuggerView_Back, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphDebuggerView_BackTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class ForwardAction extends Action {
public ForwardAction() {
- super("Forward", Action.AS_PUSH_BUTTON);
- setToolTipText("Forward");
+ super(Messages.GraphDebuggerView_Forward, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphDebuggerView_ForwardTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
class HomeAction extends Action {
public HomeAction() {
- super("Home", Action.AS_PUSH_BUTTON);
- setToolTipText("Navigate to root library");
+ super(Messages.GraphDebuggerView_Home, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphDebuggerView_HomeTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV_DISABLED));
}
class FindAction extends Action {
public FindAction() {
- super("Find", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png"));
- setToolTipText("Find Resource");
+ super(Messages.GraphDebuggerView_Find, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerView_FindTT);
}
@Override
public void run() {
class AddStatementAction extends Action {
public AddStatementAction() {
- super("AddStatement", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add Statement Between Existing Resources");
+ super(Messages.GraphDebuggerView_AddStatement, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerView_AddStatementTT);
}
@Override
public void run() {
class AddResourceAction extends Action {
public AddResourceAction() {
- super("AddResource", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add New Related Resource");
+ super(Messages.GraphDebuggerView_AddResource, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphDebuggerView_AddResourceTT);
}
@Override
public void run() {
public class Messages extends NLS {
- public static String Name_adaption_problem;
- public static String Name_formulation_problem;
+ public static String GraphDebugger_Cancel;
+ public static String GraphDebugger_ConfirmActionsDots;
+ public static String GraphDebugger_ConfirmActionsDotsMsg;
+ public static String GraphDebugger_Continue;
+ public static String GraphDebugger_EditValue;
+ public static String GraphDebugger_EnterResourceIDorURI;
+ public static String GraphDebugger_InputNewPropertyValue;
+ public static String GraphDebugger_LabelDragResource;
+ public static String GraphDebugger_Lookup;
+ public static String GraphDebugger_StatusIndexLookpuFailed;
+ public static String GraphDebugger_StatusInvalidInput;
+ public static String GraphDebugger_StatusInvalidInputExpectIdxClusterIds;
+ public static String GraphDebugger_StatusInvalidInputResIdORURIExpected;
+ public static String GraphDebugger_StatusInvalidPrefixedInput;
+ public static String GraphDebugger_StatusResourceforURI;
+ public static String GraphDebugger_StatusResourceIDFailed;
+ public static String GraphDebugger_StatusTransientResourceID;
+ public static String GraphDebugger_StatusURIlookupFailed;
+ public static String GraphDebuggerEditor_AddResource;
+ public static String GraphDebuggerEditor_AddResourceTT;
+ public static String GraphDebuggerEditor_AddStatement;
+ public static String GraphDebuggerEditor_AddStatementTT;
+ public static String GraphDebuggerEditor_Back;
+ public static String GraphDebuggerEditor_BackTT;
+ public static String GraphDebuggerEditor_Find;
+ public static String GraphDebuggerEditor_FindTT;
+ public static String GraphDebuggerEditor_Forward;
+ public static String GraphDebuggerEditor_ForwardTT;
+ public static String GraphDebuggerEditor_Refresh;
+ public static String GraphDebuggerEditor_RefreshTT;
+ public static String GraphDebuggerView_AddResource;
+ public static String GraphDebuggerView_AddResourceTT;
+ public static String GraphDebuggerView_AddStatement;
+ public static String GraphDebuggerView_AddStatementTT;
+ public static String GraphDebuggerView_Back;
+ public static String GraphDebuggerView_BackTT;
+ public static String GraphDebuggerView_Find;
+ public static String GraphDebuggerView_FindTT;
+ public static String GraphDebuggerView_Forward;
+ public static String GraphDebuggerView_ForwardTT;
+ public static String GraphDebuggerView_Home;
+ public static String GraphDebuggerView_HomeTT;
+ public static String GraphDebuggerView_Refresh;
+ public static String SearchResourceDialog_ActivatorResourceLabelProviderFailed;
+ public static String SearchResourceDialog_EnterNameResURIOrId;
+ public static String SearchResourceDialog_SeperatorLblPreviouslySelected;
+ public static String SearchResourceDialog_ShowInBrowser;
+ public static String SessionDebuggerView_ActivatorUnexpectedException;
+ public static String SessionDebuggerView_ActivatorUnexpectedIOException;
+ public static String SessionDebuggerView_Shell;
+ public static String SessionDebuggerView_WroteCommand;
+ public static String VariableDebugger_DragResourceToDebugger;
+ public static String VariableDebugger_Lookup;
+ public static String VariableDebugger_TextToolTip;
+ public static String VariableDebuggerView_Back;
+ public static String VariableDebuggerView_Forward;
+ public static String VariableDebuggerView_Home;
+ public static String VariableDebuggerView_HomeTT;
+ public static String VariableDebuggerView_Refresh;
private static final String BUNDLE_NAME = "org.simantics.debug.ui.messages"; //$NON-NLS-1$
static {
public void run(ReadGraph g) {
try {
if (!asyncListening && resFoundQueue!=null) resFoundQueue.g = g;
- Resource root = g.getResource("http:/");
+ Resource root = g.getResource("http:/"); //$NON-NLS-1$
Layer0 L0 = Layer0.getInstance(g);
LinkedList<Resource> queue = new LinkedList<Resource>();
queue.add(root);
*/
private static final int DEFAULT_MAX_INDEX_HITS = 1000;
- private static final Pattern ID_PATTERN = Pattern.compile("\\$([0-9]+)");
+ private static final Pattern ID_PATTERN = Pattern.compile("\\$([0-9]+)"); //$NON-NLS-1$
private static final String SEARCH_RESOURCE_DIALOG = "SearchResourceDialog"; //$NON-NLS-1$
private static final int SHOW_IN_BROWSER_ID = IDialogConstants.CLIENT_ID + 1;
- private static final String SHOW_IN_BROWSER_LABEL = "Show In Browser";
+ private static final String SHOW_IN_BROWSER_LABEL = Messages.SearchResourceDialog_ShowInBrowser;
private Session session;
@SuppressWarnings("unused")
@Override
public String getText(Object element) {
if (element == null)
- return "null";
+ return "null"; //$NON-NLS-1$
// This may happen if multiple choice is enabled
if (element instanceof String)
return (String) element;
String name = NameUtils.getSafeName(g, r);
String uri = DebugUtils.getPossibleRootRelativePath(g, r);
return
- "[" + r.getResourceId() + "] - "
+ "[" + r.getResourceId() + "] - " //$NON-NLS-1$ //$NON-NLS-2$
+ name
- + (uri != null ? " - " : "")
- + (uri != null ? uri : "");
+ + (uri != null ? " - " : "") //$NON-NLS-1$ //$NON-NLS-2$
+ + (uri != null ? uri : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
- Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Resource label provider failed unexpectedly.", e));
- return "";
+ Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.SearchResourceDialog_ActivatorResourceLabelProviderFailed, e));
+ return ""; //$NON-NLS-1$
}
}
};
@Override
public String getText(Object element) {
if (element==null)
- return "null";
+ return "null"; //$NON-NLS-1$
return element.toString();
}
@Override
this.session = s;
this.selection = selection;
this.labelProvider = new ElementLabelProvider(shell.getDisplay());
- setMessage("Enter name, resource URI or ID");
+ setMessage(Messages.SearchResourceDialog_EnterNameResURIOrId);
setListLabelProvider(labelProvider);
setDetailsLabelProvider(detailsLabelProvider);
setTitle(title);
//setInitialPattern("*", FilteredItemsSelectionDialog.FULL_SELECTION);
setSelectionHistory(new ResourceSelectionHistory());
- setSeparatorLabel("Previously selected above, others below");
+ setSeparatorLabel(Messages.SearchResourceDialog_SeperatorLblPreviouslySelected);
}
@Override
protected void configureShell(Shell shell) {
this.resourceManager = new LocalResourceManager(JFaceResources.getResources(), shell);
- setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png")));
+ setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png"))); //$NON-NLS-1$
super.configureShell(shell);
}
try {
return DebugUtils.getSafeLabel(g, r);
} catch (Exception ex) {
- System.out.println("Exception thrown from restoreItemFromMemento");
+ System.out.println("Exception thrown from restoreItemFromMemento"); //$NON-NLS-1$
}
} catch (Throwable t) {}
- return "" + r.getResourceId();
+ return "" + r.getResourceId(); //$NON-NLS-1$
}
});
if (name==null) return null;
return new LabeledResource(name, r);
} catch (NumberFormatException | DatabaseException e) {
- LOGGER.info("Search memento restoration failed.", e);
+ LOGGER.info("Search memento restoration failed.", e); //$NON-NLS-1$
return null;
}
}
public ItemsFilterWithSearchResults() {
final String pattern = getPattern();
- final boolean findUris = pattern.trim().startsWith("http:/");
+ final boolean findUris = pattern.trim().startsWith("http:/"); //$NON-NLS-1$
final long referencedResourceId = referencedResourceId(pattern);
final boolean findIds = referencedResourceId != 0;
IResourceFilter rf = resourceFilter;
String filter = getFilterForResourceFilter(rf);
if (!filter.isEmpty())
- filter += " AND ";
- filter += "Name:" + pattern + "*";
+ filter += " AND "; //$NON-NLS-1$
+ filter += "Name:" + pattern + "*"; //$NON-NLS-1$ //$NON-NLS-2$
Layer0 L0 = Layer0.getInstance(graph);
@SuppressWarnings("unchecked")
@Override
public String getElementName(Object item) {
- return ((Container<Resource>)item).get().getResourceId()+"";
+ return ((Container<Resource>)item).get().getResourceId()+""; //$NON-NLS-1$
//return item.toString();
}
private String getFilterForResourceFilter(IResourceFilter filter) {
if (filter == null || filter == ResourceSearch.FILTER_ALL)
- return "";
+ return ""; //$NON-NLS-1$
if (filter == ResourceSearch.FILTER_RELATIONS)
- return "Types:Relation";
+ return "Types:Relation"; //$NON-NLS-1$
if (filter == ResourceSearch.FILTER_TYPES)
- return "Types:Type";
- return "";
+ return "Types:Type"; //$NON-NLS-1$
+ return ""; //$NON-NLS-1$
}
}
*/
public SessionDebugger(Composite parent, int style, final Session session) {
super(parent, style);
- Assert.isNotNull(session, "session is null");
+ Assert.isNotNull(session, "session is null"); //$NON-NLS-1$
this.session = session;
updater = new MergingGraphRequestProcessor(session, 100);
import org.eclipse.core.runtime.IStatus;
import org.eclipse.core.runtime.Status;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.browser.Browser;
import org.eclipse.swt.custom.CTabFolder;
@SuppressWarnings("deprecation")
public class SessionDebuggerView extends SimanticsView {
- public static final String VIEW_ID = "org.simantics.debug.sessionDebugger";
+ public static final String VIEW_ID = "org.simantics.debug.sessionDebugger"; //$NON-NLS-1$
private CTabFolder folder;
private Text commandLine;
@Override
protected Set<String> getBrowseContexts() {
- return Collections.singleton("");
+ return Collections.singleton(""); //$NON-NLS-1$
}
private CTabItem createItem(int index, CTabFolder folder, Control control) {
if (historyPosition < 0) {
return;
} else if (historyPosition == 0) {
- commandLine.setText("");
+ commandLine.setText(""); //$NON-NLS-1$
historyPosition = -1;
} else {
commandLine.setText(history.get(--historyPosition));
}
} else if (e.keyCode == SWT.ESC) {
historyPosition = -1;
- commandLine.setText("");
+ commandLine.setText(""); //$NON-NLS-1$
} else if (e.keyCode == SWT.CR || e.keyCode == SWT.KEYPAD_CR) {
applyCommand(commandLine.getText());
}
});
CTabItem shellItem = createItem(0, folder, shell);
- shellItem.setText("Shell");
+ shellItem.setText(Messages.SessionDebuggerView_Shell);
// SessionDebugger deprecated = new SessionDebugger(folder, SWT.NONE, Simantics.getSession());
// deprecated.initializeUI();
} catch (DatabaseException e) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Unexpected exception while applying command " + command, e));
+ Messages.SessionDebuggerView_ActivatorUnexpectedException + command, e));
}
}
Path p = (Path) output;
long size = Files.size(p);
if (size < (1L << 16)) {
- terminal.addFirst(new String(Files.readAllBytes(p), "UTF-8"));
+ terminal.addFirst(new String(Files.readAllBytes(p), "UTF-8")); //$NON-NLS-1$
}
- terminal.addFirst("Wrote command '" + command + "' output to file " + p);
+ terminal.addFirst(NLS.bind(Messages.SessionDebuggerView_WroteCommand ,new Object[] { command , p}));
} catch (IOException e) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Unexpected I/O exception while applying command " + command, e));
+ NLS.bind(Messages.SessionDebuggerView_ActivatorUnexpectedIOException , new Object[]{ command, e})));
}
} else {
- throw new IllegalArgumentException("Unsupported output argument type " + output);
+ throw new IllegalArgumentException("Unsupported output argument type " + output); //$NON-NLS-1$
}
if (terminal.size() > 10)
terminal.removeLast();
private void apply(String command, Object data) {
if (data instanceof String) {
SWTUtils.asyncExec(commandLine, () -> {
- commandLine.setText("");
+ commandLine.setText(""); //$NON-NLS-1$
addHistory(command, data);
console.setText(formatTerminal());
});
SWTUtils.asyncExec(commandLine, () -> {
try {
addHistory(command, dumpListenerReport((ListenerReport) data));
- commandLine.setText("");
+ commandLine.setText(""); //$NON-NLS-1$
console.setText(formatTerminal());
} catch (IOException e) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Unexpected I/O exception while applying command " + command, e));
+ Messages.SessionDebuggerView_ActivatorUnexpectedIOException + command, e));
}
});
}
}
private Path dumpListenerReport(ListenerReport data) throws IOException {
- File f = Simantics.getTempfile("debug", "listenerReport");
- try (PrintStream out = new PrintStream(f, "UTF-8")) {
- out.print("<pre>");
+ File f = Simantics.getTempfile("debug", "listenerReport"); //$NON-NLS-1$ //$NON-NLS-2$
+ try (PrintStream out = new PrintStream(f, "UTF-8")) { //$NON-NLS-1$
+ out.print("<pre>"); //$NON-NLS-1$
data.print(out);
- out.print("</pre>");
+ out.print("</pre>"); //$NON-NLS-1$
}
return f.toPath();
}
private String formatTerminal() {
StringBuilder b = new StringBuilder();
- b.append("<html><head/><body>\n");
+ b.append("<html><head/><body>\n"); //$NON-NLS-1$
for (String s : terminal)
- b.append(s).append("<br/>\n");
- b.append("</body></html>");
+ b.append(s).append("<br/>\n"); //$NON-NLS-1$
+ b.append("</body></html>"); //$NON-NLS-1$
return b.toString();
}
void historyChanged();
}
- private final static String DEFAULT_DEBUGGER_CSS_FILE = "debugger.css";
- private final static String DEFAULT_DEBUGGER_CSS_PATH = "css/" + DEFAULT_DEBUGGER_CSS_FILE;
+ private final static String DEFAULT_DEBUGGER_CSS_FILE = "debugger.css"; //$NON-NLS-1$
+ private final static String DEFAULT_DEBUGGER_CSS_PATH = "css/" + DEFAULT_DEBUGGER_CSS_FILE; //$NON-NLS-1$
private static int RESOURCE_NAME_MAX_LENGTH = 1000;
- private final Charset utf8 = Charset.forName("UTF-8");
+ private final Charset utf8 = Charset.forName("UTF-8"); //$NON-NLS-1$
private final LocalResourceManager resourceManager;
if (!browser.isDisposed())
browser.setText(content);
if (!updateTriggerCounter.isDisposed())
- updateTriggerCounter.setText(updateCount + "/" + triggerCounter);
+ updateTriggerCounter.setText(updateCount + "/" + triggerCounter); //$NON-NLS-1$
}
});
}
*/
public VariableDebugger(Composite parent, int style, final Session session, String initialURI) {
super(parent, style);
- Assert.isNotNull(session, "session is null");
+ Assert.isNotNull(session, "session is null"); //$NON-NLS-1$
this.session = session;
this.currentElement = initialURI;
this.resourceManager = new LocalResourceManager(JFaceResources.getResources(), parent);
if (!css.exists()) {
URL url = FileLocator.find(Activator.getDefault().getBundle(), new Path(DEFAULT_DEBUGGER_CSS_PATH), null);
if (url == null)
- throw new FileNotFoundException("Could not find '" + DEFAULT_DEBUGGER_CSS_PATH + "' in bundle '" + Activator.PLUGIN_ID + "'");
+ throw new FileNotFoundException("Could not find '" + DEFAULT_DEBUGGER_CSS_PATH + "' in bundle '" + Activator.PLUGIN_ID + "'"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
cssPath = FileUtils.copyResource(url, css, true).toURI().toString();
} else {
cssPath = css.toURI().toString();
public Label createDropLabel(Composite parent) {
final Label label = new Label(parent, SWT.BORDER | SWT.FLAT);
label.setAlignment(SWT.CENTER);
- label.setText(" Drag a resource or a variable here to examine it in this debugger! ");
+ label.setText(Messages.VariableDebugger_DragResourceToDebugger);
label.setForeground(parent.getDisplay().getSystemColor(SWT.COLOR_DARK_GRAY));
GridData data = new GridData(SWT.LEFT, SWT.FILL, false, false);
label.setLayoutData(data);
text.setLayoutData(data);
Button button = new Button(parent, SWT.NONE);
- button.setText("Lookup");
+ button.setText(Messages.VariableDebugger_Lookup);
GridData data2 = new GridData(SWT.FILL, SWT.FILL, false, false);
button.setLayoutData(data2);
protected Text createUpdateTriggerCounter(Composite parent) {
Text label = new Text(parent, SWT.BORDER | SWT.FLAT);
label.setEditable(false);
- label.setToolTipText("Amount of Screen/Listener Updates Received for Shown Variable");
+ label.setToolTipText(Messages.VariableDebugger_TextToolTip);
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.FILL)
.grab(false, false).hint(32, SWT.DEFAULT).applyTo(label);
updateTriggerCounter = label;
@Override
public void changing(LocationEvent event) {
String location = event.location;
- if (location.startsWith("simantics:browser"))
- location = "about:" + location.substring(17);
+ if (location.startsWith("simantics:browser")) //$NON-NLS-1$
+ location = "about:" + location.substring(17); //$NON-NLS-1$
//System.out.println("changing: location=" + location);
// Do not follow links that are meant as actions that are
// handled below.
event.doit = false;
- if ("about:blank".equals(location)) {
+ if ("about:blank".equals(location)) { //$NON-NLS-1$
// Just changing to the same old blank url is ok since it
// allows the browser to refresh itself.
event.doit = true;
}
- if (location.startsWith("about:-link")) {
- String target = location.replace("about:-link", "");
+ if (location.startsWith("about:-link")) { //$NON-NLS-1$
+ String target = location.replace("about:-link", ""); //$NON-NLS-1$ //$NON-NLS-2$
try {
byte[] bytes = Base64.decode(target);
String url = new String(bytes, utf8);
} catch (IOException e) {
ErrorLogger.defaultLogError(e);
}
- } else if (location.startsWith("about:-remove")) {
- } else if (location.startsWith("about:-edit-value")) {
+ } else if (location.startsWith("about:-remove")) { //$NON-NLS-1$
+ } else if (location.startsWith("about:-edit-value")) { //$NON-NLS-1$
}
}
});
if (o instanceof byte[]) {
byte[] arr = (byte[]) o;
byte[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("byte", Arrays.toString(arr2), arr.length);
+ return truncated("byte", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof int[]) {
int[] arr = (int[]) o;
int[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("int", Arrays.toString(arr2), arr.length);
+ return truncated("int", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof long[]) {
long[] arr = (long[]) o;
long[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("long", Arrays.toString(arr2), arr.length);
+ return truncated("long", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof float[]) {
float[] arr = (float[]) o;
float[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("float", Arrays.toString(arr2), arr.length);
+ return truncated("float", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof double[]) {
double[] arr = (double[]) o;
double[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("double", Arrays.toString(arr2), arr.length);
+ return truncated("double", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof boolean[]) {
boolean[] arr = (boolean[]) o;
boolean[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("boolean", Arrays.toString(arr2), arr.length);
+ return truncated("boolean", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else if (o instanceof Object[]) {
Object[] arr = (Object[]) o;
Object[] arr2 = Arrays.copyOf(arr, RESOURCE_NAME_MAX_LENGTH);
- return truncated("Object", Arrays.toString(arr2), arr.length);
+ return truncated("Object", Arrays.toString(arr2), arr.length); //$NON-NLS-1$
} else {
- return "Unknown big array " + o.getClass();
+ return "Unknown big array " + o.getClass(); //$NON-NLS-1$
}
} else {
- return o.getClass().getComponentType() + "[" + length + "] = " + ObjectUtils.toString(o);
+ return o.getClass().getComponentType() + "[" + length + "] = " + ObjectUtils.toString(o); //$NON-NLS-1$ //$NON-NLS-2$
}
}
return null;
}
protected String truncated(String type, String string, int originalLength) {
- return type + "[" + RESOURCE_NAME_MAX_LENGTH + "/" + originalLength + "] = " + string;
+ return type + "[" + RESOURCE_NAME_MAX_LENGTH + "/" + originalLength + "] = " + string; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
protected String getVariableName(ReadGraph graph, Variable r) {
for(VariableConnectionPointDescriptor v : c.getConnectionPointDescriptors(graph, null)) {
result.add(v.getRelativeRVI(graph, base));
}
- return "c " + result.toString();
+ return "c " + result.toString(); //$NON-NLS-1$
} else if (clazz.isArray()) {
if(int[].class == clazz) {
return Arrays.toString((int[])o);
Object value = r.getValue(graph);
if(value instanceof Resource) return getResourceRef(graph, (Resource)value);
else if (value instanceof Variable) return getVariableRef(graph, (Variable)value);
- else return value != null ? getValue(graph, r, value) : "null";
+ else return value != null ? getValue(graph, r, value) : "null"; //$NON-NLS-1$
} catch (Throwable e) {
try {
- Logger.defaultLogError("getValue " + r.getURI(graph), e);
+ Logger.defaultLogError("getValue " + r.getURI(graph), e); //$NON-NLS-1$
} catch (DatabaseException e1) {
Logger.defaultLogError(e1);
}
protected String getDatatype(ReadGraph graph, Variable r) {
try {
Datatype dt = r.getPossibleDatatype(graph);
- return dt != null ? dt.toSingleLineString() : "undefined";
+ return dt != null ? dt.toSingleLineString() : "undefined"; //$NON-NLS-1$
} catch (Exception e) {
return e.getMessage();
}
}
private String getVariableRef(ReadGraph graph, Variable r) throws DatabaseException {
- String ret = "<a href=\"simantics:browser-link" + getLinkString(graph, r) + "\">"
+ String ret = "<a href=\"simantics:browser-link" + getLinkString(graph, r) + "\">" //$NON-NLS-1$ //$NON-NLS-2$
+ getVariableName(graph, r)
- + "</a>";
+ + "</a>"; //$NON-NLS-1$
// if (graph.isInstanceOf(r, L0.Literal)) {
// ret += " <a class=\"edit-link\" href=\"simantics:browser-edit-value" + getLinkString(r) + "\">"
// + "(edit value)"
// } catch (Exception e) {
// e.printStackTrace();
// }
- content.append("<tr>");
- content.append("<td>").append(getVariableRef(graph, property)).append("</td>");
- content.append("<td>").append(getValue(graph, property)).append("</td>");
- content.append("<td>").append(getDatatype(graph, property)).append("</td>");
- content.append("</tr>");
+ content.append("<tr>"); //$NON-NLS-1$
+ content.append("<td>").append(getVariableRef(graph, property)).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<td>").append(getValue(graph, property)).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<td>").append(getDatatype(graph, property)).append("</td>"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("</tr>"); //$NON-NLS-1$
}
protected String getRVIString(ReadGraph graph, Variable var) throws DatabaseException {
try {
return var.getRVI(graph).toString(graph);
} catch (Throwable e) {
- return "No RVI";
+ return "No RVI"; //$NON-NLS-1$
}
}
StringBuilder content = new StringBuilder();
// Generate HTML -page
- content.append("<html><head>").append(getHead()).append("</head>\n");
- content.append("<body>\n");
- content.append("<div id=\"mainContent\">\n");
+ content.append("<html><head>").append(getHead()).append("</head>\n"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<body>\n"); //$NON-NLS-1$
+ content.append("<div id=\"mainContent\">\n"); //$NON-NLS-1$
for (String uri : uris) {
//System.out.println("URI: " + uri);
Variable var = Variables.getPossibleVariable(graph, uri);
}
// Begin #top DIV
- content.append("<div id=\"top\">\n");
- content.append("<table class=\"top\">\n");
- content.append("<tr><td class=\"top_key\">URI</td><td class=\"top_value\"><span id=\"uri\">").append(uri).append("</span></td></tr>\n");
- content.append("<tr><td class=\"top_key\">RVI</td><td class=\"top_value\"><span id=\"uri\">").append(rviString).append("</span></td></tr>\n");
- content.append("<tr><td class=\"top_key\">Class</td><td class=\"top_value\"><span id=\"class\">").append(var.getClass().getCanonicalName()).append("</span></td></tr>\n");
- content.append("<tr><td class=\"top_key\">Solver node</td><td class=\"top_value\"><span id=\"class\">").append(node).append("</span></td></tr>\n");
- content.append("</table>\n");
- content.append("</div>\n");
+ content.append("<div id=\"top\">\n"); //$NON-NLS-1$
+ content.append("<table class=\"top\">\n"); //$NON-NLS-1$
+ content.append("<tr><td class=\"top_key\">URI</td><td class=\"top_value\"><span id=\"uri\">").append(uri).append("</span></td></tr>\n"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<tr><td class=\"top_key\">RVI</td><td class=\"top_value\"><span id=\"uri\">").append(rviString).append("</span></td></tr>\n"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<tr><td class=\"top_key\">Class</td><td class=\"top_value\"><span id=\"class\">").append(var.getClass().getCanonicalName()).append("</span></td></tr>\n"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("<tr><td class=\"top_key\">Solver node</td><td class=\"top_value\"><span id=\"class\">").append(node).append("</span></td></tr>\n"); //$NON-NLS-1$ //$NON-NLS-2$
+ content.append("</table>\n"); //$NON-NLS-1$
+ content.append("</div>\n"); //$NON-NLS-1$
// Close #top DIV
// Content
}
} catch (DatabaseException e) {
// This may happen if the Variable implementation is broken
- ErrorLogger.defaultLogError("Broken variable child retrieval implementation or serious modelling error encountered. See exception for details.", e);
+ ErrorLogger.defaultLogError("Broken variable child retrieval implementation or serious modelling error encountered. See exception for details.", e); //$NON-NLS-1$
}
TreeMap<String, Variable> map2 = new TreeMap<String, Variable>();
}
} catch (DatabaseException e) {
// This may happen if the Variable implementation is broken
- ErrorLogger.defaultLogError("Broken variable property retrieval implementation or serious modelling error encountered. See exception for details.", e);
+ ErrorLogger.defaultLogError("Broken variable property retrieval implementation or serious modelling error encountered. See exception for details.", e); //$NON-NLS-1$
}
- content.append("\n<div id=\"data\">\n");
- content.append("<table>\n");
+ content.append("\n<div id=\"data\">\n"); //$NON-NLS-1$
+ content.append("<table>\n"); //$NON-NLS-1$
- content.append("<tr><th>Child</th></tr>");
+ content.append("<tr><th>Child</th></tr>"); //$NON-NLS-1$
for (Variable child : map.values()) {
- content.append("<tr><td>").append(getVariableRef(graph, child)).append("</td></tr>");
+ content.append("<tr><td>").append(getVariableRef(graph, child)).append("</td></tr>"); //$NON-NLS-1$ //$NON-NLS-2$
}
- content.append("<tr><th>Property</th><th>Value</th><th>Datatype</th></tr>");
+ content.append("<tr><th>Property</th><th>Value</th><th>Datatype</th></tr>"); //$NON-NLS-1$
for (Variable property : map2.values()) {
updateProperty(content, graph, property);
}
// Close #data
- content.append("</div>\n\n");
+ content.append("</div>\n\n"); //$NON-NLS-1$
}
// Close #mainContent
- content.append("</div>\n");
- content.append("</body></html>\n");
+ content.append("</div>\n"); //$NON-NLS-1$
+ content.append("</body></html>\n"); //$NON-NLS-1$
// Update content
return content.toString();
}
private String getHead() {
- String result = "";
+ String result = ""; //$NON-NLS-1$
if (cssPath != null) {
- result = "<link href=\"" + cssPath + "\" rel=\"stylesheet\" type=\"text/css\">";
+ result = "<link href=\"" + cssPath + "\" rel=\"stylesheet\" type=\"text/css\">"; //$NON-NLS-1$ //$NON-NLS-2$
}
return result;
}
public class VariableDebuggerView extends ViewPart {
- public static final String VIEW_ID = "org.simantics.debug.variableDebugger";
+ public static final String VIEW_ID = "org.simantics.debug.variableDebugger"; //$NON-NLS-1$
private ResourceInput input;
//
class RefreshAction extends Action {
public RefreshAction() {
- super("Refresh", BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif"));
+ super(Messages.VariableDebuggerView_Refresh, BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif")); //$NON-NLS-2$
}
@Override
public void run() {
class BackAction extends Action {
public BackAction() {
- super("Back", Action.AS_PUSH_BUTTON);
+ super(Messages.VariableDebuggerView_Back, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class ForwardAction extends Action {
public ForwardAction() {
- super("Forward", Action.AS_PUSH_BUTTON);
+ super(Messages.VariableDebuggerView_Forward, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
class HomeAction extends Action {
public HomeAction() {
- super("Home", Action.AS_PUSH_BUTTON);
- setToolTipText("Navigate to root library");
+ super(Messages.VariableDebuggerView_Home, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.VariableDebuggerView_HomeTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV_DISABLED));
}
import javax.swing.SwingUtilities;
import org.eclipse.jface.layout.GridDataFactory;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.browser.Browser;
import org.eclipse.swt.layout.GridData;
public GraphvizComponent2 createGraph(Composite parent) {
graph = new Graph();
- graph.setRankdir("LR");
+ graph.setRankdir("LR"); //$NON-NLS-1$
graphVizComponent = new GraphvizComponent2(parent, SWT.NONE);
SwingUtilities.invokeLater(new Runnable() {
if (n == null) {
n = new Node(graph);
if (!r.isPersistent()) {
- n.setShape("box");
- n.setFontColor("blue");
+ n.setShape("box"); //$NON-NLS-1$
+ n.setFontColor("blue"); //$NON-NLS-1$
}
nodeMap.map(r, n);
}
@SuppressWarnings("unused")
protected void appendLabel(Node node, String text) {
- String label = node.get("label");
+ String label = node.get("label"); //$NON-NLS-1$
if (true) {
if (label == null || label.length() == 0)
label = text;//escape(text);
else {
label = label.substring(1,label.length()-1);
- label += "<br/>"+text;
+ label += "<br/>"+text; //$NON-NLS-1$
}
- label = "<" + label + ">";
+ label = "<" + label + ">"; //$NON-NLS-1$ //$NON-NLS-2$
} else {
if (label == null || label.length() == 0)
label = text;
else {
- label += " "+text;
+ label += " "+text; //$NON-NLS-1$
}
}
L0 = Layer0.getInstance(g);
graph = new Graph();
- graph.setRankdir("LR");
+ graph.setRankdir("LR"); //$NON-NLS-1$
nodeMap.clear();
edgeMap.clear();
continue;
Node node = getResourceRef(g, r);
if (r.equals(getDebuggerLocation())) {
- node.setFillColor("#aaffaa");
- node.setStyle("filled");
+ node.setFillColor("#aaffaa"); //$NON-NLS-1$
+ node.setStyle("filled"); //$NON-NLS-1$
}
//Node node = getOrCreate(r);
processed.add(r);
uri = g.syncRequest(new ResourceToPossibleURI(r));
} catch (Exception e) {
e.printStackTrace();
- uri = "Cannot get URI: " + e.getMessage();
+ uri = "Cannot get URI: " + e.getMessage(); //$NON-NLS-1$
}
if (uri != null)
- appendLabel(node, "URI: " + uri);
+ appendLabel(node, "URI: " + uri); //$NON-NLS-1$
//content.append("\t\t<div class=\"monospaced\">" + uri + "</div><br/>");
Collection<Statement> statements = g.getStatements(r, L0.IsWeaklyRelatedTo);
map.add(predicate, new Resource[] {subject, obj});
} catch (Throwable e) {
e.printStackTrace();
- ErrorLogger.defaultLogError("Cannot find statement " + subject + " " + predicate + " " + obj, e);
+ ErrorLogger.defaultLogError("Cannot find statement " + subject + " " + predicate + " " + obj, e); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
ClusteringSupport support = g.getSession().getService(ClusteringSupport.class);
//content.append("<h3>" + " ["+ r.getResourceId() + "-" + support.getCluster(r) + "] " + "</h3>\n");
- appendLabel(node, " ["+ r.getResourceId() + "-" + support.getCluster(r) + "]");
+ appendLabel(node, " ["+ r.getResourceId() + "-" + support.getCluster(r) + "]"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
//content.append("<table>\n");
//content.append("<tr><th>Predicate</th><th>Object</th></tr>");
//content.append("<tr><td class=\"subtitle\" colspan=\"2\">Tags</td></tr>");
for(Statement stm : statements) {
if(stm.getSubject().equals(stm.getObject())) {
- updateTag(node, g, r, stm.getPredicate(), "Tag");
+ updateTag(node, g, r, stm.getPredicate(), "Tag"); //$NON-NLS-1$
map.remove(stm.getPredicate());
}
}
for(Statement stm : statements) {
Resource predicate = stm.getPredicate();
if(g.isInstanceOf(stm.getPredicate(), L0.OrderedSet)) {
- updateTag(node, g, r, stm.getPredicate(), "Ordered Set");
+ updateTag(node, g, r, stm.getPredicate(), "Ordered Set"); //$NON-NLS-1$
map.remove(stm.getPredicate());
}
Resource inverse = g.getPossibleInverse(predicate);
for(Resource pred : preds) {
String str = htmlEscape(getResourceName(g, pred));
if(str == null)
- str = "<null>";
+ str = "<null>"; //$NON-NLS-1$
strmap.put(pred, str);
}
Arrays.sort(preds, new Comparator<Resource>() {
if(!stmSubject.equals(subj)) {
Node asserted = getResourceRef(graph, stmSubject);
Edge e = new Edge(this.graph, objects[i].node, asserted);
- e.setLabel("Asserted in");
+ e.setLabel(Messages.GraphicalDebugger_AssertedIn);
- objects[i].node.setFillColor("#ffaaaa");
- objects[i].node.setStyle("filled");
+ objects[i].node.setFillColor("#ffaaaa"); //$NON-NLS-1$
+ objects[i].node.setStyle("filled"); //$NON-NLS-1$
}
}
cur = OrderedSetUtils.next(graph, subj, cur);
} catch(DatabaseException e) {
Edge edge = new Edge(this.graph, node, node);
- edge.setLabel("Broken Ordered Set");
+ edge.setLabel(Messages.GraphicalDebugger_BrockenOrderedSet);
//list.add("<span style=\"color:red;font-weight:bold\">BROKEN ORDERED SET:<br/></span><span style=\"color:red\">" + e.getMessage() + "</span>");
// Resource inv = graph.getPossibleInverse(subj);
// for(Statement stat : graph.getStatements(cur, L0.IsRelatedTo)) {
}
for (int i = 0; i < list.size() ; ++i) {
Edge e = new Edge(this.graph, node, list.get(i));
- e.setLabel("Oredered set item " + i);
+ e.setLabel(NLS.bind(Messages.GraphicalDebugger_OrderedSetItem , i));
}
// Output table rows
public class GraphicalDebuggerEditor extends ResourceEditorPart {
- public static final String EDITOR_ID = "org.simantics.debug.graphicalDebuggerEditor";
+ public static final String EDITOR_ID = "org.simantics.debug.graphicalDebuggerEditor"; //$NON-NLS-1$
private GraphicalDebugger debugger;
private IAction backAction;
class RefreshAction extends Action {
public RefreshAction() {
- super("Refresh", BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif"));
+ super(Messages.GraphicalDebuggerEditor_Refresh, BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif")); //$NON-NLS-2$
}
@Override
public void run() {
class FindAction extends Action {
public FindAction() {
- super("Find", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png"));
- setToolTipText("Find Resource");
+ super(Messages.GraphicalDebuggerEditor_Find, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_blue.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphicalDebuggerEditor_FindTT);
}
@Override
public void run() {
class AddStatementAction extends Action {
public AddStatementAction() {
- super("AddStatement", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add Statement Between Existing Resources");
+ super(Messages.GraphicalDebuggerEditor_AddStatement, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphicalDebuggerEditor_AddStatementTT);
}
@Override
public void run() {
}
class AddResourceAction extends Action {
public AddResourceAction() {
- super("AddResource", BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png"));
- setToolTipText("Add New Related Resource");
+ super(Messages.GraphicalDebuggerEditor_AddResource, BundleUtils.getImageDescriptorFromPlugin(Activator.PLUGIN_ID, "icons/cog_add.png")); //$NON-NLS-2$
+ setToolTipText(Messages.GraphicalDebuggerEditor_AddResourceTT);
}
@Override
public void run() {
}
class BackAction extends Action {
public BackAction() {
- super("Back", Action.AS_PUSH_BUTTON);
- setToolTipText("Back");
+ super(Messages.GraphicalDebuggerEditor_Back, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphicalDebuggerEditor_BackTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class ForwardAction extends Action {
public ForwardAction() {
- super("Forward", Action.AS_PUSH_BUTTON);
- setToolTipText("Forward");
+ super(Messages.GraphicalDebuggerEditor_Forward, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphicalDebuggerEditor_ForwardTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
class DecreaseDepthAction extends Action {
public DecreaseDepthAction() {
- super("Decrease", Action.AS_PUSH_BUTTON);
+ super(Messages.GraphicalDebuggerEditor_Decrease, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class IncreaseDepthAction extends Action {
public IncreaseDepthAction() {
- super("Increase", Action.AS_PUSH_BUTTON);
+ super(Messages.GraphicalDebuggerEditor_Increase, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
public class GraphicalDebuggerView extends ViewPart {
- public static final String VIEW_ID = "org.simantics.debug.graphicalDebugger";
+ public static final String VIEW_ID = "org.simantics.debug.graphicalDebugger"; //$NON-NLS-1$
// private final boolean DEFAULT_RECYCLE_VIEW = true;
//
class RefreshAction extends Action {
public RefreshAction() {
- super("Refresh", BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif"));
+ super(Messages.GraphicalDebuggerView_Refresh, BundleUtils.getImageDescriptorFromPlugin(SimanticsUI.PLUGIN_ID, "icons/refresh.gif")); //$NON-NLS-2$
}
@Override
public void run() {
class BackAction extends Action {
public BackAction() {
- super("Back", Action.AS_PUSH_BUTTON);
+ super(Messages.GraphicalDebuggerView_Back, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class ForwardAction extends Action {
public ForwardAction() {
- super("Forward", Action.AS_PUSH_BUTTON);
+ super(Messages.GraphicalDebuggerView_Forward, Action.AS_PUSH_BUTTON);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
class HomeAction extends Action {
public HomeAction() {
- super("Home", Action.AS_PUSH_BUTTON);
- setToolTipText("Navigate to root library");
+ super(Messages.GraphicalDebuggerView_Home, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphicalDebuggerView_HomeTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_ETOOL_HOME_NAV_DISABLED));
}
class DecreaseDepthAction extends Action {
public DecreaseDepthAction() {
- super("Decrease", Action.AS_PUSH_BUTTON);
- setToolTipText("Decrease Depth");
+ super(Messages.GraphicalDebuggerView_Decrease, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphicalDebuggerView_DecreaseTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_BACK_DISABLED));
}
class IncreaseDepthAction extends Action {
public IncreaseDepthAction() {
- super("Increase", Action.AS_PUSH_BUTTON);
- setToolTipText("Increase Depth");
+ super(Messages.GraphicalDebuggerView_Increase, Action.AS_PUSH_BUTTON);
+ setToolTipText(Messages.GraphicalDebuggerView_IncreaseTT);
setImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD));
setDisabledImageDescriptor(PlatformUI.getWorkbench().getSharedImages().getImageDescriptor(ISharedImages.IMG_TOOL_FORWARD_DISABLED));
}
--- /dev/null
+package org.simantics.debug.ui.graph;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.debug.ui.graph.messages"; //$NON-NLS-1$
+ public static String GraphicalDebugger_AssertedIn;
+ public static String GraphicalDebugger_BrockenOrderedSet;
+ public static String GraphicalDebugger_OrderedSetItem;
+ public static String GraphicalDebuggerEditor_AddResource;
+ public static String GraphicalDebuggerEditor_AddResourceTT;
+ public static String GraphicalDebuggerEditor_AddStatement;
+ public static String GraphicalDebuggerEditor_AddStatementTT;
+ public static String GraphicalDebuggerEditor_Back;
+ public static String GraphicalDebuggerEditor_BackTT;
+ public static String GraphicalDebuggerEditor_Decrease;
+ public static String GraphicalDebuggerEditor_Find;
+ public static String GraphicalDebuggerEditor_FindTT;
+ public static String GraphicalDebuggerEditor_Forward;
+ public static String GraphicalDebuggerEditor_ForwardTT;
+ public static String GraphicalDebuggerEditor_Increase;
+ public static String GraphicalDebuggerEditor_Refresh;
+ public static String GraphicalDebuggerView_Back;
+ public static String GraphicalDebuggerView_Decrease;
+ public static String GraphicalDebuggerView_DecreaseTT;
+ public static String GraphicalDebuggerView_Forward;
+ public static String GraphicalDebuggerView_Home;
+ public static String GraphicalDebuggerView_HomeTT;
+ public static String GraphicalDebuggerView_Increase;
+ public static String GraphicalDebuggerView_IncreaseTT;
+ public static String GraphicalDebuggerView_Refresh;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+GraphicalDebugger_AssertedIn=Asserted in\r
+GraphicalDebugger_BrockenOrderedSet=Broken Ordered Set\r
+GraphicalDebugger_OrderedSetItem=Ordered set item {0}\r
+GraphicalDebuggerEditor_AddResource=AddResource\r
+GraphicalDebuggerEditor_AddResourceTT=Add New Related Resource\r
+GraphicalDebuggerEditor_AddStatement=AddStatement\r
+GraphicalDebuggerEditor_AddStatementTT=Add Statement Between Existing Resources\r
+GraphicalDebuggerEditor_Back=Back\r
+GraphicalDebuggerEditor_BackTT=Back\r
+GraphicalDebuggerEditor_Decrease=Decrease\r
+GraphicalDebuggerEditor_Find=Find\r
+GraphicalDebuggerEditor_FindTT=Find Resource\r
+GraphicalDebuggerEditor_Forward=Forward\r
+GraphicalDebuggerEditor_ForwardTT=Forward\r
+GraphicalDebuggerEditor_Increase=Increase\r
+GraphicalDebuggerEditor_Refresh=Refresh\r
+GraphicalDebuggerView_Back=Back\r
+GraphicalDebuggerView_Decrease=Decrease\r
+GraphicalDebuggerView_DecreaseTT=Decrease Depth\r
+GraphicalDebuggerView_Forward=Forward\r
+GraphicalDebuggerView_Home=Home\r
+GraphicalDebuggerView_HomeTT=Navigate to root library\r
+GraphicalDebuggerView_Increase=Increase\r
+GraphicalDebuggerView_IncreaseTT=Increase Depth\r
+GraphicalDebuggerView_Refresh=Refresh\r
public class Activator extends AbstractUIPlugin {
// The plug-in ID
- public static final String PLUGIN_ID = "org.simantics.debug.ui";
+ public static final String PLUGIN_ID = "org.simantics.debug.ui"; //$NON-NLS-1$
// The shared instance
private static Activator plugin;
if (stm != null) {
String label = NameUtils.getSafeLabel(graph, r);
if (!label.isEmpty() && !stm.isAsserted(r))
- name += " (" + label + ")";
+ name += " (" + label + ")"; //$NON-NLS-1$ //$NON-NLS-2$
}
return name;
}
public static void addResource(Session s, GraphDebugger debugger) throws DatabaseException {
Shell shell = debugger.getShell();
- SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, "Create New Resource");
+ SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, Messages.DebugUtils_CreateNewResource);
rld.setBlockOnOpen(true);
rld.setResourceFilter(ResourceSearch.FILTER_TYPES);
Resource subject_ = debugger.getDebuggerLocation();
if (subject_ == null) {
rld.setBlockOnOpen(true);
- rld.setMessage("Select Subject");
+ rld.setMessage(Messages.DebugUtils_SelectSubject);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
rld.setBlockOnOpen(true);
rld.setResourceFilter(ResourceSearch.FILTER_RELATIONS);
- rld.setMessage("Select Predicate");
+ rld.setMessage(Messages.DebugUtils_SelectPredicate);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
final Resource predicate = ((Container<Resource>)rld.getResult()[0]).get();
- rld.setMessage("Select Type of New Object Instance");
+ rld.setMessage(Messages.DebugUtils_SelectTypeOfNewObjectInstance);
rld.setResourceFilter(ResourceSearch.FILTER_TYPES);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
@SuppressWarnings("unchecked")
public static void addStatement(Session s, GraphDebugger debugger) throws DatabaseException {
Shell shell = debugger.getShell();
- SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, "Create New Statement");
+ SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, Messages.DebugUtils_CreateNewStatement);
Resource subject_ = debugger.getDebuggerLocation();
if (subject_ == null) {
rld.setBlockOnOpen(true);
- rld.setMessage("Select Subject");
+ rld.setMessage(Messages.DebugUtils_SelectSubject);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
rld.setBlockOnOpen(true);
rld.setResourceFilter(ResourceSearch.FILTER_RELATIONS);
- rld.setMessage("Select Predicate");
+ rld.setMessage(Messages.DebugUtils_SelectPredicate);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
final Resource predicate = ((Container<Resource>)rld.getResult()[0]).get();
rld.setResourceFilter(ResourceSearch.FILTER_ALL);
- rld.setMessage("Select Object");
+ rld.setMessage(Messages.DebugUtils_SelectObject);
rld.setInitialSelections(new Object[] {});
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
public static void find(Session s, GraphDebugger debugger) {
Shell shell = debugger.getShell();
- SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, "Select Resource to View");
+ SearchResourceDialog rld = new SearchResourceDialog(s, false, shell, Messages.DebugUtils_SelectResourceToView);
rld.setBlockOnOpen(true);
if (rld.open()!=org.eclipse.jface.window.Window.OK) return;
if (rld.getResult()==null) return;
public class GraphDebuggerAdapter extends AbstractResourceEditorAdapter {
public GraphDebuggerAdapter() {
- super("Graph Debugger View", SimanticsUI.getImageDescriptor("icons/etool16/bug.png"));
+ super(Messages.GraphDebuggerAdapter_GraphDebuggerView, SimanticsUI.getImageDescriptor("icons/etool16/bug.png")); //$NON-NLS-1$
}
@Override
public class GraphDebuggerEditorAdapter extends AbstractResourceEditorAdapter {
public GraphDebuggerEditorAdapter() {
- super("Graph Debugger", SimanticsUI.getImageDescriptor("icons/etool16/bug.png"));
+ super(Messages.GraphDebuggerEditorAdapter_GraphDebugger, SimanticsUI.getImageDescriptor("icons/etool16/bug.png")); //$NON-NLS-2$
}
@Override
public class GraphicalDebuggerEditorAdapter extends AbstractResourceEditorAdapter {
public GraphicalDebuggerEditorAdapter() {
- super("Graphical Debugger", SimanticsUI.getImageDescriptor("icons/etool16/bug.png"));
+ super(Messages.GraphicalDebuggerEditorAdapter_GraphicalDebugger, SimanticsUI.getImageDescriptor("icons/etool16/bug.png")); //$NON-NLS-1$
}
@Override
--- /dev/null
+package org.simantics.debug.ui.internal;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.debug.ui.internal.messages"; //$NON-NLS-1$
+ public static String DebugUtils_CreateNewResource;
+ public static String DebugUtils_CreateNewStatement;
+ public static String DebugUtils_SelectObject;
+ public static String DebugUtils_SelectPredicate;
+ public static String DebugUtils_SelectResourceToView;
+ public static String DebugUtils_SelectSubject;
+ public static String DebugUtils_SelectTypeOfNewObjectInstance;
+ public static String GraphDebuggerAdapter_GraphDebuggerView;
+ public static String GraphDebuggerEditorAdapter_GraphDebugger;
+ public static String GraphicalDebuggerEditorAdapter_GraphicalDebugger;
+ public static String SearchResourceHandler_OpenResource;
+ public static String TGEditorAdapter_OntologyViewer;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public Object execute(ExecutionEvent event) throws ExecutionException {
Shell shell = HandlerUtil.getActiveShellChecked(event);
Session session = Simantics.getSession();
- SearchResourceDialog rld = new SearchResourceDialog(session, false, shell, "Open Resource");
+ SearchResourceDialog rld = new SearchResourceDialog(session, false, shell, Messages.SearchResourceHandler_OpenResource);
rld.setResourceFilter(ResourceSearch.FILTER_ALL);
rld.setBlockOnOpen(true);
rld.open();
*/
public class TGEditorAdapter extends AbstractResourceEditorAdapter {
- public static final String EDITOR_ID = "org.simantics.modeling.ui.pgraphEditor";
+ public static final String EDITOR_ID = "org.simantics.modeling.ui.pgraphEditor"; //$NON-NLS-1$
public TGEditorAdapter() {
- super("Ontology Viewer", SimanticsUI.getImageDescriptor("icons/etool16/bug.png"));
+ super(Messages.TGEditorAdapter_OntologyViewer, SimanticsUI.getImageDescriptor("icons/etool16/bug.png")); //$NON-NLS-1$
}
@Override
--- /dev/null
+DebugUtils_CreateNewResource=Create New Resource\r
+DebugUtils_CreateNewStatement=Create New Statement\r
+DebugUtils_SelectObject=Select Object\r
+DebugUtils_SelectPredicate=Select Predicate\r
+DebugUtils_SelectResourceToView=Select Resource to View\r
+DebugUtils_SelectSubject=Select Subject\r
+DebugUtils_SelectTypeOfNewObjectInstance=Select Type of New Object Instance\r
+GraphDebuggerAdapter_GraphDebuggerView=Graph Debugger View\r
+GraphDebuggerEditorAdapter_GraphDebugger=Graph Debugger\r
+GraphicalDebuggerEditorAdapter_GraphicalDebugger=Graphical Debugger\r
+SearchResourceHandler_OpenResource=Open Resource\r
+TGEditorAdapter_OntologyViewer=Ontology Viewer\r
# Contributors:
# VTT Technical Research Centre of Finland - initial API and implementation
###############################################################################
+GraphDebugger_Cancel=Cancel
+GraphDebugger_ConfirmActionsDots=Confirm action...
+GraphDebugger_ConfirmActionsDotsMsg=This action will remove the selected statement.\nAre you sure you want to proceed with this action?
+GraphDebugger_Continue=Continue
+GraphDebugger_EditValue=Edit Value
+GraphDebugger_EnterResourceIDorURI=Enter resource ID (RID) or URI
+GraphDebugger_InputNewPropertyValue=Input new property value. For numeric vector values, separate numbers with comma (',').
+GraphDebugger_LabelDragResource=Drag a resource here to examine it in this debugger\!
+GraphDebugger_Lookup=&Lookup
+GraphDebugger_StatusIndexLookpuFailed=Index & cluster -based lookup failed. See Error Log.
+GraphDebugger_StatusInvalidInput=Invalid input, expected transient resource ID
+GraphDebugger_StatusInvalidInputExpectIdxClusterIds=Invalid input, expected index & cluster IDs
+GraphDebugger_StatusInvalidInputResIdORURIExpected=Invalid input, resource ID or URI expected
+GraphDebugger_StatusInvalidPrefixedInput=Invalid '$'-prefixed input, expected resource ID
+GraphDebugger_StatusResourceforURI=Resource for URI ''{0}'' not found
+GraphDebugger_StatusResourceIDFailed=Resource ID lookup failed. See Error Log.
+GraphDebugger_StatusTransientResourceID=Transient resource ID lookup failed. See Error Log.
+GraphDebugger_StatusURIlookupFailed=URI lookup failed. See Error Log.
+GraphDebuggerEditor_AddResourceTT=Add New Related Resource
+GraphDebuggerEditor_AddStatement=AddStatement
+GraphDebuggerEditor_AddStatementTT=Add Statement Between Existing Resources
+GraphDebuggerEditor_Back=Back
+GraphDebuggerEditor_BackTT=Back
+GraphDebuggerEditor_Find=Find
+GraphDebuggerEditor_FindTT=Find Resource
+GraphDebuggerEditor_Forward=Forward
+GraphDebuggerEditor_ForwardTT=Forward
+GraphDebuggerEditor_Refresh=Refresh
+GraphDebuggerEditor_RefreshTT=Refresh
-Name_adaption_problem = <p>GraphDebugger: name adaption problem in {0}</p>
-Name_formulation_problem = <p>GraphDebugger: unknown name formulation problem in {0}</p>
\ No newline at end of file
+
+GraphDebuggerEditor_AddResource=AddResource
+GraphDebuggerView_AddResource=AddResource
+GraphDebuggerView_AddResourceTT=Add New Related Resource
+GraphDebuggerView_AddStatement=AddStatement
+GraphDebuggerView_AddStatementTT=Add Statement Between Existing Resources
+GraphDebuggerView_Back=Back
+GraphDebuggerView_BackTT=Back
+GraphDebuggerView_Find=Find
+GraphDebuggerView_FindTT=Find Resource
+GraphDebuggerView_Forward=Forward
+GraphDebuggerView_ForwardTT=Forward
+GraphDebuggerView_Home=Home
+GraphDebuggerView_HomeTT=Navigate to root library
+GraphDebuggerView_Refresh=Refresh
+SearchResourceDialog_ActivatorResourceLabelProviderFailed=Resource label provider failed unexpectedly.
+SearchResourceDialog_EnterNameResURIOrId=Enter name, resource URI or ID
+SearchResourceDialog_SeperatorLblPreviouslySelected=Previously selected above, others below
+SearchResourceDialog_ShowInBrowser=Show In Browser
+SessionDebuggerView_ActivatorUnexpectedException=Unexpected exception while applying command
+SessionDebuggerView_ActivatorUnexpectedIOException=Unexpected I/O exception while applying command {0}{1}
+SessionDebuggerView_Shell=Shell
+SessionDebuggerView_WroteCommand=Wrote command ''{0}'' output to file {1}
+VariableDebugger_DragResourceToDebugger=\ \ Drag a resource or a variable here to examine it in this debugger\!
+VariableDebugger_Lookup=Lookup
+VariableDebugger_TextToolTip=Amount of Screen/Listener Updates Received for Shown Variable
+VariableDebuggerView_Back=Back
+VariableDebuggerView_Forward=Forward
+VariableDebuggerView_Home=Home
+VariableDebuggerView_HomeTT=Navigate to root library
+VariableDebuggerView_Refresh=Refresh
public class DesktopProjectFeature extends AbstractProjectFeature {
- private static final String DEFAULT_PERSPECTIVE = "org.simantics.desktop.modelling.perspective";
+ private static final String DEFAULT_PERSPECTIVE = "org.simantics.desktop.modelling.perspective"; //$NON-NLS-1$
@Override
public void configure() throws ProjectException {
context.setHint(SelectionHints.KEY_MAIN, lib);
IStructuredSelection sel = new StructuredSelection(context);
- ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.modelExportWizard");
+ ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.modelExportWizard"); //$NON-NLS-1$
} catch (DatabaseException e) {
// TODO Auto-generated catch block
e.printStackTrace();
@Override
public Resource perform(ReadGraph graph) throws DatabaseException {
- List<Resource> ontologies = Simantics.applySCL("Simantics/SharedOntologies", "getSharedOntologies", graph, Tuple0.INSTANCE);
+ List<Resource> ontologies = Simantics.applySCL("Simantics/SharedOntologies", "getSharedOntologies", graph, Tuple0.INSTANCE); //$NON-NLS-1$ //$NON-NLS-2$
if(ontologies.size() == 1) return ontologies.iterator().next();
return null;
}
context.setHint(SelectionHints.KEY_MAIN, lib);
IStructuredSelection sel = new StructuredSelection(context);
- ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.sharedOntologyExportWizard");
+ ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.sharedOntologyExportWizard"); //$NON-NLS-1$
} catch (DatabaseException e) {
// TODO Auto-generated catch block
e.printStackTrace();
// Get imported transferable graph file using FileDialog
Shell shell = HandlerUtil.getActiveShellChecked(event);
FileDialog fd = new FileDialog(shell, SWT.OPEN);
- fd.setText("Import Model");
+ fd.setText(Messages.ImportModel_ImportModel);
- String path = Activator.getDefault().getPreferenceStore().getString("IMPORT_MODEL_PATH");
+ String path = Activator.getDefault().getPreferenceStore().getString("IMPORT_MODEL_PATH"); //$NON-NLS-1$
if(path.isEmpty() || !(new File(path).exists())){
- path = System.getProperty("user.dir");
+ path = System.getProperty("user.dir"); //$NON-NLS-1$
}
fd.setFilterPath(path);
- String[] filterExt = {"*.tg", "*.*"};
+ String[] filterExt = {"*.tg", "*.*"}; //$NON-NLS-1$ //$NON-NLS-2$
fd.setFilterExtensions(filterExt);
final String selected = fd.open();
if(selected == null) return null;
- Job job = new DatabaseJob("Import model") {
+ Job job = new DatabaseJob(Messages.ImportModel_DatabaseImportModel) {
@Override
protected IStatus run(IProgressMonitor monitor) {
public Object execute(ExecutionEvent event) throws ExecutionException {
IStructuredSelection sel = new StructuredSelection();
- ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.sharedOntologyImportWizard");
+ ModelingUtils.openWizard(Display.getCurrent(), sel, "org.simantics.modeling.ui.sharedOntologyImportWizard"); //$NON-NLS-1$
return null;
}
--- /dev/null
+package org.simantics.desktop.ui.internal;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.desktop.ui.internal.messages"; //$NON-NLS-1$
+ public static String ImportModel_DatabaseImportModel;
+ public static String ImportModel_ImportModel;
+ public static String NewModel_0_Failed;
+ public static String NewModel_Book1;
+ public static String NewModel_Library;
+ public static String NewModel_NewModel;
+ public static String NewModel_Sheet1;
+ public static String NewModel_Sheet2;
+ public static String NewModel_Sheet3;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import org.eclipse.core.runtime.IStatus;
import org.eclipse.core.runtime.Status;
import org.eclipse.core.runtime.jobs.Job;
+import org.eclipse.osgi.util.NLS;
import org.simantics.DatabaseJob;
import org.simantics.Simantics;
import org.simantics.db.Resource;
@Override
public Object execute(ExecutionEvent event) throws ExecutionException {
- Job job = new DatabaseJob("Creating Model") {
+ Job job = new DatabaseJob(Messages.NewModel_NewModel) {
@Override
protected IStatus run(IProgressMonitor monitor) {
try {
});
return Status.OK_STATUS;
} catch (DatabaseException e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, getName() + " failed.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, NLS.bind(Messages.NewModel_0_Failed, getName()), e);
}
}
};
Resource model = ModelingUtils.createModel(graph, type, name);
Resource conf = graph.syncRequest(new Configuration(model));
- ModelingUtils.addSCLMainToModel(graph, model, "SCLMain", "");
- ModelingUtils.createLocalLibrary(graph, model, "Library");
+ ModelingUtils.addSCLMainToModel(graph, model, "SCLMain", ""); //$NON-NLS-1$ //$NON-NLS-2$
+ ModelingUtils.createLocalLibrary(graph, model, Messages.NewModel_Library);
- Resource book = SpreadsheetGraphUtils.createBook(graph, conf, "Book1");
- SpreadsheetUtils.createSheet(graph, book, "Sheet1", new String[] { }, new int[] { 50 });
- SpreadsheetUtils.createSheet(graph, book, "Sheet2", new String[] { }, new int[] { 50 });
- SpreadsheetUtils.createSheet(graph, book, "Sheet3", new String[] { }, new int[] { 50 });
+ Resource book = SpreadsheetGraphUtils.createBook(graph, conf, Messages.NewModel_Book1);
+ SpreadsheetUtils.createSheet(graph, book, Messages.NewModel_Sheet1, new String[] { }, new int[] { 50 });
+ SpreadsheetUtils.createSheet(graph, book, Messages.NewModel_Sheet2, new String[] { }, new int[] { 50 });
+ SpreadsheetUtils.createSheet(graph, book, Messages.NewModel_Sheet3, new String[] { }, new int[] { 50 });
return model;
}
--- /dev/null
+ImportModel_DatabaseImportModel=Import model\r
+ImportModel_ImportModel=Import Model\r
+NewModel_0_Failed={0} failed.\r
+NewModel_Book1=Book1\r
+NewModel_Library=Library\r
+NewModel_NewModel=Creating Model\r
+NewModel_Sheet1=Sheet1\r
+NewModel_Sheet2=Sheet2\r
+NewModel_Sheet3=Sheet3\r
eclipse.preferences.version=1
+encoding//src/org/simantics/document/linking/actions/messages.properties=ISO-8859-1
+encoding//src/org/simantics/document/linking/ge/messages.properties=ISO-8859-1
encoding//src/org/simantics/document/linking/report/ExportToPDF.java=UTF-8
+encoding//src/org/simantics/document/linking/report/messages.properties=ISO-8859-1
encoding//src/org/simantics/document/linking/report/templates/ModelDocumentWriter.java=UTF-8
encoding//src/org/simantics/document/linking/report/templates/ReferredDocumentWriter.java=UTF-8
+encoding//src/org/simantics/document/linking/report/templates/messages.properties=ISO-8859-1
+encoding//src/org/simantics/document/linking/utils/messages.properties=ISO-8859-1
+encoding//src/org/simantics/document/linking/views/messages.properties=ISO-8859-1
+encoding//src/org/simantics/document/linking/wizard/messages.properties=ISO-8859-1
public void start(BundleContext context) throws Exception {
super.start(context);
plugin = this;
- cross = imageDescriptorFromPlugin(PLUGIN_ID, "icons/silk_small/cross.png");
- clock_red = imageDescriptorFromPlugin(PLUGIN_ID, "icons/silk_small/clock_red.png");
+ cross = imageDescriptorFromPlugin(PLUGIN_ID, "icons/silk_small/cross.png"); //$NON-NLS-1$
+ clock_red = imageDescriptorFromPlugin(PLUGIN_ID, "icons/silk_small/clock_red.png"); //$NON-NLS-1$
}
/*
--- /dev/null
+package org.simantics.document.linking.actions;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.actions.messages"; //$NON-NLS-1$
+ public static String SearchLinksAction_CannotPerformSearch;
+ public static String UpdateReferencesAction_CannotUpdateReferences;
+ public static String UpdateReferencesAction_FixOldReferences;
+ public static String UpdateReferencesAction_FixReferences;
+ public static String UpdateReferencesAction_NothingToFix;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
Layer0 l0 = Layer0.getInstance(graph);
String s = graph.getPossibleRelatedValue(resource, l0.HasLabel, Bindings.STRING);
if (s == null)
- s = graph.getRelatedValue(resource, l0.HasName, Bindings.STRING);
+ s = graph.getRelatedValue(resource, l0.HasName, Bindings.STRING);
return s;
}
});
- ISearchService searchService = (ISearchService)PlatformUI.getWorkbench().getService(ISearchService.class);
+ ISearchService searchService = (ISearchService) PlatformUI.getWorkbench().getService(ISearchService.class);
SearchQuery query = new SearchQuery(name);
- query.setSearchFlag("Name", "on");
- query.setSearchFlag(DocumentLink.URIs.SearchFunction, "on");
+ query.setSearchFlag("Name", "on"); //$NON-NLS-1$ //$NON-NLS-2$
+ query.setSearchFlag(DocumentLink.URIs.SearchFunction, "on"); //$NON-NLS-1$
searchService.performQuery(query, ISearchService.ResultBrowser.VIEW, true);
} catch (DatabaseException e) {
- ExceptionUtils.logAndShowError("Cannot perform search",e);
+ ExceptionUtils.logAndShowError(Messages.SearchLinksAction_CannotPerformSearch, e);
}
-
-
+
}
};
}
import java.util.Collection;
import java.util.Collections;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.MessageDialog;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.widgets.Display;
import org.simantics.Simantics;
import org.simantics.db.ReadGraph;
@Override
public Collection<Resource> perform(ReadGraph graph)
throws DatabaseException {
- return findDocumentReferences(graph, document);
+ return findDocumentReferences(graph, document);
}
});
-
+
if (coll == null)
return;
-
- String dialogTitle = "Fix References";
- String dialogMessage = "Fix " + coll.size() + " old references?";
- String dialogButtonLabels[] = new String[]{"Ok","Cancel"};
+
+ String dialogTitle = Messages.UpdateReferencesAction_FixReferences;
+ String dialogMessage = NLS.bind(Messages.UpdateReferencesAction_FixOldReferences, coll.size());
+ String dialogButtonLabels[] = new String[] { IDialogConstants.OK_LABEL,
+ IDialogConstants.CANCEL_LABEL };
int defaultIndex = 0;
if (coll.size() == 0) {
- dialogMessage = "Nothing to fix.";
- dialogButtonLabels = new String[]{"OK"};
- MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
+ dialogMessage = Messages.UpdateReferencesAction_NothingToFix;
+ dialogButtonLabels = new String[] { IDialogConstants.OK_LABEL };
+ MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle,
+ null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
dialog.open();
return;
}
- MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
+ MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null,
+ dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
if (dialog.open() != 0)
return;
Simantics.getSession().markUndoPoint();
fixDocumentReferences(coll);
} catch (DatabaseException e) {
- ExceptionUtils.logAndShowError("Cannot update references",e);
+ ExceptionUtils.logAndShowError(Messages.UpdateReferencesAction_CannotUpdateReferences, e);
}
-
-
+
}
};
}
--- /dev/null
+SearchLinksAction_CannotPerformSearch=Cannot perform search\r
+UpdateReferencesAction_CannotUpdateReferences=Cannot update references\r
+UpdateReferencesAction_FixOldReferences=Fix {0} old references?\r
+UpdateReferencesAction_FixReferences=Fix References\r
+UpdateReferencesAction_NothingToFix=Nothing to fix.\r
static {
columns = new ArrayList<SearchResultColumn>();
- columns.add(new SearchResultColumn("Name"));
- columns.add(new SearchResultColumn("Comment"));
- columns.add(new SearchResultColumn("Part Of"));
+ columns.add(new SearchResultColumn("Name")); //$NON-NLS-1$
+ columns.add(new SearchResultColumn("Comment")); //$NON-NLS-1$
+ columns.add(new SearchResultColumn("Part Of")); //$NON-NLS-1$
}
@Override
int type = 0;
public NameComparator(String query) {
- String parts[] = query.split(" OR ");
+ String parts[] = query.split(" OR "); //$NON-NLS-1$
for (String s : parts) {
- if (s.startsWith("Name:")) {
+ if (s.startsWith("Name:")) { //$NON-NLS-1$
name = s.substring(5);
}
}
name = name.trim();
boolean freeStart = false;
boolean freeEnd = false;
- if (name.endsWith("*")) {
+ if (name.endsWith("*")) { //$NON-NLS-1$
name = name.substring(0,name.length()-1);
freeEnd = true;
}
- if (name.startsWith("*")) {
+ if (name.startsWith("*")) { //$NON-NLS-1$
name = name.substring(1,name.length());
freeStart = true;
}
SearchResult result = new SearchResult(columns);
Set<Resource> processed = new HashSet<Resource>();
- NameComparator c = new NameComparator(query.getQuery("Name"));
+ NameComparator c = new NameComparator(query.getQuery("Name")); //$NON-NLS-1$
for (Resource source : results) {
// Prevent index corruption from producing duplicate results.
String relationName = NameUtils.getSafeLabel(graph, relation);
if (relationName.length() == 0)
relationName = NameUtils.getSafeName(graph, relation);
- parentName = parentName +"#"+relationName;
+ parentName = parentName +"#"+relationName; //$NON-NLS-1$
}
DocumentLinkRow rst = new DocumentLinkRow();
public String getContent(int column) {
switch (column) {
case 0:
- return "<a class=\"small\" href=\"resource:"+ resource.getResource() +"\"" + (resource.getUri() == null ? "" : " title=\""+resource.getUri()+"\">")+StringUtil.escape(resource.getName())+"</a>";
+ return "<a class=\"small\" href=\"resource:"+ resource.getResource() +"\"" + (resource.getUri() == null ? "" : " title=\""+resource.getUri()+"\">")+StringUtil.escape(resource.getName())+"</a>"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$ //$NON-NLS-6$
case 1:
if (comment != null)
return comment;
- return "";
+ return ""; //$NON-NLS-1$
case 2:
if (parent != null)
- return "<a class=\"small\" href=\"resource:"+ parent.getResource() +"\"" + (parent.getUri() == null ? "" : " title=\""+parent.getUri()+"\">")+StringUtil.escape(parent.getName())+"</a>";
- return "";
+ return "<a class=\"small\" href=\"resource:"+ parent.getResource() +"\"" + (parent.getUri() == null ? "" : " title=\""+parent.getUri()+"\">")+StringUtil.escape(parent.getName())+"</a>"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$ //$NON-NLS-6$
+ return ""; //$NON-NLS-1$
default:
- return "";
+ return ""; //$NON-NLS-1$
}
}
}
public class Constants {
- public static String NAME = "Name";
- public static String VALUE = "Value";
- public static String REFERENCE = "Reference";
- public static String COMMENT = "Comment";
+ public static String NAME = "Name"; //$NON-NLS-1$
+ public static String VALUE = "Value"; //$NON-NLS-1$
+ public static String REFERENCE = "Reference"; //$NON-NLS-1$
+ public static String COMMENT = "Comment"; //$NON-NLS-1$
public static String[] SOURCE_COLUMN_KEYS = {NAME,VALUE,REFERENCE,COMMENT};
public static Column[] SOURCE_COLUMNS = new Column[] {
- new Column(NAME,Align.LEFT,200,"Name",false),
- new Column(VALUE,Align.LEFT,100,"Value",false),
- new Column(REFERENCE,Align.LEFT,150,"Reference Document",false),
- new Column(COMMENT,Align.LEFT,200,"Comment",true)
+ new Column(NAME,Align.LEFT,200,Messages.Constants_Name,false),
+ new Column(VALUE,Align.LEFT,100,Messages.Constants_Value,false),
+ new Column(REFERENCE,Align.LEFT,150,Messages.Constants_ReferenceDocument,false),
+ new Column(COMMENT,Align.LEFT,200,Messages.Constants_Comment,true)
};
public static String[] SOURCE_OBJECT_COLUMN_KEYS = {NAME,REFERENCE,COMMENT};
public static Column[] SOURCE_OBJECT_COLUMNS = new Column[] {
- new Column(NAME,Align.LEFT,200,"Name",false),
- new Column(REFERENCE,Align.LEFT,150,"Reference Document",false),
- new Column(COMMENT,Align.LEFT,200,"Comment",true)
+ new Column(NAME,Align.LEFT,200,Messages.Constants_Name,false),
+ new Column(REFERENCE,Align.LEFT,150,Messages.Constants_RefernceDocument,false),
+ new Column(COMMENT,Align.LEFT,200,Messages.Constants_Comment,true)
};
}
import java.util.List;
import java.util.Stack;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.MessageDialog;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.widgets.Display;
import org.simantics.Simantics;
import org.simantics.db.ReadGraph;
public void run() {
System.out.println(target);
try {
- Pair<Collection<Resource>, Collection<Resource>> refs = Simantics.getSession().syncRequest(new FindFixable(target));
- String dialogTitle = "Fix References";
- String dialogMessage = "Fix " + refs.first.size() + " old references and " + refs.second.size() + " removed references?";
- String dialogButtonLabels[] = new String[]{"Ok","Cancel"};
+ Pair<Collection<Resource>, Collection<Resource>> refs = Simantics.getSession()
+ .syncRequest(new FindFixable(target));
+ String dialogTitle = Messages.FixAllReferencesAction_FixReferences;
+ String dialogMessage = NLS.bind(Messages.FixAllReferencesAction_FixOldReferences,
+ new Object[] { refs.first.size(), refs.second.size() });
+ String dialogButtonLabels[] = new String[] { IDialogConstants.OK_LABEL, IDialogConstants.CANCEL_LABEL };
int defaultIndex = 0;
if (refs.first.size() == 0 && refs.second.size() == 0) {
- dialogMessage = "Nothing to fix.";
- dialogButtonLabels = new String[]{"OK"};
- MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
+ dialogMessage = Messages.FixAllReferencesAction_NothingToFix;
+ dialogButtonLabels = new String[] { IDialogConstants.OK_LABEL };
+ MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle,
+ null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
dialog.open();
return;
}
- MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null, dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
+ MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), dialogTitle, null,
+ dialogMessage, MessageDialog.CONFIRM, dialogButtonLabels, defaultIndex);
if (dialog.open() != 0)
return;
Simantics.getSession().markUndoPoint();
Simantics.getSession().syncRequest(new FixAll(refs));
} catch (DatabaseException e) {
- ExceptionUtils.logAndShowError("Cannot fix references", e);
+ ExceptionUtils.logAndShowError(Messages.FixAllReferencesAction_CannotFixReferences, e);
}
}
};
--- /dev/null
+package org.simantics.document.linking.ge;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.ge.messages"; //$NON-NLS-1$
+ public static String Constants_Comment;
+ public static String Constants_Name;
+ public static String Constants_ReferenceDocument;
+ public static String Constants_RefernceDocument;
+ public static String Constants_Value;
+ public static String FixAllReferencesAction_CannotFixReferences;
+ public static String FixAllReferencesAction_FixOldReferences;
+ public static String FixAllReferencesAction_FixReferences;
+ public static String FixAllReferencesAction_NothingToFix;
+ public static String ShowDocumentAction_CannotOpenEditor;
+ public static String ShowDocumentWithAction_CannotOpenEditor;
+ public static String ShowDocumentWithAction_OpenWith;
+ public static String SourceObjectDropAction_CannotCreateDocumentLink;
+ public static String SourceObjectDropAction_DocumentLink;
+ public static String VariableLabelRule_DeletedReference;
+ public static String VariableLabelRule_LabelDefault;
+ public static String VariableLabelRule_NoValue;
+ public static String VariableLabelRule_ReferencesDoesNotExists;
+ public static String VariableLabelRule_ReferencesHasNotBeenSet;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
try {
adapter.openEditor(reference);
} catch (Exception e) {
- ExceptionUtils.logAndShowError("Cannot open editor", e);
+ ExceptionUtils.logAndShowError(Messages.ShowDocumentAction_CannotOpenEditor, e);
}
}
});
dialog.setContentProvider(new ArrayContentProvider());
dialog.setLabelProvider(new EditorAdapterLabelProvider());
dialog.setInput(adapters);
- dialog.setTitle("Open with");
+ dialog.setTitle(Messages.ShowDocumentWithAction_OpenWith);
if (dialog.open() != ListDialog.OK)
return;
EditorAdapter adapter = (EditorAdapter)dialog.getResult()[0];
adapter.openEditor(reference);
} catch (Exception e) {
- ExceptionUtils.logAndShowError("Cannot open editor", e);
+ ExceptionUtils.logAndShowError(Messages.ShowDocumentWithAction_CannotOpenEditor, e);
}
}
});
package org.simantics.document.linking.ge;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.MessageDialog;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.widgets.Display;
import org.simantics.Simantics;
import org.simantics.db.ReadGraph;
@Override
public void run() {
- String dialogMessage = "Cannot create document link to \"" + label +"\":" + e.getMessage();
- MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), "Document Link", null, dialogMessage, MessageDialog.INFORMATION, new String[]{"OK"}, 0);
+ String dialogMessage = NLS.bind(Messages.SourceObjectDropAction_CannotCreateDocumentLink , new Object[] { label , e.getMessage() });
+ MessageDialog dialog = new MessageDialog(Display.getCurrent().getActiveShell(), Messages.SourceObjectDropAction_DocumentLink, null, dialogMessage, MessageDialog.INFORMATION, new String[]{ IDialogConstants.OK_LABEL }, 0);
dialog.open();
}
});
import java.util.Map;
+import org.eclipse.osgi.util.NLS;
import org.simantics.browsing.ui.model.labels.LabelRule;
import org.simantics.databoard.Bindings;
import org.simantics.db.ReadGraph;
if (graph.isInstanceOf(node, sl.Source)) {
Resource reference = SourceLinkUtil.getReferredDocument(graph, node);
String comment = graph.getPossibleRelatedValue(node, sl.hasSourceComment);
- labels[0] = "";
- labels[1] = "";
- labels[3] = comment != null ? comment : "";
+ labels[0] = ""; //$NON-NLS-1$
+ labels[1] = ""; //$NON-NLS-1$
+ labels[3] = comment != null ? comment : ""; //$NON-NLS-1$
if (reference != null) {
if (SourceLinkUtil.isValidReference(graph, reference)) {
labels[2] = NameUtils.getSafeLabel(graph, reference);
} else {
- labels[2] = "Deleted reference";
+ labels[2] = Messages.VariableLabelRule_DeletedReference;
}
} else {
if (graph.getPossibleRelatedValue(node, sl.hasSourceReferenceURI, Bindings.STRING) != null) {
- labels[2] = "Reference does not exist";
+ labels[2] = Messages.VariableLabelRule_ReferencesDoesNotExists;
} else {
- labels[2] = "Reference has not been set";
+ labels[2] = Messages.VariableLabelRule_ReferencesHasNotBeenSet;
}
}
} else {
- labels[0] = "";
+ labels[0] = ""; //$NON-NLS-1$
}
if (graph.hasValue(node)) {
Object value = graph.getValue(node);
labels[1] = SourceLinkUtil.getValueString(value);
} else if (!graph.isInstanceOf(node, l0.SCLValue)){
- labels[1] = "No Value";
+ labels[1] = Messages.VariableLabelRule_NoValue;
} else {
- labels[1] = "";
+ labels[1] = ""; //$NON-NLS-1$
}
if (defaultValue) {
- labels[1] +=" (default)";
+ NLS.bind(Messages.VariableLabelRule_LabelDefault,labels[1] );
}
- labels[2] = "";
- labels[3] = "";
+ labels[2] = ""; //$NON-NLS-1$
+ labels[3] = ""; //$NON-NLS-1$
} else {
labels[0] = NameUtils.getSafeLabel(graph, node);//graph.getRelatedValue(node, l0.HasName);
if (labels[0].length() == 0)
labels[0] = NameUtils.getSafeName(graph, node);//graph.getRelatedValue(node, l0.HasName);
- labels[1] = "";
- labels[2] = "";
- labels[3] = "";
+ labels[1] = ""; //$NON-NLS-1$
+ labels[2] = ""; //$NON-NLS-1$
+ labels[3] = ""; //$NON-NLS-1$
}
--- /dev/null
+Constants_Comment=Comment\r
+Constants_Name=Name\r
+Constants_ReferenceDocument=Reference Document\r
+Constants_RefernceDocument=Reference Document\r
+Constants_Value=Value\r
+FixAllReferencesAction_CannotFixReferences=Cannot fix references\r
+FixAllReferencesAction_FixOldReferences=Fix {0} old references and \r
+FixAllReferencesAction_FixReferences=Fix References\r
+FixAllReferencesAction_NothingToFix=Nothing to fix.\r
+ShowDocumentAction_CannotOpenEditor=Cannot open editor\r
+ShowDocumentWithAction_CannotOpenEditor=Cannot open editor\r
+ShowDocumentWithAction_OpenWith=Open with\r
+SourceObjectDropAction_CannotCreateDocumentLink=Cannot create document link to "{0}":{1}\r
+SourceObjectDropAction_DocumentLink=Document Link\r
+VariableLabelRule_DeletedReference=Deleted reference\r
+VariableLabelRule_LabelDefault={0} (default)\r
+VariableLabelRule_NoValue=No Value\r
+VariableLabelRule_ReferencesDoesNotExists=Reference does not exist\r
+VariableLabelRule_ReferencesHasNotBeenSet=Reference has not been set\r
*/
public interface Document {
- public static String TOC = "toc";
+ public static String TOC = "toc"; //$NON-NLS-1$
public enum TextSize {TINY,SMALL,MEDIUM,LARGE,HUGE};
ReportWriter<?> reportWriter = (ReportWriter<?>)context.get(ReportWriter.class);
CustomizableContent content = null;
if (reportWriter instanceof CustomizableContentProvider) {
- content = ((CustomizableContentProvider)reportWriter).getContent("Title");
+ content = ((CustomizableContentProvider)reportWriter).getContent("Title"); //$NON-NLS-1$
}
if (content == null)
- writeTitle(getDefaultLines(graph, (Resource)context.get("model"), (String)context.get("DocumentName")));
+ writeTitle(getDefaultLines(graph, (Resource)context.get("model"), (String)context.get("DocumentName"))); //$NON-NLS-1$ //$NON-NLS-2$
else {
- List<DocumentLine> lines = content.getLines(graph, (Resource)context.get("model"), context);
+ List<DocumentLine> lines = content.getLines(graph, (Resource)context.get("model"), context); //$NON-NLS-1$
writeTitle(lines);
}
}
Document lineWriter = null;
try {
- if (filename.toLowerCase().endsWith(".pdf"))
- lineWriter = new PDFDocument(filename, new Font("Arial", Font.PLAIN, 10),new Font("Arial", Font.BOLD, 10));
- else if (filename.toLowerCase().endsWith(".html") ||
- filename.toLowerCase().endsWith(".htm"))
+ if (filename.toLowerCase().endsWith(".pdf")) //$NON-NLS-1$
+ lineWriter = new PDFDocument(filename, new Font("Arial", Font.PLAIN, 10),new Font("Arial", Font.BOLD, 10)); //$NON-NLS-1$ //$NON-NLS-2$
+ else if (filename.toLowerCase().endsWith(".html") || //$NON-NLS-1$
+ filename.toLowerCase().endsWith(".htm")) //$NON-NLS-1$
lineWriter = new HTMLDocument(new File(filename));
else {
- throw new Exception("File has unknow extension " + filename);
+ throw new Exception("File has unknow extension " + filename); //$NON-NLS-1$
}
export(lineWriter, reportWriter, monitor);
} catch (Exception e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Could not generate report", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.ExportToPDF_ActivatorCouldNotGenerateReport, e);
} finally {
if (lineWriter != null) {
try {
}
}
- String status = "Report generated.";
+ String status = Messages.ExportToPDF_ReportGenerated;
// if (lineWriter instanceof PDFTableWriter) {
// status += " Report size " + ((PDFTableWriter)lineWriter).getCurrentPageIndex() + " pages.";
// }
try {
Map<Object, Object> context = new HashMap<Object, Object>();
- context.put("model", model);
+ context.put("model", model); //$NON-NLS-1$
context.put(Document.class, document);
context.put(ReportWriter.class, reportWriter);
- context.put("DocumentName", reportWriter.getName());
+ context.put("DocumentName", reportWriter.getName()); //$NON-NLS-1$
reportWriter.start(graph, model, document, context);
List<T> list = reportWriter.getReportItems(graph);
- monitor.beginTask("Write Report", list.size());
+ monitor.beginTask(Messages.ExportToPDF_MonitorWriteReport, list.size());
T previous = null;
T current = null;
--- /dev/null
+package org.simantics.document.linking.report;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.report.messages"; //$NON-NLS-1$
+ public static String ExportToPDF_ActivatorCouldNotGenerateReport;
+ public static String ExportToPDF_MonitorWriteReport;
+ public static String ExportToPDF_ReportGenerated;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
@Override
public ImageDescriptor getImage() {
if (alignment == Alignment.LEFT) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_left.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_left.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else if (alignment == Alignment.CENTER) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_center.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_center.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_right.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_align_right.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
public And() {
- separator = " ";
+ separator = " "; //$NON-NLS-1$
}
public And(String separator) {
@Override
public String getValue(ReadGraph graph, Variable variable, Map<Object, Object> context) throws DatabaseException {
- String s = "";
+ String s = ""; //$NON-NLS-1$
for (int i = 0 ; i < children.size(); i++) {
String s2 = children.get(i).getValue(graph, variable, context);
if (s2 != null) {
@Override
public String toString() {
- return "and " + "(" + separator +")" ;
+ return "and " + "(" + separator +")" ; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
@RelatedGetValue(DocumentLink.URIs.EvaluatorTree_HasValue)
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_columns.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_columns.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
public Constant() {
- string = "text";
+ string = "text"; //$NON-NLS-1$
}
public Constant(String text) {
if (text == null)
- throw new NullPointerException("Text is null");
+ throw new NullPointerException("Text is null"); //$NON-NLS-1$
string = text;
}
@Override
public String toString() {
- return "\"" + string + "\"";
+ return "\"" + string + "\""; //$NON-NLS-1$ //$NON-NLS-2$
}
@RelatedGetValue(DocumentLink.URIs.EvaluatorTree_HasValue)
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/textfield.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/textfield.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
public static List<NamedResource> getTemplates(final Resource library) throws DatabaseException{
if (library == null)
- throw new IllegalArgumentException("Library cannot be null");
+ throw new IllegalArgumentException("Library cannot be null"); //$NON-NLS-1$
List<NamedResource> templates = Simantics.getSession().syncRequest(new Read<List<NamedResource>>() {
@Override
public List<NamedResource> perform(ReadGraph graph) throws DatabaseException{
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/date.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/date.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
@Override
public String toString() {
- return "root";
+ return "root"; //$NON-NLS-1$
}
@Override
@Override
public String getValue(ReadGraph graph, Variable variable, Map<Object, Object> context) throws DatabaseException {
if (children.size() > 3)
- throw new DatabaseException("If node has more than 3 children.");
+ throw new DatabaseException("If node has more than 3 children."); //$NON-NLS-1$
String ifVal = children.get(0).getValue(graph, variable, context);
if (ifVal != null && ifVal.length() > 0 && !Boolean.FALSE.toString().equals(ifVal)) {
@Override
public List<DocumentLine> getLines(ReadGraph graph, Variable variable, Map<Object, Object> context) throws DatabaseException {
if (children.size() > 3)
- throw new DatabaseException("If node has more than 3 children.");
+ throw new DatabaseException("If node has more than 3 children."); //$NON-NLS-1$
String ifVal = children.get(0).getValue(graph, variable, context);
if (ifVal != null && ifVal.length() > 0 && !Boolean.FALSE.toString().equals(ifVal)) {
return children.get(1).getLines(graph, variable, context);
@Override
public String toString() {
- return "if";
+ return "if"; //$NON-NLS-1$
}
@Override
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/help.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/help.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
@Override
@Override
public String getValue(ReadGraph graph, Variable variable, Map<Object, Object> context) throws DatabaseException {
- String s = "";
+ String s = ""; //$NON-NLS-1$
for (int i = 0 ; i < children.size(); i++) {
String s2 = children.get(i).getValue(graph, variable, context);
if (s2 != null) {
s+= s2;
if (i < children.size()-1)
- s+=System.getProperty("line.separator");
+ s+=System.getProperty("line.separator"); //$NON-NLS-1$
}
}
if (s.length() == 0)
@Override
public String toString() {
- return "Lines" ;
+ return "Lines" ; //$NON-NLS-1$
}
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_linespacing.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_linespacing.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
@Override
public String toString() {
- return "or";
+ return "or"; //$NON-NLS-1$
}
@Override
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_list_numbers.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_list_numbers.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
String separator;
public Path() {
- separator = "/";
+ separator = "/"; //$NON-NLS-1$
}
public Path(String separator) {
@Override
public String toString() {
- return "path " + "(" + separator +")" ;
+ return "path " + "(" + separator +")" ; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
@Override
@Override
public String getValue(ReadGraph graph, Variable variable,
Map<Object, Object> context) throws DatabaseException {
- Resource model = (Resource)context.get("model");
- String text = "";
+ Resource model = (Resource)context.get("model"); //$NON-NLS-1$
+ String text = ""; //$NON-NLS-1$
Variable parent = variable.getParent(graph);
while (parent != null) {
text = children.get(0).getValue(graph, parent, context) + separator + text;
public List<DocumentLine> getLines(ReadGraph graph, Variable variable,
Map<Object, Object> context) throws DatabaseException {
List<DocumentLine> result = new ArrayList<DocumentLine>();
- Resource model = (Resource)context.get("model");
+ Resource model = (Resource)context.get("model"); //$NON-NLS-1$
for (int i = 0 ; i < children.size(); i++) {
Variable parent = variable.getParent(graph);
while (parent != null) {
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/folder.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/folder.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
@Override
*
*/
public class PredefinedVariables {
- public static final String root = "root";
- public static final String project = "project";
- public static final String model = "model";
- public static final String template = "template";
- public static final String current = ".";
+ public static final String root = "root"; //$NON-NLS-1$
+ public static final String project = "project"; //$NON-NLS-1$
+ public static final String model = "model"; //$NON-NLS-1$
+ public static final String template = "template"; //$NON-NLS-1$
+ public static final String current = "."; //$NON-NLS-1$
private static PredefinedVariables factory = new PredefinedVariables();
if (colonInx != -1 && firstFlashInx != -1 && colonInx+1 == firstFlashInx && path.length() > firstFlashInx+1){
String scheme = path.substring(0, colonInx);
String absPath = path.substring(firstFlashInx+1);
- if (scheme.equals("pre")){
+ if (scheme.equals("pre")){ //$NON-NLS-1$
int endOfPredefined1 = absPath.indexOf('/');
int endOfPredefined2 = absPath.indexOf('#');
if (endOfPredefined1 == -1 && endOfPredefined2 == -1)
Variable property = null;
if (relativePath != null){
- if (relativePath.startsWith("/."))
+ if (relativePath.startsWith("/.")) //$NON-NLS-1$
relativePath = relativePath.substring(1);
property = v.browsePossible(graph, relativePath);
}
@Override
public ImageDescriptor getImage() {
if (textSize == TextSize.TINY) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_5.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_5.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else if (textSize == TextSize.SMALL) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_4.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_4.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else if (textSize == TextSize.MEDIUM) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_3.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_3.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else if (textSize == TextSize.LARGE) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_2.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_2.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else if (textSize == TextSize.HUGE) {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_1.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/text_heading_1.png"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
return null;
}
@GraphType(DocumentLink.URIs.EvaluatorTree_Variable)
public class Variable extends EvaluatorLeaf implements StringEditableNode{
- String variableRef = "#HasName";
+ String variableRef = "#HasName"; //$NON-NLS-1$
public Variable() {
@Override
public String setValue(String value) {
if (value.length() == 0)
- return "Variable reference cannot be empty";
+ return "Variable reference cannot be empty"; //$NON-NLS-1$
variableRef = value;
return null;
}
@Override
public ImageDescriptor getImage() {
- return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/database_go.png");
+ return Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/database_go.png"); //$NON-NLS-1$ //$NON-NLS-2$
}
index = index + 1;
uniqueIndex.put(cls,index);
- return cls.getSimpleName() +"_"+index;
+ return cls.getSimpleName() +"_"+index; //$NON-NLS-1$
}
String getUniqueId(HTMLElement element) {
Class<? extends HTMLElement> cls = element.getClass();
private static String getDataUrl() throws IOException {
Bundle b = Platform.getBundle(Activator.PLUGIN_ID);
- URL dataUrl = FileLocator.find(b, new Path("report"), null);
+ URL dataUrl = FileLocator.find(b, new Path("report"), null); //$NON-NLS-1$
URL fileUrl = FileLocator.toFileURL(dataUrl);
- return URLDecoder.decode(fileUrl.getPath(), "UTF-8");
+ return URLDecoder.decode(fileUrl.getPath(), "UTF-8"); //$NON-NLS-1$
}
private void copyBaseCSS(String cssUrl) throws Exception {
- File f = new File(URLDecoder.decode(cssUrl, "UTF-8")).getAbsoluteFile();
+ File f = new File(URLDecoder.decode(cssUrl, "UTF-8")).getAbsoluteFile(); //$NON-NLS-1$
copyData(f, os);
}
private void header() throws Exception {
PrintStream resultOs = os;
- String cssUrl = getDataUrl() +"/report.css";
- resultOs.println("<!DOCTYPE html>");
- resultOs.println("<html lang=\"en\">");
- resultOs.println("<head>");
- resultOs.println(" <meta charset=\"utf-8\">");
- resultOs.println(" <title>Report</title>");
+ String cssUrl = getDataUrl() +"/report.css"; //$NON-NLS-1$
+ resultOs.println("<!DOCTYPE html>"); //$NON-NLS-1$
+ resultOs.println("<html lang=\"en\">"); //$NON-NLS-1$
+ resultOs.println("<head>"); //$NON-NLS-1$
+ resultOs.println(" <meta charset=\"utf-8\">"); //$NON-NLS-1$
+ resultOs.println(" <title>Report</title>"); //$NON-NLS-1$
if (referCSS)
- resultOs.println(" <link rel=\"stylesheet\" href=\"" + cssUrl + "\" type=\"text/css\">");
- resultOs.println(" <style>");
+ resultOs.println(" <link rel=\"stylesheet\" href=\"" + cssUrl + "\" type=\"text/css\">"); //$NON-NLS-1$ //$NON-NLS-2$
+ resultOs.println(" <style>"); //$NON-NLS-1$
if (!referCSS) {
copyBaseCSS(cssUrl);
}
- resultOs.println(" </style>");
- resultOs.println("</head>");
- resultOs.println("<body>");
+ resultOs.println(" </style>"); //$NON-NLS-1$
+ resultOs.println("</head>"); //$NON-NLS-1$
+ resultOs.println("<body>"); //$NON-NLS-1$
}
private void footer() throws Exception{
toc.close();
content.close();
PrintStream resultOs = os;
- resultOs.println("</body>");
- resultOs.println("</html>");
+ resultOs.println("</body>"); //$NON-NLS-1$
+ resultOs.println("</html>"); //$NON-NLS-1$
}
@Override
return (T)getOrCreateToc();
} else if (cls == DocumentTitlePage.class) {
if (titlePage != null)
- throw new Exception("Document many have only one title page");
+ throw new Exception("Document many have only one title page"); //$NON-NLS-1$
titlePage = new HTMLTitlePage(this);
return (T)titlePage;
}
public HTMLStreamElement(File file) throws Exception{
parent = null;
this.file = file;
- os = new PrintStream(file,"UTF-8");
+ os = new PrintStream(file,"UTF-8"); //$NON-NLS-1$
}
public HTMLStreamElement(HTMLStreamElement parent) throws Exception{
}
private void openStream() throws IOException {
- file = File.createTempFile("report_content", ".html");
- os = new PrintStream(file,"UTF-8");
+ file = File.createTempFile("report_content", ".html"); //$NON-NLS-1$ //$NON-NLS-2$
+ os = new PrintStream(file,"UTF-8"); //$NON-NLS-1$
}
public TableRow writeRowRaw(List<String> line) throws Exception {
if (currentLine == 0)
startTable();
- String clz = "\"";
- clz += currentLine % 2 == 0 ? "even" : "odd";
- clz += " "+currentTextSize;
- clz += "\"";
- os.println(" <tr class=" + clz+ ">");
+ String clz = "\""; //$NON-NLS-1$
+ clz += currentLine % 2 == 0 ? "even" : "odd"; //$NON-NLS-1$ //$NON-NLS-2$
+ clz += " "+currentTextSize; //$NON-NLS-1$
+ clz += "\""; //$NON-NLS-1$
+ os.println(" <tr class=" + clz+ ">"); //$NON-NLS-1$ //$NON-NLS-2$
if (line.size() > 1) {
for (int i = 0; i < line.size(); i++) {
String s = line.get(i);
Alignment a = columns.get(i).getAlignment();
- String tdClass = "class=\"" +a.toString()+"\"";
+ String tdClass = "class=\"" +a.toString()+"\""; //$NON-NLS-1$ //$NON-NLS-2$
if (s != null)
- os.println(" <td "+tdClass+">" + s + "</td>");
+ os.println(" <td "+tdClass+">" + s + "</td>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
else
- os.println(" <td> </td>");
+ os.println(" <td> </td>"); //$NON-NLS-1$
}
} else if (line.size() == 1){
String s = line.get(0);
Alignment a = columns.get(0).getAlignment();
- String tdClass = "class=\"" +a.toString()+"\"";
+ String tdClass = "class=\"" +a.toString()+"\""; //$NON-NLS-1$ //$NON-NLS-2$
if (s != null)
- os.println(" <td "+tdClass + " colspan=\"" + columns.size()+"\">" + s + "</td>");
+ os.println(" <td "+tdClass + " colspan=\"" + columns.size()+"\">" + s + "</td>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
else
- os.println(" <td colspan=\"" + columns.size()+"\"> </td>");
+ os.println(" <td colspan=\"" + columns.size()+"\"> </td>"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
- os.println(" <td colspan=\"" + columns.size()+"\"> </td>");
+ os.println(" <td colspan=\"" + columns.size()+"\"> </td>"); //$NON-NLS-1$ //$NON-NLS-2$
}
- os.println(" </tr>");
+ os.println(" </tr>"); //$NON-NLS-1$
currentLine++;
writer.currentLine++;
return new HTMLTableRow(null);
public TableRow writeRowRaw2(List<TextItem> line) throws Exception {
if (currentLine == 0)
startTable();
- String clz = "\"";
- clz += currentLine % 2 == 0 ? "even" : "odd";
- clz += " "+currentTextSize;
- clz += "\"";
- os.println(" <tr class=" + clz+ ">");
+ String clz = "\""; //$NON-NLS-1$
+ clz += currentLine % 2 == 0 ? "even" : "odd"; //$NON-NLS-1$ //$NON-NLS-2$
+ clz += " "+currentTextSize; //$NON-NLS-1$
+ clz += "\""; //$NON-NLS-1$
+ os.println(" <tr class=" + clz+ ">"); //$NON-NLS-1$ //$NON-NLS-2$
if (line.size() > 1) {
for (int i = 0; i < line.size(); i++) {
TextItem item = line.get(i);
Alignment a = columns.get(i).getAlignment();
- String tdClass = "class=\"" +a.toString()+"\"";
+ String tdClass = "class=\"" +a.toString()+"\""; //$NON-NLS-1$ //$NON-NLS-2$
if (item != null && item.getText() != null)
- os.println(" <td "+tdClass+">" + item.toString() + "</td>");
+ os.println(" <td "+tdClass+">" + item.toString() + "</td>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
else
- os.println(" <td> </td>");
+ os.println(" <td> </td>"); //$NON-NLS-1$
}
} else if (line.size() == 1){
String s = line.get(0).toString();
Alignment a = columns.get(0).getAlignment();
- String tdClass = "class=\"" +a.toString()+"\"";
+ String tdClass = "class=\"" +a.toString()+"\""; //$NON-NLS-1$ //$NON-NLS-2$
if (s != null)
- os.println(" <td "+tdClass + " colspan=\"" + columns.size()+"\">" + s + "</td>");
+ os.println(" <td "+tdClass + " colspan=\"" + columns.size()+"\">" + s + "</td>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
else
- os.println(" <td colspan=\"" + columns.size()+"\"> </td>");
+ os.println(" <td colspan=\"" + columns.size()+"\"> </td>"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
- os.println(" <td colspan=\"" + columns.size()+"\"> </td>");
+ os.println(" <td colspan=\"" + columns.size()+"\"> </td>"); //$NON-NLS-1$ //$NON-NLS-2$
}
- os.println(" </tr>");
+ os.println(" </tr>"); //$NON-NLS-1$
currentLine++;
writer.currentLine++;
return new HTMLTableRow(null);
void style() {
for (int i = 0; i < columns.size(); i++) {
- os.println("table."+classID+" th.column"+i+" {");
- os.println(" width: " + ((int)(columns.get(i).getWidth()*100.0)) + "%;");
- os.println("}");
+ os.println("table."+classID+" th.column"+i+" {"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
+ os.println(" width: " + ((int)(columns.get(i).getWidth()*100.0)) + "%;"); //$NON-NLS-1$ //$NON-NLS-2$
+ os.println("}"); //$NON-NLS-1$
}
}
void startTable() {
if (id != null) {
- os.println("<a id=\"" + id + "\"></a>");
+ os.println("<a id=\"" + id + "\"></a>"); //$NON-NLS-1$ //$NON-NLS-2$
}
- String clz = classID + " " + (linesVisible ? "lines" : "nolines");
- os.println("<table class=\"" + clz +"\" >");
+ String clz = classID + " " + (linesVisible ? "lines" : "nolines"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
+ os.println("<table class=\"" + clz +"\" >"); //$NON-NLS-1$ //$NON-NLS-2$
if (headerVisible) {
if (title != null)
- os.println(" <caption>"+title+"</caption>");
- os.println(" <thead>");
- os.println(" <tr class=MEDIUM>");
+ os.println(" <caption>"+title+"</caption>"); //$NON-NLS-1$ //$NON-NLS-2$
+ os.println(" <thead>"); //$NON-NLS-1$
+ os.println(" <tr class=MEDIUM>"); //$NON-NLS-1$
int ci = 0;
for (TableColumn c : columns) {
- os.println(" <th class=\"column" + ci +"\">" + escape(c.getName()) + "</th>");
+ os.println(" <th class=\"column" + ci +"\">" + escape(c.getName()) + "</th>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
ci++;
}
- os.println(" </tr>");
- os.println(" </thead>");
+ os.println(" </tr>"); //$NON-NLS-1$
+ os.println(" </thead>"); //$NON-NLS-1$
}
- os.println(" <tbody>");
+ os.println(" <tbody>"); //$NON-NLS-1$
}
void endTable() throws Exception{
if (currentLine > 0) {
- os.println(" </tbody>");
- os.println("</table>");
- os.println("<br>");
+ os.println(" </tbody>"); //$NON-NLS-1$
+ os.println("</table>"); //$NON-NLS-1$
+ os.println("<br>"); //$NON-NLS-1$
if (!copyStyle) {
- os.println("<style>");
+ os.println("<style>"); //$NON-NLS-1$
style();
- os.println("</style>");
+ os.println("</style>"); //$NON-NLS-1$
}
}
}
public void writeTitle(List<DocumentLine> lines) throws Exception {
writer.nextPage();
for (DocumentLine line : lines) {
- String hTag = "h4";
+ String hTag = "h4"; //$NON-NLS-1$
if (line.getHints().containsKey(TextSize.class)) {
TextSize size = (TextSize)line.getHints().get(TextSize.class);
switch (size) {
case HUGE:
- hTag = "h1";
+ hTag = "h1"; //$NON-NLS-1$
break;
case LARGE:
- hTag = "h2";
+ hTag = "h2"; //$NON-NLS-1$
break;
case MEDIUM:
- hTag = "h3";
+ hTag = "h3"; //$NON-NLS-1$
break;
case SMALL:
- hTag = "h4";
+ hTag = "h4"; //$NON-NLS-1$
break;
case TINY:
- hTag = "h5";
+ hTag = "h5"; //$NON-NLS-1$
break;
default:
break;
}
}
- writer.os.println("<"+hTag +">" + line.getLine() + "</"+hTag+">");
+ writer.os.println("<"+hTag +">" + line.getLine() + "</"+hTag+">"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
}
writer.nextPage();
public HTMLTocElement(HTMLDocument writer) throws Exception{
super(writer);
- this.os.println("<h2>Table of Contents</h2>");
+ this.os.println(Messages.HTMLTocElement_TocHeading);
tocTable = new HTMLTable(writer, os, false);
tocTable.setHeaderVisible(false);
tocTable.setLinesVisible(false);
- tocTable.addColumn("Name", 1.0);
+ tocTable.addColumn("Name", 1.0); //$NON-NLS-1$
}
@Override
public void addTocElement(String label, DocumentElement element) throws Exception{
HTMLElement e = (HTMLElement)element;
if (e.getId() == null)
- throw new IllegalArgumentException("Element has no id " + element);
+ throw new IllegalArgumentException("Element has no id " + element); //$NON-NLS-1$
//os.println("<a href=\"#" + e.getId() + "\">" + label + "</a><br>");
- tocTable.writeRow("<a href=\"#" + e.getId() + "\">" + label + "</a><br>");
+ tocTable.writeRow("<a href=\"#" + e.getId() + "\">" + label + "</a><br>"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
public void close() throws Exception{
tocTable.endTable();
- os.print("<br>");
+ os.print("<br>"); //$NON-NLS-1$
super.close();
}
@Override
public String getId() {
- return "toc";
+ return "toc"; //$NON-NLS-1$
}
}
@Override
public String toString() {
if (getURL() != null)
- return "<a href=\"" + getURL().toString() + "\">" + getText() + "</a>";
+ return "<a href=\"" + getURL().toString() + "\">" + getText() + "</a>"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
return super.toString();
}
--- /dev/null
+package org.simantics.document.linking.report.html;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.report.html.messages"; //$NON-NLS-1$
+ public static String HTMLTocElement_TocHeading;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+HTMLTocElement_TocHeading=<h2>Table of Contents</h2>
--- /dev/null
+ExportToPDF_ActivatorCouldNotGenerateReport=Could not generate report\r
+ExportToPDF_MonitorWriteReport=Write Report\r
+ExportToPDF_ReportGenerated=Report generated.\r
--- /dev/null
+package org.simantics.document.linking.report.pdf;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.report.pdf.messages"; //$NON-NLS-1$
+ public static String PDFTocElement_TocHeading;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
}
private void defaultFonts() {
- fonts.put(TextSize.TINY, new Font("Arial", Font.PLAIN, 6));
- fonts.put(TextSize.SMALL, new Font("Arial", Font.PLAIN, 8));
- fonts.put(TextSize.MEDIUM, new Font("Arial", Font.PLAIN, 10));
- fonts.put(TextSize.LARGE, new Font("Arial", Font.PLAIN, 16));
- fonts.put(TextSize.HUGE, new Font("Arial", Font.BOLD, 24));
+ fonts.put(TextSize.TINY, new Font("Arial", Font.PLAIN, 6)); //$NON-NLS-1$
+ fonts.put(TextSize.SMALL, new Font("Arial", Font.PLAIN, 8)); //$NON-NLS-1$
+ fonts.put(TextSize.MEDIUM, new Font("Arial", Font.PLAIN, 10)); //$NON-NLS-1$
+ fonts.put(TextSize.LARGE, new Font("Arial", Font.PLAIN, 16)); //$NON-NLS-1$
+ fonts.put(TextSize.HUGE, new Font("Arial", Font.BOLD, 24)); //$NON-NLS-1$
contentStream.setDefaultFont(fonts.get(TextSize.SMALL));
}
return (T)getOrCreateToc();
} else if (cls == DocumentTitlePage.class) {
if (titlePage != null)
- throw new Exception("Report may contain only one title page");
+ throw new Exception("Report may contain only one title page"); //$NON-NLS-1$
titlePage = new PDFTitlePage(this);
return (T)titlePage;
}
if (currentTable != null && currentTable.currentLine > 0) {
currentTable.setLinesVisible(false);
currentTable.setHeaderVisible(false);
- currentTable.writeLine("");
+ currentTable.writeLine(""); //$NON-NLS-1$
}
}
this.stream = stream;
Rectangle pageSize = stream.getPageSize();
document = new Document(pageSize);
- tempFile = File.createTempFile("ReportGenerator", ".pdf");
+ tempFile = File.createTempFile("ReportGenerator", ".pdf"); //$NON-NLS-1$ //$NON-NLS-2$
writer = PdfWriter.getInstance(document, new FileOutputStream(tempFile));
document.open();
this.cb = writer.getDirectContent();
// Find possible line break and set it as a limit to the next layout
next = lineMeasurer.nextOffset(cellWidth);
limit = next;
- charat = text.indexOf(System.getProperty("line.separator"),position+1);
+ charat = text.indexOf(System.getProperty("line.separator"),position+1); //$NON-NLS-1$
if(charat < next && charat != -1){
limit = charat;
}
document.nextPage();
this.page = document.contentStream.getCurrentPage();
Table table = document.newElement(Table.class);
- table.addColumn("Names", 1.0).setAlignment(alignment);
+ table.addColumn("Names", 1.0).setAlignment(alignment); //$NON-NLS-1$
table.setLinesVisible(false);
table.setHeaderVisible(false);
table.setTextSize(textSize);
int lines = (document.contentStream.getAvailableLines()-3)/2;
for (int i = 0; i < lines; i++)
- table.writeRow("");
+ table.writeRow(""); //$NON-NLS-1$
for (DocumentLine line : titleLines) {
TextSize s = (TextSize)line.getHints().get(TextSize.class);
if (s != null)
//linesPerPage = stream.getAvailableLines();
PDFPage page = stream.getCurrentPage();
page.setFont(titleFont);
- page.writeLine("Table of Contents");
+ page.writeLine(Messages.PDFTocElement_TocHeading);
page.setFont(itemFont);
- page.writeLine("");
+ page.writeLine(""); //$NON-NLS-1$
linesOnFirstPage = tocTable.getAvailableLines();
//linesOnFirstPage = page.availableLines;
}
List<PDFPage> pages = destStream.getPages();
int tocIndex = pages.indexOf(after)+1;
- tocTable.addColumn("Document", 0.9);
- tocTable.addColumn("Page", 0.1).setAlignment(Alignment.RIGHT);
+ tocTable.addColumn("Document", 0.9); //$NON-NLS-1$
+ tocTable.addColumn("Page", 0.1).setAlignment(Alignment.RIGHT); //$NON-NLS-1$
tocTable.setHeaderVisible(false);
tocTable.setLinesVisible(false);
for (Pair<String, PDFElement> item : toc) {
--- /dev/null
+PDFTocElement_TocHeading=Table of Contents
@Override
public String getName() {
- return "Complete Structure";
+ return "Complete Structure"; //$NON-NLS-1$
}
@Override
writer.newElement(TableOfContents.class);
Table table = writer.newElement(Table.class,Document.TOC);
- table.addColumn("Name", 0.2);
- table.addColumn("Attribute", 0.2);
- table.addColumn("Value", 0.15);
- table.addColumn("Document", 0.2);
- table.addColumn("Comment", 0.25);
+ table.addColumn("Name", 0.2); //$NON-NLS-1$
+ table.addColumn("Attribute", 0.2); //$NON-NLS-1$
+ table.addColumn("Value", 0.15); //$NON-NLS-1$
+ table.addColumn("Document", 0.2); //$NON-NLS-1$
+ table.addColumn("Comment", 0.25); //$NON-NLS-1$
//lineWriter.nextPage();
}
if (obj != null) {
- String text = "";
+ String text = ""; //$NON-NLS-1$
List<Resource> path = SourceLinkUtil.getDiagramPath(graph, model, obj);
if (path == null) {
Resource r = path.get(i);
text += parentComparator.getText(r);
if (i < path.size()-2)
- text += "/";
+ text += "/"; //$NON-NLS-1$
}
} else {
for (int i = 0 ; i < path.size(); i++) {
Resource r = path.get(i);
text += parentComparator.getText(r);
if (i < path.size()-1)
- text += "/";
+ text += "/"; //$NON-NLS-1$
}
}
//row[0] = text;
toc.addTocElement(text, table);
} else {
//row[0] = "Hierarchy missing";
- table.setTitle("Hierarchy missing");
+ table.setTitle("Hierarchy missing"); //$NON-NLS-1$
}
}
}
text[2].setText(SourceLinkUtil.getValueString(value));
}
} else {
- text[1].setText("Error in property reference");
+ text[1].setText(Messages.CompleteStructureWriter_ErrorInPropertyRefrence);
}
}
Resource document = SourceLinkUtil.getReferredDocument(graph, source);
@Override
public String getName() {
- return "Diagram structure with dependencies";
+ return "Diagram structure with dependencies"; //$NON-NLS-1$
}
@Override
@Override
public String getName() {
- return "Diagram structure";
+ return "Diagram structure"; //$NON-NLS-1$
}
@Override
titlePage.writeTitle(graph, context);
Table table = lineWriter.newElement(Table.class);
- table.addColumn("Name", 0.4);
- table.addColumn("Document", 0.6);
+ table.addColumn("Name", 0.4); //$NON-NLS-1$
+ table.addColumn("Document", 0.6); //$NON-NLS-1$
//lineWriter.nextPage();
List<Resource> path = SourceLinkUtil.getDiagramPath(graph, model, obj);
if (writer.getAvailableLines() < 2)
writer.nextPage();
- String text = "";
+ String text = ""; //$NON-NLS-1$
for (int i = 0 ; i < path.size(); i++) {
Resource r = path.get(i);
text += diagramComparator.getText(r);
if (i < path.size()-1)
- text += "/";
+ text += "/"; //$NON-NLS-1$
}
row[0].setText(text);
} else {
- row[0].setText("Hierarchy missing");
+ row[0].setText(Messages.DiagramStructureWriter_Hierarchymissing);
}
}
@Override
public String getName() {
- return "Document Structure";
+ return "Document Structure"; //$NON-NLS-1$
}
@Override
titlePage.writeTitle(graph, context);
writer.newElement(TableOfContents.class);
Table table = writer.newElement(Table.class,Document.TOC);
- table.addColumn("Name", 0.2);
- table.addColumn("Attribute", 0.35);
- table.addColumn("Value", 0.15);
- table.addColumn("Comment", 0.3);
+ table.addColumn("Name", 0.2); //$NON-NLS-1$
+ table.addColumn("Attribute", 0.35); //$NON-NLS-1$
+ table.addColumn("Value", 0.15); //$NON-NLS-1$
+ table.addColumn("Comment", 0.3); //$NON-NLS-1$
//lineWriter.nextPage();
this.graph = graph;
if (path != null) {
TextSize size = table.getTextSize();
table.setTextSize(TextSize.MEDIUM);
- table.writeRow(" " + diagramComparator.getText(path.get(path.size()-1)));
+ table.writeRow(" " + diagramComparator.getText(path.get(path.size()-1))); //$NON-NLS-1$
table.setTextSize(size);
}
}
text[2].setText(SourceLinkUtil.getValueString(value));
}
} else {
- text[1].setText("Error in property reference ");
+ text[1].setText(Messages.DocumentStructureWriter_ErrorInPropertyReference);
}
}
@Override
public void setDefaultContent(String id) {
- if ("Document".equals(id) || id == null) {
- EvaluatorCustomizableContent c = new EvaluatorCustomizableContent("Document format");
+ if ("Document".equals(id) || id == null) { //$NON-NLS-1$
+ EvaluatorCustomizableContent c = new EvaluatorCustomizableContent("Document format"); //$NON-NLS-1$
Or item = new Or();
- item.addChild(new Variable("#HasLabel"));
- item.addChild(new Variable("#HasName"));
+ item.addChild(new Variable("#HasLabel")); //$NON-NLS-1$
+ item.addChild(new Variable("#HasName")); //$NON-NLS-1$
c.setItem(item);
c.setSupportStyles(false);
c.setSupportMultiline(true);
- content.put("Document", c);
+ content.put("Document", c); //$NON-NLS-1$
}
- if ("Title".equals(id) || id == null) {
- EvaluatorCustomizableContent e = new EvaluatorCustomizableContent("Document Title");
+ if ("Title".equals(id) || id == null) { //$NON-NLS-1$
+ EvaluatorCustomizableContent e = new EvaluatorCustomizableContent("Document Title"); //$NON-NLS-1$
EvaluatorNode lines = new Lines();
Or nameOr = new Or();
- nameOr.createChild(Variable.class).setVariableRef("#HasLabel");
- nameOr.createChild(Variable.class).setVariableRef("#HasName");
+ nameOr.createChild(Variable.class).setVariableRef("#HasLabel"); //$NON-NLS-1$
+ nameOr.createChild(Variable.class).setVariableRef("#HasName"); //$NON-NLS-1$
lines.createChild(TextSizeHint.class).setTextSize(TextSize.HUGE).createChild(AlignmentHint.class).setAlignment(Alignment.CENTER).addChild(nameOr.copy());
- lines.createChild(TextSizeHint.class).setTextSize(TextSize.HUGE).createChild(AlignmentHint.class).setAlignment(Alignment.CENTER).createChild(Variable.class).setVariableRef("DocumentName");
+ lines.createChild(TextSizeHint.class).setTextSize(TextSize.HUGE).createChild(AlignmentHint.class).setAlignment(Alignment.CENTER).createChild(Variable.class).setVariableRef("DocumentName"); //$NON-NLS-1$
lines.createChild(TextSizeHint.class).setTextSize(TextSize.LARGE).createChild(AlignmentHint.class).setAlignment(Alignment.CENTER).createChild(Date.class);
e.setItem(lines);
e.setSupportStyles(true);
e.setSupportMultiline(true);
- content.put("Title", e);
+ content.put("Title", e); //$NON-NLS-1$
}
}
} else {
item = this.document.newItem(TextItem.class);
}
- item.setText(getContent("Document").getContent(graph, document,context));
+ item.setText(getContent("Document").getContent(graph, document,context)); //$NON-NLS-1$
return item;
}
protected TextItem getNonExistingDocumentItem() throws Exception{
TextItem item = this.document.newItem(TextItem.class);
- item.setText("[DOCUMENT DOES NOT EXIST]");
+ item.setText(Messages.DocumentWriter_DocumentDoesNotExist);
return item;
}
--- /dev/null
+package org.simantics.document.linking.report.templates;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.report.templates.messages"; //$NON-NLS-1$
+ public static String CompleteStructureWriter_ErrorInPropertyRefrence;
+ public static String DiagramStructureWriter_Hierarchymissing;
+ public static String DocumentStructureWriter_ErrorInPropertyReference;
+ public static String DocumentWriter_DocumentDoesNotExist;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
@Override
public String getName() {
- return "Model Internal Documents";
+ return "Model Internal Documents"; //$NON-NLS-1$
}
@Override
DocumentTitlePage titlePage = lineWriter.newElement(DocumentTitlePage.class);
titlePage.writeTitle(graph, context);
Table table = lineWriter.newElement(Table.class);
- table.addColumn("Folder", 0.4);
- table.addColumn("Document", 0.6);
+ table.addColumn("Folder", 0.4); //$NON-NLS-1$
+ table.addColumn("Document", 0.6); //$NON-NLS-1$
//lineWriter.nextPage();
this.graph = graph;
private String getText(List<Resource> current, boolean indent) throws DatabaseException {
- String text = "";
+ String text = ""; //$NON-NLS-1$
if (indent)
for (int i = 0; i < current.size()-1; i++) {
- text += " ";
+ text += " "; //$NON-NLS-1$
}
text += NameUtils.getSafeLabel(graph, current.get(current.size()-1));
private class DocumentContentProvider implements RowContentProvider<List<Resource>> {
public void setText(Document writer, java.util.List<Resource> previous, java.util.List<Resource> current, java.util.List<Resource> next, TextItem[] row) throws Exception {
- String s = "";
+ String s = ""; //$NON-NLS-1$
Resource document = current.get(current.size()-1);
int rev = revisionIndex(document);
for (int i = 0; i < rev; i++)
- s += " ";
+ s += " "; //$NON-NLS-1$
row[1] = getDocumentItem(document);
row[1].setText(s + row[1].getText());
};
@Override
public String getName() {
- return "Referred Documents";
+ return "Referred Documents"; //$NON-NLS-1$
}
public String getContent(ReadGraph graph, Resource resource, Map<Object, Object> context)
throws DatabaseException {
if (!SourceLinkUtil.isValidReference(graph, resource))
- return "Deleted reference";
+ return "Deleted reference"; //$NON-NLS-1$
Variable variable = graph.adapt(resource, Variable.class);
return item.getValue(graph, variable,context);
}
public List<DocumentLine> getLines(ReadGraph graph, Resource resource, Map<Object, Object> context)
throws DatabaseException {
if (!SourceLinkUtil.isValidReference(graph, resource))
- return Collections.singletonList(new DocumentLine("Deleted reference"));
+ return Collections.singletonList(new DocumentLine("Deleted reference")); //$NON-NLS-1$
Variable variable = graph.adapt(resource, Variable.class);
return item.getLines(graph, variable,context);
}
public SCLCustomizableContent(String label) {
session = new CommandSession(SCLOsgi.MODULE_REPOSITORY, null);
- sclCode = new String[]{"import \"Simantics/Ontologies\"",
- "nameOfResource r = match possibleRelatedValue r L0.HasName with\n"+
- " Just name -> name\n"+
- " Nothing -> \"no name\"",
- "nameOfResource res"};
+ sclCode = new String[]{"import \"Simantics/Ontologies\"", //$NON-NLS-1$
+ "nameOfResource r = match possibleRelatedValue r L0.HasName with\n"+ //$NON-NLS-1$
+ " Just name -> name\n"+ //$NON-NLS-1$
+ " Nothing -> \"no name\"", //$NON-NLS-1$
+ "nameOfResource res"}; //$NON-NLS-1$
}
@Override
public String getContent(ReadGraph graph, Resource resource, Map<Object, Object> context)
throws DatabaseException {
- session.setVariable("res", Types.con("Simantics/DB", "Resource"), resource);
+ session.setVariable("res", Types.con("Simantics/DB", "Resource"), resource); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
final StringBuilder responseBuilder = new StringBuilder();
final StringBuilder errorBuilder = new StringBuilder();
for (String code : sclCode) {
}
});
if(errorBuilder.length() > 0)
- throw new DatabaseException("Error executing SCL \"" + code + "\" " + errorBuilder.toString().trim());
+ throw new DatabaseException("Error executing SCL \"" + code + "\" " + errorBuilder.toString().trim()); //$NON-NLS-1$ //$NON-NLS-2$
}
return responseBuilder.toString().trim();
}
--- /dev/null
+CompleteStructureWriter_ErrorInPropertyRefrence=Error in property reference\r
+DiagramStructureWriter_Hierarchymissing=Hierarchy missing\r
+DocumentStructureWriter_ErrorInPropertyReference=Error in property reference \r
+DocumentWriter_DocumentDoesNotExist=[DOCUMENT DOES NOT EXIST]\r
--- /dev/null
+package org.simantics.document.linking.utils;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.utils.messages"; //$NON-NLS-1$
+ public static String SourceLinkUtil_DatabaseExceptionDocumentInDifferentModel;
+ public static String SourceLinkUtil_DatabaseExceptionLocNotModelPart;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
Resource link = null;
DependencyCheckResult result = checkDependecies(graph, document, instance);
if (result == DependencyCheckResult.NoLocationModel)
- throw new DatabaseException("Location of document link is not part of a model.");
+ throw new DatabaseException(Messages.SourceLinkUtil_DatabaseExceptionLocNotModelPart);
if (result == DependencyCheckResult.DifferentModel) {
- throw new DatabaseException("Location of document link and document are in different models, document link cannot be created.");
+ throw new DatabaseException(Messages.SourceLinkUtil_DatabaseExceptionDocumentInDifferentModel);
}
if (result == DependencyCheckResult.NoReferenceModel) {
//referred document and location are not in the same model, create an URI reference.
}
public static Resource createInstanceSource(WriteGraph graph, Resource reference, Resource location) throws DatabaseException {
- return createInstanceSource(graph, reference, location, "");
+ return createInstanceSource(graph, reference, location, ""); //$NON-NLS-1$
}
public static Resource createInstanceSource(WriteGraph graph, Resource reference, Resource location, String comment) throws DatabaseException {
}
public static Resource createInstanceSource(WriteGraph graph, String reference, Resource location) throws DatabaseException {
- return createInstanceSource(graph, reference, location, "");
+ return createInstanceSource(graph, reference, location, ""); //$NON-NLS-1$
}
public static Resource createInstanceSource(WriteGraph graph, String reference, Resource location, String comment) throws DatabaseException {
}
public static Resource createFunctionalSource(WriteGraph graph, Resource reference, Resource location, Resource relation) throws DatabaseException {
- return createFunctionalSource(graph, reference, location, relation, "");
+ return createFunctionalSource(graph, reference, location, relation, ""); //$NON-NLS-1$
}
}
public static Resource createFunctionalSource(WriteGraph graph, String reference, Resource location, Resource relation) throws DatabaseException {
- return createFunctionalSource(graph, reference, location, relation, "");
+ return createFunctionalSource(graph, reference, location, relation, ""); //$NON-NLS-1$
}
} else if (value instanceof Object[]) {
return Arrays.toString((Object[])value);
} else {
- return "TODO: Array " + value.getClass().getSimpleName();
+ return "TODO: Array " + value.getClass().getSimpleName(); //$NON-NLS-1$
}
} else {
return value.toString();
}
public static String getCustomizedString(ReadGraph graph, Resource document, List<String> annotationContent) throws DatabaseException{
- String label = "";
+ String label = ""; //$NON-NLS-1$
Variable doc = graph.adapt(document, Variable.class);
for (String path : annotationContent) {
- if (path.startsWith("\"") && path.endsWith("\"")) {
- label += path.substring(1,path.length()-1)+ " ";
+ if (path.startsWith("\"") && path.endsWith("\"")) { //$NON-NLS-1$ //$NON-NLS-2$
+ label += path.substring(1,path.length()-1)+ " "; //$NON-NLS-1$
} else {
Variable v = PredefinedVariables.getInstance().getVariable(graph, path, null, doc);
if (v != null) {
- label += v.getValue(graph) + " ";
+ label += v.getValue(graph) + " "; //$NON-NLS-1$
}
}
}
--- /dev/null
+SourceLinkUtil_DatabaseExceptionDocumentInDifferentModel=Location of document link and document are in different models, document link cannot be created.\r
+SourceLinkUtil_DatabaseExceptionLocNotModelPart=Location of document link is not part of a model.\r
--- /dev/null
+package org.simantics.document.linking.views;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.views.messages"; //$NON-NLS-1$
+ public static String SourceView_All;
+ public static String SourceView_Browsing;
+ public static String SourceView_LinkAll;
+ public static String SourceView_LinkDocuments;
+ public static String SourceView_Linking;
+ public static String SourceView_OldRemoved;
+ public static String SourceView_PinSelection;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
/**
* The ID of the view as specified by the extension.
*/
- public static final String ID = "org.simantics.document.linking.views.SourceView";
+ public static final String ID = "org.simantics.document.linking.views.SourceView"; //$NON-NLS-1$
private Composite composite;
composite.setLayout(new FillLayout());
tabFolder = new TabFolder(composite, SWT.NONE);
TabItem link = new TabItem(tabFolder, SWT.NONE);
- link.setText("Linking");
+ link.setText(Messages.SourceView_Linking);
TabItem browse = new TabItem(tabFolder, SWT.NONE);
- browse.setText("Browsing");
+ browse.setText(Messages.SourceView_Browsing);
linkComposite = new Composite(tabFolder, SWT.NONE);
link.setControl(linkComposite);
}
});
Button checkingButton = new Button(browseComposite, SWT.TOGGLE);
- checkingButton.setText("All");
+ checkingButton.setText(Messages.SourceView_All);
checkingButton.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
boolean checked = button.getSelection();
browseExplorer.dispose();
createModelExplorer(checked,support,browseComposite);
- button.setText(checked ? "Old/Removed" : "All");
+ button.setText(checked ? Messages.SourceView_OldRemoved : Messages.SourceView_All);
if (currentModel != null)
setModel(currentModel, true);
browseComposite.getParent().layout(true, true);
}
private void createModelExplorer(boolean onlyCheckable,WidgetSupport support,Composite browseComposite) {
- browseExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false, true), selectionProvider,getSite(), browseComposite, support,false, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION);
+ browseExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false, true), selectionProvider,getSite(), browseComposite, support,false, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
if(!onlyCheckable)
browseExplorer.setBrowseContexts(DocumentLink.URIs.ModelViewpointBrowseContext, DocumentLink.URIs.ModelViewpointActionContext);
else
browseExplorer.setInputSource(new SingleSelectionInputSource(Resource.class));
browseExplorer.getExplorer().setAutoExpandLevel(2); // Expand everything in the beginning
browseExplorer.setColumnsVisible(true);
- browseExplorer.setContextMenuId("#SourceModelViewPopup");
+ browseExplorer.setContextMenuId("#SourceModelViewPopup"); //$NON-NLS-1$
browseExplorer.finish();
((Tree)browseExplorer.getExplorer().getControl()).setLinesVisible(true);
}
private void createLinkTab(final Composite linkComposite) {
- objectExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false,true), selectionProvider,getSite(), linkComposite, support, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION);
+ objectExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false,true), selectionProvider,getSite(), linkComposite, support, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
objectExplorer.setBrowseContexts(DocumentLink.URIs.SourceObjectViewpointBrowseContext, DocumentLink.URIs.SourceObjectViewpointActionContext);
objectExplorer.setColumns(Constants.SOURCE_OBJECT_COLUMNS);
objectExplorer.setInputSource(new SingleSelectionInputSource(Resource.class));
objectExplorer.getExplorer().setAutoExpandLevel(2); // Expand everything in the beginning
objectExplorer.setColumnsVisible(true);
- objectExplorer.setContextMenuId("#SourceObjectViewPopup");
+ objectExplorer.setContextMenuId("#SourceObjectViewPopup"); //$NON-NLS-1$
objectExplorer.finish();
((Tree)objectExplorer.getExplorer().getControl()).setLinesVisible(true);
final Sash sash = new Sash (linkComposite, SWT.HORIZONTAL);
- propertyExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false,true), selectionProvider,getSite(), linkComposite, support, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION);
+ propertyExplorer = new SourceLinkExplorerComposite(ArrayMap.keys("displaySelectors", "displayFilter","treeView").values(false, false,true), selectionProvider,getSite(), linkComposite, support, SWT.BORDER | SWT.SINGLE | SWT.FULL_SELECTION); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
propertyExplorer.setBrowseContexts(DocumentLink.URIs.SourcePropertyViewpointBrowseContext, DocumentLink.URIs.SourcePropertyViewpointActionContext);
propertyExplorer.setColumns(Constants.SOURCE_COLUMNS);
propertyExplorer.setInputSource(new SingleSelectionInputSource(Resource.class));
propertyExplorer.getExplorer().setAutoExpandLevel(2); // Expand everything in the beginning
propertyExplorer.setColumnsVisible(true);
- propertyExplorer.setContextMenuId("#SourcePropertyViewPopup");
+ propertyExplorer.setContextMenuId("#SourcePropertyViewPopup"); //$NON-NLS-1$
propertyExplorer.finish();
((Tree)propertyExplorer.getExplorer().getControl()).setLinesVisible(true);
}
private void makeActions() {
- pinSelectionAction = new Action("Pin selection", Action.AS_CHECK_BOX) {
+ pinSelectionAction = new Action(Messages.SourceView_PinSelection, Action.AS_CHECK_BOX) {
public void run() {
pinSelection = isChecked();
}
};
// action1.setToolTipText("Action 1 tooltip");
- pinSelectionAction.setImageDescriptor(Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/lock.png"));
+ pinSelectionAction.setImageDescriptor(Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/lock.png")); //$NON-NLS-1$ //$NON-NLS-2$
- linkAllAction = new Action("Link All", Action.AS_RADIO_BUTTON) {
+ linkAllAction = new Action(Messages.SourceView_LinkAll, Action.AS_RADIO_BUTTON) {
@Override
public void run() {
setAcceptedObject(AcceptedObject.ALL);
}
};
- linkDocumentsAction = new Action("Link Documents", Action.AS_RADIO_BUTTON) {
+ linkDocumentsAction = new Action(Messages.SourceView_LinkDocuments, Action.AS_RADIO_BUTTON) {
@Override
public void run() {
setAcceptedObject(AcceptedObject.DOCUMENT);
--- /dev/null
+SourceView_All=All\r
+SourceView_Browsing=Browsing\r
+SourceView_LinkAll=Link All\r
+SourceView_LinkDocuments=Link Documents\r
+SourceView_Linking=Linking\r
+SourceView_OldRemoved=Old/Removed\r
+SourceView_PinSelection=Pin selection\r
viewer.setLabelProvider(new EvaluatorLabelProvider());
viewer.setCellEditors(new CellEditor[]{new EvaluatorNodeCellEditor(viewer.getTree())});
viewer.setCellModifier(new EvaluatorNodeCellModifier());
- viewer.setColumnProperties(new String[]{"value"});
+ viewer.setColumnProperties(new String[]{"value"}); //$NON-NLS-1$
viewer.setInput(root);
viewer.getTree().addMenuDetectListener(new MenuDetectListener() {
final EvaluatorItem item = i;
Menu menu = new Menu(viewer.getControl());
MenuItem add = new MenuItem(menu, SWT.CASCADE);
- add.setText("Add");
+ add.setText(Messages.EvaluatorConfigurationWidget_Add);
Menu addMenu = new Menu(menu);
add.setMenu(addMenu);
- add.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_right.png")));
+ add.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_right.png"))); //$NON-NLS-1$ //$NON-NLS-2$
MenuItem insert = new MenuItem(menu, SWT.CASCADE);
- insert.setText("Insert");
+ insert.setText("Insert"); //$NON-NLS-1$
Menu insertMenu = new Menu(menu);
insert.setMenu(insertMenu);
- insert.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_left.png")));
+ insert.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_left.png"))); //$NON-NLS-1$ //$NON-NLS-2$
// add menu
if (item instanceof EvaluatorNode) {
insert.setEnabled(false);
MenuItem menuItem = new MenuItem(menu, SWT.PUSH);
- menuItem.setText("Remove");
+ menuItem.setText(Messages.EvaluatorConfigurationWidget_Remove);
menuItem.addSelectionListener(new SelectionAdapter() {
public void widgetSelected(SelectionEvent e) {
EvaluatorNode parent = item.getParent();
};
});
menuItem.setEnabled(item != root);
- menuItem.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/delete.png")));
+ menuItem.setImage(manager.createImage(AbstractUIPlugin.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/delete.png"))); //$NON-NLS-1$ //$NON-NLS-2$
menu.setLocation(event.x,event.y);
menu.setVisible(true);
}
return 0;
}
- return "";
+ return ""; //$NON-NLS-1$
}
@Override
public void modify(Object element, String property, Object value) {
--- /dev/null
+package org.simantics.document.linking.wizard;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.linking.wizard.messages"; //$NON-NLS-1$
+ public static String EvaluatorConfigurationWidget_Add;
+ public static String EvaluatorConfigurationWidget_Remove;
+ public static String ReportCustomizationPage_Defaults;
+ public static String ReportCustomizationPage_GiveTemplateName;
+ public static String ReportCustomizationPage_Library;
+ public static String ReportCustomizationPage_Load;
+ public static String ReportCustomizationPage_Name;
+ public static String ReportCustomizationPage_NameCannotBeEmpty;
+ public static String ReportCustomizationPage_Save;
+ public static String ReportCustomizationPage_SaveReportCustomizations;
+ public static String ReportGeneratePage_File;
+ public static String ReportGeneratePage_FileNotSelected;
+ public static String ReportGeneratePage_GenerateReport;
+ public static String ReportGeneratePage_GeneratingReport;
+ public static String ReportGeneratePage_Report;
+ public static String ReportGeneratePage_ReportFail;
+ public static String ReportGeneratePage_ReportFailed;
+ public static String ReportGeneratePage_ReportNotGenerated;
+ public static String ReportGeneratePage_ReportWriterNotSelected;
+ public static String ReportGeneratePage_ShowReport;
+ public static String ReportGeneratePage_Status;
+ public static String ReportSelectionPage_Browse;
+ public static String ReportSelectionPage_File;
+ public static String ReportSelectionPage_FilterHTMLDocument;
+ public static String ReportSelectionPage_FilterPDFDocument;
+ public static String ReportSelectionPage_Model;
+ public static String ReportSelectionPage_ReportTemplates;
+ public static String ReportWizard_CustomizeReport;
+ public static String ReportWizard_RunReport;
+ public static String ReportWizard_SelectReportParameters;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.CENTER).applyTo(loadButton);
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.CENTER).applyTo(saveButton);
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.CENTER).applyTo(resetButton);
- loadButton.setText("Load");
- saveButton.setText("Save");
- resetButton.setText("Defaults");
+ loadButton.setText(Messages.ReportCustomizationPage_Load);
+ saveButton.setText(Messages.ReportCustomizationPage_Save);
+ resetButton.setText(Messages.ReportCustomizationPage_Defaults);
loadButton.addSelectionListener(new SelectionAdapter() {
@Override
@Override
public Resource perform(ReadGraph graph) throws DatabaseException {
Layer0 l0 = Layer0.getInstance(graph);
- Resource lib = graph.syncRequest(new PossibleObjectWithName(model, l0.ConsistsOf,"Library"));
+ Resource lib = graph.syncRequest(new PossibleObjectWithName(model, l0.ConsistsOf,Messages.ReportCustomizationPage_Library));
if (lib != null)
return lib;
private void save() {
try {
- InputDialog dialog = new InputDialog(getShell(), "Save report customization", "Give template name", "Name", new NotNullValidator("Name cannot be empty"));
+ InputDialog dialog = new InputDialog(getShell(), Messages.ReportCustomizationPage_SaveReportCustomizations, Messages.ReportCustomizationPage_GiveTemplateName, Messages.ReportCustomizationPage_Name, new NotNullValidator(Messages.ReportCustomizationPage_NameCannotBeEmpty));
if (dialog.open() != InputDialog.OK)
return;
final String name = dialog.getValue();
import org.eclipse.core.runtime.IStatus;
import org.eclipse.jface.operation.IRunnableWithProgress;
import org.eclipse.jface.wizard.WizardPage;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.events.SelectionAdapter;
import org.eclipse.swt.events.SelectionEvent;
Composite composite = new Composite(parent, SWT.NONE);
composite.setLayout(new GridLayout(2,false));
Label label = new Label(composite, SWT.NONE);
- label.setText("File:");
+ label.setText(Messages.ReportGeneratePage_File);
fileLabel = new Label(composite, SWT.NONE);
label = new Label(composite, SWT.NONE);
- label.setText("Report:");
+ label.setText(Messages.ReportGeneratePage_Report);
reportLabel = new Label(composite, SWT.NONE);
label = new Label(composite, SWT.NONE);
- label.setText("Status:");
+ label.setText(Messages.ReportGeneratePage_Status);
this.statusLabel = new Label(composite, SWT.NONE);
- this.statusLabel.setText("Report has not been generated");
+ this.statusLabel.setText(Messages.ReportGeneratePage_ReportNotGenerated);
generateButton = new Button(composite, SWT.PUSH);
- generateButton.setText("Generate report");
+ generateButton.setText(Messages.ReportGeneratePage_GenerateReport);
generateButton.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
}
});
showButton = new Button(composite, SWT.PUSH);
- showButton.setText("Show Report");
+ showButton.setText(Messages.ReportGeneratePage_ShowReport);
showButton.addSelectionListener(new SelectionAdapter() {
@Override
}
private void updateContent() {
- fileLabel.setText(filename == null ? "File has not been selected" : filename);
- reportLabel.setText(reportWriter == null ? "Report Writer has not been selected" : reportWriter.getName());
+ fileLabel.setText(filename == null ? Messages.ReportGeneratePage_FileNotSelected : filename);
+ reportLabel.setText(reportWriter == null ? Messages.ReportGeneratePage_ReportWriterNotSelected : reportWriter.getName());
generateButton.setEnabled(filename != null && reportWriter != null && model != null);
showButton.setEnabled(generated);
generateButton.setEnabled(!generated);
if (!generated)
- statusLabel.setText("Report has not been generated");
+ statusLabel.setText(Messages.ReportGeneratePage_ReportNotGenerated);
}
public void setGenerated(boolean b) {
private void generate() {
generateButton.setEnabled(false);
- statusLabel.setText("Generating report");
+ statusLabel.setText(Messages.ReportGeneratePage_GeneratingReport);
try {
getWizard().getContainer().run(true, false, new IRunnableWithProgress() {
}
});
} catch (InterruptedException err) {
- setErrorMessage("Report failed: " + err.getMessage());
- ErrorLogger.defaultLogError("Report failed.",err);
- statusLabel.setText("Report failed.");
+ setErrorMessage(NLS.bind(Messages.ReportGeneratePage_ReportFailed , err.getMessage()));
+ ErrorLogger.defaultLogError(Messages.ReportGeneratePage_ReportFail,err);
+ statusLabel.setText(Messages.ReportGeneratePage_ReportFail);
} catch (InvocationTargetException e) {
Throwable err = e.getCause();
- setErrorMessage("Report failed: " + err.getMessage());
- ErrorLogger.defaultLogError("Report failed.",err);
- statusLabel.setText("Report failed.");
+ setErrorMessage(NLS.bind(Messages.ReportGeneratePage_ReportFailed , err.getMessage()));
+ ErrorLogger.defaultLogError(Messages.ReportGeneratePage_ReportFail,err);
+ statusLabel.setText(Messages.ReportGeneratePage_ReportFail);
}
setGenerated(true);
Composite composite = new Composite(parent, SWT.NONE);
composite.setLayout(new GridLayout(3,false));
Label label = new Label(composite, SWT.NONE);
- label.setText("Model:");
+ label.setText(Messages.ReportSelectionPage_Model);
modelCombo = new CCombo(composite, SWT.BORDER|SWT.READ_ONLY);
label = new Label(composite, SWT.NONE);
- label.setText("File:");
+ label.setText(Messages.ReportSelectionPage_File);
filenameText = new Text(composite, SWT.BORDER|SWT.SINGLE);
browseButton = new Button(composite, SWT.PUSH);
- browseButton.setText("Browse");
+ browseButton.setText(Messages.ReportSelectionPage_Browse);
reportWriters.add(new ModelDocumentWriter());
reportWriters.add(new ReferredDocumentWriter());
reportWriters.add(new CompleteStructureWriter());
Group group = new Group(composite, SWT.NONE);
- group.setText("Report templates");
+ group.setText(Messages.ReportSelectionPage_ReportTemplates);
group.setLayout(new FillLayout(SWT.VERTICAL));
GridDataFactory.fillDefaults().grab(true, false).align(SWT.FILL, SWT.CENTER).applyTo(filenameText);
@Override
public void widgetSelected(SelectionEvent e) {
FileDialog dialog = new FileDialog(Display.getCurrent().getActiveShell(),SWT.SAVE);
- dialog.setFilterExtensions(new String[]{"*.pdf","*.html"});
- dialog.setFilterNames(new String[]{"PDF Document","HTML Document"});
+ dialog.setFilterExtensions(new String[]{"*.pdf","*.html"}); //$NON-NLS-1$ //$NON-NLS-2$
+ dialog.setFilterNames(new String[]{Messages.ReportSelectionPage_FilterPDFDocument,Messages.ReportSelectionPage_FilterHTMLDocument});
String filename = dialog.open();
if (filename == null)
- filenameText.setText("");
+ filenameText.setText(""); //$NON-NLS-1$
else
filenameText.setText(filename);
validate();
@Override
public void addPages() {
- reportSelectionPage = new ReportSelectionPage("Select report parameters");
- reportCustomizationPage = new ReportCustomizationPage("Customize report");
- reportGeneratePage = new ReportGeneratePage("Run Report");
+ reportSelectionPage = new ReportSelectionPage(Messages.ReportWizard_SelectReportParameters);
+ reportCustomizationPage = new ReportCustomizationPage(Messages.ReportWizard_CustomizeReport);
+ reportGeneratePage = new ReportGeneratePage(Messages.ReportWizard_RunReport);
addPage(reportSelectionPage);
addPage(reportCustomizationPage);
addPage(reportGeneratePage);
--- /dev/null
+EvaluatorConfigurationWidget_Add=Add\r
+EvaluatorConfigurationWidget_Remove=Remove\r
+ReportCustomizationPage_Defaults=Defaults\r
+ReportCustomizationPage_GiveTemplateName=Give template name\r
+ReportCustomizationPage_Library=Library\r
+ReportCustomizationPage_Load=Load\r
+ReportCustomizationPage_Name=Name\r
+ReportCustomizationPage_NameCannotBeEmpty=Name cannot be empty\r
+ReportCustomizationPage_Save=Save\r
+ReportCustomizationPage_SaveReportCustomizations=Save report customization\r
+ReportGeneratePage_File=File:\r
+ReportGeneratePage_FileNotSelected=File has not been selected\r
+ReportGeneratePage_GenerateReport=Generate report\r
+ReportGeneratePage_GeneratingReport=Generating report\r
+ReportGeneratePage_Report=Report:\r
+ReportGeneratePage_ReportFail=Report failed.\r
+ReportGeneratePage_ReportFailed=Report failed: {0}\r
+ReportGeneratePage_ReportNotGenerated=Report has not been generated\r
+ReportGeneratePage_ReportWriterNotSelected=Report Writer has not been selected\r
+ReportGeneratePage_ShowReport=Show Report\r
+ReportGeneratePage_Status=Status:\r
+ReportSelectionPage_Browse=Browse\r
+ReportSelectionPage_File=File:\r
+ReportSelectionPage_FilterHTMLDocument=HTML Document\r
+ReportSelectionPage_FilterPDFDocument=PDF Document\r
+ReportSelectionPage_Model=Model:\r
+ReportSelectionPage_ReportTemplates=Report templates\r
+ReportWizard_CustomizeReport=Customize report\r
+ReportWizard_RunReport=Run Report\r
+ReportWizard_SelectReportParameters=Select report parameters\r
Bundle bundle = context.getBundle();
- DOCUMENT_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/document_decoration.png"));
- cross = ImageDescriptor.createFromURL(bundle.getResource("icons/silk_small/cross.png"));
- clock_red = ImageDescriptor.createFromURL(bundle.getResource("icons/silk_small/clock_red.png"));
+ DOCUMENT_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/document_decoration.png")); //$NON-NLS-1$
+ cross = ImageDescriptor.createFromURL(bundle.getResource("icons/silk_small/cross.png")); //$NON-NLS-1$
+ clock_red = ImageDescriptor.createFromURL(bundle.getResource("icons/silk_small/clock_red.png")); //$NON-NLS-1$
IPath ipath = Platform.getStateLocation(bundle);
location = Paths.get(ipath.toOSString());
public class CSSCompletionAssistProcessor implements IContentAssistProcessor {
- private String lastError = "";
+ private String lastError = ""; //$NON-NLS-1$
private CSSTextEditorEnvironment environment;
public CSSCompletionAssistProcessor(CSSTextEditorEnvironment environment) {
tmpOffset = selection.getOffset() + selection.getLength();
final int offset = tmpOffset;
IDocument document = viewer.getDocument();
- String tmpPrefix = "";
+ String tmpPrefix = ""; //$NON-NLS-1$
try {
tmpPrefix = getPrefix(document, offset);
} catch (BadLocationException e) {
private static String getPrefix(IDocument doc, int offset) throws BadLocationException {
if (doc == null || offset >= doc.getLength())
- return "";
+ return ""; //$NON-NLS-1$
int length= 0;
while (--offset >= 0 && Character.isJavaIdentifierPart(doc.getChar(offset)) || doc.getChar(offset) == '.')
public class CSSCompletionProposal implements ICompletionProposal, ICompletionProposalExtension, ICompletionProposalExtension2, ICompletionProposalExtension3, ICompletionProposalExtension4, ICompletionProposalExtension5 {
- private static final Image PRIVATE = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/private_co.gif").createImage();
- private static final Image PUBLIC = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/public_co.gif").createImage();
- private static final Image CONST = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/container_obj.gif").createImage();
- private static final Image TYPE = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/typedef_obj.gif").createImage();
+ private static final Image PRIVATE = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/private_co.gif").createImage(); //$NON-NLS-1$ //$NON-NLS-2$
+ private static final Image PUBLIC = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/public_co.gif").createImage(); //$NON-NLS-1$ //$NON-NLS-2$
+ private static final Image CONST = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/container_obj.gif").createImage(); //$NON-NLS-1$ //$NON-NLS-2$
+ private static final Image TYPE = Activator.imageDescriptorFromPlugin("org.simantics.scl.ui", "icons/typedef_obj.gif").createImage(); //$NON-NLS-1$ //$NON-NLS-2$
private final String content;
private final String name;
this.name = value.getName().name;
this.module = value.getName().module;
this.documentation = value.getDocumentation();
- this.content = name + " :: " + value.getType() + " (" + module + ")";
+ this.content = name + " :: " + value.getType() + " (" + module + ")"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
this.replacementOffset = replacementOffset;
this.prefix = prefix;
// System.out.println(prefix);
public CSSCompletionProposal(String name, String module, CSSCompletionType completionType, int replacementOffset, String prefix) {
this.name = name;
this.module = module;
- this.content = name + " (" + module + ")";
+ this.content = name + " (" + module + ")"; //$NON-NLS-1$ //$NON-NLS-2$
this.documentation = null;
this.replacementOffset = replacementOffset;
this.prefix = prefix;
// String sadd = doc.get(start, end);
// System.out.println("toReplace : " + sadd);
if (p.y > 0) {
- doc.replace(p.x, p.y, "");
+ doc.replace(p.x, p.y, ""); //$NON-NLS-1$
doc.replace(offset, 0, getName());
} else {
String currentText = doc.get(offset - prefix.length(), prefix.length());
if (currentText.equals(getName()))
return;
- doc.replace(offset - prefix.length(), prefix.length(), "");
+ doc.replace(offset - prefix.length(), prefix.length(), ""); //$NON-NLS-1$
doc.replace(offset - prefix.length(), 0, getName());
}
} catch (BadLocationException x) {
*/
public class CSSEditor extends TextEditor {
- public static final String EDITOR_ID = "org.simantics.document.ui.csseditor";
+ public static final String EDITOR_ID = "org.simantics.document.ui.csseditor"; //$NON-NLS-1$
private boolean disposed = false;
try {
getResourceInput().init(null);
} catch (DatabaseException e) {
- throw new PartInitException("Failed to initialize " + input, e);
+ throw new PartInitException("Failed to initialize " + input, e); //$NON-NLS-1$
}
}
DocumentResource DOC = DocumentResource.getInstance(graph);
currentText = graph.getPossibleRelatedValue(resource, DOC.cssDocument, Bindings.STRING);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
synchronized(annotationModel.getLockObject()) {
annotationModel.removeAllAnnotations();
for(CompilationError error : errors) {
- Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true,
+ Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, //$NON-NLS-1$
error.description);
int begin = Locations.beginOf(error.location);
int end = Locations.endOf(error.location);
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument");
+ TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
ITokenScanner getSclTokenScanner() {
RuleBasedScanner scanner = new RuleBasedScanner();
- Font font = new Font(device, "Courier New", 10, SWT.NORMAL);
- Font boldFont = new Font(device, "Courier New", 10, SWT.BOLD);
+ Font font = new Font(device, "Courier New", 10, SWT.NORMAL); //$NON-NLS-1$
+ Font boldFont = new Font(device, "Courier New", 10, SWT.BOLD); //$NON-NLS-1$
Token defaultToken = new Token(
new TextAttribute(
}
});
- reservedWord.addWord("if", reserved);
- reservedWord.addWord("then", reserved);
- reservedWord.addWord("else", reserved);
- reservedWord.addWord("match", reserved);
- reservedWord.addWord("with", reserved);
- reservedWord.addWord("data", reserved);
- reservedWord.addWord("type", reserved);
- reservedWord.addWord("class", reserved);
+ reservedWord.addWord("if", reserved); //$NON-NLS-1$
+ reservedWord.addWord("then", reserved); //$NON-NLS-1$
+ reservedWord.addWord("else", reserved); //$NON-NLS-1$
+ reservedWord.addWord("match", reserved); //$NON-NLS-1$
+ reservedWord.addWord("with", reserved); //$NON-NLS-1$
+ reservedWord.addWord("data", reserved); //$NON-NLS-1$
+ reservedWord.addWord("type", reserved); //$NON-NLS-1$
+ reservedWord.addWord("class", reserved); //$NON-NLS-1$
IRule[] rules = new IRule[] {
//new MultiLineRule("\"\"\"", "\"\"\"", string),
- new PatternRule("\"", "\"", string, '\\', true),
- new MultiLineRule("/*", "*/", comment),
- new EndOfLineRule("//", comment),
+ new PatternRule("\"", "\"", string, '\\', true), //$NON-NLS-1$ //$NON-NLS-2$
+ new MultiLineRule("/*", "*/", comment), //$NON-NLS-1$ //$NON-NLS-2$
+ new EndOfLineRule("//", comment), //$NON-NLS-1$
reservedWord
};
scanner.setRules(rules);
private class PinSelection extends Action {
public PinSelection() {
- super("Pin Selection", IAction.AS_CHECK_BOX);
+ super(Messages.DocumentView_PinSelection, IAction.AS_CHECK_BOX);
setImageDescriptor(
BundleUtils.getImageDescriptorFromPlugin(
- "org.eclipse.ui",
- "icons/full/etool16/pin_editor.png"));
+ "org.eclipse.ui", //$NON-NLS-1$
+ "icons/full/etool16/pin_editor.png")); //$NON-NLS-1$
}
@Override
--- /dev/null
+package org.simantics.document.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.messages"; //$NON-NLS-1$
+ public static String DocumentView_PinSelection;
+ public static String OpenEntityDocumentAdapter_DocumentEditor;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public class OpenEntityDocumentAdapter extends AbstractResourceEditorAdapter {
- private static final String EDITOR_ID = "org.simantics.document.ui.editor";
+ private static final String EDITOR_ID = "org.simantics.document.ui.editor"; //$NON-NLS-1$
public OpenEntityDocumentAdapter() throws MalformedURLException {
- super("Document Editor", ImageDescriptor.createFromURL(new URL(
- "platform:/plugin/com.famfamfam.silk/icons/table.png")));
+ super(Messages.OpenEntityDocumentAdapter_DocumentEditor, ImageDescriptor.createFromURL(new URL(
+ "platform:/plugin/com.famfamfam.silk/icons/table.png"))); //$NON-NLS-1$
}
protected String getEditorId() {
@Override
public void run() {
- InputDialog dialog = new InputDialog(Display.getCurrent().getActiveShell(), "Add URL", "Input URL", "", new URLValidator());
+ InputDialog dialog = new InputDialog(Display.getCurrent().getActiveShell(), Messages.AddUrlDocument_AddURL, Messages.AddUrlDocument_InputURL, "", new URLValidator()); //$NON-NLS-3$
if (dialog.open() != InputDialog.OK)
return;
final String uriString = dialog.getValue();
}
}, e -> {
if (e != null)
- ExceptionUtils.logAndShowError("Cannot add URL link.", e);
+ ExceptionUtils.logAndShowError(Messages.AddUrlDocument_CannotAddURLLink, e);
});
}
};
}, e -> {
dialog.getAnnotationConfigurator().dispose();
if (e != null)
- ExceptionUtils.logAndShowError("Cannot add URL link.", e);
+ ExceptionUtils.logAndShowError("Cannot add URL link.", e); //$NON-NLS-1$
});
}
};
}
public static Resource addUrlDocumentWithDetailSCL(WriteGraph graph, Resource target, String name, String uriString) throws DatabaseException {
- AddUrlDocumentWithDetail urlDocument = new AddUrlDocumentWithDetail(graph, "http://www.simantics.org/Layer0-1.1/ConsistsOf");
+ AddUrlDocumentWithDetail urlDocument = new AddUrlDocumentWithDetail(graph, "http://www.simantics.org/Layer0-1.1/ConsistsOf"); //$NON-NLS-1$
Resource urlResource = urlDocument.doAddUrl(graph, name, uriString);
urlDocument.linkDocument(graph, target, urlResource);
return urlResource;
return;
exportDocument(resource, filename);
} catch (DatabaseException e) {
- ExceptionUtils.logAndShowError("Cannot export document.", e);
+ ExceptionUtils.logAndShowError(Messages.ExportDocumentFile_CannotExportDocument, e);
}
}
import org.eclipse.core.runtime.IProgressMonitor;
import org.eclipse.core.runtime.IStatus;
import org.eclipse.core.runtime.Status;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.MessageDialog;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.widgets.DirectoryDialog;
import org.eclipse.swt.widgets.Display;
public ExportDocumentFolder(ReadGraph graph, String relationUri, String useResourceNames) throws DatabaseException {
relation = graph.getResource(relationUri);
- this.useResourceNames = useResourceNames.equals("true");
+ this.useResourceNames = useResourceNames.equals("true"); //$NON-NLS-1$
}
@Override
File folder = new File(folderName);
int choice = -1;
if (folder.list().length > 0) {
- MessageDialog messageDialog = new MessageDialog(shell, "Folder export", null, "Selected folder \"" + folderName + "\" is not empty.", MessageDialog.QUESTION, new String[]{"Delete and export","Overwrite","Cancel"}, 2);
+ MessageDialog messageDialog = new MessageDialog(shell, Messages.ExportDocumentFolder_FolderExport, null, NLS.bind(Messages.ExportDocumentFolder_SelectedFolder, folderName), MessageDialog.QUESTION, new String[]{Messages.ExportDocumentFolder_DeleteAndExport,Messages.ExportDocumentFolder_Overwrite, IDialogConstants.CANCEL_LABEL }, 2); //$NON-NLS-3$
choice = messageDialog.open();
if (choice == 2)
return;
File folder;
boolean clear = false;
public ExportJob(Resource resource,File folder, boolean clear) {
- super("Export folder");
+ super(Messages.ExportDocumentFolder_ExportFolder);
this.resource = resource;
this.folder = folder;
this.clear = clear;
@Override
protected IStatus run(IProgressMonitor monitor) {
try {
- monitor.beginTask("Export folder", IProgressMonitor.UNKNOWN);
+ monitor.beginTask(Messages.ExportDocumentFolder_ExportFolder, IProgressMonitor.UNKNOWN);
if (clear) {
GraphFileUtil.clearDirectoryStructure(folder);
monitor.worked(1);
}
FileDocumentUtil.exportDocumentFolder(resource, folder, relation, useResourceNames, monitor);
monitor.done();
- return new Status(IStatus.OK, Activator.PLUGIN_ID, "Folder exported.");
+ return new Status(IStatus.OK, Activator.PLUGIN_ID, Messages.ExportDocumentFolder_ActivatorFolderExported);
} catch (Exception e) {
monitor.done();
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Cannot export document folder.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.ExportDocumentFolder_AcivatorCannotExport, e);
}
}
}
// if is, use those extensions to filter this list.
// note: in windows using "reg query ..." to read bindings form registry would work.
// Note : If the above mentioned filtering is implemented it should be made optional / configurable.
- dialog.setFilterExtensions(new String[]{"*.*"});
+ dialog.setFilterExtensions(new String[]{"*.*"}); //$NON-NLS-1$
if (dialog.open() == null) return;
String filterPath = dialog.getFilterPath();
String[] filenames = dialog.getFileNames();
- ImportJob job = new ImportJob(filenames.length > 1 ? "Import files" : "Import file", resource, filterPath, filenames);
+ ImportJob job = new ImportJob(filenames.length > 1 ? Messages.ImportDocument_JobImportFiles : Messages.ImportDocument_ImportFile, resource, filterPath, filenames);
job.setUser(true);
job.schedule();
}
@Override
protected IStatus run(final IProgressMonitor monitor) {
- monitor.beginTask("Importing...", filenames.length);
+ monitor.beginTask(Messages.ImportDocument_ImportingDots, filenames.length);
try {
Simantics.getSession().syncRequest(new WriteRequest() {
@Override
}
}
});
- return new Status(IStatus.OK, Activator.PLUGIN_ID, "Import succesful.");
+ return new Status(IStatus.OK, Activator.PLUGIN_ID, Messages.ImportDocument_ActivatorImportSucessful);
} catch (DatabaseException e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Import failed.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.ImportDocument_ImportFailed, e);
} finally {
monitor.done();
}
return;
}
- ImportJob job = new ImportJob("Import folder", resource, filename);
+ ImportJob job = new ImportJob(Messages.ImportDocumentFolder_ImportFolder, resource, filename);
job.setUser(true);
job.schedule();
}
}
}
});
- return new Status(IStatus.OK, Activator.PLUGIN_ID, "Folder imported.");
+ return new Status(IStatus.OK, Activator.PLUGIN_ID, Messages.ImportDocumentFolder_ActivatorFolderImported);
} catch (DatabaseException e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Cannot import document folder.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.ImportDocumentFolder_ActivatorCannotImportDocumentFolder, e);
}
}
}
}, e -> {
dialog.getAnnotationConfigurator().dispose();
if (e != null)
- ExceptionUtils.logAndShowError("Cannot import document.", e);
+ ExceptionUtils.logAndShowError(Messages.ImportDocumentWithDetail_CannotImportDocument, e);
});
}
};
public static Resource importDocumentWithDetailSCL(WriteGraph graph, Resource target, String filename) throws FileNotFoundException, DatabaseException {
File file = new File(filename);
if (!file.exists())
- throw new FileNotFoundException("File not found - " + file.getAbsolutePath());
- ImportDocumentWithDetail document = new ImportDocumentWithDetail(graph, "http://www.simantics.org/Layer0-1.1/ConsistsOf");
+ throw new FileNotFoundException("File not found - " + file.getAbsolutePath()); //$NON-NLS-1$
+ ImportDocumentWithDetail document = new ImportDocumentWithDetail(graph, "http://www.simantics.org/Layer0-1.1/ConsistsOf"); //$NON-NLS-1$
return document.doDocumentImport(graph, target, filename, file.getName());
}
--- /dev/null
+package org.simantics.document.ui.actions;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.actions.messages"; //$NON-NLS-1$
+ public static String AddUrlDocument_AddURL;
+ public static String AddUrlDocument_CannotAddURLLink;
+ public static String AddUrlDocument_InputURL;
+ public static String ExportDocumentFile_CannotExportDocument;
+ public static String ExportDocumentFolder_AcivatorCannotExport;
+ public static String ExportDocumentFolder_ActivatorFolderExported;
+ public static String ExportDocumentFolder_DeleteAndExport;
+ public static String ExportDocumentFolder_ExportFolder;
+ public static String ExportDocumentFolder_FolderExport;
+ public static String ExportDocumentFolder_Overwrite;
+ public static String ExportDocumentFolder_SelectedFolder;
+ public static String ImportDocument_ActivatorImportSucessful;
+ public static String ImportDocument_ImportFailed;
+ public static String ImportDocument_ImportFile;
+ public static String ImportDocument_ImportingDots;
+ public static String ImportDocument_JobImportFiles;
+ public static String ImportDocumentFolder_ActivatorCannotImportDocumentFolder;
+ public static String ImportDocumentFolder_ActivatorFolderImported;
+ public static String ImportDocumentFolder_ImportFolder;
+ public static String ImportDocumentWithDetail_CannotImportDocument;
+ public static String NewDocumentFolder_Folder;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
Layer0 l0 = Layer0.getInstance(graph);
- String name = NameUtils.findFreshName(graph, "Folder", resource, relation);
+ String name = NameUtils.findFreshName(graph, Messages.NewDocumentFolder_Folder, resource, relation);
Resource folder = graph.newResource();
graph.claim(folder, l0.InstanceOf, folderType);
graph.claimLiteral(folder, l0.HasName, name);
--- /dev/null
+AddUrlDocument_AddURL=Add URL\r
+AddUrlDocument_CannotAddURLLink=Cannot add URL link.\r
+AddUrlDocument_InputURL=Input URL\r
+ExportDocumentFile_CannotExportDocument=Cannot export document.\r
+ExportDocumentFolder_AcivatorCannotExport=Cannot export document folder.\r
+ExportDocumentFolder_ActivatorFolderExported=Folder exported.\r
+ExportDocumentFolder_DeleteAndExport=Delete and export\r
+ExportDocumentFolder_ExportFolder=Export folder\r
+ExportDocumentFolder_FolderExport=Folder export\r
+ExportDocumentFolder_Overwrite=Overwrite\r
+ExportDocumentFolder_SelectedFolder=Selected folder "{0}" is not empty.\r
+ImportDocument_ActivatorImportSucessful=Import successful.\r
+ImportDocument_ImportFailed=Import failed.\r
+ImportDocument_ImportFile=Import file\r
+ImportDocument_ImportingDots=Importing...\r
+ImportDocument_JobImportFiles=Import files\r
+ImportDocumentFolder_ActivatorCannotImportDocumentFolder=Cannot import document folder.\r
+ImportDocumentFolder_ActivatorFolderImported=Folder imported.\r
+ImportDocumentFolder_ImportFolder=Import folder\r
+ImportDocumentWithDetail_CannotImportDocument=Cannot import document.\r
+NewDocumentFolder_Folder=Folder\r
DocumentResource doc = DocumentResource.getInstance(graph);
if (!graph.isInstanceOf(resource, doc.Document))
return;
- result.add(new ComparableTabContributor(new DocumentPropertyTabContributor(), 1, resource, "Document"));
+ result.add(new ComparableTabContributor(new DocumentPropertyTabContributor(), 1, resource, Messages.DocumentTabContribution_Document));
}
private class DocumentPropertyTabContributor extends PropertyTabContributorImpl {
GridLayoutFactory.fillDefaults().margins(3,3).spacing(1, 1).numColumns(4).applyTo(composite);
Label label = new Label(composite, SWT.NONE);
- label.setText("Name");
+ label.setText(Messages.DocumentTabContribution_Name);
TrackedText name = new TrackedText(composite, support, SWT.BORDER);
name.setTextFactory(new StringPropertyFactory(Layer0.URIs.HasName));
support.register(validator);
Button showButton = new Button(composite, SWT.PUSH);
- showButton.setText("Show");
+ showButton.setText(Messages.DocumentTabContribution_Show);
showButton.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
DocumentResource doc;
try {
doc = DocumentResource.getInstance(context.getSession());
- new DocumentRevisionWidget(composite, support, doc.HasOlderVersion, "Old");
- new DocumentRevisionWidget(composite, support, doc.HasNewerVersion, "New");
+ new DocumentRevisionWidget(composite, support, doc.HasOlderVersion, Messages.DocumentTabContribution_Old);
+ new DocumentRevisionWidget(composite, support, doc.HasNewerVersion, Messages.DocumentTabContribution_New);
} catch (DatabaseException e1) {
- ExceptionUtils.logAndShowError("Cannot create documen version UI", e1);
+ ExceptionUtils.logAndShowError(Messages.DocumentTabContribution_CannotCreateDocumentVersionUI, e1);
}
public String perform(ReadGraph graph) throws DatabaseException {
Resource res = AdaptionUtils.adaptToSingle(forSelection, Resource.class);
if (res == null)
- return "N/A";
+ return Messages.DocumentTabContribution_6;
Layer0 l0 = Layer0.getInstance(graph);
return graph.getPossibleRelatedValue(res, l0.HasName);
}
try {
adapter.openEditor(resource);
} catch (Exception e) {
- ExceptionUtils.logAndShowError("Cannot open editor", e);
+ ExceptionUtils.logAndShowError(Messages.DocumentTabContribution_7, e);
}
}
});
label.setText(name);
text = new Text(parent, SWT.SINGLE|SWT.BORDER|SWT.READ_ONLY);
showButton = new Button(parent, SWT.PUSH);
- showButton.setText("Show");
+ showButton.setText(Messages.DocumentTabContribution_8);
showButton.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
}
});
removeButton = new Button(parent, SWT.PUSH);
- removeButton.setText("Unset");
+ removeButton.setText(Messages.DocumentTabContribution_9);
removeButton.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
});
revisionDoc = null;
} catch (DatabaseException e1) {
- ExceptionUtils.logAndShowError("Cannot remove document revision", e1);
+ ExceptionUtils.logAndShowError(Messages.DocumentTabContribution_10, e1);
}
updateUI();
}
@Override
public void exception(AsyncReadGraph graph, Throwable t) {
- ExceptionUtils.logAndShowError("Cannot show document revision", t);
+ ExceptionUtils.logAndShowError(Messages.DocumentTabContribution_11, t);
}
@Override
if (revisionDoc != null)
text.setText(revisionDoc.getName());
else
- text.setText("");
+ text.setText(""); //$NON-NLS-1$
}
private void setRevisionDoc(final Resource toSet) {
--- /dev/null
+package org.simantics.document.ui.contribution;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.contribution.messages"; //$NON-NLS-1$
+ public static String DocumentTabContribution_10;
+ public static String DocumentTabContribution_11;
+ public static String DocumentTabContribution_6;
+ public static String DocumentTabContribution_7;
+ public static String DocumentTabContribution_8;
+ public static String DocumentTabContribution_9;
+ public static String DocumentTabContribution_CannotCreateDocumentVersionUI;
+ public static String DocumentTabContribution_Document;
+ public static String DocumentTabContribution_Name;
+ public static String DocumentTabContribution_New;
+ public static String DocumentTabContribution_Old;
+ public static String DocumentTabContribution_Show;
+ public static String NameInputValidator_CannotHaveDuplicateName;
+ public static String NameInputValidator_EmptyNameNotAllowed;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import java.util.Collection;
import org.eclipse.jface.dialogs.IInputValidator;
+import org.eclipse.osgi.util.NLS;
import org.simantics.Simantics;
import org.simantics.browsing.ui.swt.widgets.impl.Widget;
import org.simantics.db.ReadGraph;
@Override
public String isValid(final String newText) {
if (newText == null || newText.length() == 0)
- return "Empty name is not allowed";
+ return Messages.NameInputValidator_EmptyNameNotAllowed;
if (selection != null) {
try {
return Simantics.getSession().syncRequest(new Read<String>() {
continue;
String n = graph.getPossibleRelatedValue(resource, l0.HasName);
if (newText.equals(n))
- return "Cannot have duplicate name " + newText;
+ return NLS.bind(Messages.NameInputValidator_CannotHaveDuplicateName, newText);
}
return null;
}
--- /dev/null
+DocumentTabContribution_10=Cannot remove document revision
+DocumentTabContribution_11=Cannot show document revision
+DocumentTabContribution_6=N/A
+DocumentTabContribution_7=Cannot open editor
+DocumentTabContribution_8=Show
+DocumentTabContribution_9=Unset
+DocumentTabContribution_CannotCreateDocumentVersionUI=Cannot create document version UI
+DocumentTabContribution_Document=Document
+DocumentTabContribution_Name=Name
+DocumentTabContribution_New=New
+DocumentTabContribution_Old=Old
+DocumentTabContribution_Show=Show
+NameInputValidator_CannotHaveDuplicateName=Cannot have duplicate name {0}
+NameInputValidator_EmptyNameNotAllowed=Empty name is not allowed
VirtualGraph vg = null;
if (useVG) {
VirtualGraphSupport support = Simantics.getSession().getService(VirtualGraphSupport.class);
- vg = support.getMemoryPersistent("document_annotation");
+ vg = support.getMemoryPersistent("document_annotation"); //$NON-NLS-1$
}
Variable annotationHolder = null;
try {
Layer0 l0 = Layer0.getInstance(graph);
Resource annotationHolderDoc = graph.newResource();
graph.claim(annotationHolderDoc, l0.InstanceOf, type);
- graph.claimLiteral(annotationHolderDoc, l0.HasName, "Template");
+ graph.claimLiteral(annotationHolderDoc, l0.HasName, "Template"); //$NON-NLS-1$
graph.claim(lib, l0.ConsistsOf, annotationHolderDoc);
if (graph.isInstanceOf(lib, type)) {
copyAnnotations(graph, lib, annotationHolderDoc);
if (useVG) {
VirtualGraphSupport support = Simantics.getSession().getService(VirtualGraphSupport.class);
- VirtualGraph vg = support.getMemoryPersistent("document_annotation");
+ VirtualGraph vg = support.getMemoryPersistent("document_annotation"); //$NON-NLS-1$
support.discard(vg);
} else {
GridDataFactory.fillDefaults().hint(500, 500).applyTo(composite);
Label label = new Label(composite, SWT.NONE);
- label.setText("File:");
+ label.setText(Messages.FileDetailDialog_File);
fileText = new Text(composite, SWT.SINGLE|SWT.BORDER);
Button browseButton = new Button(composite, SWT.PUSH);
- browseButton.setText("Browse");
+ browseButton.setText(Messages.FileDetailDialog_Browse);
label = new Label(composite, SWT.NONE);
- label.setText("Name:");
+ label.setText(Messages.FileDetailDialog_Name);
nameText = new Text(composite, SWT.SINGLE|SWT.BORDER);
label = new Label(composite, SWT.NONE);
label = new Label(composite, SWT.NONE);
- label.setText("Annotations:");
+ label.setText(Messages.FileDetailDialog_Annotations);
annotationComposite = new Composite(composite, SWT.NONE);
annotationComposite.setLayout(new FillLayout());
@Override
public void widgetSelected(SelectionEvent e) {
FileDialog dialog = new FileDialog(e.display.getActiveShell(),SWT.OPEN);
- dialog.setFilterExtensions(new String[]{"*.*"});
+ dialog.setFilterExtensions(new String[]{"*.*"}); //$NON-NLS-1$
String s = dialog.open();
if (s != null) {
name = null;
--- /dev/null
+package org.simantics.document.ui.dialogs;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.dialogs.messages"; //$NON-NLS-1$
+ public static String FileDetailDialog_Annotations;
+ public static String FileDetailDialog_Browse;
+ public static String FileDetailDialog_File;
+ public static String FileDetailDialog_Name;
+ public static String UrlDetailDialog_Annotations;
+ public static String UrlDetailDialog_Name;
+ public static String UrlDetailDialog_URL;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
GridDataFactory.fillDefaults().hint(500, 500).applyTo(composite);
Label label = new Label(composite, SWT.NONE);
- label.setText("URL:");
+ label.setText(Messages.UrlDetailDialog_URL);
urlText = new Text(composite, SWT.SINGLE|SWT.BORDER);
label = new Label(composite, SWT.NONE);
- label.setText("Name:");
+ label.setText(Messages.UrlDetailDialog_Name);
nameText = new Text(composite, SWT.SINGLE|SWT.BORDER);
label = new Label(composite, SWT.NONE);
- label.setText("Annotations:");
+ label.setText(Messages.UrlDetailDialog_Annotations);
annotationComposite = new Composite(composite, SWT.BORDER);
annotationComposite.setLayout(new FillLayout());
//
--- /dev/null
+FileDetailDialog_Annotations=Annotations:\r
+FileDetailDialog_Browse=Browse\r
+FileDetailDialog_File=File:\r
+FileDetailDialog_Name=Name:\r
+UrlDetailDialog_Annotations=Annotations:\r
+UrlDetailDialog_Name=Name:\r
+UrlDetailDialog_URL=URL:\r
Resource documentType = graph.getSingleObject(binding, DOC.DocumentTypeBinding_HasDocumentType);
Resource document = graph.newResource();
graph.claim(document, L0.InstanceOf, null, DOC.ScenegraphDocument);
- graph.claimLiteral(document, L0.HasName, "Documentation");
+ graph.claimLiteral(document, L0.HasName, "Documentation"); //$NON-NLS-1$
graph.claim(resource, DOC.HasDocumentation, document);
graph.claim(document, L0.PartOf, resource);
Resource scenegraph = graph.newResource();
graph.claim(scenegraph, L0.InstanceOf, null, documentType);
- graph.claimLiteral(scenegraph, L0.HasName, "Scenegraph");
+ graph.claimLiteral(scenegraph, L0.HasName, "Scenegraph"); //$NON-NLS-1$
graph.claim(scenegraph, L0.PartOf, document);
graph.claim(document, DOC.ScenegraphDocument_scenegraph, scenegraph);
Variable result = ScenegraphLoaderProcess.getVariable(graph, null, scenegraph, ScenegraphLoaderUtils.getRuntime(graph, context), root);
if(result != null) {
- Variable userDoc = result.getPossibleProperty(graph, "UserDocumentation");
+ Variable userDoc = result.getPossibleProperty(graph, "UserDocumentation"); //$NON-NLS-1$
if(userDoc != null) return userDoc;
}
@SCLValue(type = "ReadGraph -> Resource -> Variable -> a")
public static Object wikitextModifier(ReadGraph graph, final Resource resource, final Variable context) throws DatabaseException {
- final ScenegraphPropertyReference<String> textReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#text");
+ final ScenegraphPropertyReference<String> textReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#text"); //$NON-NLS-1$
return new FunctionImpl1<Object, Object>() {
@Override
public void perform(WriteGraph graph) throws DatabaseException {
- Variable selection = resolveEditSelection(graph, context, "..../Scroll/Browser#edited");
+ Variable selection = resolveEditSelection(graph, context, "..../Scroll/Browser#edited"); //$NON-NLS-1$
if (selection != null) {
selection.setValue(graph, (String)value, Bindings.STRING);
graph.markUndoPoint();
} else {
- LOGGER.error("No selection for resource : " + resource + ", Variable context : " + context + ", value : " + value);
+ LOGGER.error("No selection for resource : " + resource + ", Variable context : " + context + ", value : " + value); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
@SCLValue(type = "ReadGraph -> Resource -> Variable -> String")
public static String selectedDocumentPart(ReadGraph graph, Resource resource, Variable context) throws DatabaseException {
- Variable selection = resolveEditSelection(graph, context, ".../Scroll/Browser#edited");
+ Variable selection = resolveEditSelection(graph, context, ".../Scroll/Browser#edited"); //$NON-NLS-1$
if(selection == null) return null;
return selection.getValue(graph);
final ScenegraphPropertyReference<Point> selectionReference;
public WikiButtonModifier(ReadGraph graph, Variable context) throws DatabaseException {
- textReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#text");
- selectionReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#selection");
+ textReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#text"); //$NON-NLS-1$
+ selectionReference = ScenegraphLoaderUtils.getRelativePropertyReference(SWTThread.getThreadAccess(), graph, context, ".../TextContainer/Text#selection"); //$NON-NLS-1$
}
abstract void perform(String before, String selected, String after, Point selection);
void perform(String before, String selected, String after, Point selection) {
if(selected.isEmpty()) {
- textReference.setValue(before + "'''bold text'''" + after);
+ textReference.setValue(before + "'''bold text'''" + after); //$NON-NLS-1$
} else {
- textReference.setValue(before + "'''" + selected + "'''" + after);
+ textReference.setValue(before + "'''" + selected + "'''" + after); //$NON-NLS-1$ //$NON-NLS-2$
}
}
void perform(String before, String selected, String after, Point selection) {
if(selected.isEmpty()) {
- textReference.setValue(before + "''italic text''" + after);
+ textReference.setValue(before + "''italic text''" + after); //$NON-NLS-1$
} else {
- textReference.setValue(before + "''" + selected + "''" + after);
+ textReference.setValue(before + "''" + selected + "''" + after); //$NON-NLS-1$ //$NON-NLS-2$
}
}
void perform(String before, String selected, String after, Point selection) {
if(selected.isEmpty()) {
- textReference.setValue(before + "<span style=\"text-decoration:line-through;\">strikethrough text</span>" + after);
+ textReference.setValue(before + "<span style=\"text-decoration:line-through;\">strikethrough text</span>" + after); //$NON-NLS-1$
} else {
- textReference.setValue(before + "<span style=\"text-decoration:line-through;\">" + selected + "</span>" + after);
+ textReference.setValue(before + "<span style=\"text-decoration:line-through;\">" + selected + "</span>" + after); //$NON-NLS-1$ //$NON-NLS-2$
}
}
void perform(String before, String selected, String after, Point selection) {
if(selected.isEmpty()) {
- textReference.setValue(before + "<span style=\"text-decoration:underline;\">strikethrough text</span>" + after);
+ textReference.setValue(before + "<span style=\"text-decoration:underline;\">strikethrough text</span>" + after); //$NON-NLS-1$
} else {
- textReference.setValue(before + "<span style=\"text-decoration:underline;\">" + selected + "</span>" + after);
+ textReference.setValue(before + "<span style=\"text-decoration:underline;\">" + selected + "</span>" + after); //$NON-NLS-1$ //$NON-NLS-2$
}
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n<hr/>\r\n" + selected + after);
+ textReference.setValue(before + "\r\n<hr/>\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + ":" + selected + after);
+ textReference.setValue(before + ":" + selected + after); //$NON-NLS-1$
}
private String hex2(int value) {
String result = Integer.toHexString(value);
- if(result.length() == 1) result = "0" + result;
+ if(result.length() == 1) result = "0" + result; //$NON-NLS-1$
return result;
}
String hex = hex2(rgb.red) + hex2(rgb.green) + hex2(rgb.blue);
if(selected.isEmpty()) {
- textReference.setValue(before + "<font style=\"font-size:" + size + ";color: #" + hex + ";font-family:" + family + ";\" >formatted text</font>" + selected + after);
+ textReference.setValue(before + "<font style=\"font-size:" + size + ";color: #" + hex + ";font-family:" + family + ";\" >formatted text</font>" + selected + after); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
} else {
- textReference.setValue(before + "<font style=\"font-size:" + size + ";color: #" + hex + ";font-family:" + family + ";\" >" + selected + "</font>" + after);
+ textReference.setValue(before + "<font style=\"font-size:" + size + ";color: #" + hex + ";font-family:" + family + ";\" >" + selected + "</font>" + after); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$
}
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "[[Image:root://Library/image.png|100px]]" + "\r\n" + selected + after);
+ textReference.setValue(before + "[[Image:root://Library/image.png|100px]]" + "\r\n" + selected + after); //$NON-NLS-1$ //$NON-NLS-2$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n= Header 1 =\r\n" + selected + after);
+ textReference.setValue(before + "\r\n= Header 1 =\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n== Header 2 ==\r\n" + selected + after);
+ textReference.setValue(before + "\r\n== Header 2 ==\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n=== Header 3 ===\r\n" + selected + after);
+ textReference.setValue(before + "\r\n=== Header 3 ===\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n==== Header 4 ====\r\n" + selected + after);
+ textReference.setValue(before + "\r\n==== Header 4 ====\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n" +
- "# Item1\r\n" +
- "# Item2\r\n" +
- "## Item2.1\r\n" +
- "# Item3\r\n" + selected + after);
+ textReference.setValue(before + "\r\n" + //$NON-NLS-1$
+ "# Item1\r\n" + //$NON-NLS-1$
+ "# Item2\r\n" + //$NON-NLS-1$
+ "## Item2.1\r\n" + //$NON-NLS-1$
+ "# Item3\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n" +
- "* Item1\r\n" +
- "* Item2\r\n" +
- "** Item2.1\r\n" +
- "* Item3\r\n" + selected + after);
+ textReference.setValue(before + "\r\n" + //$NON-NLS-1$
+ "* Item1\r\n" + //$NON-NLS-1$
+ "* Item2\r\n" + //$NON-NLS-1$
+ "** Item2.1\r\n" + //$NON-NLS-1$
+ "* Item3\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
- textReference.setValue(before + "\r\n" +
- "{| border=\"1\"\r\n" +
- "! header\r\n" +
- "! header2 \r\n" +
- "|-\r\n" +
- "| cell || cell2\r\n" +
- "|-\r\n" +
- "| cell3\r\n" +
- "| cell4\r\n" +
- "|}\r\n" + selected + after);
+ textReference.setValue(before + "\r\n" + //$NON-NLS-1$
+ "{| border=\"1\"\r\n" + //$NON-NLS-1$
+ "! header\r\n" + //$NON-NLS-1$
+ "! header2 \r\n" + //$NON-NLS-1$
+ "|-\r\n" + //$NON-NLS-1$
+ "| cell || cell2\r\n" + //$NON-NLS-1$
+ "|-\r\n" + //$NON-NLS-1$
+ "| cell3\r\n" + //$NON-NLS-1$
+ "| cell4\r\n" + //$NON-NLS-1$
+ "|}\r\n" + selected + after); //$NON-NLS-1$
}
@Override
void perform(String before, String selected, String after, Point selection) {
textReference.setValue(before +
- "[[Media:root://Documents/Document.pdf|Link to a file within the model]]\r\n" + selected + after);
+ "[[Media:root://Documents/Document.pdf|Link to a file within the model]]\r\n" + selected + after); //$NON-NLS-1$
}
};
void perform(String before, String selected, String after, Point selection) {
textReference.setValue(before +
- "[http://www.simantics.org External Website Link]\r\n" + selected + after);
+ "[http://www.simantics.org External Website Link]\r\n" + selected + after); //$NON-NLS-1$
}
try {
WorkbenchUtils.openEditor(editorId, new ResourceEditorInput2(editorId, root, root, rvi));
} catch (PartInitException e) {
- LOGGER.error("Failed to open CSS editor for root " + root, e);
+ LOGGER.error("Failed to open CSS editor for root " + root, e); //$NON-NLS-1$
}
});
public static String noDocumentText(ReadGraph graph, final Resource resource, final Variable context) throws DatabaseException {
Variable selection = ScenegraphLoaderUtils.getPossibleVariableSelection(graph, context);
- if(selection == null) return "<no input>";
+ if(selection == null) return "<no input>"; //$NON-NLS-1$
Resource input = selection.getRepresents(graph);
- if(input == null) return "<no input>";
+ if(input == null) return "<no input>"; //$NON-NLS-1$
String path = DocumentUtils.indexRootPath(graph, selection);
if(!path.isEmpty()) {
- return "for " + path + selection.getName(graph);
+ return "for " + path + selection.getName(graph); //$NON-NLS-1$
}
- return "for " + NameUtils.getSafeLabel(graph, input);
+ return "for " + NameUtils.getSafeLabel(graph, input); //$NON-NLS-1$
}
DefaultActions.asyncPerformDefaultAction(s, input, false, false, false);
}
} catch (DatabaseException | InterruptedException e) {
- Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Failed to resolve URI to a database resource or variable: " + uri, e));
+ Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Failed to resolve URI to a database resource or variable: " + uri, e)); //$NON-NLS-1$
}
}
return true;
public SearchResult apply(IProgressMonitor monitor, ReadGraph graph, Resource model, SearchQuery query, Integer maxResults) {
try {
Collection<Map<String, Object>> results = Searching.performSearch(graph, Layer0X.getInstance(graph).Dependencies, model,
- query.escaped(false).getQuery("Name","Types"), maxResults);
+ query.escaped(false).getQuery("Name","Types"), maxResults); //$NON-NLS-1$ //$NON-NLS-2$
return generateSearchResults(graph, results);
} catch (DatabaseException e) {
Logger.defaultLogError(e);
public static void createNewVersion(WriteGraph graph, Resource oldDocument, Resource newDocument, Resource relation) throws DatabaseException{
DocumentResource doc = DocumentResource.getInstance(graph);
if (graph.hasStatement(oldDocument, doc.HasNewerVersion))
- throw new DatabaseException("Document " + NameUtils.getSafeName(graph, oldDocument) +" has already new version");
+ throw new DatabaseException("Document " + NameUtils.getSafeName(graph, oldDocument) +" has already new version"); //$NON-NLS-1$ //$NON-NLS-2$
Resource inverse = graph.getInverse(relation);
Resource lib = graph.getSingleObject(oldDocument, inverse);
if (!graph.getSingleType(document2, doc.Document).equals(graph.getSingleType(document1, doc.Document)))
return;
if (!versionRel.equals(doc.HasNewerVersion) && !(versionRel.equals(doc.HasOlderVersion)))
- throw new IllegalArgumentException("Unknow version relation + " + graph.getPossibleURI(versionRel));
+ throw new IllegalArgumentException("Unknow version relation + " + graph.getPossibleURI(versionRel)); //$NON-NLS-1$
Resource versionRelInv = graph.getInverse(versionRel);
// toSet must not be part of the document's version history
if (lib != null) {
Resource relation = graph.getPossibleObject(lib, doc.HasLibraryRelation);
String type= graph.getPossibleRelatedValue(lib, doc.HasVersionType);
- if ("TREE".equals(type) && relation != null) {
+ if ("TREE".equals(type) && relation != null) { //$NON-NLS-1$
if (versionRel.equals(doc.HasOlderVersion)) {
graph.deny(document2, graph.getInverse(relation));
graph.claim(document1,relation,document2);
public static void unsetVersion(WriteGraph graph, Resource document1, Resource document2, Resource versionRel) throws DatabaseException {
DocumentResource doc = DocumentResource.getInstance(graph);
if (!versionRel.equals(doc.HasNewerVersion) && !(versionRel.equals(doc.HasOlderVersion)))
- throw new IllegalArgumentException("Unknow version relation + " + graph.getPossibleURI(versionRel));
+ throw new IllegalArgumentException("Unknow version relation + " + graph.getPossibleURI(versionRel)); //$NON-NLS-1$
graph.deny(document1, versionRel,document2);
Resource lib = getLib(graph, document1);
if (lib != null) {
Resource relation = graph.getPossibleObject(lib, doc.HasLibraryRelation);
String type= graph.getPossibleRelatedValue(lib, doc.HasVersionType);
- if ("TREE".equals(type) && relation != null) {
+ if ("TREE".equals(type) && relation != null) { //$NON-NLS-1$
if (versionRel.equals(doc.HasOlderVersion)) {
graph.deny(document1, relation);
graph.claim(lib,relation,document2);
private static ExternalFileWatcher fileWatcher;
public ExternalEditorAdapter() {
- super("External Editor", Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/page.png"));
+ super(Messages.ExternalEditorAdapter_ExternalEditor, Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/page.png")); //$NON-NLS-2$ //$NON-NLS-3$
}
@Override
StringBuilder sb = new StringBuilder();
String uri = graph.getPossibleURI(input);
if (uri != null) {
- sb.append(generateSHA1(uri)).append("_");
+ sb.append(generateSHA1(uri)).append("_"); //$NON-NLS-1$
}
sb.append(graph.getRelatedValue(input, Layer0.getInstance(graph).HasName).toString());
Path filePath = Activator.getInstanceLocation().resolve(sb.toString());
try {
GraphFileUtil.writeDataToFile(graph, input, filePath.toFile());
} catch (IOException | DatabaseException e) {
- LOGGER.error("Could not write data to file ", e);
+ LOGGER.error("Could not write data to file ", e); //$NON-NLS-1$
}
return input;
});
- LOGGER.info("Adding tempFile {} with resource {}", filePath, input);
+ LOGGER.info("Adding tempFile {} with resource {}", filePath, input); //$NON-NLS-1$
return filePath;
}
});
}
public static String generateSHA1(String message) {
- return hashString(message, "SHA-1");
+ return hashString(message, "SHA-1"); //$NON-NLS-1$
}
private static String hashString(String message, String algorithm) {
try {
MessageDigest digest = MessageDigest.getInstance(algorithm);
- byte[] hashedBytes = digest.digest(message.getBytes("UTF-8"));
+ byte[] hashedBytes = digest.digest(message.getBytes("UTF-8")); //$NON-NLS-1$
return convertByteArrayToHexString(hashedBytes);
} catch (NoSuchAlgorithmException | UnsupportedEncodingException ex) {
// Should not happen
- LOGGER.error("Could not generate hash", ex);
+ LOGGER.error("Could not generate hash", ex); //$NON-NLS-1$
}
- return "";
+ return ""; //$NON-NLS-1$
}
private static String convertByteArrayToHexString(byte[] arrayBytes) {
Path parent = keys.get(key);
Path newPath = parent.resolve(pathEvent.context());
if (ENTRY_MODIFY == kind) {
- LOGGER.info("New path modified: " + newPath);
+ LOGGER.info("New path modified: " + newPath); //$NON-NLS-1$
Resource resource = tempFiles.get(newPath);
if (resource != null) {
GraphFileUtil.writeDataToGraph(newPath.toFile(), resource);
} else {
- LOGGER.warn("No resource found for {}", newPath.toAbsolutePath());
+ LOGGER.warn("No resource found for {}", newPath.toAbsolutePath()); //$NON-NLS-1$
}
} else if (ENTRY_DELETE == kind) {
- System.out.println("New path deleted: " + newPath);
+ System.out.println("New path deleted: " + newPath); //$NON-NLS-1$
}
}
if (!key.reset()) {
}
} catch (InterruptedException e) {
if (!stopped.get())
- LOGGER.error("Could not stop", e);
+ LOGGER.error("Could not stop", e); //$NON-NLS-1$
} catch (Throwable t) {
- LOGGER.error("An error occured", t);
+ LOGGER.error("An error occured", t); //$NON-NLS-1$
}
}
});
private void register(Path path) throws IOException {
if (Files.isDirectory(path)) {
- LOGGER.info("Registering path {}", path);
+ LOGGER.info("Registering path {}", path); //$NON-NLS-1$
WatchKey key = path.toAbsolutePath().register(ws, ENTRY_DELETE, ENTRY_MODIFY);
keys.put(key, path);
}
import java.util.Set;
import org.eclipse.core.runtime.IProgressMonitor;
+import org.eclipse.osgi.util.NLS;
import org.simantics.Simantics;
import org.simantics.db.ReadGraph;
import org.simantics.db.Resource;
}
}, e -> {
if (e != null)
- ExceptionUtils.logAndShowError("Cannot import file " + fileName, e);
+ ExceptionUtils.logAndShowError(NLS.bind(Messages.FileDocumentUtil_CannotImportFile, fileName), e);
});
public static void importFolder(WriteGraph graph, File folder, Resource folderResource, Resource relation, IProgressMonitor monitor) throws Exception{
if (monitor != null) {
int count = _countFiles(folder);
- monitor.beginTask("Import files", count);
+ monitor.beginTask(Messages.FileDocumentUtil_MonitorImportFiles, count);
}
_importFolder(graph, folder, folderResource, relation, monitor);
if (monitor != null)
return;
int i = 1;
while (true) {
- String proposal = name +" (" + i +")";
+ String proposal = name +" (" + i +")"; //$NON-NLS-1$ //$NON-NLS-2$
if (!names.contains(proposal)) {
graph.claimLiteral(res, l0.HasName, proposal);
return;
name = graph.getRelatedValue(r, useResourceNames ? gf.HasResourceName : l0.HasName);
canExport = true;
} else if (graph.isInstanceOf(r, doc.UrlDocument)) {
- name = graph.getRelatedValue(r, l0.HasName) +".url";
+ name = graph.getRelatedValue(r, l0.HasName) +".url"; //$NON-NLS-1$
canExport = true;
}
if (canExport) {
name = resolveName(folder, name, names, true);
- File file = new File(folder.getAbsolutePath()+"/"+name);
+ File file = new File(folder.getAbsolutePath()+"/"+name); //$NON-NLS-1$
if (graph.isInstanceOf(r, doc.FileDocument)) {
GraphFileUtil.writeDataToFile(graph,r, file);
} else if (graph.isInstanceOf(r, doc.UrlDocument)) {
if (type.size() == folderType.size() && folderType.containsAll(type)) {
String name = graph.getRelatedValue(r, l0.HasName);
name = resolveName(folder, name, names, false);
- File subFolder = new File(folder.getAbsolutePath()+"/"+name);
+ File subFolder = new File(folder.getAbsolutePath()+"/"+name); //$NON-NLS-1$
if (!subFolder.exists()) {
if (!subFolder.mkdir()) {
// TODO : error.
* @throws DatabaseException
*/
private static void exportUrl(File toFile, String name, String url) throws Exception{
- PrintStream os = new PrintStream(toFile,"UTF-8");
- os.println("[InternetShortcut]");
- os.println("URL="+url);
- os.println("name="+name);
+ PrintStream os = new PrintStream(toFile,"UTF-8"); //$NON-NLS-1$
+ os.println("[InternetShortcut]"); //$NON-NLS-1$
+ os.println("URL="+url); //$NON-NLS-1$
+ os.println("name="+name); //$NON-NLS-1$
os.flush();
os.close();
}
String name = null;
BufferedReader is = null;
try {
- is = new BufferedReader(new InputStreamReader(new FileInputStream(file), "UTF-8"));
+ is = new BufferedReader(new InputStreamReader(new FileInputStream(file), "UTF-8")); //$NON-NLS-1$
while ((s = is.readLine()) != null) {
- if (s.startsWith("URL=")) {
+ if (s.startsWith("URL=")) { //$NON-NLS-1$
url = s.substring(4);
- } else if (s.startsWith("name=")) {
+ } else if (s.startsWith("name=")) { //$NON-NLS-1$
name = s.substring(5);
}
}
}
private static boolean isUrl(File file) throws Exception{
- return (file.getAbsolutePath().endsWith(".url"));
+ return (file.getAbsolutePath().endsWith(".url")); //$NON-NLS-1$
}
private static final char ESCAPE = '%';
for (int i = 0; i < len; i++) {
char ch = s.charAt(i);
if (ch == ESCAPE) {
- String num = "0x";
+ String num = "0x"; //$NON-NLS-1$
num += s.charAt(++i);
num += s.charAt(++i);
ch = (char)Integer.decode(num).intValue();
if (used.contains(current)) {
current = createFileName(proposal, i);
} else {
- File subFile = new File(parentFolder.getAbsolutePath()+"/"+current);
+ File subFile = new File(parentFolder.getAbsolutePath()+"/"+current); //$NON-NLS-1$
if (!subFile.exists())
break;
if (subFile.exists() && subFile.isFile() && subFile.canWrite()) {
if (used.contains(current)) {
current = proposal+i;
} else {
- File subFolder = new File(parentFolder.getAbsolutePath()+"/"+current);
+ File subFolder = new File(parentFolder.getAbsolutePath()+"/"+current); //$NON-NLS-1$
if (!subFolder.exists())
break;
if (subFolder.exists() && subFolder.isDirectory()) {
}
private static String createFileName(String original, int i) {
- int extIndex = original.lastIndexOf(".");
+ int extIndex = original.lastIndexOf("."); //$NON-NLS-1$
if (extIndex == -1)
return original+i;
return original.substring(0,extIndex) + i + original.substring(extIndex);
--- /dev/null
+package org.simantics.document.ui.graphfile;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.graphfile.messages"; //$NON-NLS-1$
+ public static String ExternalEditorAdapter_ExternalEditor;
+ public static String FileDocumentUtil_CannotImportFile;
+ public static String FileDocumentUtil_MonitorImportFiles;
+ public static String UrlEditorAdapter_Browser;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public class UrlEditorAdapter extends AbstractResourceEditorAdapter implements EditorAdapter {
public UrlEditorAdapter() {
- super("Browser",Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/world.png"));
+ super(Messages.UrlEditorAdapter_Browser,Activator.imageDescriptorFromPlugin("com.famfamfam.silk", "icons/world.png")); //$NON-NLS-2$ //$NON-NLS-3$
}
--- /dev/null
+ExternalEditorAdapter_ExternalEditor=External Editor
+FileDocumentUtil_CannotImportFile=Cannot import file {0}
+FileDocumentUtil_MonitorImportFiles=Import files
+UrlEditorAdapter_Browser=Browser
--- /dev/null
+DocumentView_PinSelection=Pin Selection
+OpenEntityDocumentAdapter_DocumentEditor=Document Editor
FileSelectionPage fileSelectionPage;
public FileDocumentImportWizard(Resource lib) {
- setWindowTitle("Document File import");
+ setWindowTitle(Messages.FileDocumentImportWizard_DocumentFileImport);
setNeedsProgressMonitor(false);
}
String fileName;
public FileSelectionPage() {
- super("FileSelction","Select a file",null);
+ super(Messages.FileSelectionPage_FileSelection,Messages.FileSelectionPage_SelectAFile,null);
}
@Override
parent.setLayout(new GridLayout(3,false));
fileText = new Text(parent,SWT.BORDER|SWT.SINGLE);
browseButton = new Button(parent, SWT.PUSH);
- browseButton.setText("Browse");
+ browseButton.setText(Messages.FileSelectionPage_Browse);
GridData data;
data = new GridData();
// TODO : is there any way to read file/executable bindings from OS?
// if is, use those extensions to filter this list.
// note: in windows using "reg query ..." to read bindings form registry would work.
- dialog.setFilterExtensions(new String[]{"*.*"});
+ dialog.setFilterExtensions(new String[]{"*.*"}); //$NON-NLS-1$
String name = dialog.open();
if (name != null) {
fileText.setText(name);
--- /dev/null
+package org.simantics.document.ui.wizard;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.document.ui.wizard.messages"; //$NON-NLS-1$
+ public static String FileDocumentImportWizard_DocumentFileImport;
+ public static String FileSelectionPage_Browse;
+ public static String FileSelectionPage_FileSelection;
+ public static String FileSelectionPage_SelectAFile;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+FileDocumentImportWizard_DocumentFileImport=Document File import\r
+FileSelectionPage_Browse=Browse\r
+FileSelectionPage_FileSelection=FileSelction\r
+FileSelectionPage_SelectAFile=Select a file\r
public class ContentSelectionPage extends WizardPage {
/** Key for preference setting that contains sub-mementos for each content URI. */
- public static final String KEY_FORMAT_SELECTIONS = "org.simantics.modeling.ui.export.wizard.formatSelections";
+ public static final String KEY_FORMAT_SELECTIONS = "org.simantics.modeling.ui.export.wizard.formatSelections"; //$NON-NLS-1$
// UI stuff
LocalResourceManager resourceManager;
List<Content> contentSelection = new ArrayList<Content>();
public ContentSelectionPage(ExportContext ctx) throws ExportException {
- super("Select Content", "Select the PDF Pages and the attachments", null);
+ super(Messages.ContentSelectionPage_SelectContent, Messages.ContentSelectionPage_SelectContentDescription, null);
this.ctx = ctx;
init();
void init() throws ExportException {
try {
- System.out.println("Found Content Types:");
+ System.out.println("Found Content Types:"); //$NON-NLS-1$
for ( ContentType ct : ctx.eep.contentTypes() ) {
- System.out.println(" "+ct);
+ System.out.println(" "+ct); //$NON-NLS-1$
}
System.out.println();
- System.out.println("Exporters:");
+ System.out.println("Exporters:"); //$NON-NLS-1$
for ( Exporter ex : ctx.eep.exporters() ) {
- System.out.println(" "+ex);
+ System.out.println(" "+ex); //$NON-NLS-1$
}
System.out.println();
- System.out.println("Formats:");
+ System.out.println("Formats:"); //$NON-NLS-1$
for ( Format format : ctx.eep.formats() ) {
- System.out.println(" "+format);
+ System.out.println(" "+format); //$NON-NLS-1$
}
System.out.println();
- System.out.println("Discoverers:");
+ System.out.println("Discoverers:"); //$NON-NLS-1$
for ( Discoverer discoverer : ctx.eep.discoverers() ) {
- System.out.println(" "+discoverer);
+ System.out.println(" "+discoverer); //$NON-NLS-1$
}
System.out.println();
- System.out.println("Publishers:");
+ System.out.println("Publishers:"); //$NON-NLS-1$
for ( Publisher publisher : ctx.eep.publishers() ) {
- System.out.println(" "+publisher.id());
+ System.out.println(" "+publisher.id()); //$NON-NLS-1$
}
System.out.println();
// Organize formats by content types - Filter out ContentTypes that don't have exporter and format.
- System.out.println("Mapped ContentTypes to Exporters:");
+ System.out.println("Mapped ContentTypes to Exporters:"); //$NON-NLS-1$
typeToFormatMap = MapList.use( new TreeMap<ContentType, List<Format>>(toStringComparator) );
for ( ContentType ct : ctx.eep.contentTypes() ) {
for ( Exporter exp : ctx.eep.getExportersForContentType( ct.id() ) ) {
Format format = ctx.eep.getFormat( exp.formatId() );
if ( format==null ) continue;
- System.out.println(" "+ct.id()+" -> "+format.fileext());
+ System.out.println(" "+ct.id()+" -> "+format.fileext()); //$NON-NLS-1$ //$NON-NLS-2$
if (!typeToFormatMap.contains(ct, format)) typeToFormatMap.add(ct, format);
}
}
for ( String content : ctx.selection ) {
initialContentHash = 13*initialContentHash + content.hashCode();
}
- initialSelectionKey = "InitialSelection-"+initialContentHash;
+ initialSelectionKey = "InitialSelection-"+initialContentHash; //$NON-NLS-1$
String sel = ctx.store.get(initialSelectionKey, null);
if ( sel != null ) {
initialSelection = ExportWizardResult.parse(sel);
// First time wizard was called with this selection.
// Check in
for ( String contentUri : ctx.selection ) {
- initialSelection.add( new Content(contentUri, null, "all", null, null, null) );
+ initialSelection.add( new Content(contentUri, null, "all", null, null, null) ); //$NON-NLS-1$
}
}
StringBuilder modelsStr = new StringBuilder();
for ( String content : ctx.selection ) {
for ( String model : allModels ) {
- if ( content.equals(model) || content.startsWith(model + "/") ) {
+ if ( content.equals(model) || content.startsWith(model + "/") ) { //$NON-NLS-1$
if ( !selectedModels.contains( model ) ) {
selectedModels.add( model );
- if ( modelsStr.length()>0 ) modelsStr.append(", ");
+ if ( modelsStr.length()>0 ) modelsStr.append(", "); //$NON-NLS-1$
modelsStr.append( model );
}
}
if ( selectedModels.isEmpty() ) selectedModels.addAll( allModels );
// UI labels
labels = new HashMap<String, Map<String, String>>();
- labels.put( "model", ctx.session.syncRequest( ExportQueries.labels( selectedModels ) ) ); // Should Model CT be used for labeling?
+ labels.put( "model", ctx.session.syncRequest( ExportQueries.labels( selectedModels ) ) ); // Should Model CT be used for labeling? //$NON-NLS-1$
// Discover contents
- System.out.println("Discovering content: "+modelsStr);
+ System.out.println("Discovering content: "+modelsStr); //$NON-NLS-1$
content = MapList.use( new TreeMap<ContentType, List<String>>(toStringComparator) );
contentToTypeMap = MapList.use( new TreeMap<String, List<ContentType>>(toStringComparator) );
modelContent = MapList.use( new TreeMap<String, List<String>>() );
for ( ContentType ct : typeToFormatMap.getKeys() ) {
- System.out.println(" "+ct.label());
+ System.out.println(" "+ct.label()); //$NON-NLS-1$
for ( Discoverer discoverer : ctx.eep.getDiscoverers( ct.id() )) {
- System.out.println(" "+discoverer.toString());
+ System.out.println(" "+discoverer.toString()); //$NON-NLS-1$
// Get content Uris
Collection<String> contents = discoverer.discoverContent(ctx, selectedModels);
content.add( ct, contentId );
contentToTypeMap.add(contentId, ct);
//modelContent.add(key)
- System.out.println(" "+contentId);
+ System.out.println(" "+contentId); //$NON-NLS-1$
}
}
Color contentTypeColor = resourceManager.createColor( new RGB(245, 245, 252) );
GridColumn column = new GridColumn(grid,SWT.NONE);
column.setTree(true);
- column.setText("Name");
+ column.setText(Messages.ContentSelectionPage_Name);
column.setWidth(200);
// "Pagees"
assertColumnIndex(1);
- Format pdfFormat = ctx.eep.getFormat("pdf");
+ Format pdfFormat = ctx.eep.getFormat("pdf"); //$NON-NLS-1$
ImageDescriptor folderID = null;
try {
- URL folderUrl = new URL("platform:/plugin/com.famfamfam.silk/icons/folder.png");
+ URL folderUrl = new URL("platform:/plugin/com.famfamfam.silk/icons/folder.png"); //$NON-NLS-1$
folderID = ImageDescriptor.createFromURL( folderUrl );
} catch (MalformedURLException e) {
e.printStackTrace();
if (modelContentType==null) continue;
// Create Model Node
- String modelLabel = labels.get("model").get(modelUri);
+ String modelLabel = labels.get("model").get(modelUri); //$NON-NLS-1$
GridItem modelNode = newLine(grid, modelLabel, modelUri, modelContentType.id());
setIcon(modelNode, 0, modelContentType.icon(modelUri));
modelNode.setToolTipText(0, modelUri);
columnNumber++;
assertColumnIndex( columnNumber );
- contentNode.setText(columnNumber, " "+pdfFormat.fileext());
+ contentNode.setText(columnNumber, " "+pdfFormat.fileext()); //$NON-NLS-1$
contentNode.setGrayed(columnNumber, false);
contentNode.setCheckable(columnNumber, true);
contentNode.setChecked(columnNumber, hasInitialSelection(contentUri, pdfFormat.id()) );
if ( !contentTypesFormats.contains(format) ) contentTypesFormats.add(format);
columnNumber++;
assertColumnIndex( columnNumber );
- contentNode.setText(columnNumber, " "+format.fileext());
+ contentNode.setText(columnNumber, " "+format.fileext()); //$NON-NLS-1$
contentNode.setGrayed(columnNumber, false);
contentNode.setCheckable(columnNumber, true);
contentNode.setChecked(columnNumber, hasInitialSelection(contentUri, format.id()) );
int cc = grid.getColumnCount();
GridColumn column = new GridColumn(grid, SWT.CHECK);
- column.setText( cc==1?"Pages":"Attachments");
+ column.setText( cc==1?Messages.ContentSelectionPage_Pages:Messages.ContentSelectionPage_Attachments);
column.setWidth( cc==1?150:200 );
for (GridItem gi : grid.getItems()) {
boolean hasInitialSelection(String uri, String formatId) {
for (Content c : initialSelection) {
if ( !c.url.equals( uri ) ) continue;
- if ( c.formatId.equals("all") || c.formatId.equals(formatId) ) return true;
+ if ( c.formatId.equals("all") || c.formatId.equals(formatId) ) return true; //$NON-NLS-1$
}
return false;
}
import org.eclipse.jface.wizard.IWizardPage;
import org.eclipse.jface.wizard.Wizard;
import org.eclipse.jface.wizard.WizardPage;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.ui.IExportWizard;
import org.eclipse.ui.IWorkbench;
import org.osgi.service.prefs.BackingStoreException;
OptionsPage optionsPage;
public ExportCoreWizard() {
- setWindowTitle("Export PDF files");
+ setWindowTitle(Messages.ExportCoreWizard_ExportPDFFiles);
setNeedsProgressMonitor(true);
}
if ( !exportProblems.isEmpty() ) {
CollectionUtils.unique(exportProblems);
WizardPage cp = (WizardPage) getContainer().getCurrentPage();
- String str = CollectionUtils.toString(exportProblems, "\n");
+ String str = CollectionUtils.toString(exportProblems, "\n"); //$NON-NLS-1$
cp.setErrorMessage( str );
return false;
}
try {
ctx.store.flush();
} catch (BackingStoreException e) {
- ErrorLogger.defaultLogError("Failed to persist wizard preferences.", e);
+ ErrorLogger.defaultLogError(Messages.ExportCoreWizard_FailedToSavePreferences, e);
ExceptionUtils.logError(e);
}
} catch (InvocationTargetException e) {
}
if (canceled[0]) {
- cp.setErrorMessage("Export canceled.");
+ cp.setErrorMessage(Messages.ExportCoreWizard_FailedToPersistWizardPrefs);
} else if (t instanceof IOException) {
- ErrorLogger.defaultLogError("An I/O problem occurred while exporting the model. See exception for details.", t);
- cp.setErrorMessage("An I/O problem occurred while exporting the model.\nMessage: " + t.getMessage());
+ ErrorLogger.defaultLogError("An I/O problem occurred while exporting the model. See exception for details.", t); //$NON-NLS-1$
+ cp.setErrorMessage(NLS.bind(Messages.ExportCoreWizard_IOProblem, t.getMessage()));
} else {
- ErrorLogger.defaultLogError("Unexpected exception while exporting the model. See exception for details.", t);
- cp.setErrorMessage("Unexpected exception while exporting the model. See error log for details.\nMessage: " + t.getMessage());
+ ErrorLogger.defaultLogError("Unexpected exception while exporting the model. See exception for details.", t); //$NON-NLS-1$
+ cp.setErrorMessage(NLS.bind(Messages.ExportCoreWizard_UnexpectedException, t.getMessage()));
}
return false;
} catch (InterruptedException e) {
--- /dev/null
+package org.simantics.export.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.export.ui.messages"; //$NON-NLS-1$
+ public static String ContentSelectionPage_Attachments;
+ public static String ContentSelectionPage_Name;
+ public static String ContentSelectionPage_Pages;
+ public static String ContentSelectionPage_SelectContent;
+ public static String ContentSelectionPage_SelectContentDescription;
+ public static String ExportCoreWizard_FailedToSavePreferences;
+ public static String ExportCoreWizard_ExportPDFFiles;
+ public static String ExportCoreWizard_FailedToPersistWizardPrefs;
+ public static String ExportCoreWizard_IOProblem;
+ public static String ExportCoreWizard_UnexpectedException;
+ public static String OptionsPage_ExportAttachmentOf;
+ public static String OptionsPage_IncludeAttachmentTo;
+ public static String OptionsPage_Merge;
+ public static String OptionsPage_OptionsPage;
+ public static String OptionsPage_OutputOptions;
+ public static String OptionsPage_PublishTo;
+ public static String OptionsPage_SelectExportOptions;
+ public static String OptionsPage_UnExpectedError;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import java.util.regex.Pattern;
import org.eclipse.jface.wizard.WizardPage;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.custom.ScrolledComposite;
import org.eclipse.swt.layout.GridData;
*/
public class OptionsPage extends WizardPage {
- public static String S_OUTPUT_OPTIONS = "Output Options";
+ public static String S_OUTPUT_OPTIONS = Messages.OptionsPage_OutputOptions;
public static LabelReference P_OUTPUT_OPTIONS = new LabelReference( S_OUTPUT_OPTIONS );
/** A reference to combo box selection */
- public static String S_PUBLISH = "Publish to";
+ public static String S_PUBLISH = Messages.OptionsPage_PublishTo;
public static ChildReference P_PUBLISH = ChildReference.compile(P_OUTPUT_OPTIONS, new LabelReference(S_PUBLISH));
ExportContext ctx;
String selectedPublisherId;
public OptionsPage(ExportContext ctx) throws ExportException {
- super("Options page", "Select export options", null);
+ super(Messages.OptionsPage_OptionsPage, Messages.OptionsPage_SelectExportOptions, null);
this.ctx = ctx;
}
public void handleEvent(Event event) {
updatingForm = true;
try {
- Preferences contentScopePrefs = ctx.store.node( "Selection-"+selectionHash );
+ Preferences contentScopePrefs = ctx.store.node( "Selection-"+selectionHash ); //$NON-NLS-1$
Preferences workspaceScopePrefs = ctx.store;
Composite outputOptions = (Composite) form.getControl(composite, P_OUTPUT_OPTIONS);
updatingForm = false;
validate();
} catch ( BindingException e ) {
- setErrorMessage( e.getClass().getName()+": "+ e.getMessage() );
+ setErrorMessage( e.getClass().getName()+": "+ e.getMessage() ); //$NON-NLS-1$
ExceptionUtils.logError(e);
} catch (AccessorConstructionException e) {
- setErrorMessage( e.getClass().getName()+": "+ e.getMessage() );
+ setErrorMessage( e.getClass().getName()+": "+ e.getMessage() ); //$NON-NLS-1$
ExceptionUtils.logError(e);
} catch (AccessorException e) {
- setErrorMessage( e.getClass().getName()+": "+ e.getMessage() );
+ setErrorMessage( e.getClass().getName()+": "+ e.getMessage() ); //$NON-NLS-1$
ExceptionUtils.logError(e);
} catch (ExportException e) {
- setErrorMessage( e.getClass().getName()+": "+ e.getMessage() );
+ setErrorMessage( e.getClass().getName()+": "+ e.getMessage() ); //$NON-NLS-1$
ExceptionUtils.logError(e);
} finally {
updatingForm = false;
for ( Format format : formats ) {
if ( format.isGroupFormat() && contentByFormat.getValues(format).size()>1 ) {
- outputOptions.addComponent("Merge "+format.fileext()+" content into one file", Datatypes.BOOLEAN);
+ outputOptions.addComponent(NLS.bind(Messages.OptionsPage_Merge, format.fileext()), Datatypes.BOOLEAN); //$NON-NLS-2$
}
if ( format.isContainerFormat() ) {
}
if ( attachmentCount > 0 ) {
- outputOptions.addComponent("Include attachments to "+format.fileext(), Datatypes.BOOLEAN);
- outputOptions.addComponent("Export attachments of "+format.fileext()+" to separate files", Datatypes.BOOLEAN);
+ outputOptions.addComponent(NLS.bind(Messages.OptionsPage_IncludeAttachmentTo, format.fileext()), Datatypes.BOOLEAN);
+ outputOptions.addComponent(NLS.bind(Messages.OptionsPage_ExportAttachmentOf, format.fileext()), Datatypes.BOOLEAN);
}
}
}
{
selection = contents;
Preferences workspaceScopePrefs = ctx.store;
- Preferences contentScopePrefs = ctx.store.node( "Selection-"+selectionHash );
- selectedPublisherId = ctx.store.get("publisherId", "");
+ Preferences contentScopePrefs = ctx.store.node( "Selection-"+selectionHash ); //$NON-NLS-1$
+ selectedPublisherId = ctx.store.get("publisherId", ""); //$NON-NLS-1$ //$NON-NLS-2$
Publisher publisher = ctx.eep.getPublisher(selectedPublisherId);
if ( publisher != null ) {
} catch (BindingException e) {
ExceptionUtils.logError(e);
- ShowMessage.showError("Unexpected error", e.getClass().getName()+" "+e.getMessage());
+ ShowMessage.showError(Messages.OptionsPage_UnExpectedError, e.getClass().getName()+" "+e.getMessage()); //$NON-NLS-2$
throw new RuntimeBindingException(e);
} catch (ExportException e) {
ExceptionUtils.logError(e);
- ShowMessage.showError("Unexpected error", e.getClass().getName()+" "+e.getMessage());
+ ShowMessage.showError(Messages.OptionsPage_UnExpectedError, e.getClass().getName()+" "+e.getMessage()); //$NON-NLS-2$
} catch (DatatypeConstructionException e) {
ExceptionUtils.logError(e);
- ShowMessage.showError("Unexpected error", e.getClass().getName()+" "+e.getMessage());
+ ShowMessage.showError(Messages.OptionsPage_UnExpectedError, e.getClass().getName()+" "+e.getMessage()); //$NON-NLS-2$
} catch (AccessorConstructionException e) {
ExceptionUtils.logError(e);
- ShowMessage.showError("Unexpected error", e.getClass().getName()+" "+e.getMessage());
+ ShowMessage.showError(Messages.OptionsPage_UnExpectedError, e.getClass().getName()+" "+e.getMessage()); //$NON-NLS-2$
} catch (AccessorException e) {
ExceptionUtils.logError(e);
// TODO Auto-generated catch block
result.accessor = Accessors.getAccessor(result.options);
result.contents = selection;
result.type = (RecordType) options.type();
- result.publisherId = "file";
+ result.publisherId = "file"; //$NON-NLS-1$
List<ExportAction> actions = new ArrayList<ExportAction>();
List<Content> manifest = new ArrayList<Content>();
String publisherLabel = ExporterUtils.getUnionValue(result.accessor, P_PUBLISH);
Publisher publisher = ctx.eep.getPublisherByLabel(publisherLabel);
- result.publisherId = publisher==null?"":publisher.id();
+ result.publisherId = publisher==null?"":publisher.id(); //$NON-NLS-1$
} catch (BindingException e) {
throw new ExportException(e);
}
- setErrorMessage( errs.isEmpty() ? null : CollectionUtils.toString(errs, ", ") );
+ setErrorMessage( errs.isEmpty() ? null : CollectionUtils.toString(errs, ", ") ); //$NON-NLS-1$
setPageComplete( errs.isEmpty() );
}
RecordAccessor ra = Accessors.getAccessor(options);
String publisherId = ExporterUtils.getUnionValue(ra, P_PUBLISH);
Publisher publisher = ctx.eep.getPublisherByLabel(publisherId);
- if ( publisher!=null ) workspaceScopePrefs.put("publisherId", publisher.id());
+ if ( publisher!=null ) workspaceScopePrefs.put("publisherId", publisher.id()); //$NON-NLS-1$
if ( ra.type().hasComponent(P_OUTPUT_OPTIONS.label) ) {
RecordAccessor rao = ra.getComponent( P_OUTPUT_OPTIONS );
- Pattern merge_pattern = Pattern.compile("Merge ([^\\s]*) content into one file");
- Pattern include_pattern = Pattern.compile("Include attachments to ([^\\s]*)");
- Pattern export_pattern = Pattern.compile("Export attachments of ([^\\s]*) to separate files");
+ Pattern merge_pattern = Pattern.compile("Merge ([^\\s]*) content into one file"); //$NON-NLS-1$
+ Pattern include_pattern = Pattern.compile("Include attachments to ([^\\s]*)"); //$NON-NLS-1$
+ Pattern export_pattern = Pattern.compile("Export attachments of ([^\\s]*) to separate files"); //$NON-NLS-1$
for (int i=0; i<rao.count(); i++) {
String name = rao.type().getComponent(i).name;
String fileExt = m.group(1);
Format format = ctx.eep.getFormatByExt(fileExt);
Boolean value = (Boolean) rao.getFieldValue(i, Bindings.BOOLEAN);
- String key = format.id()+"_merge";
+ String key = format.id()+"_merge"; //$NON-NLS-1$
contentScopePrefs.putBoolean(key, value);
workspaceScopePrefs.putBoolean(key, value);
}
String fileExt = m.group(1);
Format format = ctx.eep.getFormatByExt(fileExt);
Boolean value = (Boolean) rao.getFieldValue(i, Bindings.BOOLEAN);
- String key = format.id()+"_include_attachments";
+ String key = format.id()+"_include_attachments"; //$NON-NLS-1$
contentScopePrefs.putBoolean(key, value);
workspaceScopePrefs.putBoolean(key, value);
}
String fileExt = m.group(1);
Format format = ctx.eep.getFormatByExt(fileExt);
Boolean value = (Boolean) rao.getFieldValue(i, Bindings.BOOLEAN);
- String key = format.id()+"_export_attachments";
+ String key = format.id()+"_export_attachments"; //$NON-NLS-1$
contentScopePrefs.putBoolean(key, value);
workspaceScopePrefs.putBoolean(key, value);
}
//Preferences workspaceScopePrefs = ctx.store;
try {
RecordAccessor ra = Accessors.getAccessor(options);
- String publisherId = workspaceScopePrefs.get("publisherId", "");
+ String publisherId = workspaceScopePrefs.get("publisherId", ""); //$NON-NLS-1$ //$NON-NLS-2$
Publisher publisher = ctx.eep.getPublisher(publisherId);
if ( publisher != null ) ExporterUtils.setUnionValue(ra, P_PUBLISH, publisher.label());
for (Format format : ctx.eep.formats()) {
if ( format.isGroupFormat() ) {
- String key = format.id()+"_merge";
+ String key = format.id()+"_merge"; //$NON-NLS-1$
Boolean value = null;
if ( containsKey(contentScopePrefs, key) ) {
value = contentScopePrefs.getBoolean(key, false);
}
if ( value != null ) {
- String key2 = "Merge "+format.fileext()+" content into one file";
+ String key2 = "Merge "+format.fileext()+" content into one file"; //$NON-NLS-1$ //$NON-NLS-2$
int index = rao.type().getComponentIndex2(key2);
if ( index>=0 ) {
rao.setFieldValue(index, Bindings.BOOLEAN, value);
}
if ( format.isContainerFormat() ) {
- String key = format.id()+"_include_attachments";
+ String key = format.id()+"_include_attachments"; //$NON-NLS-1$
Boolean value = null;
if ( containsKey(contentScopePrefs, key) ) {
value = contentScopePrefs.getBoolean(key, false);
}
if ( value != null ) {
- String key2 = "Include attachments to "+format.fileext();
+ String key2 = "Include attachments to "+format.fileext(); //$NON-NLS-1$
int index = rao.type().getComponentIndex2(key2);
if ( index>=0 ) {
rao.setFieldValue(index, Bindings.BOOLEAN, value);
}
if ( format.isContainerFormat() ) {
- String key = format.id()+"_export_attachments";
+ String key = format.id()+"_export_attachments"; //$NON-NLS-1$
Boolean value = null;
if ( containsKey(contentScopePrefs, key) ) {
value = contentScopePrefs.getBoolean(key, false);
}
if ( value != null ) {
- String key2 = "Export attachments of "+format.fileext()+" to separate files";
+ String key2 = "Export attachments of"+format.fileext()+" to separate files"; //$NON-NLS-2$
int index = rao.type().getComponentIndex2(key2);
if ( index>=0 ) {
rao.setFieldValue(index, Bindings.BOOLEAN, value);
public void savePrefs() throws ExportException {
try {
int oldSelectionHash = selectionHash;
- Preferences contentScopePrefs = ctx.store.node( "Selection-"+oldSelectionHash );
+ Preferences contentScopePrefs = ctx.store.node( "Selection-"+oldSelectionHash ); //$NON-NLS-1$
Preferences workspaceScopePrefs = ctx.store;
RecordBinding binding = ctx.databoard.getMutableBinding( form.type() );
for (Format format : ctx.eep.formats()) {
if ( format.isContainerFormat() ) {
- String key = "Include attachments to "+format.fileext();
+ String key = "Include attachments to "+format.fileext(); //$NON-NLS-1$
int index = rao.type().getComponentIndex2(key);
if ( index>=0 ) rao.setFieldValue(index, Bindings.BOOLEAN, true);
- key = "Export attachments of "+format.fileext()+" to separate files";;
+ key = "Export attachments of "+format.fileext()+" to separate files";; //$NON-NLS-1$ //$NON-NLS-2$
index = rao.type().getComponentIndex2(key);
if ( index>=0 ) rao.setFieldValue(index, Bindings.BOOLEAN, true);
}
--- /dev/null
+ContentSelectionPage_Attachments=Attachments
+ContentSelectionPage_Name=Name
+ContentSelectionPage_Pages=Pages
+ContentSelectionPage_SelectContent=Select Content
+ContentSelectionPage_SelectContentDescription=Select the PDF Pages and the attachments
+ExportCoreWizard_FailedToSavePreferences=Failed to persist wizard preferences.
+ExportCoreWizard_ExportPDFFiles=Export PDF files
+ExportCoreWizard_FailedToPersistWizardPrefs=Export canceled.
+ExportCoreWizard_IOProblem=An I/O problem occurred while exporting the model.\nMessage: {0}
+ExportCoreWizard_UnexpectedException=Unexpected exception while exporting the model. See error log for details.\nMessage: {0}
+OptionsPage_ExportAttachmentOf=Export attachments of {0} to separate files
+OptionsPage_IncludeAttachmentTo=Include attachments to {0}
+OptionsPage_Merge=Merge {0} content into one file
+OptionsPage_OptionsPage=Options page
+OptionsPage_OutputOptions=Output Options
+OptionsPage_PublishTo=Publish to
+OptionsPage_SelectExportOptions=Select export options
+OptionsPage_UnExpectedError=Unexpected error
// Sanity check
for (int i = 0; i < filterExtensions.length; i++) {
String extension = filterExtensions[i];
- if (!extension.startsWith("*.")) {
- System.err.println("Invalid extension filter provied: " + extension);
+ if (!extension.startsWith("*.")) { //$NON-NLS-1$
+ System.err.println("Invalid extension filter provied: " + extension); //$NON-NLS-1$
}
}
FileDialog dialog = new FileDialog(shell, SWT.OPEN);
- dialog.setText("Choose File");
+ dialog.setText(Messages.ImportFileHandler_ChooseFile);
dialog.setFilterExtensions(filterExtensions);
dialog.setFilterNames(filterNames);
final String fileName = dialog.open();
selectedResource = a.getAdapter(Resource.class);
}
} catch(NullPointerException | ClassCastException npe) {
- LOGGER.warn("Failed to find selection, passing null to file importer", npe);
+ LOGGER.warn("Failed to find selection, passing null to file importer", npe); //$NON-NLS-1$
}
FileImportService.performFileImport(Paths.get(fileName), Optional.of(selectedResource), Optional.of((Consumer<Throwable>) t -> {
- LOGGER.error("Could not import file " + fileName, t);
+ LOGGER.error("Could not import file " + fileName, t); //$NON-NLS-1$
}));
}
}
\ No newline at end of file
--- /dev/null
+package org.simantics.fileimport.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.fileimport.ui.messages"; //$NON-NLS-1$
+ public static String ImportFileHandler_ChooseFile;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+ImportFileHandler_ChooseFile=Choose File
private static Graph createGraph() {
Graph graph = new Graph();
- Node node1 = new Node(graph, "A");
- Node node2 = new Node(graph, "B");
- new Edge(graph, node1, node2).setLabel("A to B");
+ Node node1 = new Node(graph, "A"); //$NON-NLS-1$
+ Node node2 = new Node(graph, "B"); //$NON-NLS-1$
+ new Edge(graph, node1, node2).setLabel("A to B"); //$NON-NLS-1$
return graph;
}
* @param graph
*/
public void asyncSetGraph(final Graph graph) {
- Job job = new Job("Layouting a graph") {
+ Job job = new Job(Messages.AbstractGraphvizEditorPart_LayoutingAGraph) {
@Override
protected IStatus run(IProgressMonitor monitor) {
}
private void workaroundJava7FocusProblem(Frame frame) {
- String ver = System.getProperty("java.version");
- if (ver.startsWith("1.7") || ver.startsWith("1.8")) {
+ String ver = System.getProperty("java.version"); //$NON-NLS-1$
+ if (ver.startsWith("1.7") || ver.startsWith("1.8")) { //$NON-NLS-1$ //$NON-NLS-2$
try {
frame.addWindowListener(new Java7FocusFixListener(this, frame));
} catch (SecurityException e) {
Frame frame;
public Java7FocusFixListener(Control control, Frame frame) throws NoSuchMethodException, SecurityException {
- this.shellSetActiveControl = Shell.class.getDeclaredMethod("setActiveControl", Control.class);
+ this.shellSetActiveControl = Shell.class.getDeclaredMethod("setActiveControl", Control.class); //$NON-NLS-1$
this.frame = frame;
this.control = control;
}
initialized.wait();
}
} catch (InterruptedException e) {
- throw new Error("GraphvizComponent AWT population interrupted for class " + this, e);
+ throw new Error("GraphvizComponent AWT population interrupted for class " + this, e); //$NON-NLS-1$
}
}
* @param graph
*/
public void setGraph(Graph graph) {
- setGraph(graph, "dot");
+ setGraph(graph, "dot"); //$NON-NLS-1$
}
/**
public void save(File file) throws IOException {
if (drawable == null) {
- throw new IOException("Nothing to save");
+ throw new IOException("Nothing to save"); //$NON-NLS-1$
}
Graph graph = drawable.getGraph();
String algo = drawable.getAlgorithm();
}
public String[] getFileExtensions() {
- return new String[]{"*.svg","*.dot","*.eps", "*.jpg", "*.jpeg","*.pdf","*.png","*.ps"};
+ return new String[]{"*.svg","*.dot","*.eps", "*.jpg", "*.jpeg","*.pdf","*.png","*.ps"}; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$ //$NON-NLS-6$ //$NON-NLS-7$ //$NON-NLS-8$
}
public String[] getFileNames() {
- return new String[]{"Scalable Vector Graphics Image", "DOT Image", "Encapsulated PostScript Image","JPG Image","JPG Image","Portable Document Format Image","Portable Network Graphics Image","PostScript Image"};
+ return new String[]{"Scalable Vector Graphics Image", "DOT Image", "Encapsulated PostScript Image","JPG Image","JPG Image","Portable Document Format Image","Portable Network Graphics Image","PostScript Image"}; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$ //$NON-NLS-6$ //$NON-NLS-7$ //$NON-NLS-8$
}
public static String getExtension(File file) {
String filename = file.getName();
- int index = filename.lastIndexOf(".");
+ int index = filename.lastIndexOf("."); //$NON-NLS-1$
if (index < 0)
return null;
return filename.substring(index+1).toLowerCase();
initialized.wait();
}
} catch (InterruptedException e) {
- throw new Error("GraphvizComponent AWT population interrupted for class " + this, e);
+ throw new Error("GraphvizComponent AWT population interrupted for class " + this, e); //$NON-NLS-1$
}
}
* @param graph
*/
public Computation<Graph> setGraph(Graph graph) {
- return setGraph(graph, "dot");
+ return setGraph(graph, "dot"); //$NON-NLS-1$
}
/**
--- /dev/null
+package org.simantics.graphviz.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.graphviz.ui.messages"; //$NON-NLS-1$
+ public static String AbstractGraphvizEditorPart_LayoutingAGraph;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+AbstractGraphvizEditorPart_LayoutingAGraph=Layouting a graph\r
public Document perform(ReadGraph graph) throws DatabaseException {
currentText = HelpUtils.readHelpFileContents(graph, resource);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element, IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog("HelpFileDocumentProvider.doSaveDocument");
+ TimeLogger.resetTimeAndLog("HelpFileDocumentProvider.doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
public void perform(WriteGraph graph) throws DatabaseException {
graph.markUndoPoint();
HelpUtils.saveHelpFileContents(graph, resource, currentText);
- Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
}
public class HelpFileEditor extends MarkdownEditor {
- private static final String EDITOR_ID = "org.simantics.help.ui.HelpFileEditor";
+ private static final String EDITOR_ID = "org.simantics.help.ui.HelpFileEditor"; //$NON-NLS-1$
private boolean disposed;
try {
getResourceInput().init(null);
} catch (DatabaseException e) {
- throw new PartInitException("Failed to initialize " + input, e);
+ throw new PartInitException("Failed to initialize " + input, e); //$NON-NLS-1$
}
}
--- /dev/null
+package org.simantics.help.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.help.ui.messages"; //$NON-NLS-1$
+ public static String OpenHelpFileAdapter_HelpFileEditor;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
private static final Logger LOGGER = LoggerFactory.getLogger(OpenHelpFileAdapter.class);
public OpenHelpFileAdapter() {
- super("Help File Editor");
+ super(Messages.OpenHelpFileAdapter_HelpFileEditor);
}
protected String getEditorId() {
String editorId = getEditorId();
WorkbenchUtils.openEditor(editorId, new ResourceEditorInput2(editorId, input, model, rvi));
} catch (PartInitException e) {
- LOGGER.error("Failed to open an editor for help file.", e);
+ LOGGER.error("Failed to open an editor for help file.", e); //$NON-NLS-1$
}
}
});
--- /dev/null
+OpenHelpFileAdapter_HelpFileEditor=Help File Editor\r
public static Resource getType(ReadGraph graph, ImageSource source) throws DatabaseException {
ImageResource IMAGE = ImageResource.getInstance(graph);
String name = source.name.toLowerCase();
- if(name.endsWith("svg")) return IMAGE.SvgImage;
- else if(name.endsWith("png")) return IMAGE.PngImage;
- else if(name.endsWith("jpg") || name.endsWith("jpeg")) return IMAGE.JpegImage;
- else if(name.endsWith("gif")) return IMAGE.GifImage;
- else throw new DatabaseException("Unsupported image format " + source.name);
+ if(name.endsWith("svg")) return IMAGE.SvgImage; //$NON-NLS-1$
+ else if(name.endsWith("png")) return IMAGE.PngImage; //$NON-NLS-1$
+ else if(name.endsWith("jpg") || name.endsWith("jpeg")) return IMAGE.JpegImage; //$NON-NLS-1$ //$NON-NLS-2$
+ else if(name.endsWith("gif")) return IMAGE.GifImage; //$NON-NLS-1$
+ else throw new DatabaseException("Unsupported image format " + source.name); //$NON-NLS-1$
}
public static void claimLiteral(WriteGraph graph, Resource image, ImageSource source) throws DatabaseException {
String name = source.name.toLowerCase();
- if (name.endsWith("svg"))
+ if (name.endsWith("svg")) //$NON-NLS-1$
graph.claimValue(image, new String(source.data), Bindings.STRING);
- else if (name.endsWith("png") || name.endsWith("jpg") || name.endsWith("jpeg") || name.endsWith("gif"))
+ else if (name.endsWith("png") || name.endsWith("jpg") || name.endsWith("jpeg") || name.endsWith("gif")) //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$
graph.claimValue(image, source.data, Bindings.BYTE_ARRAY);
- else throw new DatabaseException("Unsupported image format " + source.name);
+ else throw new DatabaseException("Unsupported image format " + source.name); //$NON-NLS-1$
}
@Override
graph.claimLiteral(image, L0.HasName, source.name, Bindings.STRING);
claimLiteral(graph, image, source);
graph.claim(parent, L0.ConsistsOf, image);
- Layer0Utils.addCommentMetadata(graph, "Imported image " + source.name + " " + image.toString());
+ Layer0Utils.addCommentMetadata(graph, "Imported image " + source.name + " " + image.toString()); //$NON-NLS-1$ //$NON-NLS-2$
return image;
// if(file.getPath().endsWith("svg")) {
import java.io.IOException;
import java.util.Collection;
+import org.eclipse.osgi.util.NLS;
import org.simantics.db.Resource;
import org.simantics.db.WriteGraph;
import org.simantics.db.common.request.WriteRequest;
ImageSource src = ImportImagesActionFactory.toImageSource(file);
new CreateImage(container, src).perform(graph);
} catch (IOException e) {
- ErrorLogger.defaultLogError("Failed to import image " + file.getName() + ", see exception for details.", e);
+ ErrorLogger.defaultLogError(NLS.bind(Messages.CreateImages_FailedToImportPage, file.getName()), e);
}
}
}
public static Collection<File> requestImportedImages(Shell parentShell) {
FileDialog dialog = new FileDialog(parentShell, SWT.MULTI);
- dialog.setText("Choose image to be imported");
- dialog.setFilterExtensions( new String[] {"*.jpg;*.png;*.gif;*.svg", "*.jpg;*.jpeg", "*.png", "*.gif", "*.svg"} );
- dialog.setFilterNames( new String[] {"All Images", "JPEG Image", "PNG Image", "GIF Image", "SVG Image"} );
+ dialog.setText(Messages.ImportImagesActionFactory_ChooseImageToBeImported);
+ dialog.setFilterExtensions( new String[] {"*.jpg;*.png;*.gif;*.svg", "*.jpg;*.jpeg", "*.png", "*.gif", "*.svg"} ); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$
+ dialog.setFilterNames( new String[] {Messages.ImportImagesActionFactory_FilterAllImage, Messages.ImportImagesActionFactory_FilterJPEGImage, Messages.ImportImagesActionFactory_FilterPNGImage, Messages.ImportImagesActionFactory_FilterGIFImages, Messages.ImportImagesActionFactory_FilterSVGImage} );
//dialog.setFilterExtensions( new String[] {"*.jpg", "*.png", "*.gif"} );
final String filename = dialog.open();
if (filename == null)
--- /dev/null
+package org.simantics.image.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.image.ui.messages"; //$NON-NLS-1$
+ public static String CreateImages_FailedToImportPage;
+ public static String ImportImagesActionFactory_ChooseImageToBeImported;
+ public static String ImportImagesActionFactory_FilterAllImage;
+ public static String ImportImagesActionFactory_FilterGIFImages;
+ public static String ImportImagesActionFactory_FilterJPEGImage;
+ public static String ImportImagesActionFactory_FilterPNGImage;
+ public static String ImportImagesActionFactory_FilterSVGImage;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
*/
public class ImageEditor extends ResourceEditorPart {
- public static final String EDITOR_ID = "org.simantics.wiki.ui.image.editor";
+ public static final String EDITOR_ID = "org.simantics.wiki.ui.image.editor"; //$NON-NLS-1$
protected boolean disposed = false;
Bundle bundle = context.getBundle();
- IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/image.png"));
- IMAGES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/images.png"));
- ADD_IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/add_image.png"));
+ IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/image.png")); //$NON-NLS-1$
+ IMAGES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/images.png")); //$NON-NLS-1$
+ ADD_IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/add_image.png")); //$NON-NLS-1$
}
/*
--- /dev/null
+CreateImages_FailedToImportPage=Failed to import image {0}, see exception for details.\r
+ImportImagesActionFactory_ChooseImageToBeImported=Choose image to be imported\r
+ImportImagesActionFactory_FilterAllImage=All Images\r
+ImportImagesActionFactory_FilterGIFImages=GIF Image\r
+ImportImagesActionFactory_FilterJPEGImage=JPEG Image\r
+ImportImagesActionFactory_FilterPNGImage=PNG Image\r
+ImportImagesActionFactory_FilterSVGImage=SVG Image\r
@Override
public String getViewpointId() {
- return "Standard";
+ return "Standard"; //$NON-NLS-1$
}
protected Read<Collection<Resource>> getChildRequest(ReadGraph graph, ImagesNode lib) throws DatabaseException {
Layer0 L0 = Layer0.getInstance(graph);
String name = graph.getPossibleRelatedValue(node.data, L0.HasName, Bindings.STRING);
if(name == null)
- name = "No name";
+ name = "No name"; //$NON-NLS-1$
return name;
}
@Override
public String getViewpointId() {
- return "Standard";
+ return "Standard"; //$NON-NLS-1$
}
}
\ No newline at end of file
@Override
public String getLabel(ReadGraph graph, ImagesNode node) throws DatabaseException {
- return "Images";
+ return Messages.ImagesLabeler_Images;
}
}
--- /dev/null
+package org.simantics.image.ui.modelBrowser;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.image.ui.modelBrowser.messages"; //$NON-NLS-1$
+ public static String ImagesLabeler_Images;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+ImagesLabeler_Images=Images\r
final Resource issueSource = ResourceAdaptionUtils.toSingleResource(context);
try {
VirtualGraphSupport support = Simantics.getSession().getService(VirtualGraphSupport.class);
- Simantics.getSession().syncRequest(new WriteRequest(support.getWorkspacePersistent("preferences")) {
+ Simantics.getSession().syncRequest(new WriteRequest(support.getWorkspacePersistent("preferences")) { //$NON-NLS-1$
@Override
public void perform(WriteGraph graph) throws DatabaseException {
IssueResource ISSUE = IssueResource.getInstance(graph);
@Override
public Map<String, ImageDescriptor> getImage(ReadGraph graph, Object content) throws DatabaseException {
Variable issue = (Variable) content;
- String severity = issue.getPossiblePropertyValue(graph, "severity");
+ String severity = issue.getPossiblePropertyValue(graph, "severity"); //$NON-NLS-1$
if (severity == null)
return Collections.emptyMap();
boolean resolved = isResolved(graph, issue);
if (issueResource != null)
return graph.hasStatement(issueResource, IssueResource.getInstance(graph).Resolved);
- Boolean resolved = issue.getPossiblePropertyValue(graph, "resolved");
+ Boolean resolved = issue.getPossiblePropertyValue(graph, "resolved"); //$NON-NLS-1$
return Boolean.TRUE.equals(resolved);
}
private ImageDescriptor toImageDescriptor(String severity) {
switch (severity) {
- case "Fatal": return fatal;
- case "Error": return error;
- case "Warning": return warning;
- case "Info": return info;
- case "Note": return note;
+ case "Fatal": return fatal; //$NON-NLS-1$
+ case "Error": return error; //$NON-NLS-1$
+ case "Warning": return warning; //$NON-NLS-1$
+ case "Info": return info; //$NON-NLS-1$
+ case "Note": return note; //$NON-NLS-1$
default: return help;
}
}
public static final IssueLabelRule INSTANCE = new IssueLabelRule();
- private static final String[] COLS = new String[] { ColumnKeys.SINGLE, "Resource", "Path" };
+ private static final String[] COLS = new String[] { ColumnKeys.SINGLE, Messages.IssueLabelRule_Resource, Messages.IssueLabelRule_Path };
public IssueLabelRule() {
}
public Map<String,String> getLabel(ReadGraph graph, Object content) throws DatabaseException {
Variable issue = (Variable)content;
- String description = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "HasDescription") );
- String resource = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "resource") );
- String path = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "path") );
+ String description = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "HasDescription") ); //$NON-NLS-1$
+ String resource = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "resource") ); //$NON-NLS-1$
+ String path = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "path") ); //$NON-NLS-1$
String[] result = new String[] { description, resource, path };
return new ArrayMap<String, String>(COLS, result);
private String formName(ReadGraph graph, Resource r) throws DatabaseException {
String name = NameUtils.getSafeName(graph, r);
final Resource project = Simantics.getProjectResource();
- String projectUri = project != null ? graph.getPossibleURI(project) : "";
+ String projectUri = project != null ? graph.getPossibleURI(project) : ""; //$NON-NLS-1$
String uri = graph.getPossibleURI(r);
if (uri != null) {
if (uri.startsWith(projectUri))
uri = uri.substring(projectUri.length());
}
- return uri != null ? name + " (" + uri + ")" : name;
+ return uri != null ? name + " (" + uri + ")" : name; //$NON-NLS-1$ //$NON-NLS-2$
}
private Resource getConfiguration(ReadGraph graph, Resource r) throws DatabaseException {
}
setVisible(true);
} else {
- setContentDescription("Issues not available.");
+ setContentDescription(Messages.IssueView2_IssuesNotAvailable);
setVisible(false);
}
}
--- /dev/null
+package org.simantics.issues.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.issues.ui.messages"; //$NON-NLS-1$
+ public static String IssueLabelRule_Path;
+ public static String IssueLabelRule_Resource;
+ public static String IssueView2_IssuesNotAvailable;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
IssueResource ISSUE = IssueResource.getInstance(graph);
graph.deny(resource, ISSUE.Issue_HasSeverity);
graph.claim(resource, ISSUE.Issue_HasSeverity, null, severity);
- Layer0Utils.addCommentMetadata(graph, "Changed severity of " + NameUtils.getSafeLabel(graph, resource) + " to " + NameUtils.getSafeName(graph, severity));
+ Layer0Utils.addCommentMetadata(graph, "Changed severity of " + NameUtils.getSafeLabel(graph, resource) + " to " + NameUtils.getSafeName(graph, severity)); //$NON-NLS-1$ //$NON-NLS-2$
}
});
}
Set<Variable> issues = graph.syncRequest(new IssuesOfSeverity(project, severity));
if(issues.size() > 1) {
- return Collections.singletonMap(DESCRIPTION, severityName + "s (" + issues.size() + " items)");
+ return Collections.singletonMap(DESCRIPTION, severityName + "s (" + issues.size() + " items)"); //$NON-NLS-1$ //$NON-NLS-2$
} else {
- return Collections.singletonMap(DESCRIPTION, severityName + "s (1 item)");
+ return Collections.singletonMap(DESCRIPTION, severityName + "s (1 item)"); //$NON-NLS-1$
}
}
user = graph.hasStatement(issueR, ISSUE.UserIssue);
resolved = graph.hasStatement(issueR, ISSUE.Resolved);
} else {
- hidden = Boolean.TRUE.equals(issue.getPossiblePropertyValue(graph, "hidden", Bindings.BOOLEAN));
+ hidden = Boolean.TRUE.equals(issue.getPossiblePropertyValue(graph, "hidden", Bindings.BOOLEAN)); //$NON-NLS-1$
}
int index = (hidden ? 1 : 0) + (user ? 2 : 0) + (resolved ? 4 : 0);
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
ListDialog<IssueSourceEntry> dialog = new ListDialog<IssueSourceEntry>(
shell, sources,
- "Select available issue sources",
- "Selected sources will be used and existing deselected sources will be removed.") {
+ Messages.ConfigureIssueSources_SelectAvailableIssueSources,
+ Messages.ConfigureIssueSources_SelectedSourcesAddRemoveMsg) {
protected CheckboxTableViewer createViewer(Composite composite) {
CheckboxTableViewer viewer = CheckboxTableViewer.newCheckList(
*/
public class ExportIssuesAsCsv extends AbstractHandler {
- private static final String PROP_LAST_VALIDATION_REPORT_PATH= "validation.report.path";
+ private static final String PROP_LAST_VALIDATION_REPORT_PATH= "validation.report.path"; //$NON-NLS-1$
@Override
public Object execute(ExecutionEvent event) throws ExecutionException {
Layer0X L0X = Layer0X.getInstance(graph);
SimulationResource SIMU = SimulationResource.getInstance(graph);
for (Resource model : graph.syncRequest(new ObjectsWithType(Simantics.getProjectResource(), L0X.Activates, SIMU.Model))) {
- return NameUtils.getSafeName(graph, model) + ".txt";
+ return NameUtils.getSafeName(graph, model) + ".txt"; //$NON-NLS-1$
}
- return "issues.txt";
+ return "issues.txt"; //$NON-NLS-1$
}
});
final DataContainer<PrintStream> externalOutput = new DataContainer<PrintStream>();
FileDialog fd = new FileDialog(parentShell, SWT.SAVE);
- fd.setText("Select Validation Output");
- fd.setFilterExtensions(new String[] { "*.txt", "*.*" });
- fd.setFilterNames(new String[] { "Comma-Separated Values (*.txt)", "All Files (*.*)" });
+ fd.setText(Messages.ExportIssuesAsCsv_SelectValidationOutput);
+ fd.setFilterExtensions(new String[] { "*.txt", "*.*" }); //$NON-NLS-1$ //$NON-NLS-2$
+ fd.setFilterNames(new String[] { Messages.ExportIssuesAsCsv_CommaSeparatedValues, Messages.ExportIssuesAsCsv_AllFiles });
if (lastReportPath != null)
fd.setFilterPath(lastReportPath);
fd.setFileName(fileName);
}
private void export(IProgressMonitor monitor, PrintStream out) throws DatabaseException {
- SubMonitor progress = SubMonitor.convert(monitor, "Export issues", IProgressMonitor.UNKNOWN);
+ SubMonitor progress = SubMonitor.convert(monitor, Messages.ExportIssuesAsCsv_ExportIssues, IProgressMonitor.UNKNOWN);
Simantics.getSession().syncRequest(new ReadRequest() {
@Override
public void run(ReadGraph graph) throws DatabaseException {
Collection<Variable> activeIssues = graph.syncRequest(new AllVisibleIssues(Simantics.getProjectResource()));
- out.println("# Exported issues (" + activeIssues.size() + ")");
+ out.println("# Exported issues (" + activeIssues.size() + ")"); //$NON-NLS-1$ //$NON-NLS-2$
for (Variable issue : activeIssues) {
exportIssue(graph, issue, out, 0);
progress.worked(1);
graph.syncRequest(new DynamicIssueSources(Simantics.getProjectResource())));
if (!dynamicIssueSources.isEmpty()) {
out.println();
- out.println("# Dynamic Issues");
+ out.println("# Dynamic Issues"); //$NON-NLS-1$
for (Variable source : dynamicIssueSources.values()) {
exportDynamicIssueSource(progress, graph, source, out, 0);
}
private Map<String, Variable> nameMap(ReadGraph graph, Set<Variable> sources) throws DatabaseException {
TreeMap<String, Variable> sorted = new TreeMap<>();
for (Variable v : sources) {
- String name = v.getPossiblePropertyValue(graph, "HasDescription", Bindings.STRING);
+ String name = v.getPossiblePropertyValue(graph, "HasDescription", Bindings.STRING); //$NON-NLS-1$
if (name == null)
name = v.getName(graph);
sorted.put(name, v);
}
private void exportIssue(ReadGraph graph, Variable issue, PrintStream out, int startColumn) throws DatabaseException {
- String description = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "HasDescription") );
- String severity = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "severity") );
- String resource = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "resource") );
- String path = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "path") );
+ String description = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "HasDescription") ); //$NON-NLS-1$
+ String severity = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "severity") ); //$NON-NLS-1$
+ String resource = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "resource") ); //$NON-NLS-1$
+ String path = StringUtils.safeString( (String) issue.getPossiblePropertyValue(graph, "path") ); //$NON-NLS-1$
for (int i = 0; i < startColumn; ++i)
- out.print(";");
- out.println(description + ";" + severity + ";" + resource + ";" + path);
+ out.print(";"); //$NON-NLS-1$
+ out.println(description + ";" + severity + ";" + resource + ";" + path); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
}
\ No newline at end of file
}
if (!hiders.isEmpty()) {
SCLContext ctx = SCLContext.getCurrent();
- Object oldGraph = ctx.put("graph", graph);
+ Object oldGraph = ctx.put("graph", graph); //$NON-NLS-1$
try {
for (Function f : hiders)
f.apply(argument);
} catch (Throwable t) {
throw new DatabaseException(t);
} finally {
- ctx.put("graph", oldGraph);
+ ctx.put("graph", oldGraph); //$NON-NLS-1$
}
}
}
if (target instanceof Variable) {
return () -> {
try {
- String id = Simantics.sync(new PossibleVariablePropertyValue<String>((Variable) target, "contextualHelpId", Bindings.STRING));
+ String id = Simantics.sync(new PossibleVariablePropertyValue<String>((Variable) target, "contextualHelpId", Bindings.STRING)); //$NON-NLS-1$
if (id == null) {
PlatformUI.getWorkbench().getHelpSystem().displayDynamicHelp();
return;
public class Hide extends FunctionHandler {
public Hide() {
- super(null, "hider", Boolean.TRUE);
+ super(null, "hider", Boolean.TRUE); //$NON-NLS-1$
}
}
}
private IAction unhideAction(List<Resource> input) {
- return tagAction("Unhide", Activator.UNHIDE_ICON, IssueResource.URIs.Hidden, false, input);
+ return tagAction(Messages.MenuActions_Unhide, Activator.UNHIDE_ICON, IssueResource.URIs.Hidden, false, input);
}
private IAction hideAction(List<Resource> input) {
- return tagAction("Hide", Activator.HIDE_ICON, IssueResource.URIs.Hidden, true, input);
+ return tagAction(Messages.MenuActions_Hide, Activator.HIDE_ICON, IssueResource.URIs.Hidden, true, input);
}
private IAction resolveAction(List<Resource> input) {
- return tagAction("Mark Resolved", Activator.RESOLVE_ICON, IssueResource.URIs.Resolved, true, input);
+ return tagAction(Messages.MenuActions_MarkResolved, Activator.RESOLVE_ICON, IssueResource.URIs.Resolved, true, input);
}
private IAction unresolveAction(List<Resource> input) {
- return tagAction("Mark Unresolved", Activator.UNRESOLVE_ICON, IssueResource.URIs.Resolved, false, input);
+ return tagAction(Messages.MenuActions_MarkUnresolved, Activator.UNRESOLVE_ICON, IssueResource.URIs.Resolved, false, input);
}
private IAction tagAction(String label, ImageDescriptor image, String tagURI, boolean tag, List<Resource> input) {
@Override
public void fill(Menu menu, int index) {
MenuItem setSeverityItem = new MenuItem(menu, SWT.CASCADE);
- setSeverityItem.setText("Set Severity");
+ setSeverityItem.setText(Messages.MenuActions_SetSeverity);
Menu setSeverity = new Menu(menu);
setSeverityItem.setMenu(setSeverity);
for (final Severity sev : Severity.values()) {
MenuItem item = new MenuItem(setSeverity, SWT.PUSH);
item.setText(sev.toString().toLowerCase());
- item.setImage(Activator.getDefault().getImageRegistry().get(sev.toString() + "-full"));
+ item.setImage(Activator.getDefault().getImageRegistry().get(sev.toString() + "-full")); //$NON-NLS-1$
item.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
--- /dev/null
+package org.simantics.issues.ui.handler;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.issues.ui.handler.messages"; //$NON-NLS-1$
+ public static String ConfigureIssueSources_SelectAvailableIssueSources;
+ public static String ConfigureIssueSources_SelectedSourcesAddRemoveMsg;
+ public static String ExportIssuesAsCsv_AllFiles;
+ public static String ExportIssuesAsCsv_CommaSeparatedValues;
+ public static String ExportIssuesAsCsv_ExportIssues;
+ public static String ExportIssuesAsCsv_SelectValidationOutput;
+ public static String MenuActions_Hide;
+ public static String MenuActions_MarkResolved;
+ public static String MenuActions_MarkUnresolved;
+ public static String MenuActions_SetSeverity;
+ public static String MenuActions_Unhide;
+ public static String PurgeResolvedIssues_MonitorPurgingResolvedIssues;
+ public static String PurgeResolvedIssues_PurgedResolvedBatchIssues;
+ public static String PurgeResolvedIssues_PurgingResolvedBatchIssues;
+ public static String RunActiveValidations_MonitorPreparingResourcesForValidation;
+ public static String RunActiveValidations_ValidateModel;
+ public static String RunActiveValidations_Validation;
+ public static String RunActiveValidations_ValidationPreparation;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public void perform(WriteGraph graph) throws DatabaseException {
graph.markUndoPoint();
Resource issue = IssueUtils.newUserIssueForModel(graph);
- Layer0Utils.addCommentMetadata(graph, "Created new User Issue " + NameUtils.getSafeLabel(graph, issue) + " " + issue.toString());
+ Layer0Utils.addCommentMetadata(graph, "Created new User Issue " + NameUtils.getSafeLabel(graph, issue) + " " + issue.toString()); //$NON-NLS-1$ //$NON-NLS-2$
}
});
} catch (DatabaseException e) {
private final boolean tag;
public PreferenceHandler() {
- this("preferences", null, false);
+ this("preferences", null, false); //$NON-NLS-1$
}
public PreferenceHandler(String tagURI, boolean tag) {
- this("preferences", tagURI, tag);
+ this("preferences", tagURI, tag); //$NON-NLS-1$
}
public PreferenceHandler(String virtualGraphId) {
import org.eclipse.core.runtime.IProgressMonitor;
import org.eclipse.core.runtime.SubMonitor;
import org.eclipse.jface.operation.IRunnableWithProgress;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.ui.PlatformUI;
import org.simantics.Simantics;
import org.simantics.browsing.ui.common.ErrorLogger;
if (project == null)
return;
- final SubMonitor mon = SubMonitor.convert(monitor, "Purging resolved issues...", 100);
+ final SubMonitor mon = SubMonitor.convert(monitor, Messages.PurgeResolvedIssues_MonitorPurgingResolvedIssues, 100);
session.syncRequest(new DelayedWriteRequest() {
@Override
public void perform(WriteGraph graph) throws DatabaseException {
graph.markUndoPoint();
IssueResource ISSUE = IssueResource.getInstance(graph);
- Set<Resource> toBeRemoved = new HashSet<Resource>();
- Map<Resource, Boolean> sourceIsContinuous = new THashMap<Resource, Boolean>();
+ Set<Resource> toBeRemoved = new HashSet<>();
+ Map<Resource, Boolean> sourceIsContinuous = new THashMap<>();
for (Resource activeIssue : graph.syncRequest(new AllActiveIssues(project))) {
if (graph.hasStatement(activeIssue, ISSUE.Resolved)) {
Resource managedBy = graph.getPossibleObject(activeIssue, ISSUE.IssueSource_Manages_Inverse);
}
}
- mon.setTaskName("Purging " + toBeRemoved.size() + " resolved batch issues...");
+ mon.setTaskName(NLS.bind(Messages.PurgeResolvedIssues_PurgingResolvedBatchIssues, toBeRemoved.size()));
mon.setWorkRemaining(toBeRemoved.size());
StringBuilder sb = new StringBuilder();
- sb.append("Purged " + toBeRemoved.size() + " resolved batch issue(s)");
+ sb.append(NLS.bind(Messages.PurgeResolvedIssues_PurgedResolvedBatchIssues, toBeRemoved.size()));
for (Resource remove : toBeRemoved) {
- //sb.append(NameUtils.getSafeLabel(graph, remove) + " ");
+ // sb.append(NameUtils.getSafeLabel(graph, remove) + " ");
RemoverUtil.remove(graph, remove);
mon.worked(1);
}
final BatchIssueValidationContext context = new BatchIssueValidationContext();
try {
- SleepingDatabaseJob dbLock = new SleepingDatabaseJob("Validation Preparation").scheduleAndWaitForRunning();
+ SleepingDatabaseJob dbLock = new SleepingDatabaseJob(Messages.RunActiveValidations_ValidationPreparation).scheduleAndWaitForRunning();
try {
PlatformUI.getWorkbench().getProgressService().run(true, true, new IRunnableWithProgress() {
@Override
session.syncRequest(new SelectedModelBatchIssueSources(model)),
validations);
- SubMonitor.convert(monitor, "Preparing resources for validation", 100);
+ SubMonitor.convert(monitor, Messages.RunActiveValidations_MonitorPreparingResourcesForValidation, 100);
context.contexts = Collections.singletonList(model);
context.domain = ModelTransferableGraphSourceRequest.getDomainOnly(session, monitor, model);
public static void run(Runnable postValidation, final Collection<BatchIssueSource> validations, final BatchIssueValidationContext context) {
// Run the validations for the selected composites
- SleepingDatabaseJob dbLock = new SleepingDatabaseJob("Validation");
+ SleepingDatabaseJob dbLock = new SleepingDatabaseJob(Messages.RunActiveValidations_Validation);
try {
dbLock.scheduleAndWaitForRunning();
try {
@Override
public void run(IProgressMonitor monitor) throws InvocationTargetException, InterruptedException {
try {
- SubMonitor progress = SubMonitor.convert(monitor, "Validate Model", 100);
+ SubMonitor progress = SubMonitor.convert(monitor, Messages.RunActiveValidations_ValidateModel, 100);
int maxWrittenIssues = IssuePreferenceUtil.getPreferences().maxBatchIssuesToWrite;
int writtenIssues = 0;
for (BatchIssueSource source : validations) {
public class Unhide extends FunctionHandler {
public Unhide() {
- super(null, "hider", Boolean.FALSE);
+ super(null, "hider", Boolean.FALSE); //$NON-NLS-1$
}
}
--- /dev/null
+ConfigureIssueSources_SelectAvailableIssueSources=Select available issue sources\r
+ConfigureIssueSources_SelectedSourcesAddRemoveMsg=Selected sources will be used and existing deselected sources will be removed.\r
+ExportIssuesAsCsv_AllFiles=All Files (*.*)\r
+ExportIssuesAsCsv_CommaSeparatedValues=Comma-Separated Values (*.txt)\r
+ExportIssuesAsCsv_ExportIssues=Export issues\r
+ExportIssuesAsCsv_SelectValidationOutput=Select Validation Output\r
+MenuActions_Hide=Hide\r
+MenuActions_MarkResolved=Mark Resolved\r
+MenuActions_MarkUnresolved=Mark Unresolved\r
+MenuActions_SetSeverity=Set Severity\r
+MenuActions_Unhide=Unhide\r
+PurgeResolvedIssues_MonitorPurgingResolvedIssues=Purging resolved issues...\r
+PurgeResolvedIssues_PurgedResolvedBatchIssues=Purged {0} resolved batch issue(s)\r
+PurgeResolvedIssues_PurgingResolvedBatchIssues=Purging {0} resolved batch issues...\r
+RunActiveValidations_MonitorPreparingResourcesForValidation=Preparing resources for validation\r
+RunActiveValidations_ValidateModel=Validate Model\r
+RunActiveValidations_Validation=Validation\r
+RunActiveValidations_ValidationPreparation=Validation Preparation\r
public class Activator extends AbstractUIPlugin {
- public static final String PLUGIN_ID = "org.simantics.issues.ui";
+ public static final String PLUGIN_ID = "org.simantics.issues.ui"; //$NON-NLS-1$
static Activator instance;
ServiceTracker messageScheme;
Bundle bundle = context.getBundle();
- HIDE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/hide.png"));
+ HIDE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/hide.png")); //$NON-NLS-1$
UNHIDE_ICON = AlphaAdjustmentImageDescriptor.adjustAlpha(HSVAdjustmentImageDescriptor.adjust(
HIDE_ICON, 0f, 0f, 1f), 96);
//RESOLVE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/lightbulb.png"));
//UNRESOLVE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/lightbulb_off.png"));
- RESOLVE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tick.png"));
+ RESOLVE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tick.png")); //$NON-NLS-1$
UNRESOLVE_ICON = AlphaAdjustmentImageDescriptor.adjustAlpha(HSVAdjustmentImageDescriptor.adjust(
RESOLVE_ICON, 0f, 0f, 1f), 96);
- PURGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/purge.gif"));
+ PURGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/purge.gif")); //$NON-NLS-1$
- FATAL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/fatal.png"));
- ERROR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/error.png"));
- WARNING_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/warning.png"));
- INFO_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/information.png"));
- NOTE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/note.png"));
- OK_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/noissue.png"));
+ FATAL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/fatal.png")); //$NON-NLS-1$
+ ERROR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/error.png")); //$NON-NLS-1$
+ WARNING_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/warning.png")); //$NON-NLS-1$
+ INFO_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/information.png")); //$NON-NLS-1$
+ NOTE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/note.png")); //$NON-NLS-1$
+ OK_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/noissue.png")); //$NON-NLS-1$
- FATAL_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/fatal_decoration.png"));
- ERROR_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/error_decoration.png"));
- WARNING_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/warning_decoration.png"));
- INFO_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/information_decoration.png"));
- NOTE_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/note_decoration.png"));
+ FATAL_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/fatal_decoration.png")); //$NON-NLS-1$
+ ERROR_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/error_decoration.png")); //$NON-NLS-1$
+ WARNING_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/warning_decoration.png")); //$NON-NLS-1$
+ INFO_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/information_decoration.png")); //$NON-NLS-1$
+ NOTE_DECORATION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/note_decoration.png")); //$NON-NLS-1$
}
@Override
@Override
protected void initializeImageRegistry(ImageRegistry reg) {
- reg.put(Severity.FATAL.toString()+"-full", FATAL_ICON);
- reg.put(Severity.ERROR.toString()+"-full", ERROR_ICON);
- reg.put(Severity.WARNING.toString()+"-full", WARNING_ICON);
- reg.put(Severity.INFO.toString()+"-full", INFO_ICON);
- reg.put(Severity.NOTE.toString()+"-full", NOTE_ICON);
+ reg.put(Severity.FATAL.toString()+"-full", FATAL_ICON); //$NON-NLS-1$
+ reg.put(Severity.ERROR.toString()+"-full", ERROR_ICON); //$NON-NLS-1$
+ reg.put(Severity.WARNING.toString()+"-full", WARNING_ICON); //$NON-NLS-1$
+ reg.put(Severity.INFO.toString()+"-full", INFO_ICON); //$NON-NLS-1$
+ reg.put(Severity.NOTE.toString()+"-full", NOTE_ICON); //$NON-NLS-1$
reg.put(Severity.FATAL.toString(), FATAL_DECORATION_ICON);
reg.put(Severity.ERROR.toString(), ERROR_DECORATION_ICON);
reg.put(Severity.WARNING.toString(), WARNING_DECORATION_ICON);
public static URL getDefaultResource(String name) {
Activator plugin = getDefault();
- if(plugin == null) throw new IllegalStateException("The plugin is not active.");
+ if(plugin == null) throw new IllegalStateException("The plugin is not active."); //$NON-NLS-1$
Bundle bundle = plugin.getBundle();
return bundle.getResource(name);
}
--- /dev/null
+IssueLabelRule_Path=Path\r
+IssueLabelRule_Resource=Resource\r
+IssueView2_IssuesNotAvailable=Issues not available.\r
@Override
protected IPreferenceStore doGetPreferenceStore() {
- return new ScopedPreferenceStore(InstanceScope.INSTANCE, "org.simantics.issues");
+ return new ScopedPreferenceStore(InstanceScope.INSTANCE, "org.simantics.issues"); //$NON-NLS-1$
}
@Override
protected void createFieldEditors() {
//addField(new BooleanFieldEditor(IssuePreferences.P_ISSUES_ENABLED, "Issue searching &enabled (only takes effect after restart)", getFieldEditorParent()));
- IntegerFieldEditor f = new IntegerFieldEditor(IssuePreferences.P_MAX_BATCH_ISSUES_TO_WRITE, "Maximum batch validation issues to write", getFieldEditorParent());
- f.getLabelControl(getFieldEditorParent()).setToolTipText("Limit for amount of batch validation issue results to write into the database");
+ IntegerFieldEditor f = new IntegerFieldEditor(IssuePreferences.P_MAX_BATCH_ISSUES_TO_WRITE, Messages.IssuePreferencePage_MaximumBatchValidationIssues, getFieldEditorParent());
+ f.getLabelControl(getFieldEditorParent()).setToolTipText(Messages.IssuePreferencePage_LimitforAmountOfBatchValidation);
addField(f);
}
--- /dev/null
+package org.simantics.issues.ui.preferences;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.issues.ui.preferences.messages"; //$NON-NLS-1$
+ public static String IssuePreferencePage_LimitforAmountOfBatchValidation;
+ public static String IssuePreferencePage_MaximumBatchValidationIssues;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+IssuePreferencePage_LimitforAmountOfBatchValidation=Limit for amount of batch validation issue results to write into the database\r
+IssuePreferencePage_MaximumBatchValidationIssues=Maximum batch validation issues to write\r
--- /dev/null
+package org.simantics.logging.ui.handlers;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.logging.ui.handlers.messages"; //$NON-NLS-1$
+ public static String SaveLogFilesHandler_FilterAllFiles;
+ public static String SaveLogFilesHandler_FilterZipArchive;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
private static final Logger LOGGER = LoggerFactory.getLogger(SaveLogFilesHandler.class);
- private static final String[] FILTER_NAMES = { "ZIP-archive", "AllFiles (*.*)" };
- private static final String[] FILTER_EXTENSIONS = { "*.zip", "*.*" };
- private static final String USER_HOME = System.getProperty("user.home");
+ private static final String[] FILTER_NAMES = { Messages.SaveLogFilesHandler_FilterZipArchive, Messages.SaveLogFilesHandler_FilterAllFiles };
+ private static final String[] FILTER_EXTENSIONS = { "*.zip", "*.*" }; //$NON-NLS-1$ //$NON-NLS-2$
+ private static final String USER_HOME = System.getProperty("user.home"); //$NON-NLS-1$
@Execute
public void execute(@Named(IServiceConstants.ACTIVE_SHELL) Shell shell) {
String destination = dialog.open();
if (destination != null) {
if (LOGGER.isDebugEnabled())
- LOGGER.debug("Destination for saving log files is {}", destination);
+ LOGGER.debug("Destination for saving log files is {}", destination); //$NON-NLS-1$
try {
LogCollector.archiveLogs(destination);
} catch (Throwable t) {
- LOGGER.error("Could not save log files to ZIP", t);
- ExceptionUtils.logAndShowError("Could not save log files to ZIP", t);
+ LOGGER.error("Could not save log files to ZIP", t); //$NON-NLS-1$
+ ExceptionUtils.logAndShowError("Could not save log files to ZIP", t); //$NON-NLS-1$
}
} else {
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug("No destination selected for saving logs");
+ LOGGER.debug("No destination selected for saving logs"); //$NON-NLS-1$
}
}
}
@Execute
public void execute(@Named("org.simantics.logging.ui.commandparameter.selectLoggingLevel") String level) {
if (LOGGER.isDebugEnabled())
- LOGGER.debug("Setting logging level to {}", level);
+ LOGGER.debug("Setting logging level to {}", level); //$NON-NLS-1$
LogConfigurator.setLoggingLevel(level);
}
--- /dev/null
+SaveLogFilesHandler_FilterAllFiles=AllFiles (*.*)\r
+SaveLogFilesHandler_FilterZipArchive=ZIP-archive\r
public class Activator extends AbstractUIPlugin {
// The plug-in ID
- public static final String PLUGIN_ID = "org.simantics.message.ui";
+ public static final String PLUGIN_ID = "org.simantics.message.ui"; //$NON-NLS-1$
// The shared instance
private static Activator plugin;
if (stack != null) {
stack = filterStack(stack);
- detailsText.setText("<pre>" + stack + "</pre>");
+ detailsText.setText("<pre>" + stack + "</pre>"); //$NON-NLS-1$ //$NON-NLS-2$
detailsTextDescription.setText(Messages.EventDetailsDialog_exception);
} else {
- detailsText.setText("<pre>" + Messages.EventDetailsDialog_noDetailedMessage + "</pre>");
- }
- }
+ detailsText.setText("<pre>" + Messages.EventDetailsDialog_noDetailedMessage + "</pre>"); //$NON-NLS-1$ //$NON-NLS-2$
+ }
+ }
LogSession logSession = logEntry.getSession();
String session = logSession != null ? logSession.getSessionData() : null;
public void changing(LocationEvent event) {
//System.out.println("changing: " + event);
String location = event.location;
- if ("about:blank".equals(location)) {
+ if ("about:blank".equals(location)) { //$NON-NLS-1$
event.doit = true;
} else {
event.doit = false;
*/
fMessageDescription = new Browser(sashForm, SWT.NONE);
fMessageDescription.setBackground(parent.getDisplay().getSystemColor(SWT.COLOR_INFO_BACKGROUND));
- fMessageDescription.setText("<html><head></head><body><p>Select a message to show its description here.</p></body></html>");
+ fMessageDescription.setText("<html><head></head><body><p>Select a message to show its description here.</p></body></html>"); //$NON-NLS-1$
fMessageDescription.addLocationListener(new LocationListener() {
@Override
public void changed(LocationEvent event) {
public void changing(LocationEvent event) {
//System.out.println("changing: " + event);
String location = event.location;
- if ("about:blank".equals(location)) {
+ if ("about:blank".equals(location)) { //$NON-NLS-1$
event.doit = true;
} else {
event.doit = false;
IStructuredSelection s = (IStructuredSelection) event.getSelection();
if (s.isEmpty()) {
//fMessageDescription.setText("Select a message to show its description here.", false, false);
- fMessageDescription.setText("<html><head></head><body><pre>Select a message to show its description here.</pre></body></html>");
+ fMessageDescription.setText("<html><head></head><body><pre>Select a message to show its description here.</pre></body></html>"); //$NON-NLS-1$
} else {
AbstractEntry entry = (AbstractEntry) s.getFirstElement();
if (entry instanceof LogEntry) {
// truncation enables us to show even lengthy messages.
if (msg.length() > Short.MAX_VALUE) {
StringBuilder truncated = new StringBuilder();
- truncated.append("... [truncated ");
- truncated.append(msg.length() - (Short.MAX_VALUE - 100));
- truncated.append(" out of ");
- truncated.append(msg.length());
- truncated.append(" characters]");
+ truncated.append( NLS.bind(Messages.LogView_Truncated, msg.length() - (Short.MAX_VALUE - 100), msg.length()));
msg = msg.substring(0, Short.MAX_VALUE - 100) + truncated;
}
try {
@SuppressWarnings("unused")
private Action createTestAction() {
- Action action = new Action("Test") {
+ Action action = new Action("Test") { //$NON-NLS-1$
public void run() {
- IStatus s1 = new Status(IStatus.INFO, Activator.PLUGIN_ID, "Test message 1", null);
- IStatus s2 = new Status(IStatus.WARNING, Activator.PLUGIN_ID, "Test message 2", null);
- IStatus s3 = new DetailStatus(IStatus.ERROR, Activator.PLUGIN_ID, "This is the short message.", HtmlUtil.p("A multi-lined message...\n<br/>continuing...<br/><br/>still...<br/>Error occurred, report at " + HtmlUtil.a("http://www.simantics.org", "simantics.org")), null);
+ IStatus s1 = new Status(IStatus.INFO, Activator.PLUGIN_ID, "Test message 1", null); //$NON-NLS-1$
+ IStatus s2 = new Status(IStatus.WARNING, Activator.PLUGIN_ID, "Test message 2", null); //$NON-NLS-1$
+ IStatus s3 = new DetailStatus(IStatus.ERROR, Activator.PLUGIN_ID, "This is the short message.", HtmlUtil.p("A multi-lined message...\n<br/>continuing...<br/><br/>still...<br/>Error occurred, report at {0}" + HtmlUtil.a("http://www.simantics.org", "simantics.org")), null); //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-1$ //$NON-NLS-1$
MessageService.defaultLog(s1);
MessageService.defaultLog(s2);
MessageService.defaultLog(s3);
// Activator.getDefault().getLog().log(s2);
// Activator.getDefault().getLog().log(s3);
- MultiStatus s4 = new MultiStatus(Activator.PLUGIN_ID, 0, "Test message 4", new Exception());
- s4.merge(new Status(IStatus.INFO, Activator.PLUGIN_ID, "MultiStatus Test 1", null));
- s4.merge(new Status(IStatus.WARNING, Activator.PLUGIN_ID, "MultiStatus Test 2", null));
- s4.merge(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "MultiStatus Test 3", null));
+ MultiStatus s4 = new MultiStatus(Activator.PLUGIN_ID, 0, "Test message 4", new Exception()); //$NON-NLS-1$
+ s4.merge(new Status(IStatus.INFO, Activator.PLUGIN_ID, "MultiStatus Test 1", null)); //$NON-NLS-1$
+ s4.merge(new Status(IStatus.WARNING, Activator.PLUGIN_ID, "MultiStatus Test 2", null)); //$NON-NLS-1$
+ s4.merge(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "MultiStatus Test 3", null)); //$NON-NLS-1$
MessageService.defaultLog(s4);
// Activator.getDefault().getLog().log(s4);
}
};
action.setImageDescriptor(ImageDescriptor.getMissingImageDescriptor());
- action.setToolTipText("Produce test log entries");
+ action.setToolTipText("Produce test log entries"); //$NON-NLS-1$
return action;
}
// Remove the content description in this case
// to save vertical space from the view.
//return Messages.LogView_WorkspaceLogFile;
- return "";
+ return ""; //$NON-NLS-1$
}
Map<String, File> sources = LogFilesManager.getLogSources();
public static String LogView_GroupBySession;
public static String LogView_LogFileTitle;
public static String LogView_OpenFile;
+ public static String LogView_Truncated;
public static String LogView_WorkspaceLogFile;
public static String LogViewLabelProvider_Session;
}
static Mapping[] colors = new Mapping[] {
- new Mapping("AliceBlue", new RGB(0xF0, 0xF8, 0xFF)),
- new Mapping("AntiqueWhite", new RGB(0xFA, 0xEB, 0xD7)), new Mapping("Aqua", new RGB(0x00, 0xFF, 0xFF)),
- new Mapping("Aquamarine", new RGB(0x7F, 0xFF, 0xD4)), new Mapping("Azure", new RGB(0xF0, 0xFF, 0xFF)),
- new Mapping("Beige", new RGB(0xF5, 0xF5, 0xDC)), new Mapping("Bisque", new RGB(0xFF, 0xE4, 0xC4)),
- new Mapping("Black", new RGB(0x00, 0x00, 0x00)), new Mapping("BlanchedAlmond", new RGB(0xFF, 0xEB, 0xCD)),
- new Mapping("Blue", new RGB(0x00, 0x00, 0xFF)), new Mapping("BlueViolet", new RGB(0x8A, 0x2B, 0xE2)),
- new Mapping("Brown", new RGB(0xA5, 0x2A, 0x2A)), new Mapping("BurlyWood", new RGB(0xDE, 0xB8, 0x87)),
- new Mapping("CadetBlue", new RGB(0x5F, 0x9E, 0xA0)), new Mapping("Chartreuse", new RGB(0x7F, 0xFF, 0x00)),
- new Mapping("Chocolate", new RGB(0xD2, 0x69, 0x1E)), new Mapping("Coral", new RGB(0xFF, 0x7F, 0x50)),
- new Mapping("CornflowerBlue", new RGB(0x64, 0x95, 0xED)),
- new Mapping("Cornsilk", new RGB(0xFF, 0xF8, 0xDC)), new Mapping("Crimson", new RGB(0xDC, 0x14, 0x3C)),
- new Mapping("Cyan", new RGB(0x00, 0xFF, 0xFF)), new Mapping("DarkBlue", new RGB(0x00, 0x00, 0x8B)),
- new Mapping("DarkCyan", new RGB(0x00, 0x8B, 0x8B)),
- new Mapping("DarkGoldenRod", new RGB(0xB8, 0x86, 0x0B)),
- new Mapping("DarkGray", new RGB(0xA9, 0xA9, 0xA9)), new Mapping("DarkGreen", new RGB(0x00, 0x64, 0x00)),
- new Mapping("DarkKhaki", new RGB(0xBD, 0xB7, 0x6B)), new Mapping("DarkMagenta", new RGB(0x8B, 0x00, 0x8B)),
- new Mapping("DarkOliveGreen", new RGB(0x55, 0x6B, 0x2F)),
- new Mapping("Darkorange", new RGB(0xFF, 0x8C, 0x00)), new Mapping("DarkOrchid", new RGB(0x99, 0x32, 0xCC)),
- new Mapping("DarkRed", new RGB(0x8B, 0x00, 0x00)), new Mapping("DarkSalmon", new RGB(0xE9, 0x96, 0x7A)),
- new Mapping("DarkSeaGreen", new RGB(0x8F, 0xBC, 0x8F)),
- new Mapping("DarkSlateBlue", new RGB(0x48, 0x3D, 0x8B)),
- new Mapping("DarkSlateGray", new RGB(0x2F, 0x4F, 0x4F)),
- new Mapping("DarkTurquoise", new RGB(0x00, 0xCE, 0xD1)),
- new Mapping("DarkViolet", new RGB(0x94, 0x00, 0xD3)), new Mapping("DeepPink", new RGB(0xFF, 0x14, 0x93)),
- new Mapping("DeepSkyBlue", new RGB(0x00, 0xBF, 0xFF)), new Mapping("DimGray", new RGB(0x69, 0x69, 0x69)),
- new Mapping("DodgerBlue", new RGB(0x1E, 0x90, 0xFF)), new Mapping("FireBrick", new RGB(0xB2, 0x22, 0x22)),
- new Mapping("FloralWhite", new RGB(0xFF, 0xFA, 0xF0)),
- new Mapping("ForestGreen", new RGB(0x22, 0x8B, 0x22)), new Mapping("Fuchsia", new RGB(0xFF, 0x00, 0xFF)),
- new Mapping("Gainsboro", new RGB(0xDC, 0xDC, 0xDC)), new Mapping("GhostWhite", new RGB(0xF8, 0xF8, 0xFF)),
- new Mapping("Gold", new RGB(0xFF, 0xD7, 0x00)), new Mapping("GoldenRod", new RGB(0xDA, 0xA5, 0x20)),
- new Mapping("Gray", new RGB(0x80, 0x80, 0x80)), new Mapping("Green", new RGB(0x00, 0x80, 0x00)),
- new Mapping("GreenYellow", new RGB(0xAD, 0xFF, 0x2F)), new Mapping("HoneyDew", new RGB(0xF0, 0xFF, 0xF0)),
- new Mapping("HotPink", new RGB(0xFF, 0x69, 0xB4)), new Mapping("IndianRed", new RGB(0xCD, 0x5C, 0x5C)),
- new Mapping("Indigo", new RGB(0x4B, 0x00, 0x82)), new Mapping("Ivory", new RGB(0xFF, 0xFF, 0xF0)),
- new Mapping("Khaki", new RGB(0xF0, 0xE6, 0x8C)), new Mapping("Lavender", new RGB(0xE6, 0xE6, 0xFA)),
- new Mapping("LavenderBlush", new RGB(0xFF, 0xF0, 0xF5)),
- new Mapping("LawnGreen", new RGB(0x7C, 0xFC, 0x00)),
- new Mapping("LemonChiffon", new RGB(0xFF, 0xFA, 0xCD)),
- new Mapping("LightBlue", new RGB(0xAD, 0xD8, 0xE6)), new Mapping("LightCoral", new RGB(0xF0, 0x80, 0x80)),
- new Mapping("LightCyan", new RGB(0xE0, 0xFF, 0xFF)),
- new Mapping("LightGoldenRodYellow", new RGB(0xFA, 0xFA, 0xD2)),
- new Mapping("LightGrey", new RGB(0xD3, 0xD3, 0xD3)), new Mapping("LightGreen", new RGB(0x90, 0xEE, 0x90)),
- new Mapping("LightPink", new RGB(0xFF, 0xB6, 0xC1)), new Mapping("LightSalmon", new RGB(0xFF, 0xA0, 0x7A)),
- new Mapping("LightSeaGreen", new RGB(0x20, 0xB2, 0xAA)),
- new Mapping("LightSkyBlue", new RGB(0x87, 0xCE, 0xFA)),
- new Mapping("LightSlateGray", new RGB(0x77, 0x88, 0x99)),
- new Mapping("LightSteelBlue", new RGB(0xB0, 0xC4, 0xDE)),
- new Mapping("LightYellow", new RGB(0xFF, 0xFF, 0xE0)), new Mapping("Lime", new RGB(0x00, 0xFF, 0x00)),
- new Mapping("LimeGreen", new RGB(0x32, 0xCD, 0x32)), new Mapping("Linen", new RGB(0xFA, 0xF0, 0xE6)),
- new Mapping("Magenta", new RGB(0xFF, 0x00, 0xFF)), new Mapping("Maroon", new RGB(0x80, 0x00, 0x00)),
- new Mapping("MediumAquaMarine", new RGB(0x66, 0xCD, 0xAA)),
- new Mapping("MediumBlue", new RGB(0x00, 0x00, 0xCD)),
- new Mapping("MediumOrchid", new RGB(0xBA, 0x55, 0xD3)),
- new Mapping("MediumPurple", new RGB(0x93, 0x70, 0xD8)),
- new Mapping("MediumSeaGreen", new RGB(0x3C, 0xB3, 0x71)),
- new Mapping("MediumSlateBlue", new RGB(0x7B, 0x68, 0xEE)),
- new Mapping("MediumSpringGreen", new RGB(0x00, 0xFA, 0x9A)),
- new Mapping("MediumTurquoise", new RGB(0x48, 0xD1, 0xCC)),
- new Mapping("MediumVioletRed", new RGB(0xC7, 0x15, 0x85)),
- new Mapping("MidnightBlue", new RGB(0x19, 0x19, 0x70)),
- new Mapping("MintCream", new RGB(0xF5, 0xFF, 0xFA)), new Mapping("MistyRose", new RGB(0xFF, 0xE4, 0xE1)),
- new Mapping("Moccasin", new RGB(0xFF, 0xE4, 0xB5)), new Mapping("NavajoWhite", new RGB(0xFF, 0xDE, 0xAD)),
- new Mapping("Navy", new RGB(0x00, 0x00, 0x80)), new Mapping("OldLace", new RGB(0xFD, 0xF5, 0xE6)),
- new Mapping("Olive", new RGB(0x80, 0x80, 0x00)), new Mapping("OliveDrab", new RGB(0x6B, 0x8E, 0x23)),
- new Mapping("Orange", new RGB(0xFF, 0xA5, 0x00)), new Mapping("OrangeRed", new RGB(0xFF, 0x45, 0x00)),
- new Mapping("Orchid", new RGB(0xDA, 0x70, 0xD6)), new Mapping("PaleGoldenRod", new RGB(0xEE, 0xE8, 0xAA)),
- new Mapping("PaleGreen", new RGB(0x98, 0xFB, 0x98)),
- new Mapping("PaleTurquoise", new RGB(0xAF, 0xEE, 0xEE)),
- new Mapping("PaleVioletRed", new RGB(0xD8, 0x70, 0x93)),
- new Mapping("PapayaWhip", new RGB(0xFF, 0xEF, 0xD5)), new Mapping("PeachPuff", new RGB(0xFF, 0xDA, 0xB9)),
- new Mapping("Peru", new RGB(0xCD, 0x85, 0x3F)), new Mapping("Pink", new RGB(0xFF, 0xC0, 0xCB)),
- new Mapping("Plum", new RGB(0xDD, 0xA0, 0xDD)), new Mapping("PowderBlue", new RGB(0xB0, 0xE0, 0xE6)),
- new Mapping("Purple", new RGB(0x80, 0x00, 0x80)), new Mapping("Red", new RGB(0xFF, 0x00, 0x00)),
- new Mapping("RosyBrown", new RGB(0xBC, 0x8F, 0x8F)), new Mapping("RoyalBlue", new RGB(0x41, 0x69, 0xE1)),
- new Mapping("SaddleBrown", new RGB(0x8B, 0x45, 0x13)), new Mapping("Salmon", new RGB(0xFA, 0x80, 0x72)),
- new Mapping("SandyBrown", new RGB(0xF4, 0xA4, 0x60)), new Mapping("SeaGreen", new RGB(0x2E, 0x8B, 0x57)),
- new Mapping("SeaShell", new RGB(0xFF, 0xF5, 0xEE)), new Mapping("Sienna", new RGB(0xA0, 0x52, 0x2D)),
- new Mapping("Silver", new RGB(0xC0, 0xC0, 0xC0)), new Mapping("SkyBlue", new RGB(0x87, 0xCE, 0xEB)),
- new Mapping("SlateBlue", new RGB(0x6A, 0x5A, 0xCD)), new Mapping("SlateGray", new RGB(0x70, 0x80, 0x90)),
- new Mapping("Snow", new RGB(0xFF, 0xFA, 0xFA)), new Mapping("SpringGreen", new RGB(0x00, 0xFF, 0x7F)),
- new Mapping("SteelBlue", new RGB(0x46, 0x82, 0xB4)), new Mapping("Tan", new RGB(0xD2, 0xB4, 0x8C)),
- new Mapping("Teal", new RGB(0x00, 0x80, 0x80)), new Mapping("Thistle", new RGB(0xD8, 0xBF, 0xD8)),
- new Mapping("Tomato", new RGB(0xFF, 0x63, 0x47)), new Mapping("Turquoise", new RGB(0x40, 0xE0, 0xD0)),
- new Mapping("Violet", new RGB(0xEE, 0x82, 0xEE)), new Mapping("Wheat", new RGB(0xF5, 0xDE, 0xB3)),
- new Mapping("White", new RGB(0xFF, 0xFF, 0xFF)), new Mapping("WhiteSmoke", new RGB(0xF5, 0xF5, 0xF5)),
- new Mapping("Yellow", new RGB(0xFF, 0xFF, 0x00)), new Mapping("YellowGreen", new RGB(0x9A, 0xCD, 0x32))
+ new Mapping("AliceBlue", new RGB(0xF0, 0xF8, 0xFF)), //$NON-NLS-1$
+ new Mapping("AntiqueWhite", new RGB(0xFA, 0xEB, 0xD7)), new Mapping("Aqua", new RGB(0x00, 0xFF, 0xFF)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Aquamarine", new RGB(0x7F, 0xFF, 0xD4)), new Mapping("Azure", new RGB(0xF0, 0xFF, 0xFF)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Beige", new RGB(0xF5, 0xF5, 0xDC)), new Mapping("Bisque", new RGB(0xFF, 0xE4, 0xC4)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Black", new RGB(0x00, 0x00, 0x00)), new Mapping("BlanchedAlmond", new RGB(0xFF, 0xEB, 0xCD)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Blue", new RGB(0x00, 0x00, 0xFF)), new Mapping("BlueViolet", new RGB(0x8A, 0x2B, 0xE2)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Brown", new RGB(0xA5, 0x2A, 0x2A)), new Mapping("BurlyWood", new RGB(0xDE, 0xB8, 0x87)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("CadetBlue", new RGB(0x5F, 0x9E, 0xA0)), new Mapping("Chartreuse", new RGB(0x7F, 0xFF, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Chocolate", new RGB(0xD2, 0x69, 0x1E)), new Mapping("Coral", new RGB(0xFF, 0x7F, 0x50)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("CornflowerBlue", new RGB(0x64, 0x95, 0xED)), //$NON-NLS-1$
+ new Mapping("Cornsilk", new RGB(0xFF, 0xF8, 0xDC)), new Mapping("Crimson", new RGB(0xDC, 0x14, 0x3C)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Cyan", new RGB(0x00, 0xFF, 0xFF)), new Mapping("DarkBlue", new RGB(0x00, 0x00, 0x8B)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DarkCyan", new RGB(0x00, 0x8B, 0x8B)), //$NON-NLS-1$
+ new Mapping("DarkGoldenRod", new RGB(0xB8, 0x86, 0x0B)), //$NON-NLS-1$
+ new Mapping("DarkGray", new RGB(0xA9, 0xA9, 0xA9)), new Mapping("DarkGreen", new RGB(0x00, 0x64, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DarkKhaki", new RGB(0xBD, 0xB7, 0x6B)), new Mapping("DarkMagenta", new RGB(0x8B, 0x00, 0x8B)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DarkOliveGreen", new RGB(0x55, 0x6B, 0x2F)), //$NON-NLS-1$
+ new Mapping("Darkorange", new RGB(0xFF, 0x8C, 0x00)), new Mapping("DarkOrchid", new RGB(0x99, 0x32, 0xCC)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DarkRed", new RGB(0x8B, 0x00, 0x00)), new Mapping("DarkSalmon", new RGB(0xE9, 0x96, 0x7A)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DarkSeaGreen", new RGB(0x8F, 0xBC, 0x8F)), //$NON-NLS-1$
+ new Mapping("DarkSlateBlue", new RGB(0x48, 0x3D, 0x8B)), //$NON-NLS-1$
+ new Mapping("DarkSlateGray", new RGB(0x2F, 0x4F, 0x4F)), //$NON-NLS-1$
+ new Mapping("DarkTurquoise", new RGB(0x00, 0xCE, 0xD1)), //$NON-NLS-1$
+ new Mapping("DarkViolet", new RGB(0x94, 0x00, 0xD3)), new Mapping("DeepPink", new RGB(0xFF, 0x14, 0x93)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DeepSkyBlue", new RGB(0x00, 0xBF, 0xFF)), new Mapping("DimGray", new RGB(0x69, 0x69, 0x69)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("DodgerBlue", new RGB(0x1E, 0x90, 0xFF)), new Mapping("FireBrick", new RGB(0xB2, 0x22, 0x22)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("FloralWhite", new RGB(0xFF, 0xFA, 0xF0)), //$NON-NLS-1$
+ new Mapping("ForestGreen", new RGB(0x22, 0x8B, 0x22)), new Mapping("Fuchsia", new RGB(0xFF, 0x00, 0xFF)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Gainsboro", new RGB(0xDC, 0xDC, 0xDC)), new Mapping("GhostWhite", new RGB(0xF8, 0xF8, 0xFF)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Gold", new RGB(0xFF, 0xD7, 0x00)), new Mapping("GoldenRod", new RGB(0xDA, 0xA5, 0x20)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Gray", new RGB(0x80, 0x80, 0x80)), new Mapping("Green", new RGB(0x00, 0x80, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("GreenYellow", new RGB(0xAD, 0xFF, 0x2F)), new Mapping("HoneyDew", new RGB(0xF0, 0xFF, 0xF0)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("HotPink", new RGB(0xFF, 0x69, 0xB4)), new Mapping("IndianRed", new RGB(0xCD, 0x5C, 0x5C)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Indigo", new RGB(0x4B, 0x00, 0x82)), new Mapping("Ivory", new RGB(0xFF, 0xFF, 0xF0)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Khaki", new RGB(0xF0, 0xE6, 0x8C)), new Mapping("Lavender", new RGB(0xE6, 0xE6, 0xFA)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("LavenderBlush", new RGB(0xFF, 0xF0, 0xF5)), //$NON-NLS-1$
+ new Mapping("LawnGreen", new RGB(0x7C, 0xFC, 0x00)), //$NON-NLS-1$
+ new Mapping("LemonChiffon", new RGB(0xFF, 0xFA, 0xCD)), //$NON-NLS-1$
+ new Mapping("LightBlue", new RGB(0xAD, 0xD8, 0xE6)), new Mapping("LightCoral", new RGB(0xF0, 0x80, 0x80)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("LightCyan", new RGB(0xE0, 0xFF, 0xFF)), //$NON-NLS-1$
+ new Mapping("LightGoldenRodYellow", new RGB(0xFA, 0xFA, 0xD2)), //$NON-NLS-1$
+ new Mapping("LightGrey", new RGB(0xD3, 0xD3, 0xD3)), new Mapping("LightGreen", new RGB(0x90, 0xEE, 0x90)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("LightPink", new RGB(0xFF, 0xB6, 0xC1)), new Mapping("LightSalmon", new RGB(0xFF, 0xA0, 0x7A)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("LightSeaGreen", new RGB(0x20, 0xB2, 0xAA)), //$NON-NLS-1$
+ new Mapping("LightSkyBlue", new RGB(0x87, 0xCE, 0xFA)), //$NON-NLS-1$
+ new Mapping("LightSlateGray", new RGB(0x77, 0x88, 0x99)), //$NON-NLS-1$
+ new Mapping("LightSteelBlue", new RGB(0xB0, 0xC4, 0xDE)), //$NON-NLS-1$
+ new Mapping("LightYellow", new RGB(0xFF, 0xFF, 0xE0)), new Mapping("Lime", new RGB(0x00, 0xFF, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("LimeGreen", new RGB(0x32, 0xCD, 0x32)), new Mapping("Linen", new RGB(0xFA, 0xF0, 0xE6)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Magenta", new RGB(0xFF, 0x00, 0xFF)), new Mapping("Maroon", new RGB(0x80, 0x00, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("MediumAquaMarine", new RGB(0x66, 0xCD, 0xAA)), //$NON-NLS-1$
+ new Mapping("MediumBlue", new RGB(0x00, 0x00, 0xCD)), //$NON-NLS-1$
+ new Mapping("MediumOrchid", new RGB(0xBA, 0x55, 0xD3)), //$NON-NLS-1$
+ new Mapping("MediumPurple", new RGB(0x93, 0x70, 0xD8)), //$NON-NLS-1$
+ new Mapping("MediumSeaGreen", new RGB(0x3C, 0xB3, 0x71)), //$NON-NLS-1$
+ new Mapping("MediumSlateBlue", new RGB(0x7B, 0x68, 0xEE)), //$NON-NLS-1$
+ new Mapping("MediumSpringGreen", new RGB(0x00, 0xFA, 0x9A)), //$NON-NLS-1$
+ new Mapping("MediumTurquoise", new RGB(0x48, 0xD1, 0xCC)), //$NON-NLS-1$
+ new Mapping("MediumVioletRed", new RGB(0xC7, 0x15, 0x85)), //$NON-NLS-1$
+ new Mapping("MidnightBlue", new RGB(0x19, 0x19, 0x70)), //$NON-NLS-1$
+ new Mapping("MintCream", new RGB(0xF5, 0xFF, 0xFA)), new Mapping("MistyRose", new RGB(0xFF, 0xE4, 0xE1)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Moccasin", new RGB(0xFF, 0xE4, 0xB5)), new Mapping("NavajoWhite", new RGB(0xFF, 0xDE, 0xAD)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Navy", new RGB(0x00, 0x00, 0x80)), new Mapping("OldLace", new RGB(0xFD, 0xF5, 0xE6)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Olive", new RGB(0x80, 0x80, 0x00)), new Mapping("OliveDrab", new RGB(0x6B, 0x8E, 0x23)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Orange", new RGB(0xFF, 0xA5, 0x00)), new Mapping("OrangeRed", new RGB(0xFF, 0x45, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Orchid", new RGB(0xDA, 0x70, 0xD6)), new Mapping("PaleGoldenRod", new RGB(0xEE, 0xE8, 0xAA)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("PaleGreen", new RGB(0x98, 0xFB, 0x98)), //$NON-NLS-1$
+ new Mapping("PaleTurquoise", new RGB(0xAF, 0xEE, 0xEE)), //$NON-NLS-1$
+ new Mapping("PaleVioletRed", new RGB(0xD8, 0x70, 0x93)), //$NON-NLS-1$
+ new Mapping("PapayaWhip", new RGB(0xFF, 0xEF, 0xD5)), new Mapping("PeachPuff", new RGB(0xFF, 0xDA, 0xB9)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Peru", new RGB(0xCD, 0x85, 0x3F)), new Mapping("Pink", new RGB(0xFF, 0xC0, 0xCB)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Plum", new RGB(0xDD, 0xA0, 0xDD)), new Mapping("PowderBlue", new RGB(0xB0, 0xE0, 0xE6)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Purple", new RGB(0x80, 0x00, 0x80)), new Mapping("Red", new RGB(0xFF, 0x00, 0x00)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("RosyBrown", new RGB(0xBC, 0x8F, 0x8F)), new Mapping("RoyalBlue", new RGB(0x41, 0x69, 0xE1)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("SaddleBrown", new RGB(0x8B, 0x45, 0x13)), new Mapping("Salmon", new RGB(0xFA, 0x80, 0x72)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("SandyBrown", new RGB(0xF4, 0xA4, 0x60)), new Mapping("SeaGreen", new RGB(0x2E, 0x8B, 0x57)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("SeaShell", new RGB(0xFF, 0xF5, 0xEE)), new Mapping("Sienna", new RGB(0xA0, 0x52, 0x2D)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Silver", new RGB(0xC0, 0xC0, 0xC0)), new Mapping("SkyBlue", new RGB(0x87, 0xCE, 0xEB)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("SlateBlue", new RGB(0x6A, 0x5A, 0xCD)), new Mapping("SlateGray", new RGB(0x70, 0x80, 0x90)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Snow", new RGB(0xFF, 0xFA, 0xFA)), new Mapping("SpringGreen", new RGB(0x00, 0xFF, 0x7F)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("SteelBlue", new RGB(0x46, 0x82, 0xB4)), new Mapping("Tan", new RGB(0xD2, 0xB4, 0x8C)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Teal", new RGB(0x00, 0x80, 0x80)), new Mapping("Thistle", new RGB(0xD8, 0xBF, 0xD8)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Tomato", new RGB(0xFF, 0x63, 0x47)), new Mapping("Turquoise", new RGB(0x40, 0xE0, 0xD0)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Violet", new RGB(0xEE, 0x82, 0xEE)), new Mapping("Wheat", new RGB(0xF5, 0xDE, 0xB3)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("White", new RGB(0xFF, 0xFF, 0xFF)), new Mapping("WhiteSmoke", new RGB(0xF5, 0xF5, 0xF5)), //$NON-NLS-1$ //$NON-NLS-2$
+ new Mapping("Yellow", new RGB(0xFF, 0xFF, 0x00)), new Mapping("YellowGreen", new RGB(0x9A, 0xCD, 0x32)) //$NON-NLS-1$ //$NON-NLS-2$
};
public static void bindTo(ResourceManager manager, FormText text) {
LogView_GroupBySession=Session
LogView_LogFileTitle={0} [{1}]
LogView_OpenFile=Open File
+LogView_Truncated=... [truncated {0} out of {1} characters]
LogView_WorkspaceLogFile=Workspace Log
LogViewLabelProvider_truncatedMessage=... (Open log entry details for full message)
LogViewLabelProvider_Session=Session
public class HttpSchemeHandler extends AbstractMessageSchemeHandler<URL> {
public HttpSchemeHandler() {
- super("http", URL.class);
+ super("http", URL.class); //$NON-NLS-1$
}
@Override
public void doPerform(URL url) {
try {
- WorkbenchUtils.openEditor("org.simantics.editors.browser", new BrowserInput(url));
+ WorkbenchUtils.openEditor("org.simantics.editors.browser", new BrowserInput(url)); //$NON-NLS-1$
} catch (PartInitException e) {
throw new RuntimeException(e);
}
public class ResourceSchemeHandler extends AbstractMessageSchemeHandler<Resource> {
public ResourceSchemeHandler() {
- super("resource", Resource.class);
+ super("resource", Resource.class); //$NON-NLS-1$
}
@Override
Session session = Simantics.peekSession();
if (session == null) {
// FIXME: not stdout.
- System.out.println("ResourceSchemeHandler: no session");
+ System.out.println("ResourceSchemeHandler: no session"); //$NON-NLS-1$
return;
}
+++ /dev/null
-/*******************************************************************************
- * Copyright (c) 2007, 2010 Association for Decentralized Information Management
- * in Industry THTH ry.
- * All rights reserved. This program and the accompanying materials
- * are made available under the terms of the Eclipse Public License v1.0
- * which accompanies this distribution, and is available at
- * http://www.eclipse.org/legal/epl-v10.html
- *
- * Contributors:
- * VTT Technical Research Centre of Finland - initial API and implementation
- *******************************************************************************/
-package org.simantics.message.ui.test;
-
-import org.eclipse.osgi.util.NLS;
-
-public class Messages extends NLS {
-
- public static String Test_message;
-
- private static final String BUNDLE_NAME = "org.simantics.message.ui.test.messages"; //$NON-NLS-1$
-
- static {
- NLS.initializeMessages(BUNDLE_NAME, Messages.class);
- }
-
-}
int code = 0;
for (Resource r : rs) {
log.log(new DetailStatus(IDetailStatus.DEBUG, Activator.PLUGIN_ID, code++,
- "Logged reference to selected resource",
- NLS.bind(Messages.Test_message, MessageUtil.resource(s, r, "this link")),
+ "Logged reference to selected resource", //$NON-NLS-1$
+ NLS.bind("<p>This is a detailed message that contains links to related information. Follow {0} to open your favorite editor for the database resource.</p>", MessageUtil.resource(s, r, "this link")), //$NON-NLS-1$
null));
}
} catch (ReferenceSerializationException e) {
+++ /dev/null
-###############################################################################
-# Copyright (c) 2007, 2010 Association for Decentralized Information Management
-# in Industry THTH ry.
-# All rights reserved. This program and the accompanying materials
-# are made available under the terms of the Eclipse Public License v1.0
-# which accompanies this distribution, and is available at
-# http://www.eclipse.org/legal/epl-v10.html
-#
-# Contributors:
-# VTT Technical Research Centre of Finland - initial API and implementation
-###############################################################################
-
-Test_message = <p>This is a detailed message that contains links to related information. Follow {0} to open your favorite editor for the database resource.</p>
--- /dev/null
+package org.simantics.migration.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.migration.ui.messages"; //$NON-NLS-1$
+ public static String MigrateActionFactory_Migrate;
+ public static String MigrateActionFactory_MigrateMsg;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
private void select(final Resource resource, final ArrayList<Update> updates) {
ListDialog listDialog = new ListDialog(Display.getCurrent().getActiveShell());
- listDialog.setTitle("Migrate");
- listDialog.setMessage("Choose the version to migrate to");
+ listDialog.setTitle(Messages.MigrateActionFactory_Migrate);
+ listDialog.setMessage(Messages.MigrateActionFactory_MigrateMsg);
listDialog.setContentProvider(new IStructuredContentProvider() {
@Override
public void inputChanged(Viewer viewer, Object oldInput, Object newInput) {
--- /dev/null
+MigrateActionFactory_Migrate=Migrate\r
+MigrateActionFactory_MigrateMsg=Choose the version to migrate to\r
public class Activator extends AbstractUIPlugin {
- public static final String PLUGIN_ID = "org.simantics.modeling.ui";
+ public static final String PLUGIN_ID = "org.simantics.modeling.ui"; //$NON-NLS-1$
// The shared instance
private static Activator plugin;
Bundle bundle = context.getBundle();
- DOCUMENT_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/Gnome-mime-document.svg"));
- FATAL_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/fatal.svg"));
- ERROR_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/error.svg"));
- WARNING_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/warning.svg"));
- INFO_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/info.svg"));
- NOTE_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/note4.svg"));
-
- BULLET_GREEN_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bullet_green.png"));
- BULLET_YELLOW_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bullet_yellow.png"));
-
- MODEL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_organisation.png"));
- COMPONENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/brick.png"));
- COMPONENT_TYPE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/box.png"));
- COMPOSITE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bricks.png"));
- INTERFACE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/application_view_list.png"));
- CONNECTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/connection.png"));
- CONNECTION_PROPERTY_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/table_relationship.png"));
- OPEN_CONNECTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/open_connection.png"));
- VARIABLE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/variable.png"));
-
- ARROW_LEFT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_left.png"));
- ARROW_RIGHT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_right.png"));
-
- SYMBOL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/photo.png"));
-
- EXPERIMENTS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png"));
- ATTACHED_EXPERIMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/time_attach.png"));
- EXPERIMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/time.png"));
- EXPERIMENT_RESULT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_bar.png"));
- EXPERIMENT_RESULT_TRANSIENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_bar_light.png"));
-
- QUERY_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/report.png"));
-
- STATES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder_tag_red.png"));
- STATE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_red.png"));
-
- TRENDS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png"));
- TREND_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_line.png"));
-
- CHARTGROUP_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_group2.png"));
- CHARTS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png"));
- CHART_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_line.png"));
- PLOT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_blue.png"));
-
- SPREADSHEET_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/table.png"));
- SPREADSHEETS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder_table.png"));
-
- SUBSCRIPTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscription.png"));
- SUBSCRIPTION_DISABLED_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscription_disabled.png"));
- SUBSCRIPTIONS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscriptions.png"));
- SUBSCRIPTION_ITEM_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_blue.png"));
-
- IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/image.png"));
- IMAGES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/images.png"));
-
- SEGMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/segment_edit.gif"));
-
- TICK_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tick.png"));
- CROSS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/silk/cross.png"));
- STOP_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/stop_red.png"));
- ARROW_IN_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_in.png");
- ARROW_UP_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/bullet_arrow_up.png");
- ARROW_DOWN_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/bullet_arrow_down.png");
- SHOW_PROFILE_MONITOR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/show-profile-monitors.png"));
- HIDE_PROFILE_MONITOR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/hide-profile-monitors.png"));
-
- POINTER_MODE = ImageDescriptor.createFromURL(bundle.getResource("icons/pointertool.png"));
- CONNECT_MODE = ImageDescriptor.createFromURL(bundle.getResource("icons/connecttool.png"));
+ DOCUMENT_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/Gnome-mime-document.svg")); //$NON-NLS-1$
+ FATAL_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/fatal.svg")); //$NON-NLS-1$
+ ERROR_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/error.svg")); //$NON-NLS-1$
+ WARNING_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/warning.svg")); //$NON-NLS-1$
+ INFO_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/info.svg")); //$NON-NLS-1$
+ NOTE_SVG_TEXT = FileUtils.getContents(bundle.getResource("icons/note4.svg")); //$NON-NLS-1$
+
+ BULLET_GREEN_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bullet_green.png")); //$NON-NLS-1$
+ BULLET_YELLOW_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bullet_yellow.png")); //$NON-NLS-1$
+
+ MODEL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_organisation.png")); //$NON-NLS-1$
+ COMPONENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/brick.png")); //$NON-NLS-1$
+ COMPONENT_TYPE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/box.png")); //$NON-NLS-1$
+ COMPOSITE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/bricks.png")); //$NON-NLS-1$
+ INTERFACE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/application_view_list.png")); //$NON-NLS-1$
+ CONNECTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/connection.png")); //$NON-NLS-1$
+ CONNECTION_PROPERTY_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/table_relationship.png")); //$NON-NLS-1$
+ OPEN_CONNECTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/open_connection.png")); //$NON-NLS-1$
+ VARIABLE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/variable.png")); //$NON-NLS-1$
+
+ ARROW_LEFT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_left.png")); //$NON-NLS-1$
+ ARROW_RIGHT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_right.png")); //$NON-NLS-1$
+
+ SYMBOL_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/photo.png")); //$NON-NLS-1$
+
+ EXPERIMENTS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png")); //$NON-NLS-1$
+ ATTACHED_EXPERIMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/time_attach.png")); //$NON-NLS-1$
+ EXPERIMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/time.png")); //$NON-NLS-1$
+ EXPERIMENT_RESULT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_bar.png")); //$NON-NLS-1$
+ EXPERIMENT_RESULT_TRANSIENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_bar_light.png")); //$NON-NLS-1$
+
+ QUERY_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/report.png")); //$NON-NLS-1$
+
+ STATES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder_tag_red.png")); //$NON-NLS-1$
+ STATE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_red.png")); //$NON-NLS-1$
+
+ TRENDS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png")); //$NON-NLS-1$
+ TREND_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_line.png")); //$NON-NLS-1$
+
+ CHARTGROUP_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_group2.png")); //$NON-NLS-1$
+ CHARTS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder.png")); //$NON-NLS-1$
+ CHART_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/chart_line.png")); //$NON-NLS-1$
+ PLOT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_blue.png")); //$NON-NLS-1$
+
+ SPREADSHEET_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/table.png")); //$NON-NLS-1$
+ SPREADSHEETS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/folder_table.png")); //$NON-NLS-1$
+
+ SUBSCRIPTION_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscription.png")); //$NON-NLS-1$
+ SUBSCRIPTION_DISABLED_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscription_disabled.png")); //$NON-NLS-1$
+ SUBSCRIPTIONS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/subscriptions.png")); //$NON-NLS-1$
+ SUBSCRIPTION_ITEM_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tag_blue.png")); //$NON-NLS-1$
+
+ IMAGE_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/image.png")); //$NON-NLS-1$
+ IMAGES_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/images.png")); //$NON-NLS-1$
+
+ SEGMENT_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/segment_edit.gif")); //$NON-NLS-1$
+
+ TICK_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/tick.png")); //$NON-NLS-1$
+ CROSS_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/silk/cross.png")); //$NON-NLS-1$
+ STOP_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/stop_red.png")); //$NON-NLS-1$
+ ARROW_IN_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/arrow_in.png"); //$NON-NLS-1$ //$NON-NLS-2$
+ ARROW_UP_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/bullet_arrow_up.png"); //$NON-NLS-1$ //$NON-NLS-2$
+ ARROW_DOWN_ICON = BundleUtils.getImageDescriptorFromPlugin("com.famfamfam.silk", "icons/bullet_arrow_down.png"); //$NON-NLS-1$ //$NON-NLS-2$
+ SHOW_PROFILE_MONITOR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/show-profile-monitors.png")); //$NON-NLS-1$
+ HIDE_PROFILE_MONITOR_ICON = ImageDescriptor.createFromURL(bundle.getResource("icons/hide-profile-monitors.png")); //$NON-NLS-1$
+
+ POINTER_MODE = ImageDescriptor.createFromURL(bundle.getResource("icons/pointertool.png")); //$NON-NLS-1$
+ CONNECT_MODE = ImageDescriptor.createFromURL(bundle.getResource("icons/connecttool.png")); //$NON-NLS-1$
- ARROW_REFRESH = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_refresh.png"));
+ ARROW_REFRESH = ImageDescriptor.createFromURL(bundle.getResource("icons/arrow_refresh.png")); //$NON-NLS-1$
Hashtable<String, String> properties = new Hashtable<String, String>();
context.registerService(SCLConsoleListener.class,
@Override
protected void initializeImageRegistry(ImageRegistry reg) {
- reg.put("tick", TICK_ICON);
- reg.put("cross", CROSS_ICON);
- reg.put("stop", STOP_ICON);
- reg.put("arrowIn", ARROW_IN_ICON);
- reg.put("arrowUp", ARROW_UP_ICON);
- reg.put("arrowDown", ARROW_DOWN_ICON);
- reg.put("showProfileMonitors", SHOW_PROFILE_MONITOR_ICON);
- reg.put("hideProfileMonitors", HIDE_PROFILE_MONITOR_ICON);
- reg.put("arrow_refresh", ARROW_REFRESH);
+ reg.put("tick", TICK_ICON); //$NON-NLS-1$
+ reg.put("cross", CROSS_ICON); //$NON-NLS-1$
+ reg.put("stop", STOP_ICON); //$NON-NLS-1$
+ reg.put("arrowIn", ARROW_IN_ICON); //$NON-NLS-1$
+ reg.put("arrowUp", ARROW_UP_ICON); //$NON-NLS-1$
+ reg.put("arrowDown", ARROW_DOWN_ICON); //$NON-NLS-1$
+ reg.put("showProfileMonitors", SHOW_PROFILE_MONITOR_ICON); //$NON-NLS-1$
+ reg.put("hideProfileMonitors", HIDE_PROFILE_MONITOR_ICON); //$NON-NLS-1$
+ reg.put("arrow_refresh", ARROW_REFRESH); //$NON-NLS-1$
}
/*
--- /dev/null
+package org.simantics.modeling.ui;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.messages"; //$NON-NLS-1$
+ public static String ModelingUIUtils_SelectQueryType;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
String label = graph.getPossibleRelatedValue2(_res, L0.HasLabel, Bindings.STRING);
if (label != null && !name.equals(label)) {
- name = label + " (" + name + ")";
+ name = label + " (" + name + ")"; //$NON-NLS-1$ //$NON-NLS-2$
}
Resource parent = graph.getPossibleObject(_res, L0.PartOf);
String parentURI = graph.getURI(parent);
if(parentURI.startsWith(modelURI)) {
parentURI = parentURI.substring(modelURI.length());
- if(parentURI.startsWith("/")) parentURI = parentURI.substring(1);
+ if(parentURI.startsWith("/")) parentURI = parentURI.substring(1); //$NON-NLS-1$
}
- name = name + " - " + URIStringUtils.unescape(parentURI);
+ name = name + " - " + URIStringUtils.unescape(parentURI); //$NON-NLS-1$
map.put(_res, new Pair<String, ImageDescriptor>(name, null));
String label = graph.getPossibleRelatedValue2(res, L0.HasLabel, Bindings.STRING);
if (label != null && !name.equals(label)) {
- name = label + " (" + name + ")";
+ name = label + " (" + name + ")"; //$NON-NLS-1$ //$NON-NLS-2$
}
Resource parent = graph.getPossibleObject(_res, L0.PartOf);
String parentURI = graph.getURI(parent);
if(parentURI.startsWith(modelURI)) {
parentURI = parentURI.substring(modelURI.length());
- if(parentURI.startsWith("/")) parentURI = parentURI.substring(1);
+ if(parentURI.startsWith("/")) parentURI = parentURI.substring(1); //$NON-NLS-1$
}
- name = name + " - " + URIStringUtils.unescape(parentURI);
+ name = name + " - " + URIStringUtils.unescape(parentURI); //$NON-NLS-1$
map.put(_res, new Pair<String, ImageDescriptor>(name, null));
@Override
public void run() {
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
- ResourceSelectionDialog3<Resource> dialog = new ResourceSelectionDialog3<Resource>(shell, map, "Select query type from list") {
+ ResourceSelectionDialog3<Resource> dialog = new ResourceSelectionDialog3<Resource>(shell, map, Messages.ModelingUIUtils_SelectQueryType) {
@Override
protected IDialogSettings getBaseDialogSettings() {
return Activator.getDefault().getDialogSettings();
@Override
public void perform(WriteGraph g) throws DatabaseException {
g.markUndoPoint();
- Simantics.applySCL("Simantics/Query", "createSCLQueryDefault", g, parent, selected);
+ Simantics.applySCL("Simantics/Query", "createSCLQueryDefault", g, parent, selected); //$NON-NLS-1$ //$NON-NLS-2$
}
});
});
if (element != null) {
newSelection.add(element);
} else {
- throw new DatabaseException("Could not find IElement for " + element);
+ throw new DatabaseException("Could not find IElement for " + element); //$NON-NLS-1$
}
}
if (element != null) {
newSelection.add(element);
} else {
- throw new DatabaseException("Could not find IElement for " + element);
+ throw new DatabaseException("Could not find IElement for " + element); //$NON-NLS-1$
}
}
public static Variable templateDiagram(ReadGraph graph, Variable self) throws DatabaseException {
Variable selection = ScenegraphLoaderUtils.getVariableSelection(graph, self);
- return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "diagram");
+ return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "diagram"); //$NON-NLS-1$
}
public static Variable templateComposite(ReadGraph graph, Variable self) throws DatabaseException {
Variable selection = ScenegraphLoaderUtils.getVariableSelection(graph, self);
- return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "diagramComposite");
+ return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "diagramComposite"); //$NON-NLS-1$
}
public static Variable templateModel(ReadGraph graph, Variable self) throws DatabaseException {
Variable selection = ScenegraphLoaderUtils.getVariableSelection(graph, self);
- return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "model");
+ return PredefinedVariables.getInstance().getPredefinedVariable(graph, selection, "model"); //$NON-NLS-1$
}
}
\ No newline at end of file
import java.util.concurrent.atomic.AtomicReference;
import org.eclipse.jface.dialogs.Dialog;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.IInputValidator;
import org.eclipse.jface.dialogs.InputDialog;
import org.eclipse.jface.dialogs.MessageDialog;
import org.eclipse.jface.viewers.IStructuredContentProvider;
import org.eclipse.jface.viewers.LabelProvider;
import org.eclipse.jface.viewers.Viewer;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.widgets.Shell;
import org.eclipse.ui.PlatformUI;
import org.simantics.Simantics;
@Override
public String toString() {
- return getClass().getSimpleName() + "[name=" + name
- + ", originally selected=" + originallySelected
- + ", selected=" + selected + "]";
+ return getClass().getSimpleName() + "[name=" + name //$NON-NLS-1$
+ + ", originally selected=" + originallySelected //$NON-NLS-1$
+ + ", selected=" + selected + "]"; //$NON-NLS-1$ //$NON-NLS-2$
}
}
final Resource model = getCommonModel(symbols);
if (model == null) {
- ShowMessage.showInformation("Same Model Required", "All the selected symbols must be from within the same model.");
+ ShowMessage.showInformation(Messages.AssignSymbolGroup_SameModelRequired, Messages.AssignSymbolGroup_SameModelRequiredMsg);
return;
}
final AtomicReference<SymbolGroup[]> groups =
new AtomicReference<SymbolGroup[]>( getSymbolGroups(symbols) );
- StringBuilder message = new StringBuilder();
- message.append("Select symbol groups the selected ");
- if (symbols.size() > 1)
- message.append(symbols.size()).append(" symbols are shown in.");
- else
- message.append("symbol is shown in.");
+ String message = symbols.size() > 1
+ ? NLS.bind(Messages.AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolsAreShownIn, symbols.size())
+ : Messages.AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolIsShownIn;
AssignSymbolGroupsDialog dialog = new AssignSymbolGroupsDialog(
PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell(),
}
}
};
- dialog.setTitle("Symbol Group Assignments");
+ dialog.setTitle(Messages.AssignSymbolGroup_SymbolGroupAssignments);
dialog.setInitialSelections(selectedElements(groups.get()));
if (dialog.open() == Dialog.OK) {
final ArrayList<SymbolGroup> added = new ArrayList<SymbolGroup>();
private static SymbolGroup newSymbolGroup(Shell shell, Resource model, final SymbolGroup[] oldGroups) {
InputDialog dialog = new InputDialog(shell,
- "New Symbol Group",
- "Write the name of the new symbol group.",
- "NewSymbolGroup",
+ Messages.AssignSymbolGroup_NewSymbolGroup,
+ Messages.AssignSymbolGroup_WriteSymbolGroupName,
+ "NewSymbolGroup", //$NON-NLS-1$
new IInputValidator() {
@Override
public String isValid(String newText) {
newText = newText.trim();
if (newText.isEmpty())
- return "The name must be non-empty.";
+ return Messages.AssignSymbolGroup_NameMustNotBeEmpty;
for (SymbolGroup g : oldGroups)
if (newText.equals(g.name))
- return "A symbol group with that name already exists.";
+ return Messages.AssignSymbolGroup_GroupSymbolAlreadyExists;
return null;
}
}
return false;
String message;
if (groups.length == 1)
- message = "Are you sure you want to remove symbol group '" + groups[0].name + "' ?";
+ message = NLS.bind(Messages.AssignSymbolGroup_AreYouSureToRemoveSymbolGroup, groups[0].name );
else
- message = "Are you sure you want to remove " + groups.length + " symbol groups?";
+ message = NLS.bind(Messages.AssignSymbolGroup_AreYouSureToRemoveSymbolGroup1, groups.length );
MessageDialog dialog =
- new MessageDialog(shell, "Confirm removal", null, message, MessageDialog.QUESTION, new String[] { "OK", "Cancel" }, 0);
+ new MessageDialog(shell, Messages.AssignSymbolGroup_ConfirmRemoval, null, message, MessageDialog.QUESTION, new String[] { IDialogConstants.OK_LABEL , IDialogConstants.CANCEL_LABEL }, 0);
if (dialog.open() == Dialog.OK) {
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
private static final String DIALOG = "AssignSymbolGroupsDialog"; //$NON-NLS-1$
- static String SELECT_ALL_TITLE = WorkbenchMessages.SelectionDialog_selectLabel;
+ static String SELECT_ALL_TITLE = ""; //$NON-NLS-1$
- static String DESELECT_ALL_TITLE = WorkbenchMessages.SelectionDialog_deselectLabel;
+ static String DESELECT_ALL_TITLE = ""; //$NON-NLS-1$
// the root element to populate the viewer with
protected Object inputElement;
ICheckStateProvider checkStateProvider,
String message) {
super(parentShell);
- setTitle(WorkbenchMessages.ListSelection_title);
+ setTitle(""); //$NON-NLS-1$
inputElement = input;
this.contentProvider = contentProvider;
this.labelProvider = labelProvider;
if (message != null) {
setMessage(message);
} else {
- setMessage(WorkbenchMessages.ListSelection_message);
+ setMessage(""); //$NON-NLS-1$
}
IDialogSettings settings = Activator.getDefault().getDialogSettings();
Label label = new Label(buttonComposite, SWT.NONE);
Button newButton = createButton(buttonComposite,
- IDialogConstants.INTERNAL_ID-1, "&New...", false);
+ IDialogConstants.INTERNAL_ID-1, org.simantics.modeling.ui.actions.WorkbenchMessages.AssignSymbolGroupsDialog_NewDots, false);
listener = new SelectionAdapter() {
public void widgetSelected(SelectionEvent e) {
newButton.addSelectionListener(listener);
Button removeButton = createButton(buttonComposite,
- IDialogConstants.INTERNAL_ID-2, "&Remove", false);
+ IDialogConstants.INTERNAL_ID-2, org.simantics.modeling.ui.actions.WorkbenchMessages.AssignSymbolGroupsDialog_RemoveAnd, false);
listener = new SelectionAdapter() {
public void widgetSelected(SelectionEvent e) {
if (!(target instanceof Resource))
return null;
return () -> {
- Job job = new Job("Compile PGraphs") {
+ Job job = new Job(Messages.CompilePGraphsAction_CompilePGraphs) {
@Override
protected IStatus run(IProgressMonitor monitor) {
try {
class ErrorMessageDialog extends MessageDialog {
public ErrorMessageDialog(Shell shell) {
super(shell,
- "Problems in the Ontology Definition File", null,
- "The following issues were found:",
- MessageDialog.ERROR, new String[] { "Continue" }, 0);
+ Messages.CompilePGraphsAction_ProblemsinOntologyDefinitionFile, null,
+ Messages.CompilePGraphsAction_FollowingIssuesFound,
+ MessageDialog.ERROR, new String[] { Messages.CompilePGraphsAction_Continue }, 0);
}
@Override
org.eclipse.swt.widgets.List list = new org.eclipse.swt.widgets.List(composite, SWT.BORDER | SWT.READ_ONLY);
GridDataFactory.fillDefaults().grab(true, true).applyTo(list);
for (Problem problem : result.getErrors())
- list.add(problem.getLocation() + ": " + problem.getDescription() + "\n");
+ list.add(problem.getLocation() + ": " + problem.getDescription() + "\n"); //$NON-NLS-1$ //$NON-NLS-2$
for (Problem problem : result.getWarnings())
- list.add(problem.getLocation() + ": " + problem.getDescription() + "\n");
+ list.add(problem.getLocation() + ": " + problem.getDescription() + "\n"); //$NON-NLS-1$ //$NON-NLS-2$
return composite;
}
@Override
public String toString() {
- return getClass().getSimpleName() + "[name=" + name
- + ", originally selected=" + originallySelected
- + ", selected=" + selected + "]";
+ return getClass().getSimpleName() + "[name=" + name //$NON-NLS-1$
+ + ", originally selected=" + originallySelected //$NON-NLS-1$
+ + ", selected=" + selected + "]"; //$NON-NLS-1$ //$NON-NLS-2$
}
}
final Resource indexRoot = getCommonModel(connectionPoints);
if (indexRoot == null) {
- ShowMessage.showInformation("Same Model Required", "All the selected connection points must be from within the same index root.");
+ ShowMessage.showInformation(Messages.ConfigureConnectionTypes_SameModelRequired, Messages.ConfigureConnectionTypes_SameModelRequiredMsg);
return;
}
StringBuilder message = new StringBuilder();
if (connectionPoints.size() > 1)
- message.append("Select connection types for the selected connection points");
+ message.append(Messages.ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoints);
else
- message.append("Select connection types for the selected connection point");
+ message.append(Messages.ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoint);
ConfigureConnectionTypesDialog dialog = new ConfigureConnectionTypesDialog(
PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell(),
}
};
- dialog.setTitle("Connection Type Assignments");
+ dialog.setTitle(Messages.ConfigureConnectionTypes_ConnectionTypeAssignments);
dialog.setInitialSelections(selectedElements(types.get()));
if (dialog.open() == Dialog.OK) {
final ArrayList<ConnectionType> added = new ArrayList<ConnectionType>();
resources.add((Resource)o);
}
return () -> {
- Job job = new Job("Copy") {
+ Job job = new Job(Messages.Copy_Copy) {
@Override
protected IStatus run(IProgressMonitor monitor) {
@Override
public String getDefaultElementData() {
final String data =
- "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" +
- "<svg overflow=\"visible\" version=\"1.1\">" +
- "<ellipse x=\"0\" y=\"0\" rx=\"5\" ry=\"5\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+
- "</svg>";
+ "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" + //$NON-NLS-1$
+ "<svg overflow=\"visible\" version=\"1.1\">" + //$NON-NLS-1$
+ "<ellipse x=\"0\" y=\"0\" rx=\"5\" ry=\"5\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+ //$NON-NLS-1$
+ "</svg>"; //$NON-NLS-1$
return data;
}
@Override
public String getDefaultElementData() {
final String data =
- "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" +
- "<svg overflow=\"visible\" version=\"1.1\">" +
- "<path d=\"M0 0 L10 0\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+
- "</svg>";
+ "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" + //$NON-NLS-1$
+ "<svg overflow=\"visible\" version=\"1.1\">" + //$NON-NLS-1$
+ "<path d=\"M0 0 L10 0\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+ //$NON-NLS-1$
+ "</svg>"; //$NON-NLS-1$
return data;
}
@Override
public String getDefaultElementData() {
final String data =
- "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" +
- "<svg overflow=\"visible\" version=\"1.1\">" +
- "<rect x=\"0\" y=\"0\" width=\"10\" height=\"10\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+
- "</svg>";
+ "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" + //$NON-NLS-1$
+ "<svg overflow=\"visible\" version=\"1.1\">" + //$NON-NLS-1$
+ "<rect x=\"0\" y=\"0\" width=\"10\" height=\"10\" style=\"fill:none;stroke-width:1;stroke:rgb(0,0,0)\"/>"+ //$NON-NLS-1$
+ "</svg>"; //$NON-NLS-1$
return data;
}
}
});
- IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput));
+ IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput)); //$NON-NLS-1$
if (eps.length == 0) {
- System.out.println("symbol editor part not found from multi page editor part: " + ap);
+ System.out.println("symbol editor part not found from multi page editor part: " + ap); //$NON-NLS-1$
return null;
}
viewer = eps[0];
}
ICanvasContext ctx = (ICanvasContext) viewer.getAdapter(ICanvasContext.class);
if (ctx == null) {
- System.out.println("No canvas context");
+ System.out.println("No canvas context"); //$NON-NLS-1$
return null;
}
MouseInfo minfo = ctx.getSingleItem(MouseUtil.class).getMousePressedInfo(0);
if(minfo == null) {
- System.out.println("No mouse info");
+ System.out.println("No mouse info"); //$NON-NLS-1$
return null;
}
final Point2D mpos = minfo.canvasPosition;
@Override
public String getDefaultElementData() {
final String data =
- "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" +
- "<svg overflow=\"visible\" version=\"1.1\">" +
- "<text fill=\"rgb(0,0,0)\" stroke=\"none\" font-size=\"12\"><tspan font-family=\"sans-serif\" >Text</tspan></text>" +
- "</svg>";
+ "<?xml version=\"1.0\" encoding=\"UTF-8\" ?>" + //$NON-NLS-1$
+ "<svg overflow=\"visible\" version=\"1.1\">" + //$NON-NLS-1$
+ "<text fill=\"rgb(0,0,0)\" stroke=\"none\" font-size=\"12\"><tspan font-family=\"sans-serif\" >Text</tspan></text>" + //$NON-NLS-1$
+ "</svg>"; //$NON-NLS-1$
return data;
}
*/
public class DuplicatePinnedViewHandler extends AbstractHandler {
- private static final String PIN_SELECTION_COMMAND = "org.simantics.modeling.ui.pinSelection";
+ private static final String PIN_SELECTION_COMMAND = "org.simantics.modeling.ui.pinSelection"; //$NON-NLS-1$
@Override
public Object execute(ExecutionEvent event) throws ExecutionException {
// with a property page just like the original.
ISelection originalSelection = originalPropertyView.getLastSelection();
- final String id = originalPart.getSite().getId() + "Pinned:" + UUID.randomUUID().toString();
+ final String id = originalPart.getSite().getId() + "Pinned:" + UUID.randomUUID().toString(); //$NON-NLS-1$
PropertyPageView newPart = (PropertyPageView) WorkbenchUtils.activateView(id);
newPart.partActivated(originalPart);
@Override
protected void perform(IProgressMonitor monitor, WriteGraph graph, List<Resource> flags,
ICanvasContext canvasContext) throws DatabaseException {
- monitor.beginTask("Expand Flags", IProgressMonitor.UNKNOWN);
+ monitor.beginTask(Messages.ExpandFlagsHandler_MonitorExpandFlags, IProgressMonitor.UNKNOWN);
Set<Resource> newSelection = new HashSet<Resource>();
for (Resource flag : flags) {
}
protected ImageDescriptor silk(String name) {
- return BundleUtils.getImageDescriptorFromBundle(Platform.getBundle("com.famfamfam.silk"), "/icons/" + name);
+ return BundleUtils.getImageDescriptorFromBundle(Platform.getBundle("com.famfamfam.silk"), "/icons/" + name); //$NON-NLS-1$ //$NON-NLS-2$
}
abstract protected T computeInput(ReadGraph graph, Object[] selection) throws DatabaseException;
}
});
- IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput));
+ IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput)); //$NON-NLS-1$
if (eps.length == 0) {
- System.out.println("symbol editor part not found from multi page editor part: " + ap);
+ System.out.println("symbol editor part not found from multi page editor part: " + ap); //$NON-NLS-1$
return null;
}
viewer = eps[0];
}
ICanvasContext ctx = (ICanvasContext) viewer.getAdapter(ICanvasContext.class);
if (ctx == null) {
- System.out.println("No canvas context");
+ System.out.println("No canvas context"); //$NON-NLS-1$
return null;
}
MouseInfo minfo = ctx.getSingleItem(MouseUtil.class).getMousePressedInfo(0);
if(minfo == null) {
- System.out.println("No mouse info");
+ System.out.println("No mouse info"); //$NON-NLS-1$
return null;
}
final Point2D mpos = minfo.canvasPosition;
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
FileDialog dialog = new FileDialog(shell);
- dialog.setText("Choose an image to be imported");
- dialog.setFilterExtensions(new String[] {"*.svg", "*.png"});
+ dialog.setText(Messages.ImportSVG_ChooseImportImage);
+ dialog.setFilterExtensions(new String[] {"*.svg", "*.png"}); //$NON-NLS-1$ //$NON-NLS-2$
final String filename = dialog.open();
if(filename == null)
@Override
public void perform(WriteGraph g) throws DatabaseException {
- Commands.get(g, "Simantics/Diagram/createSVGElement")
+ Commands.get(g, "Simantics/Diagram/createSVGElement") //$NON-NLS-1$
.execute(g, g.syncRequest(new IndexRoot(composite)),
composite, suffix(filename), data, mposX, mposY);
}
IRunnableWithProgress runnable = new IRunnableWithProgress() {
@Override
public void run(final IProgressMonitor monitor) throws InvocationTargetException, InterruptedException {
- final SubMonitor submonitor = SubMonitor.convert(monitor, "Merge Flags", 1000);
+ final SubMonitor submonitor = SubMonitor.convert(monitor, Messages.MergeFlagsAction_MonitorMergeFlags, 1000);
try {
Simantics.getSession().sync(new WriteRequest() {
@Override
graph.markUndoPoint();
SubMonitor expand = submonitor.newChild(10);
- expand.subTask("Expand Composite Set");
+ expand.subTask(Messages.MergeFlagsAction_ExpandCompositeSet);
MergeFlags.expandCompositeSet(graph, composites);
if (monitor.isCanceled())
throw new CancelTransactionException();
expand.done();
SubMonitor collect = submonitor.newChild(490);
- collect.subTask("Collect flags");
+ collect.subTask(Messages.MergeFlagsAction_CollectFlag);
collect.setWorkRemaining(composites.size());
ArrayList<ArrayList<Resource>> groups = new ArrayList<ArrayList<Resource>>();
for(Resource composite : composites) {
collect.done();
SubMonitor merge = submonitor.newChild(500);
- merge.subTask("Merge collected flags");
+ merge.subTask(Messages.MergeFlagsAction_MonitorMergeCollectedFlags);
merge.setWorkRemaining(composites.size());
for(ArrayList<Resource> group : groups) {
MergeFlags.merge(graph, group);
private static final Logger LOGGER = LoggerFactory.getLogger(MergeFlagsHandler.class);
protected void perform(IProgressMonitor monitor, WriteGraph graph, List<Resource> flags, ICanvasContext canvasContext) throws DatabaseException {
- monitor.beginTask("Merge Selected Flags", IProgressMonitor.UNKNOWN);
+ monitor.beginTask(Messages.MergeFlagsHandler_MonitorMergeSelectedFlags, IProgressMonitor.UNKNOWN);
performMerge(graph, flags, canvasContext);
}
@Override
protected void perform(IProgressMonitor monitor, WriteGraph graph, List<Resource> flags,
ICanvasContext canvasContext) throws DatabaseException {
- monitor.beginTask("Merge Related Flags", IProgressMonitor.UNKNOWN);
+ monitor.beginTask(Messages.MergeRelatedFlagsHandler_MonitorMergeRelatedFlags, IProgressMonitor.UNKNOWN);
MergeFlags.expandFlagSet(graph, flags);
MergeFlagsHandler.performMerge(graph, flags, canvasContext);
}
--- /dev/null
+package org.simantics.modeling.ui.actions;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.actions.messages"; //$NON-NLS-1$
+ public static String AssignSymbolGroup_AreYouSureToRemoveSymbolGroup;
+ public static String AssignSymbolGroup_AreYouSureToRemoveSymbolGroup1;
+ public static String AssignSymbolGroup_ConfirmRemoval;
+ public static String AssignSymbolGroup_GroupSymbolAlreadyExists;
+ public static String AssignSymbolGroup_NameMustNotBeEmpty;
+ public static String AssignSymbolGroup_NewSymbolGroup;
+ public static String AssignSymbolGroup_SameModelRequired;
+ public static String AssignSymbolGroup_SameModelRequiredMsg;
+ public static String AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolIsShownIn;
+ public static String AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolsAreShownIn;
+ public static String AssignSymbolGroup_SymbolGroupAssignments;
+ public static String AssignSymbolGroup_WriteSymbolGroupName;
+ public static String CompilePGraphsAction_CompilePGraphs;
+ public static String CompilePGraphsAction_Continue;
+ public static String CompilePGraphsAction_FollowingIssuesFound;
+ public static String CompilePGraphsAction_ProblemsinOntologyDefinitionFile;
+ public static String ConfigureConnectionTypes_ConnectionTypeAssignments;
+ public static String ConfigureConnectionTypes_SameModelRequired;
+ public static String ConfigureConnectionTypes_SameModelRequiredMsg;
+ public static String ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoint;
+ public static String ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoints;
+ public static String Copy_Copy;
+ public static String ExpandFlagsHandler_MonitorExpandFlags;
+ public static String ImportSVG_ChooseImportImage;
+ public static String MergeFlagsAction_CollectFlag;
+ public static String MergeFlagsAction_ExpandCompositeSet;
+ public static String MergeFlagsAction_MonitorMergeCollectedFlags;
+ public static String MergeFlagsAction_MonitorMergeFlags;
+ public static String MergeFlagsHandler_MonitorMergeSelectedFlags;
+ public static String MergeRelatedFlagsHandler_MonitorMergeRelatedFlags;
+ public static String ModeledActions_ActivatorInvalidContributionsEncounteredIn;
+ public static String NewComponentTypeAction_ActivatorFailedToCreateNewUserComponent;
+ public static String NewComponentTypeAction_NewUserComponent;
+ public static String NewConnectionPoint_SelectConnectionPointType;
+ public static String NewLibrary_Library;
+ public static String NewProceduralComponentType_ActivatorFailedToCreateNewUserComponent;
+ public static String NewProceduralComponentType_NewUserComponent;
+ public static String NewSubscription_Subscription;
+ public static String RenameDiagramComponents_ActivatorRenameDiaActionFailed;
+ public static String SetInitialState_SetInitialState;
+ public static String SwitchComponentTypeContribution_AlternativeTypes;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import org.eclipse.jface.action.IContributionItem;
import org.eclipse.jface.action.MenuManager;
import org.eclipse.jface.action.Separator;
+import org.eclipse.osgi.util.NLS;
import org.simantics.browsing.ui.NodeContext;
import org.simantics.browsing.ui.common.NodeContextBuilder;
import org.simantics.browsing.ui.model.InvalidContribution;
import org.simantics.modeling.ui.Activator;
import org.simantics.project.ontology.ProjectResource;
import org.simantics.ui.contribution.DynamicMenuContribution;
-import org.simantics.ui.selection.WorkbenchSelectionElement;
import org.simantics.ui.selection.WorkbenchSelectionUtils;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
public void setInitializationData(IConfigurationElement config, String propertyName, Object data) throws CoreException {
if(data instanceof String) {
String str = (String)data;
- String[] parms = str.split(";");
+ String[] parms = str.split(";"); //$NON-NLS-1$
for(String parm : parms) {
- String[] keyValue = parm.split("=");
+ String[] keyValue = parm.split("="); //$NON-NLS-1$
if(keyValue.length == 2) {
String key = keyValue[0].trim();
- if("context".equals(key)) {
+ if("context".equals(key)) { //$NON-NLS-1$
browseContexts = Collections.singleton(keyValue[1]);
}
}
result.add(NodeContextBuilder.buildWithInput(res));
}
} catch (DatabaseException e) {
- LOGGER.error("Failed to get node contexts for selection.", e);
+ LOGGER.error("Failed to get node contexts for selection.", e); //$NON-NLS-1$
}
}
if (first)
first = false;
else
- items.add(new Separator(category == null ? "" : category.getLabel()));
+ items.add(new Separator(category == null ? "" : category.getLabel())); //$NON-NLS-1$
for (Action action : actions)
items.add(new ActionContributionItem(action));
}
}
@Override
- protected IContributionItem[] getContributionItems(ReadGraph graph, Object[] selection)
- throws DatabaseException
- {
- List<NodeContext> contexts = Arrays.asList( (NodeContext[]) selection );
+ protected IContributionItem[] getContributionItems(ReadGraph graph, Object[] selection) throws DatabaseException {
+ List<NodeContext> contexts = Arrays.asList((NodeContext[]) selection);
if (contexts.isEmpty())
return NONE;
result = new HashMap<>();
- for(Map.Entry<IActionCategory, List<Action>> entry : m.entrySet()) {
+ for
(Map.Entry<IActionCategory, List<Action>> entry : m.entrySet()) {
List<Action> exist = current.get(entry.getKey());
if (exist == null)
continue;
ArrayList<Action> l = new ArrayList<Action>();
- for(Action e : exist) {
+ for (Action e : exist) {
String id = e.getId();
boolean found = false;
- for(Action a : entry.getValue()) {
- if(id.equals(a.getId())) {
+ for (Action a : entry.getValue()) {
+ if (id.equals(a.getId())) {
found = true;
break;
}
}
- if(found) l.add(e);
+ if (found)
+ l.add(e);
}
- if(!l.isEmpty()) result.put(entry.getKey(), l);
+ if (!l.isEmpty())
+ result.put(entry.getKey(), l);
}
current = result;
} catch (InvalidContribution e) {
Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Invalid contribution encountered in " + getClass().getSimpleName() + ".", e));
+ NLS.bind(Messages.ModeledActions_ActivatorInvalidContributionsEncounteredIn,
+ getClass().getSimpleName()),
+ e));
}
return NONE;
}
public void setInitializationData(IConfigurationElement config, String propertyName, Object data) throws CoreException {
if(data instanceof String) {
String str = (String)data;
- String[] parms = str.split(";");
+ String[] parms = str.split(";"); //$NON-NLS-1$
for(String parm : parms) {
- String[] keyValue = parm.split("=");
+ String[] keyValue = parm.split("="); //$NON-NLS-1$
if(keyValue.length == 2) {
String key = keyValue[0].trim();
- if("context".equals(key)) {
+ if("context".equals(key)) { //$NON-NLS-1$
browseContexts = Collections.singleton(keyValue[1]);
}
}
return new Runnable() {
@Override
public void run() {
- Job job = new DatabaseJob("New User Component") {
+ Job job = new DatabaseJob(Messages.NewComponentTypeAction_NewUserComponent) {
@Override
protected IStatus run(IProgressMonitor monitor) {
try {
});
return Status.OK_STATUS;
} catch (DatabaseException e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Failed to create new user component.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.NewComponentTypeAction_ActivatorFailedToCreateNewUserComponent, e);
}
}
};
name = sb.toString();
} else {
// domains.size() == 1
- name = NameUtils.getSafeName(graph, _res) + " (" + graph.getURI(domains.iterator().next()) + ")";
+ name = NameUtils.getSafeName(graph, _res) + " (" + graph.getURI(domains.iterator().next()) + ")"; //$NON-NLS-1$ //$NON-NLS-2$
}
map.put(_res, new Pair<String, ImageDescriptor>(name, null));
}
String createConnectionPointComment(ReadGraph graph, Resource target, Resource[] cps) throws DatabaseException {
StringBuilder result = new StringBuilder();
- result.append("Created connection point");
+ result.append("Created connection point"); //$NON-NLS-1$
if (cps.length > 1)
result.append('s');
- result.append(" for ")
+ result.append(" for ") //$NON-NLS-1$
.append(NameUtils.getSafeName(graph, componentType))
- .append(":\n");
+ .append(":\n"); //$NON-NLS-1$
for (int i = 0; i < cps.length; ++i) {
result.append('\t');
result.append(NameUtils.getSafeName(graph, cps[i]));
private Resource[] queryCps(Map<Resource, Pair<String, ImageDescriptor>> map) {
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
- ResourceSelectionDialog3<Resource> dialog = new ResourceSelectionDialog3<Resource>(shell, map, "Select connection point type") {
+ ResourceSelectionDialog3<Resource> dialog = new ResourceSelectionDialog3<Resource>(shell, map, Messages.NewConnectionPoint_SelectConnectionPointType) {
@Override
protected IDialogSettings getBaseDialogSettings() {
return Activator.getDefault().getDialogSettings();
Layer0 L0 = Layer0.getInstance(graph);
DocumentResource DOC = DocumentResource.getInstance(graph);
- String name = NameUtils.findFreshEscapedName(graph, "Document", model, L0.ConsistsOf);
+ String name = NameUtils.findFreshEscapedName(graph, "Document", model, L0.ConsistsOf); //$NON-NLS-1$
// Create DOC.WikiDocument instance
Resource wikiDocument = graph.newResource();
Resource documentType = graph.getSingleObject(DOC.WikiDocument_WikiDocumentBinding, DOC.DocumentTypeBinding_HasDocumentType);
Resource document = graph.newResource();
graph.claim(document, L0.InstanceOf, null, DOC.ScenegraphDocument);
- graph.claimLiteral(document, L0.HasName, "Documentation");
+ graph.claimLiteral(document, L0.HasName, "Documentation"); //$NON-NLS-1$
graph.claim(wikiDocument, DOC.HasDocumentation, document);
graph.claim(document, L0.PartOf, wikiDocument);
Resource scenegraph = graph.newResource();
graph.claim(scenegraph, L0.InstanceOf, null, documentType);
- graph.claimLiteral(scenegraph, L0.HasName, "Scenegraph");
+ graph.claimLiteral(scenegraph, L0.HasName, "Scenegraph"); //$NON-NLS-1$
graph.claim(scenegraph, L0.PartOf, document);
graph.claim(document, DOC.ScenegraphDocument_scenegraph, scenegraph);
Layer0 l0 = Layer0.getInstance(graph);
Resource library = graph.newResource();
- String name = NameUtils.findFreshName(graph, "Library", parent, l0.ConsistsOf);
+ String name = NameUtils.findFreshName(graph, Messages.NewLibrary_Library, parent, l0.ConsistsOf);
graph.claim(library, l0.InstanceOf, null, l0.Library);
graph.addLiteral(library, l0.HasName, l0.NameOf, l0.String, name, Bindings.STRING);
graph.claim(library, l0.PartOf, parent);
- Layer0Utils.addCommentMetadata(graph, "Created new Library named " + name + ", resource " + library);
+ Layer0Utils.addCommentMetadata(graph, "Created new Library named " + name + ", resource " + library); //$NON-NLS-1$ //$NON-NLS-2$
return library;
}
// Name
String defaultName = graph.getRelatedValue(indexRoot, MOD.StructuralModel_HasDefaultComponentTypeName, Bindings.STRING);
String name = NameUtils.findFreshName(graph, defaultName, library);
- graph.claimLiteral(componentType, L0.HasName, name + "@1");
- graph.claimLiteral(componentType, L0X.HasGeneratedNamePrefix, "");
+ graph.claimLiteral(componentType, L0.HasName, name + "@1"); //$NON-NLS-1$
+ graph.claimLiteral(componentType, L0X.HasGeneratedNamePrefix, ""); //$NON-NLS-1$
// Substructure
// Resource substructureType = graph.getSingleObject(indexRoot, MOD.StructuralModel_HasComponentTypeSubstructureType);
// }
graph.addLiteral(componentType, STR.ProceduralComponentType_code, STR.ProceduralComponentType_code_Inverse,
- STR.ProceduralComponentTypeCode, "[]", Bindings.STRING);
+ STR.ProceduralComponentTypeCode, "[]", Bindings.STRING); //$NON-NLS-1$
Resource symbolDiagramType = graph.getPossibleObject(indexRoot, MOD.StructuralModel_HasSymbolDiagramType);
if(symbolDiagramType == null) symbolDiagramType = DIA.Composite;
// Symbol
- Resource symbol = new ModelingUtils(graph).createSymbol2("Symbol", symbolDiagramType);
+ Resource symbol = new ModelingUtils(graph).createSymbol2("Symbol", symbolDiagramType); //$NON-NLS-1$
graph.claim(componentType, MOD.ComponentTypeToSymbol, symbol);
graph.claim(componentType, L0.ConsistsOf, symbol);
return new Runnable() {
@Override
public void run() {
- Job job = new DatabaseJob("New User Component") {
+ Job job = new DatabaseJob(Messages.NewProceduralComponentType_NewUserComponent) {
@Override
protected IStatus run(IProgressMonitor monitor) {
try {
public void perform(WriteGraph graph) throws DatabaseException {
graph.markUndoPoint();
Resource r = NewProceduralComponentType.create(graph, library);
- Layer0Utils.addCommentMetadata(graph, "Created new Procedural Component Type " + graph.getPossibleRelatedValue2(r, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Created new Procedural Component Type " + graph.getPossibleRelatedValue2(r, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
return Status.OK_STATUS;
} catch (DatabaseException e) {
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Failed to create new user component.", e);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.NewProceduralComponentType_ActivatorFailedToCreateNewUserComponent, e);
}
}
};
Layer0 l0 = Layer0.getInstance(g);
ModelingResources wr = ModelingResources.getInstance(g);
- String freshLabel = NameUtils.findFreshLabel(g, "Subscription", model);
+ String freshLabel = NameUtils.findFreshLabel(g, Messages.NewSubscription_Subscription, model);
@SuppressWarnings("unused")
Resource subscription = GraphUtils.create2(g, wr.Subscription,
l0.HasName, UUID.randomUUID().toString(),
l0.PartOf, model);
CommentMetadata cm = g.getMetadata(CommentMetadata.class);
- g.addMetadata(cm.add("Created subscription folder " + freshLabel));
+ g.addMetadata(cm.add("Created subscription folder " + freshLabel)); //$NON-NLS-1$
}
});
}
});
}
} catch (DatabaseException e) {
- Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "RenameDiagramComponents action failed, see exception for details", e));
+ Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.RenameDiagramComponents_ActivatorRenameDiaActionFailed, e));
}
}
};
@Override
public void fill(Menu menu, int index) {
MenuItem setInitialState = new MenuItem(menu, SWT.CASCADE, index);
- setInitialState.setText("Set Initial State");
+ setInitialState.setText(Messages.SetInitialState_SetInitialState);
Menu subMenu = new Menu(menu);
setInitialState.setMenu(subMenu);
try {
groups = Simantics.getSession().syncRequest(new ComponentSwitchGroupQuery(resource));
} catch (DatabaseException e) {
- LOGGER.error("Retrieval of switch groups failed.", e);
+ LOGGER.error("Retrieval of switch groups failed.", e); //$NON-NLS-1$
return;
}
if(label == null) {
label = graph.getPossibleRelatedValue(group, L0.HasName);
if(label == null)
- label = "Alternative types";
+ label = Messages.SwitchComponentTypeContribution_AlternativeTypes;
}
groupObj = new SwitchGroup(label);
}
--- /dev/null
+package org.simantics.modeling.ui.actions;
+
+import org.eclipse.osgi.util.NLS;
+
+public class WorkbenchMessages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.actions.messages"; //$NON-NLS-1$
+ public static String AssignSymbolGroupsDialog_NewDots;
+ public static String AssignSymbolGroupsDialog_RemoveAnd;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, WorkbenchMessages.class);
+ }
+
+ private WorkbenchMessages() {
+ }
+}
public void exception(Throwable t) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Global modeled toolbar contribution listener ran into an unexpected exception.",
+ Messages.GlobalModeledToolbarActions_ActivatorGlobalModeledToolbarException,
t));
}
} catch (InvalidContribution e) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Encountered invalid modeled contribution(s) while loading global modeled toolbar contributions.",
+ Messages.GlobalModeledToolbarActions_ActivatorEncounteredInvalidContributionException,
e));
}
if (first)
first = false;
else
- items.add(new Separator(category == null ? "" : category.getLabel()));
+ items.add(new Separator(category == null ? "" : category.getLabel())); //$NON-NLS-1$
for (Action action : actions)
items.add(new ActionContributionItem(action));
}
}
});
- IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput));
+ IEditorPart[] eps = rfe.findEditors(new ResourceEditorInput("org.simantics.modeling.ui.symbolEditor", symbolEditorInput)); //$NON-NLS-1$
if (eps.length == 0) {
- System.out.println("symbol editor part not found from multi page editor part: " + ap);
+ System.out.println("symbol editor part not found from multi page editor part: " + ap); //$NON-NLS-1$
return;
}
viewer = eps[0];
}
ICanvasContext ctx = (ICanvasContext) viewer.getAdapter(ICanvasContext.class);
if (ctx == null) {
- System.out.println("No canvas context");
+ System.out.println("No canvas context"); //$NON-NLS-1$
return;
}
MouseInfo minfo = ctx.getSingleItem(MouseUtil.class).getMousePressedInfo(0);
if(minfo == null) {
- System.out.println("No mouse info");
+ System.out.println("No mouse info"); //$NON-NLS-1$
return;
}
final Point2D mpos = minfo.canvasPosition;
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
FileDialog dialog = new FileDialog(shell);
- dialog.setText("Choose an image to be imported");
- dialog.setFilterExtensions(new String[] {"*.svg", "*.png"});
+ dialog.setText(Messages.ImportSVGPNG_ChooseImportImage);
+ dialog.setFilterExtensions(new String[] {"*.svg", "*.png"}); //$NON-NLS-1$ //$NON-NLS-2$
final String filename = dialog.open();
if(filename == null)
@Override
public void perform(WriteGraph g) throws DatabaseException {
- Object svg = Commands.get(g, "Simantics/Diagram/createSVGElementR")
+ Object svg = Commands.get(g, "Simantics/Diagram/createSVGElementR") //$NON-NLS-1$
.execute(g, g.syncRequest(new IndexRoot(composite)),
composite, suffix(filename), data, mposX, mposY);
--- /dev/null
+package org.simantics.modeling.ui.actions.e4;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.actions.e4.messages"; //$NON-NLS-1$
+ public static String GlobalModeledToolbarActions_ActivatorEncounteredInvalidContributionException;
+ public static String GlobalModeledToolbarActions_ActivatorGlobalModeledToolbarException;
+ public static String ImportSVGPNG_ChooseImportImage;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+GlobalModeledToolbarActions_ActivatorEncounteredInvalidContributionException=Encountered invalid modeled contribution(s) while loading global modeled toolbar contributions.\r
+GlobalModeledToolbarActions_ActivatorGlobalModeledToolbarException=Global modeled toolbar contribution listener ran into an unexpected exception.\r
+ImportSVGPNG_ChooseImportImage=Choose an image to be imported\r
--- /dev/null
+AssignSymbolGroup_AreYouSureToRemoveSymbolGroup=Are you sure you want to remove symbol group ''{0}'' ?
+AssignSymbolGroup_AreYouSureToRemoveSymbolGroup1=Are you sure you want to remove {0} symbol groups?
+AssignSymbolGroup_ConfirmRemoval=Confirm removal
+AssignSymbolGroup_GroupSymbolAlreadyExists=A symbol group with that name already exists.
+AssignSymbolGroup_NameMustNotBeEmpty=The name must be non-empty.
+AssignSymbolGroup_NewSymbolGroup=New Symbol Group
+AssignSymbolGroup_SameModelRequired=Same Model Required
+AssignSymbolGroup_SameModelRequiredMsg=All the selected symbols must be from within the same model.
+AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolIsShownIn=Select symbol groups the selected symbol is shown in.
+AssignSymbolGroup_SelectSymbolGroupsTheSelectedSymbolsAreShownIn=Select symbol groups the selected {0} symbols are shown in.
+AssignSymbolGroup_SymbolGroupAssignments=Symbol Group Assignments
+AssignSymbolGroup_WriteSymbolGroupName=Write the name of the new symbol group.
+AssignSymbolGroupsDialog_NewDots=&New...
+AssignSymbolGroupsDialog_RemoveAnd=&Remove
+CompilePGraphsAction_CompilePGraphs=Compile PGraphs
+CompilePGraphsAction_Continue=Continue
+CompilePGraphsAction_FollowingIssuesFound=The following issues were found:
+CompilePGraphsAction_ProblemsinOntologyDefinitionFile=Problems in the Ontology Definition File
+ConfigureConnectionTypes_ConnectionTypeAssignments=Connection Type Assignments
+ConfigureConnectionTypes_SameModelRequired=Same Model Required
+ConfigureConnectionTypes_SameModelRequiredMsg=All the selected connection points must be from within the same index root.
+ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoint=Select connection types for the selected connection point
+ConfigureConnectionTypes_SelectConnectionTypeForSelectedConnectionPoints=Select connection types for the selected connection points
+Copy_Copy=Copy
+ExpandFlagsHandler_MonitorExpandFlags=Expand Flags
+ImportSVG_ChooseImportImage=Choose an image to be imported
+MergeFlagsAction_CollectFlag=Collect flags
+MergeFlagsAction_ExpandCompositeSet=Expand Composite Set
+MergeFlagsAction_MonitorMergeCollectedFlags=Merge collected flags
+MergeFlagsAction_MonitorMergeFlags=Merge Flags
+MergeFlagsHandler_MonitorMergeSelectedFlags=Merge Selected Flags
+MergeRelatedFlagsHandler_MonitorMergeRelatedFlags=Merge Related Flags
+ModeledActions_ActivatorInvalidContributionsEncounteredIn=Invalid contribution encountered in {0}
+NewComponentTypeAction_ActivatorFailedToCreateNewUserComponent=Failed to create new user component.
+NewComponentTypeAction_NewUserComponent=New User Component
+NewConnectionPoint_SelectConnectionPointType=Select connection point type
+NewLibrary_Library=Library
+NewProceduralComponentType_ActivatorFailedToCreateNewUserComponent=Failed to create new user component.
+NewProceduralComponentType_NewUserComponent=New User Component
+NewSubscription_Subscription=Subscription
+RenameDiagramComponents_ActivatorRenameDiaActionFailed=RenameDiagramComponents action failed, see exception for details
+SetInitialState_SetInitialState=Set Initial State
+SwitchComponentTypeContribution_AlternativeTypes=Alternative types
import javax.swing.JPanel;
import javax.swing.JTabbedPane;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.simantics.utils.strings.format.MetricsFormat;
public class AWTStyleDialog extends JDialog {
private boolean useFormat = true;
public AWTStyleDialog(Frame owner,boolean useFont, boolean useColor, boolean useFormat) {
- super(owner,"Style",true);
+ super(owner,Messages.AWTStyleDialog_Style,true);
this.useFont = useFont;
this.useColor = useColor;
this.useFormat = useFormat;
public AWTStyleDialog(boolean useFont, boolean useColor, boolean useFormat) {
super();
- setTitle("Style");
+ setTitle(Messages.AWTStyleDialog_Style);
setModal(true);
this.useFont = useFont;
this.useColor = useColor;
public void setStartFont(Font font) {
if (!useFont)
- throw new RuntimeException("Dialog is not configured with font support");
+ throw new RuntimeException("Dialog is not configured with font support"); //$NON-NLS-1$
fontChooser.setCurrentFont(font);
}
public void setStartColor(Color color) {
if (!useColor)
- throw new RuntimeException("Dialog is not configured with color support");
+ throw new RuntimeException("Dialog is not configured with color support"); //$NON-NLS-1$
colorChooser.setColor(color);
}
public void setStartFormat(MetricsFormat format) {
if (!useFormat)
- throw new RuntimeException("Dialog is not configured with format support");
+ throw new RuntimeException("Dialog is not configured with format support"); //$NON-NLS-1$
metricsEditor.setMetricsFormat(format);
}
private void createContents() {
-
+
JTabbedPane tabbedPane = new JTabbedPane();
- getContentPane().add(tabbedPane,BorderLayout.CENTER);
+ getContentPane().add(tabbedPane, BorderLayout.CENTER);
if (useFont)
- tabbedPane.addTab("Font", fontChooser = new FontChooser("Sample text"));
+ tabbedPane.addTab(Messages.AWTStyleDialog_Font,
+ fontChooser = new FontChooser(Messages.AWTStyleDialog_SampleText));
if (useColor)
- tabbedPane.addTab("Color",colorChooser = new JColorChooser(new Color(0, 0, 0)));
+ tabbedPane.addTab(Messages.AWTStyleDialog_Color, colorChooser = new JColorChooser(new Color(0, 0, 0)));
if (useFormat)
- tabbedPane.addTab("Metrics",metricsEditor = new MetricsEditor());
-
+ tabbedPane.addTab(Messages.AWTStyleDialog_Metrics, metricsEditor = new MetricsEditor());
+
JPanel controlPanel = new JPanel();
- getContentPane().add(controlPanel,BorderLayout.SOUTH);
+ getContentPane().add(controlPanel, BorderLayout.SOUTH);
controlPanel.setLayout(new FlowLayout(FlowLayout.RIGHT));
-
- JButton okButton = new JButton("OK");
+
+ JButton okButton = new JButton(IDialogConstants.OK_LABEL);
controlPanel.add(okButton);
okButton.addActionListener(new ActionListener() {
-
+
@Override
public void actionPerformed(ActionEvent e) {
cancelled = false;
AWTStyleDialog.this.dispose();
}
});
-
- JButton cancelButton = new JButton("Cancel");
+
+ JButton cancelButton = new JButton(IDialogConstants.CANCEL_LABEL);
controlPanel.add(cancelButton);
cancelButton.addActionListener(new ActionListener() {
-
+
@Override
public void actionPerformed(ActionEvent e) {
AWTStyleDialog.this.setVisible(false);
AWTStyleDialog.this.dispose();
}
});
-
-
+
this.addWindowListener(new WindowListener() {
-
+
@Override
public void windowOpened(WindowEvent arg0) {}
-
+
@Override
public void windowIconified(WindowEvent arg0) {}
-
+
@Override
public void windowDeiconified(WindowEvent arg0) {}
-
+
@Override
public void windowDeactivated(WindowEvent arg0) {}
-
+
@Override
public void windowClosing(WindowEvent arg0) {
if (metricsEditor != null)
metricsEditor.dispose();
}
-
+
@Override
public void windowClosed(WindowEvent arg0) {}
-
+
@Override
public void windowActivated(WindowEvent arg0) {}
});
*/
public class EditStyle {
- private static final String SECTION_AWT_STYLE_DIALOG = "AWTStyleDialog";
- private static final String SETTING_DIALOG_HEIGHT = "h";
- private static final String SETTING_DIALOG_WIDTH = "w";
- private static final String SETTING_DIALOG_Y = "y";
- private static final String SETTING_DIALOG_X = "x";
+ private static final String SECTION_AWT_STYLE_DIALOG = "AWTStyleDialog"; //$NON-NLS-1$
+ private static final String SETTING_DIALOG_HEIGHT = "h"; //$NON-NLS-1$
+ private static final String SETTING_DIALOG_WIDTH = "w"; //$NON-NLS-1$
+ private static final String SETTING_DIALOG_Y = "y"; //$NON-NLS-1$
+ private static final String SETTING_DIALOG_X = "x"; //$NON-NLS-1$
public static void openStyleDialog(final Resource[] resources) {
if (resources.length == 0)
final boolean useColor = hasColor;
final boolean useFormat = hasFormat;
- Job job = new Job("Open Style Dialog") {
+ Job job = new Job(Messages.EditStyle_OpenStyleDialog) {
@Override
protected IStatus run(IProgressMonitor monitor) {
- monitor.beginTask("Open dialog", IProgressMonitor.UNKNOWN);
+ monitor.beginTask(Messages.EditStyle_MonitorOpenDialog, IProgressMonitor.UNKNOWN);
SwingUtilities.invokeLater(new Runnable() {
@Override
public void run() {
private static final long serialVersionUID = -53650261362110193L;
- private static Font DEFAULT_FONT = new Font("Arial", Font.PLAIN, 16);
+ private static Font DEFAULT_FONT = new Font(Messages.FontChooser_DefaultFont, Font.PLAIN, 16);
private String sampleText;
private JLabel text;
GraphicsEnvironment ge = GraphicsEnvironment.getLocalGraphicsEnvironment();
String[] ff = ge.getAvailableFontFamilyNames();
fonts = new String[ff.length + 1];
- fonts[0] = "-- keep current font --";
+ fonts[0] = Messages.FontChooser_KeepCurrentFont;
System.arraycopy(ff, 0, fonts, 1, ff.length);
fontList = new JList(fonts);
sizeComboBox = new JComboBox(sizes);
sizeComboBox.addActionListener(listener);
sizeComboBox.setSelectedIndex(7);
- controlPanel.add(new JLabel("Size: "));
+ controlPanel.add(new JLabel(Messages.FontChooser_Size));
controlPanel.add(sizeComboBox);
- boldCheckBox = new JCheckBox("Bold");
+ boldCheckBox = new JCheckBox(Messages.FontChooser_Bold);
boldCheckBox.addActionListener(listener);
controlPanel.add(boldCheckBox);
- italicCheckBox = new JCheckBox("Italic");
+ italicCheckBox = new JCheckBox(Messages.FontChooser_Italic);
italicCheckBox.addActionListener(listener);
controlPanel.add(italicCheckBox);
--- /dev/null
+package org.simantics.modeling.ui.actions.style;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.actions.style.messages"; //$NON-NLS-1$
+ public static String AWTStyleDialog_Color;
+ public static String AWTStyleDialog_Font;
+ public static String AWTStyleDialog_Metrics;
+ public static String AWTStyleDialog_SampleText;
+ public static String AWTStyleDialog_Style;
+ public static String EditStyle_MonitorOpenDialog;
+ public static String EditStyle_OpenStyleDialog;
+ public static String FontChooser_DefaultFont;
+ public static String FontChooser_Bold;
+ public static String FontChooser_Italic;
+ public static String FontChooser_KeepCurrentFont;
+ public static String FontChooser_Size;
+ public static String MetricsEditor_AddFormatTemplate;
+ public static String MetricsEditor_AddFormatTemplateTT;
+ public static String MetricsEditor_Format;
+ public static String MetricsEditor_FormatError;
+ public static String MetricsEditor_FormatName;
+ public static String MetricsEditor_FormatPattern;
+ public static String MetricsEditor_FormatPatternNotCorrect;
+ public static String MetricsEditor_Name;
+ public static String MetricsEditor_NewFormat;
+ public static String MetricsEditor_NewFormatField;
+ public static String MetricsEditor_NewFormatTT;
+ public static String MetricsEditor_Numbers;
+ public static String MetricsEditor_RemoveTemplate;
+ public static String MetricsEditor_RemoveTemplateTT;
+ public static String MetricsEditor_UpdateTemplate;
+ public static String MetricsEditor_UpdateTemplateTT;
+ public static String MetricsEditor_Value;
+ public static String MetricsEditor_ValuePresentation;
+ public static String MetricsEditor_ValueTest;
+ public static String MetricsEditor_ValueTestNotANumber;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import javax.swing.event.TableModelListener;
import javax.swing.table.TableModel;
+import org.eclipse.osgi.util.NLS;
import org.simantics.utils.strings.format.MetricsFormat;
import org.simantics.utils.strings.format.MetricsFormatList;
import org.simantics.utils.strings.format.MetricsFormatListListener;
panel.add(fieldPanel,BorderLayout.CENTER);
- labelPanel.add(new JLabel("Value test:"));
+ labelPanel.add(new JLabel(Messages.MetricsEditor_ValueTest));
fieldPanel.add(valueTestField);
- labelPanel.add(new JLabel("Value presentation:"));
+ labelPanel.add(new JLabel(Messages.MetricsEditor_ValuePresentation));
fieldPanel.add(valuePresentationField);
- labelPanel.add(new JLabel("Format name:"));
+ labelPanel.add(new JLabel(Messages.MetricsEditor_FormatName));
fieldPanel.add(formatNameField);
- labelPanel.add(new JLabel("Format pattern:"));
+ labelPanel.add(new JLabel(Messages.MetricsEditor_FormatPattern));
fieldPanel.add(formatPatternField);
add(panel,BorderLayout.NORTH);
add(controlPanel,BorderLayout.SOUTH);
controlPanel.setLayout(new FlowLayout(FlowLayout.LEFT));
- JButton addTemplateButton = new JButton("Add Format Template");
- addTemplateButton.setToolTipText("Add current format to templates");
+ JButton addTemplateButton = new JButton(Messages.MetricsEditor_AddFormatTemplate);
+ addTemplateButton.setToolTipText(Messages.MetricsEditor_AddFormatTemplateTT);
controlPanel.add(addTemplateButton);
addTemplateButton.addActionListener(new ActionListener() {
}
});
- JButton removeTemplateButton = new JButton("Remove Template");
- removeTemplateButton.setToolTipText("Remove selected template");
+ JButton removeTemplateButton = new JButton(Messages.MetricsEditor_RemoveTemplate);
+ removeTemplateButton.setToolTipText(Messages.MetricsEditor_RemoveTemplateTT);
controlPanel.add(removeTemplateButton);
removeTemplateButton.addActionListener(new ActionListener() {
}
});
- JButton updateTemplateButton = new JButton("Update Template");
- updateTemplateButton.setToolTipText("Update selected template using current format");
+ JButton updateTemplateButton = new JButton(Messages.MetricsEditor_UpdateTemplate);
+ updateTemplateButton.setToolTipText(Messages.MetricsEditor_UpdateTemplateTT);
controlPanel.add(updateTemplateButton);
updateTemplateButton.addActionListener(new ActionListener() {
}
});
- JButton newFormatButton = new JButton("New Format");
- newFormatButton.setToolTipText("Create a new Format");
+ JButton newFormatButton = new JButton(Messages.MetricsEditor_NewFormat);
+ newFormatButton.setToolTipText(Messages.MetricsEditor_NewFormatTT);
controlPanel.add(newFormatButton);
newFormatButton.addActionListener(new ActionListener() {
valueTestField.addActionListener(l);
formatPatternField.addActionListener(l);
- valueTestField.setText("123456.789");
- formatPatternField.setText("%s");
+ valueTestField.setText(Messages.MetricsEditor_Numbers);
+ formatPatternField.setText("%s"); //$NON-NLS-1$
updateValues();
}
private void newFormat() {
format = null;
- formatNameField.setText("New format");
- formatPatternField.setText("%s");
+ formatNameField.setText(Messages.MetricsEditor_NewFormatField);
+ formatPatternField.setText("%s"); //$NON-NLS-1$
updateValues();
}
try {
d = Double.parseDouble(value);
} catch (NumberFormatException e) {
- valuePresentationField.setText("Value test is not a number");
+ valuePresentationField.setText(Messages.MetricsEditor_ValueTestNotANumber);
return;
}
formatValue = d;
try {
format = createMetricsFormatFromFields();
} catch (Exception e) {
- valuePresentationField.setText("Format pattern is not correct " + e.getMessage());
+ valuePresentationField.setText(NLS.bind(Messages.MetricsEditor_FormatPatternNotCorrect, e.getMessage()));
}
if (format == null)
return; // TODO : show error
try {
valuePresentationField.setText(format.formatValue(formatValue));
} catch (Exception e) {
- valuePresentationField.setText("Format error: " + e.getMessage());
+ valuePresentationField.setText(NLS.bind(Messages.MetricsEditor_FormatError, e.getMessage()));
}
formatNameField.setText(format.getName());
formatPatternField.setText(format.getPattern());
private class MetricsTableModel implements TableModel, MetricsFormatListListener {
- private String[] columnNames = {"Name","Format","Value"};
+ private String[] columnNames = {Messages.MetricsEditor_Name,Messages.MetricsEditor_Format,Messages.MetricsEditor_Value};
private MetricsFormatList formatList;
private double formatValue = 0;
} else if (columnIndex == 2) {
return format.formatValue(formatValue);
}
- throw new IndexOutOfBoundsException("There is no column " + columnIndex);
+ throw new IndexOutOfBoundsException("There is no column " + columnIndex); //$NON-NLS-1$
}
@Override
--- /dev/null
+AWTStyleDialog_Color=Color
+AWTStyleDialog_Font=Font
+AWTStyleDialog_Metrics=Metrics
+AWTStyleDialog_SampleText=Sample text
+AWTStyleDialog_Style=Style
+EditStyle_MonitorOpenDialog=Open dialog
+EditStyle_OpenStyleDialog=Open Style Dialog
+FontChooser_DefaultFont=Arial
+FontChooser_Bold=Bold
+FontChooser_Italic=Italic
+FontChooser_KeepCurrentFont=-- keep current font --
+FontChooser_Size=Size:
+MetricsEditor_AddFormatTemplate=Add Format Template
+MetricsEditor_AddFormatTemplateTT=Add current format to templates
+MetricsEditor_Format=Format
+MetricsEditor_FormatError=Format error: {}
+MetricsEditor_FormatName=Format name:
+MetricsEditor_FormatPattern=Format pattern:
+MetricsEditor_FormatPatternNotCorrect=Format pattern is not correct {0}
+MetricsEditor_Name=Name
+MetricsEditor_NewFormat=New Format
+MetricsEditor_NewFormatField=New format
+MetricsEditor_NewFormatTT=Create a new Format
+MetricsEditor_Numbers=123456.789
+MetricsEditor_RemoveTemplate=Remove Template
+MetricsEditor_RemoveTemplateTT=Remove selected template
+MetricsEditor_UpdateTemplate=Update Template
+MetricsEditor_UpdateTemplateTT=Update selected template using current format
+MetricsEditor_Value=Value
+MetricsEditor_ValuePresentation=Value presentation:
+MetricsEditor_ValueTest=Value test:
+MetricsEditor_ValueTestNotANumber=Value test is not a number
public String perform(ReadGraph graph) throws DatabaseException {
Resource r = ResourceAdaptionUtils.toSingleResource(selection);
if (r == null)
- return "Selection";
+ return "Selection"; //$NON-NLS-1$
return NameLabelUtil.modalName(graph, r);
}
};
GridDataFactory.fillDefaults().grab(true, false).span(3, 1).applyTo(nameText.getWidget());
*/
Label autoscrollLabel = new Label(body, support, 0);
- autoscrollLabel.setText("Auto-scroll settings:");
+ autoscrollLabel.setText(Messages.ChartComposite_AutoScrollSettings);
autoscrollLabel.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(autoscrollLabel.getControl());
GridLayoutFactory.fillDefaults().equalWidth(false).numColumns(3).extendedMargins(5,5,5,5).applyTo(templateComposite);
Label templateHeader = new Label(templateComposite, support, 0);
- templateHeader.setText("Template");
+ templateHeader.setText(Messages.ChartComposite_Template);
//templateHeader.setFont(smallFont);
templateHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(templateHeader.getWidget());
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(templateCombo.getWidget());
Button resetButton = new Button(templateComposite, support, SWT.NONE | SWT.READ_ONLY);
- resetButton.setText("Apply");
+ resetButton.setText(Messages.ChartComposite_Apply);
resetButton.addSelectionListener(new SelectionListenerImpl<Resource>(context) {
@Override
public void apply(WriteGraph graph, Resource monitor) throws DatabaseException {
GridLayoutFactory.fillDefaults().equalWidth(false).numColumns(4).extendedMargins(5,5,5,5).applyTo(buttonComposite);
Label startHeader = new Label(buttonComposite, support, 0);
- startHeader.setText("Start time");
+ startHeader.setText(Messages.ChartComposite_StartTime);
//startHeader.setFont(smallFont);
startHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(startHeader.getWidget());
TrackedText timeWindowStart = new TrackedText(buttonComposite, support, SWT.BORDER | SWT.FLAT);
- timeWindowStart.getWidget().setToolTipText("Chart Window Fixed Start Time in Seconds or Yy Dd HH:mm:ss.ddd");
+ timeWindowStart.getWidget().setToolTipText(Messages.ChartComposite_ChartWindowTT);
timeWindowStart.setTextFactory(new TimePropertyFactory(ChartResource.URIs.Chart_TimeWindowStart));
timeWindowStart.addModifyListener(new TimePropertyModifier(context, ChartResource.URIs.Chart_TimeWindowStart, START_VALIDATOR));
timeWindowStart.setInputValidator( START_VALIDATOR );
// l1.setText("seconds");
Label sizeHeader = new Label(buttonComposite, support, 0);
- sizeHeader.setText("Length");
+ sizeHeader.setText(Messages.ChartComposite_Length);
//sizeHeader.setFont(smallFont);
sizeHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(sizeHeader.getWidget());
TrackedText timeWindowLength = new TrackedText(buttonComposite, support, SWT.BORDER | SWT.FLAT);
- timeWindowLength.getWidget().setToolTipText("Chart Window Fixed Time Axis Length in Seconds or Yy Dd HH:mm:ss.ddd");
+ timeWindowLength.getWidget().setToolTipText(Messages.ChartComposite_ChartWindowTT2);
timeWindowLength.setTextFactory(new TimePropertyFactory(ChartResource.URIs.Chart_TimeWindowLength));
timeWindowLength.addModifyListener(new TimePropertyModifier(context, ChartResource.URIs.Chart_TimeWindowLength, LENGTH_VALIDATOR));
timeWindowLength.setInputValidator( LENGTH_VALIDATOR );
// l2.setText("seconds");
Label incrementHeader = new Label(buttonComposite, support, 0);
- incrementHeader.setText("Scroll increment");
+ incrementHeader.setText(Messages.ChartComposite_ScrollIncrement);
//incrementHeader.setFont(smallFont);
incrementHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(incrementHeader.getWidget());
try {
Double d = Double.parseDouble(newText);
if (d < 1 || d > 100)
- return "Increment must be between 1..100";
+ return Messages.ChartComposite_ScrollIncrementRange;
return null;
} catch (NumberFormatException e) {
return e.getMessage();
Label l3 = new Label(buttonComposite, support, 0);
l3.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
- l3.setText("%");
+ l3.setText("%"); //$NON-NLS-1$
Composite checkboxComposite = new Composite(buttonComposite, SWT.NONE);
checkboxComposite.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
final Button showMilestones = new Button(checkboxComposite, support, SWT.CHECK);
showMilestones.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
- showMilestones.setText("Show &Milestones");
+ showMilestones.setText(Messages.ChartComposite_ShowMileStones);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(showMilestones.getWidget());
showMilestones.setSelectionFactory(new BooleanPropertyFactory(ChartResource.URIs.Chart_ShowMilestones));
showMilestones.addSelectionListener(new SelectionAdapter() {
} catch (DatabaseException e1) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Failed to set Show Milestones", e1));
+ Messages.ChartComposite_ActivatorFailedToSetShowMilestones, e1));
}
}
});
final Button trackExperimentTime = new Button(checkboxComposite, support, SWT.CHECK);
trackExperimentTime.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
- trackExperimentTime.setText("Hairline &Tracks Experiment Time");
- trackExperimentTime.setTooltipText("Value Tip Hairline Tracks Experiment Time During Simulation");
+ trackExperimentTime.setText(Messages.ChartComposite_HairlineAndTracksExperimentTime);
+ trackExperimentTime.setTooltipText(Messages.ChartComposite_HairlineAndTracksExperimentTimeTT);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(trackExperimentTime.getWidget());
trackExperimentTime.setSelectionFactory(new BooleanPropertyFactory(ChartResource.URIs.Chart_trackExperimentTime));
trackExperimentTime.addSelectionListener(new SelectionAdapter() {
} catch (DatabaseException e1) {
Activator.getDefault().getLog().log(
new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Failed to set Track Experiment Time", e1));
+ Messages.ChartComposite_ActivatorFailedTrackExperimentTime, e1));
}
}
});
@Override
public String perform(ReadGraph graph, Resource r) throws DatabaseException {
Double value = graph.getPossibleRelatedAdapter(r, graph.getResource(propertyURI), Double.class);
- return value != null ? value.toString() : "";
+ return value != null ? value.toString() : ""; //$NON-NLS-1$
}
}
--- /dev/null
+package org.simantics.modeling.ui.chart.property;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.chart.property.messages"; //$NON-NLS-1$
+ public static String ChartComposite_ActivatorFailedToSetShowMilestones;
+ public static String ChartComposite_ActivatorFailedTrackExperimentTime;
+ public static String ChartComposite_Apply;
+ public static String ChartComposite_AutoScrollSettings;
+ public static String ChartComposite_ChartWindowTT;
+ public static String ChartComposite_ChartWindowTT2;
+ public static String ChartComposite_HairlineAndTracksExperimentTime;
+ public static String ChartComposite_HairlineAndTracksExperimentTimeTT;
+ public static String ChartComposite_Length;
+ public static String ChartComposite_ScrollIncrement;
+ public static String ChartComposite_ScrollIncrementRange;
+ public static String ChartComposite_ShowMileStones;
+ public static String ChartComposite_StartTime;
+ public static String ChartComposite_Template;
+ public static String TimeInputValidator_ValueRange;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
@Override
public String adapt(ReadGraph graph, Resource source, RelationContext context) throws DatabaseException {
Double value = ADAPTER.adapt(graph, source, context);
- return value != null ? value.toString() : "";
+ return value != null ? value.toString() : ""; //$NON-NLS-1$
}
}
import java.text.ParseException;
import org.eclipse.jface.dialogs.IInputValidator;
+import org.eclipse.osgi.util.NLS;
import org.simantics.utils.format.TimeFormat;
/**
*/
public class TimeInputValidator implements IInputValidator {
- Format decimalFormat = new DecimalFormat("0");
+ Format decimalFormat = new DecimalFormat("0"); //$NON-NLS-1$
Format timeFormat = new TimeFormat(100, 0);
public Double parse(String text) {
if (text==null) return null;
text = text.trim();
- if (text.equals("")) return null;
+ if (text.equals("")) return null; //$NON-NLS-1$
try {
return (Double) timeFormat.parseObject(text);
@Override
public String isValid(String text) {
- if (text==null) return "Null";
+ if (text == null)
+ return "Null"; //$NON-NLS-1$
text = text.trim();
- if (text.equals("")) return null;
+ if (text.equals("")) //$NON-NLS-1$
+ return null;
try {
Double d = (Double) timeFormat.parseObject(text);
-
- if (d != null && d.doubleValue()<minValue)
- return "The value must be at least "+minValue+" seconds.";
+
+ if (d != null && d.doubleValue() < minValue)
+ return NLS.bind(Messages.TimeInputValidator_ValueRange, minValue);
return null;
} catch (ParseException e) {
}
-
+
try {
Number n = (Number) decimalFormat.parseObject(text);
- if (n != null && n.doubleValue()<minValue)
- return "The value must be at least "+minValue+" seconds.";
+ if (n != null && n.doubleValue() < minValue)
+ return NLS.bind(Messages.TimeInputValidator_ValueRange, minValue);
return null;
} catch (ParseException e) {
- return "Unable to parse specified value as a measure of time.";
+ return "Unable to parse specified value as a measure of time."; //$NON-NLS-1$
}
}
@Override
public String perform(ReadGraph graph, Resource r) throws DatabaseException {
Double value = graph.getPossibleRelatedAdapter(r, graph.getResource(propertyURI), Double.class);
- if (value == null) return "";
+ if (value == null) return ""; //$NON-NLS-1$
Format timeFormat = new TimeFormat(100, 3);
return timeFormat.format(value);
}
--- /dev/null
+ChartComposite_ActivatorFailedToSetShowMilestones=Failed to set Show Milestones\r
+ChartComposite_ActivatorFailedTrackExperimentTime=Failed to set Track Experiment Time\r
+ChartComposite_Apply=Apply\r
+ChartComposite_AutoScrollSettings=Auto-scroll settings:\r
+ChartComposite_ChartWindowTT=Chart Window Fixed Start Time in Seconds or Yy Dd HH:mm:ss.ddd\r
+ChartComposite_ChartWindowTT2=Chart Window Fixed Time Axis Length in Seconds or Yy Dd HH:mm:ss.ddd\r
+ChartComposite_HairlineAndTracksExperimentTime=Hairline &Tracks Experiment Time\r
+ChartComposite_HairlineAndTracksExperimentTimeTT=Value Tip Hairline Tracks Experiment Time During Simulation\r
+ChartComposite_Length=Length\r
+ChartComposite_ScrollIncrement=Scroll increment\r
+ChartComposite_ScrollIncrementRange=Increment must be between 1..100\r
+ChartComposite_ShowMileStones=Show &Milestones\r
+ChartComposite_StartTime=Start time\r
+ChartComposite_Template=Template\r
+TimeInputValidator_ValueRange=The value must be at least {0} seconds.\r
public class ComponentTypeEditor extends ResourceEditorPart implements IExecutableExtension {
protected ComponentTypeViewer viewer;
- protected String formTitle = "User Component Interface";
+ protected String formTitle = Messages.ComponentTypeEditor_UserComponentInterface;
@Override
public void setInitializationData(IConfigurationElement cfig, String propertyName, Object data) {
if (data instanceof String) {
- String[] params = ((String) data).split(";");
+ String[] params = ((String) data).split(";"); //$NON-NLS-1$
for (String param : params) {
- String[] keyValue = param.split("=");
+ String[] keyValue = param.split("="); //$NON-NLS-1$
if (keyValue.length == 2) {
- if ("formTitle".equals(keyValue[0])) {
+ if ("formTitle".equals(keyValue[0])) { //$NON-NLS-1$
formTitle = keyValue[1];
}
}
Resource owner = graph.getPossibleObject(resource, STR.ComponentType_hasScript_Inverse);
immutable = owner != null && StructuralUtils.isImmutable(graph, owner);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
synchronized(annotationModel.getLockObject()) {
annotationModel.removeAllAnnotations();
for(CompilationError error : result.getErrors()) {
- Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, error.description);
+ Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, error.description); //$NON-NLS-1$
int begin = Locations.beginOf(error.location);
int end = Locations.endOf(error.location);
Position position = new Position(begin, end - begin);
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument");
+ TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
String name = graph.getRelatedValue(script, L0.HasName);
Resource componentType = graph.getSingleObject(script, STR.ComponentType_hasScript_Inverse);
String ctName = graph.getRelatedValue(componentType, L0.HasName);
- return ctName + " " + name;
+ return ctName + " " + name; //$NON-NLS-1$
}
},
}
private static final String[] EXECUTION_PHASES = new String[] {
- "step",
- "analogAutomation",
- "binaryAutomation",
- "preparation"
+ "step", //$NON-NLS-1$
+ "analogAutomation", //$NON-NLS-1$
+ "binaryAutomation", //$NON-NLS-1$
+ "preparation" //$NON-NLS-1$
};
private static final String[] EXECUTION_PHASE_LABELS = new String[] {
- "Execute at each step",
- "Execute together with analog automation",
- "Execute together with binary automation",
- "Execute during preparation"
+ Messages.ComponentTypeScriptEditor_ExecuteAtEachStep,
+ Messages.ComponentTypeScriptEditor_ExecuteAnalogAutomation,
+ Messages.ComponentTypeScriptEditor_ExecuteBinaryAutomation,
+ Messages.ComponentTypeScriptEditor_ExecuteDuringPreparation
};
@Override
String type = graph.getPossibleRelatedValue(relation, L0.RequiresValueType);
String label = graph.getPossibleRelatedValue(relation, L0.HasLabel);
if (label == null)
- label = "";
+ label = ""; //$NON-NLS-1$
String description = graph.getPossibleRelatedValue(relation, L0.HasDescription);
if (description == null)
- description = "";
+ description = ""; //$NON-NLS-1$
NumberType numberType = null;
if(type == null)
- type = "Double";
+ type = "Double"; //$NON-NLS-1$
String unit = graph.getPossibleRelatedValue(relation, L0X.HasUnit, Bindings.STRING);
- String defaultValue = "0";
+ String defaultValue = "0"; //$NON-NLS-1$
String expression = null;
for(Resource assertion : graph.getAssertedObjects(data.componentType, relation)) {
try {
expression = graph.getPossibleRelatedValue(assertion, L0.SCLValue_expression, Bindings.STRING);
if(expression != null) {
- defaultValue = "=" + expression;
+ defaultValue = "=" + expression; //$NON-NLS-1$
} else {
Datatype dt = getPossibleDatatype(graph, assertion);
if (dt == null)
section.setReadOnly(readOnly);
IMessageManager mm = data.form.getMessageManager();
if (readOnly)
- mm.addMessage("readonly", "(Opened in read-only mode)", null, IMessageProvider.INFORMATION);
+ mm.addMessage("readonly", Messages.ComponentTypeViewer_OpenedInReadOnly, null, IMessageProvider.INFORMATION); //$NON-NLS-1$
else
- mm.removeMessage("readonly");
+ mm.removeMessage("readonly"); //$NON-NLS-1$
}
}
import java.util.regex.Matcher;
import java.util.regex.Pattern;
+import org.eclipse.jface.dialogs.IDialogConstants;
import org.eclipse.jface.dialogs.IMessageProvider;
import org.eclipse.jface.layout.GridDataFactory;
import org.eclipse.jface.layout.GridLayoutFactory;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.custom.StyledText;
import org.eclipse.swt.custom.TableEditor;
* Used to validate property names.
*/
public static final Pattern PROPERTY_NAME_PATTERN =
- Pattern.compile("([a-z]|_[0-9a-zA-Z_])[0-9a-zA-Z_]*");
+ Pattern.compile("([a-z]|_[0-9a-zA-Z_])[0-9a-zA-Z_]*"); //$NON-NLS-1$
public static final String[] PROPERTY_TYPE_SUGGESTIONS = new String[] {
- "Double",
- "Integer",
- "Float",
- "String",
- "Boolean",
- "Long",
- "[Double]",
- "[Integer]",
- "[Float]",
- "[String]",
- "[Boolean]",
- "[Long]",
- "Vector Double",
- "Vector Integer",
- "Vector Float",
- "Vector String",
- "Vector Boolean",
- "Vector Long"
+ "Double", //$NON-NLS-1$
+ "Integer", //$NON-NLS-1$
+ "Float", //$NON-NLS-1$
+ "String", //$NON-NLS-1$
+ "Boolean", //$NON-NLS-1$
+ "Long", //$NON-NLS-1$
+ "[Double]", //$NON-NLS-1$
+ "[Integer]", //$NON-NLS-1$
+ "[Float]", //$NON-NLS-1$
+ "[String]", //$NON-NLS-1$
+ "[Boolean]", //$NON-NLS-1$
+ "[Long]", //$NON-NLS-1$
+ "Vector Double", //$NON-NLS-1$
+ "Vector Integer", //$NON-NLS-1$
+ "Vector Float", //$NON-NLS-1$
+ "Vector String", //$NON-NLS-1$
+ "Vector Boolean", //$NON-NLS-1$
+ "Vector Long" //$NON-NLS-1$
};
-
+
public Resource componentType;
public FormToolkit tk;
public Form form;
graph.markUndoPoint();
Layer0 L0 = Layer0.getInstance(graph);
String prevName = graph.getPossibleRelatedValue2(propertyInfo.resource, L0.HasName);
- String oldCamelCasedLabel = prevName != null ? ComponentTypeCommands.camelCaseNameToLabel(prevName) : "";
+ String oldCamelCasedLabel = prevName != null ? ComponentTypeCommands.camelCaseNameToLabel(prevName) : ""; //$NON-NLS-1$
String oldLabel = graph.getPossibleRelatedValue(propertyInfo.resource, L0.HasLabel);
boolean setLabel = oldLabel == null
|| oldLabel.isEmpty()
private Range parseRange(NumberType numberType, String minStr, String maxStr, boolean lowInclusive, boolean highInclusive) throws RangeException {
try {
- String rangeStr = (lowInclusive ? "[" : "(") + minStr + ".." + maxStr + (highInclusive ? "]" : ")");
+ String rangeStr = (lowInclusive ? "[" : "(") + minStr + ".." + maxStr + (highInclusive ? "]" : ")"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$ //$NON-NLS-4$ //$NON-NLS-5$
return Range.valueOf(rangeStr);
} catch (IllegalArgumentException e) {
// Limits are invalid
private static Combo createRangeInclusionCombo(Composite parent, boolean inclusive) {
Combo rng = new Combo(parent, SWT.READ_ONLY);
- rng.add("Inclusive");
- rng.add("Exclusive");
+ rng.add(Messages.ComponentTypeViewerData_Inclusive);
+ rng.add(Messages.ComponentTypeViewerData_Exclusive);
rng.select(inclusive ? 0 : 1);
return rng;
}
GridLayoutFactory.swtDefaults().numColumns(3).applyTo(composite);
Label low = new Label(composite, SWT.NONE);
- low.setText("Minimum Value:");
+ low.setText(Messages.ComponentTypeViewerData_MinimumValue);
final Text lowText = new Text(composite, SWT.BORDER | extraTextStyle);
GridDataFactory.fillDefaults().grab(true, false).hint(100, SWT.DEFAULT).applyTo(lowText);
final Combo lowSelector = createRangeInclusionCombo(composite, !range.getLower().isExclusive());
Label high = new Label(composite, SWT.NONE);
- high.setText("Maximum Value:");
+ high.setText(Messages.ComponentTypeViewerData_MaximumValue);
final Text highText = new Text(composite, SWT.BORDER | extraTextStyle);
GridDataFactory.fillDefaults().grab(true, false).hint(100, SWT.DEFAULT).applyTo(highText);
final Combo highSelector = createRangeInclusionCombo(composite, !range.getUpper().isExclusive());
GridLayoutFactory.swtDefaults().numColumns(2).equalWidth(true).applyTo(buttonComposite);
Button ok = new Button(buttonComposite, SWT.NONE);
- ok.setText("&OK");
+ ok.setText(IDialogConstants.OK_LABEL);
GridDataFactory.swtDefaults().align(SWT.FILL, SWT.CENTER).applyTo(ok);
Button cancel = new Button(buttonComposite, SWT.NONE);
- cancel.setText("&Cancel");
+ cancel.setText(IDialogConstants.CANCEL_LABEL);
GridDataFactory.swtDefaults().align(SWT.FILL, SWT.CENTER).applyTo(ok);
if (range.getLower().getValue() != null)
}
};
- String helpText = propertyInfo.immutable ? "ESC to close." : "Ctrl+Enter to apply changes, ESC to cancel.";
+ String helpText = propertyInfo.immutable ? Messages.ComponentTypeViewerData_ESCToClose : Messages.ComponentTypeViewerData_CtrlEnterApplyChanges;
Label help = tk.createLabel(shell, helpText, SWT.BORDER | SWT.FLAT);
GridDataFactory.fillDefaults().grab(true, false).align(SWT.FILL, SWT.CENTER).applyTo(help);
- help.setForeground( tk.getColors().createColor( "fg", tk.getColors().getSystemColor(SWT.COLOR_LIST_SELECTION) ) );
+ help.setForeground( tk.getColors().createColor( "fg", tk.getColors().getSystemColor(SWT.COLOR_LIST_SELECTION) ) ); //$NON-NLS-1$
Display display = table.getDisplay();
Rectangle clientArea = display.getClientArea();
return null;
for (ComponentTypeViewerPropertyInfo info : properties) {
if (propertyName.equals(info.name))
- return "Property name '" + propertyName + "' is already in use.";
+ return NLS.bind(Messages.ComponentTypeViewerData_PropertyNameInUse, propertyName);
}
for (NamedResource cp : connectionPoints) {
if (propertyName.equals(cp.getName()))
- return "Name '" + propertyName + "' is already used for a terminal.";
+ return NLS.bind(Messages.ComponentTypeViewerData_NameInUse, propertyName );
}
Matcher m = namePattern.matcher(propertyName);
if (!m.matches())
- return "Property name '" + propertyName + "' contains invalid characters, does not match pattern "
- + namePattern.pattern() + ".";
+ return NLS.bind(Messages.ComponentTypeViewerData_ContainsInvalidCharacters, propertyName, namePattern.pattern());
return null;
}
public class ConfigurationPropertiesSection implements ComponentTypeViewerSection {
private static final Logger LOGGER = LoggerFactory.getLogger(ConfigurationPropertiesSection.class);
-
- private static final String[] COLUMN_NAMES =
- new String[] {"Name", "Type", "Default Value", "Unit", "Range", "Label", "Description"};
+
+ private static final String[] COLUMN_NAMES = {
+ Messages.ConfigurationPropertiesSection_Name,
+ Messages.ConfigurationPropertiesSection_Type,
+ Messages.ConfigurationPropertiesSection_DefaultValue,
+ Messages.ConfigurationPropertiesSection_Unit,
+ Messages.ConfigurationPropertiesSection_Range,
+ Messages.ConfigurationPropertiesSection_Label,
+ Messages.ConfigurationPropertiesSection_Description
+ };
private static final int[] COLUMN_LENGTHS =
new int[] { 120, 100, 100, 50, 100, 100, 100 };
private static final int[] COLUMN_WEIGHTS =
*/
private static final int[] IMMUTABLE_COLUMNS_WITH_IMMUTABLE_RELATION =
{ 0, 1, 3, 4, 5, 6 };
-
ComponentTypeViewerData data;
+
Table table;
TableColumn[] columns;
TableEditor editor;
section = tk.createSection(form.getBody(), Section.TITLE_BAR | Section.EXPANDED);
section.setLayout(new FillLayout());
- section.setText("Configuration properties");
+ section.setText(Messages.ConfigurationPropertiesSection_ConfigurationProperties);
Composite sectionBody = tk.createComposite(section);
GridLayoutFactory.fillDefaults().numColumns(2).applyTo(sectionBody);
GridDataFactory.fillDefaults().applyTo(buttons);
GridLayoutFactory.fillDefaults().applyTo(buttons);
- newProperty = tk.createButton(buttons, "New property", SWT.PUSH);
+ newProperty = tk.createButton(buttons, Messages.ConfigurationPropertiesSection_NewProperty, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(newProperty);
- removeProperty = tk.createButton(buttons, "Remove property", SWT.PUSH);
+ removeProperty = tk.createButton(buttons, Messages.ConfigurationPropertiesSection_RemoveProperty, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(removeProperty);
- liftProperties = tk.createButton(buttons, "Lift Properties", SWT.PUSH);
+ liftProperties = tk.createButton(buttons, Messages.ConfigurationPropertiesSection_LiftProperties, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(liftProperties);
hasTypes = !getTypes().isEmpty();
if(hasTypes) {
- setTypes = tk.createButton(buttons, "Assign Types", SWT.PUSH);
+ setTypes = tk.createButton(buttons, Messages.ConfigurationPropertiesSection_AssignTypes, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(setTypes);
}
if (!info.immutable)
propertiesToBeRemoved.add(info.resource);
}
- System.out.println("remove " + propertiesToBeRemoved.size() + " resources");
+ //System.out.println("remove " + propertiesToBeRemoved.size() + " resources"); //$NON-NLS-1$ //$NON-NLS-2$
if(!propertiesToBeRemoved.isEmpty())
Simantics.getSession().async(new WriteRequest() {
@Override
String predicateName = NameUtils.getSafeName(graph, predicate);
if(existing.contains(predicateName)) continue;
- String name = componentName + " " + predicateName;
+ String name = componentName + " " + predicateName; //$NON-NLS-1$
map.put(new LiftedProperty(component, type, predicate), new Pair<String, ImageDescriptor>(name, null));
}
});
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
- LiftPropertiesDialog dialog = new LiftPropertiesDialog(shell, map, "Select properties to lift") {
+ LiftPropertiesDialog dialog = new LiftPropertiesDialog(shell, map, Messages.ConfigurationPropertiesSection_SelectPropertiesToLift) {
@Override
protected IDialogSettings getBaseDialogSettings() {
return Activator.getDefault().getDialogSettings();
graph.claim(data.componentType, L0.DomainOf, copy);
Layer0Utils.assert_(graph, data.componentType, copy, copyAss.iterator().next());
CommentMetadata cm = graph.getMetadata(CommentMetadata.class);
- graph.addMetadata(cm.add("Lifted property " + NameUtils.getSafeName(graph, copy) + " into "+ NameUtils.getSafeName(graph, data.componentType)));
+ graph.addMetadata(cm.add("Lifted property " + NameUtils.getSafeName(graph, copy) + " into "+ NameUtils.getSafeName(graph, data.componentType))); //$NON-NLS-1$ //$NON-NLS-2$
}
if(mapProperties) {
Variable v = Variables.getVariable(graph, p.getComponent());
Variable property = v.getProperty(graph, p.getPredicate());
Variable displayValue = property.getProperty(graph, Variables.DISPLAY_VALUE);
- displayValue.setValue(graph, "=" + NameUtils.getSafeName(graph, p.getPredicate()), Bindings.STRING);
+ displayValue.setValue(graph, "=" + NameUtils.getSafeName(graph, p.getPredicate()), Bindings.STRING); //$NON-NLS-1$
}
index++;
}
} catch (DatabaseException e1) {
- LOGGER.error("Lifting properties failed", e1);
+ LOGGER.error("Lifting properties failed", e1); //$NON-NLS-1$
return;
}
if(propertiesToSet.size() != 1) return;
Shell shell = PlatformUI.getWorkbench().getActiveWorkbenchWindow().getShell();
- SetTypesDialog page = new SetTypesDialog(shell, getTypes(), "Select user types for property");
+ SetTypesDialog page = new SetTypesDialog(shell, getTypes(), Messages.ConfigurationPropertiesSection_SelectUserTypesForProp);
if (page.open() == Window.OK) {
final Object[] result = page.getResult();
if (result != null && result.length > 0) {
}
});
} catch (DatabaseException e) {
- LOGGER.error("Finding UserDefinedProperties failed.", e);
+ LOGGER.error("Finding UserDefinedProperties failed.", e); //$NON-NLS-1$
return Collections.emptyMap();
}
}
import org.simantics.structural.stubs.StructuralResource2;
public class DerivedPropertiesSection implements ComponentTypeViewerSection {
- private static final String[] COLUMN_NAMES =
- new String[] {"Name", "Type", "Expression", "Unit", "Label", "Description"};
+ private static final String[] COLUMN_NAMES = {
+ Messages.DerivedPropertiesSection_Name,
+ Messages.DerivedPropertiesSection_Type,
+ Messages.DerivedPropertiesSection_Expression,
+ Messages.DerivedPropertiesSection_Unit,
+ Messages.DerivedPropertiesSection_Label,
+ Messages.DerivedPropertiesSection_Description
+ };
private static final int[] COLUMN_LENGTHS =
new int[] { 120, 100, 100, 70, 100, 100 };
private static final int[] COLUMN_WEIGHTS =
Form form = data.form;
section = tk.createSection(form.getBody(), Section.TITLE_BAR | Section.EXPANDED);
section.setLayout(new FillLayout());
- section.setText("Derived properties");
+ section.setText(Messages.DerivedPropertiesSection_DerivedProperties);
Composite sectionBody = tk.createComposite(section);
GridLayoutFactory.fillDefaults().numColumns(2).applyTo(sectionBody);
GridDataFactory.fillDefaults().applyTo(buttons);
GridLayoutFactory.fillDefaults().applyTo(buttons);
- newProperty = tk.createButton(buttons, "New property", SWT.PUSH);
+ newProperty = tk.createButton(buttons, Messages.DerivedPropertiesSection_NewProperty, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(newProperty);
- removeProperty = tk.createButton(buttons, "Remove property", SWT.PUSH);
+ removeProperty = tk.createButton(buttons, Messages.DerivedPropertiesSection_RemoveProperty, SWT.PUSH);
GridDataFactory.fillDefaults().applyTo(removeProperty);
// Actions
public static String validateMonitorExpression(final RequestProcessor processor, final Resource componentType, final Resource relation, final String expression) {
if (expression.trim().isEmpty()) {
- return "Expression is empty.";
+ return Messages.DerivedPropertiesSection_ExpressionIsEmpty;
}
if (expression.trim().isEmpty()) {
- return "Expression is empty.";
+ return Messages.DerivedPropertiesSection_ExpressionIsEmpty;
}
try {
return processor.sync(new UniqueRead<String>() {
} catch (Exception e) {
String msg = e.getMessage();
- int index = msg.indexOf(":");
+ int index = msg.indexOf(":"); //$NON-NLS-1$
if(index > 0) msg = msg.substring(index);
return msg;
}
TableItem item = new TableItem(table, SWT.NONE);
- item.setText(0, info.valid != null ? info.name + " (!)" : info.name);
+ item.setText(0, info.valid != null ? info.name + " (!)" : info.name); //$NON-NLS-1$
item.setText(1, info.type);
item.setText(2, info.expression);
item.setText(3, info.unitString());
// l.setText("Map lifted properties into interface");
// GridDataFactory.fillDefaults().grab(false, false).applyTo(l);
checkbox = new Button(c, SWT.CHECK);
- checkbox.setText("Map lifted properties into interface");
+ checkbox.setText(Messages.LiftPropertiesDialog_MapLiftedPropertiesIntoInterface);
checkbox.addSelectionListener(new SelectionListener() {
@Override
--- /dev/null
+package org.simantics.modeling.ui.componentTypeEditor;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.componentTypeEditor.messages"; //$NON-NLS-1$
+ public static String ComponentTypeEditor_UserComponentInterface;
+ public static String ComponentTypeScriptEditor_ExecuteAnalogAutomation;
+ public static String ComponentTypeScriptEditor_ExecuteAtEachStep;
+ public static String ComponentTypeScriptEditor_ExecuteBinaryAutomation;
+ public static String ComponentTypeScriptEditor_ExecuteDuringPreparation;
+ public static String ComponentTypeViewer_OpenedInReadOnly;
+ public static String ComponentTypeViewerData_ContainsInvalidCharacters;
+ public static String ComponentTypeViewerData_CtrlEnterApplyChanges;
+ public static String ComponentTypeViewerData_ESCToClose;
+ public static String ComponentTypeViewerData_Exclusive;
+ public static String ComponentTypeViewerData_Inclusive;
+ public static String ComponentTypeViewerData_MaximumValue;
+ public static String ComponentTypeViewerData_MinimumValue;
+ public static String ComponentTypeViewerData_NameInUse;
+ public static String ComponentTypeViewerData_PropertyNameInUse;
+ public static String ConfigurationPropertiesSection_AssignTypes;
+ public static String ConfigurationPropertiesSection_ConfigurationProperties;
+ public static String ConfigurationPropertiesSection_DefaultValue;
+ public static String ConfigurationPropertiesSection_Description;
+ public static String ConfigurationPropertiesSection_Label;
+ public static String ConfigurationPropertiesSection_LiftProperties;
+ public static String ConfigurationPropertiesSection_Name;
+ public static String ConfigurationPropertiesSection_NewProperty;
+ public static String ConfigurationPropertiesSection_Range;
+ public static String ConfigurationPropertiesSection_RemoveProperty;
+ public static String ConfigurationPropertiesSection_SelectPropertiesToLift;
+ public static String ConfigurationPropertiesSection_SelectUserTypesForProp;
+ public static String ConfigurationPropertiesSection_Type;
+ public static String ConfigurationPropertiesSection_Unit;
+ public static String DerivedPropertiesSection_DerivedProperties;
+ public static String DerivedPropertiesSection_Description;
+ public static String DerivedPropertiesSection_Expression;
+ public static String DerivedPropertiesSection_ExpressionIsEmpty;
+ public static String DerivedPropertiesSection_Label;
+ public static String DerivedPropertiesSection_Name;
+ public static String DerivedPropertiesSection_NewProperty;
+ public static String DerivedPropertiesSection_RemoveProperty;
+ public static String DerivedPropertiesSection_Type;
+ public static String DerivedPropertiesSection_Unit;
+ public static String LiftPropertiesDialog_MapLiftedPropertiesIntoInterface;
+ public static String ProceduralComponentInstanceViewer_CouldnotCreateVariableForResource;
+ public static String ProceduralComponentInstanceViewer_NoProceduralSubstructure;
+ public static String ProceduralComponentInstanceViewerEditorAdapter_ProceduralComponentInstanceViewer;
+ public static String ProceduralComponentTypeCodeDocumentProvider_ActivatorInternalErrorMsg;
+ public static String ProceduralComponentTypeEditorNamingService_UnsupportedInput;
+ public static String SCLModuleEditorAdapter_SCLModuleEditor;
+ public static String SCLModuleViewer_ApplyChanges;
+ public static String SCLModuleViewer_Code;
+ public static String SymbolCodeDocumentProvider2_ActivatorInternalErrorInCodeCompilation;
+ public static String SymbolDropHandlerDocumentProvider_ActivatorInternalError;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
try {
getResourceInput().init(null);
} catch (DatabaseException e) {
- throw new PartInitException("Failed to initialize " + input, e);
+ throw new PartInitException("Failed to initialize " + input, e); //$NON-NLS-1$
}
}
if(graph.isInstanceOf(resource, L0.PGraph)) {
currentText = graph.getRelatedValue(resource, L0.PGraph_definition, Bindings.STRING);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
} else {
Resource indexRoot = graph.syncRequest(new PossibleIndexRoot(resource));
try {
currentText = PrettyPrintTG.print(tg, false);
errorHappened = false;
}
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
} catch (Exception e) {
- throw new DatabaseException("Could not get PGraph from " + resource);
+ throw new DatabaseException("Could not get PGraph from " + resource); //$NON-NLS-1$
}
}
}
synchronized(annotationModel.getLockObject()) {
annotationModel.removeAllAnnotations();
for(CompilationError error : errors) {
- Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true,
+ Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, //$NON-NLS-1$
error.description);
int begin = Locations.beginOf(error.location);
int end = Locations.endOf(error.location);
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog("PGraphEditorDocumentProvider.doSaveDocument");
+ TimeLogger.resetTimeAndLog("PGraphEditorDocumentProvider.doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
graph.markUndoPoint();
Layer0 L0 = Layer0.getInstance(graph);
graph.claimLiteral(resource, L0.PGraph_definition, currentText, Bindings.STRING);
- Layer0Utils.addCommentMetadata(graph, "Saved Ontology Definition File " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Saved Ontology Definition File " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
}
ITokenScanner getSclTokenScanner() {
RuleBasedScanner scanner = new RuleBasedScanner();
- Font font = new Font(device, "Courier New", 10, SWT.NORMAL);
- Font boldFont = new Font(device, "Courier New", 10, SWT.BOLD);
+ Font font = new Font(device, "Courier New", 10, SWT.NORMAL); //$NON-NLS-1$
+ Font boldFont = new Font(device, "Courier New", 10, SWT.BOLD); //$NON-NLS-1$
Token defaultToken = new Token(
new TextAttribute(
}
});
- reservedWord.addWord("if", reserved);
- reservedWord.addWord("then", reserved);
- reservedWord.addWord("else", reserved);
- reservedWord.addWord("match", reserved);
- reservedWord.addWord("with", reserved);
- reservedWord.addWord("data", reserved);
- reservedWord.addWord("type", reserved);
- reservedWord.addWord("class", reserved);
+ reservedWord.addWord("if", reserved); //$NON-NLS-1$
+ reservedWord.addWord("then", reserved); //$NON-NLS-1$
+ reservedWord.addWord("else", reserved); //$NON-NLS-1$
+ reservedWord.addWord("match", reserved); //$NON-NLS-1$
+ reservedWord.addWord("with", reserved); //$NON-NLS-1$
+ reservedWord.addWord("data", reserved); //$NON-NLS-1$
+ reservedWord.addWord("type", reserved); //$NON-NLS-1$
+ reservedWord.addWord("class", reserved); //$NON-NLS-1$
IRule[] rules = new IRule[] {
//new MultiLineRule("\"\"\"", "\"\"\"", string),
- new PatternRule("\"", "\"", string, '\\', true),
- new MultiLineRule("/*", "*/", comment),
- new PatternRule("//", null, comment, '\0', true),
+ new PatternRule("\"", "\"", string, '\\', true), //$NON-NLS-1$ //$NON-NLS-2$
+ new MultiLineRule("/*", "*/", comment), //$NON-NLS-1$ //$NON-NLS-2$
+ new PatternRule("//", null, comment, '\0', true), //$NON-NLS-1$
reservedWord
};
scanner.setRules(rules);
Resource inputResource = getInputResource();
Variable context = Variables.getPossibleVariable(graph, inputResource);
if(context == null)
- return createErrorGraph("Couldn't create variable for the resource.");
+ return createErrorGraph(Messages.ProceduralComponentInstanceViewer_CouldnotCreateVariableForResource);
try {
List<SubstructureElement> proceduralDesc =
Functions.getProceduralDesc(graph, context);
if(proceduralDesc == null)
- return createErrorGraph("Component does not have a procedural substructure.");
+ return createErrorGraph(Messages.ProceduralComponentInstanceViewer_NoProceduralSubstructure);
return createGraph(graph, proceduralDesc);
} catch(DatabaseException e) {
e.printStackTrace();
private static Graph createErrorGraph(String description) {
Graph graph = new Graph();
- new Node(graph, description).setShape("rectangle");
+ new Node(graph, description).setShape("rectangle"); //$NON-NLS-1$
return graph;
}
Node node = connectionPoints.get(interface_.relation);
if(node == null) {
node = new Node(graph);
- node.setShape("diamond");
+ node.setShape("diamond"); //$NON-NLS-1$
node.setLabel(nameOf(g, interface_.relation));
connectionPoints.put(interface_.relation, node);
}
private static Graph createGraph(ReadGraph g, List<SubstructureElement> proceduralDesc) throws DatabaseException {
Graph graph = new Graph();
- graph.setRankdir("LR");
+ graph.setRankdir("LR"); //$NON-NLS-1$
THashMap<String, Node> components = new THashMap<String, Node>();
for(SubstructureElement element : proceduralDesc)
if(element instanceof Component) {
Component component = (Component)element;
Record record = new Record();
- record.add(component.name + " : " + nameOf(g, component.type));
+ record.add(component.name + " : " + nameOf(g, component.type)); //$NON-NLS-1$
StringBuilder b = new StringBuilder();
boolean first = true;
for(Property property : component.properties) {
if(first)
first = false;
else
- b.append("\\n");
- b.append(nameOf(g, property.relation) + " = " + property.value);
+ b.append("\\n"); //$NON-NLS-1$
+ b.append(nameOf(g, property.relation) + " = " + property.value); //$NON-NLS-1$
}
record.add(b.toString());
components.put(component.name, record.toNode(graph));
Edge edge = new Edge(cp1.first, cp2.first);
if(cp1.second != null) {
if(cp2.second != null)
- edge.setLabel(cp1.second + "-" + cp2.second);
+ edge.setLabel(cp1.second + "-" + cp2.second); //$NON-NLS-1$
else
edge.setLabel(cp1.second);
}
}
else {
Node p = new Node(graph);
- p.setShape("point");
+ p.setShape("point"); //$NON-NLS-1$
boolean first = true;
for(ConnectionPoint cp : cps) {
Pair<Node, String> cp1 = getCp(g, graph, components, connectionPoints, cp);
AbstractResourceEditorAdapter {
public static final ImageDescriptor ICON = ImageDescriptor.createFromURL(Activator.getDefault().getBundle()
- .getResource("icons/shape_3d_gray.png"));
- public static final String EDITOR_ID = "org.simantics.modeling.ui.proceduralComponentInstanceViewer";
+ .getResource("icons/shape_3d_gray.png")); //$NON-NLS-1$
+ public static final String EDITOR_ID = "org.simantics.modeling.ui.proceduralComponentInstanceViewer"; //$NON-NLS-1$
public ProceduralComponentInstanceViewerEditorAdapter() {
- super("Procedural Component Instance Viewer", ICON, -10);
+ super(Messages.ProceduralComponentInstanceViewerEditorAdapter_ProceduralComponentInstanceViewer, ICON, -10);
}
private static Resource browseComponent(ReadGraph graph, Resource input) throws DatabaseException {
public Document perform(ReadGraph graph) throws DatabaseException {
currentText = graph.getValue(resource, Bindings.STRING);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
@Override
public void exception(Throwable t) {
Activator.getDefault().getLog().log(
- new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Internal error in procedural user component code compilation.", t));
+ new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.ProceduralComponentTypeCodeDocumentProvider_ActivatorInternalErrorMsg, t));
}
@Override
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument");
+ TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
import java.util.ArrayList;
import java.util.List;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.ui.IEditorInput;
import org.simantics.NameLabelMode;
import org.simantics.NameLabelUtil;
if (input instanceof IResourceEditorInput) {
Resource code = ((IResourceEditorInput) input).getResource();
if (code != null) {
- return truncated(getPropertyOwnerName(graph, code) + " (Code)", 256);
+ return truncated(getPropertyOwnerName(graph, code) + " (Code)", 256); //$NON-NLS-1$
}
}
- return "Unsupported input: " + input;
+ return NLS.bind(Messages.ProceduralComponentTypeEditorNamingService_UnsupportedInput, input);
}
@Override
return sb.toString();
}
}
- return "Unsupported input: " + input;
+ return NLS.bind(Messages.ProceduralComponentTypeEditorNamingService_UnsupportedInput, input);
}
private StringBuilder getTooltip(ReadGraph graph, String editorId, IResourceEditorInput input, StringBuilder sb) throws DatabaseException {
ResourceArray path = getPathInIndexRoot(graph, owner);
for (int i = path.size() - 2; i > 0; --i) {
String segment = NameLabelUtil.modalName(graph, path.get(i), mode);
- if (segment.contains("/"))
- segment = "\"" + segment + "\"";
+ if (segment.contains("/")) //$NON-NLS-1$
+ segment = "\"" + segment + "\""; //$NON-NLS-1$ //$NON-NLS-2$
- sb.append(segment).append("/");
+ sb.append(segment).append("/"); //$NON-NLS-1$
}
sb.append(name);
String rootLabel = NameLabelUtil.modalName(graph, root, mode);
- sb.append(" (" + rootLabel + ")");
+ sb.append(" (" + rootLabel + ")"); //$NON-NLS-1$ //$NON-NLS-2$
return sb;
}
}
Layer0 L0 = Layer0.getInstance(graph);
Resource owner = graph.getPossibleObject(property, L0.PropertyOf);
if (owner == null)
- return "No owner (Code)";
+ return "No owner (Code)"; //$NON-NLS-1$
return graph.getPossibleRelatedValue(owner, L0.HasName);
}
public void perform(WriteGraph graph) throws DatabaseException {
graph.markUndoPoint();
save(graph, inputResource, originalText);
- Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(inputResource, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(inputResource, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
Layer0 L0 = Layer0.getInstance(graph);
Resource parent = graph.getPossibleObject(inputResource, L0.PropertyOf);
if(parent == null)
- return "No parent";
- return graph.getPossibleRelatedValue(parent, L0.HasName) + " (Code)";
+ return "No parent"; //$NON-NLS-1$
+ return graph.getPossibleRelatedValue(parent, L0.HasName) + " (Code)"; //$NON-NLS-1$
}
@Override
public Object execute(ExecutionEvent event) throws ExecutionException {
String id = event.getCommand().getId();
SCLEditorBase editor = (SCLEditorBase)PlatformUI.getWorkbench().getActiveWorkbenchWindow().getActivePage().getActiveEditor();
- if(id.equals("org.eclipse.ui.edit.undo")) {
+ if(id.equals("org.eclipse.ui.edit.undo")) { //$NON-NLS-1$
editor.editor.getUndoManager().undo();
}
else {
try {
getResourceInput().init(null);
} catch (DatabaseException e) {
- throw new PartInitException("Failed to initialize " + input, e);
+ throw new PartInitException("Failed to initialize " + input, e); //$NON-NLS-1$
}
}
implements EditorAdapter {
public SCLModuleEditorAdapter() {
- super("SCL Module Editor", null, 20);
+ super(Messages.SCLModuleEditorAdapter_SCLModuleEditor, null, 20);
}
@Override
@Override
public void run() {
try {
- WorkbenchUtils.openEditor("org.simantics.scl.ui.editor2",
+ WorkbenchUtils.openEditor("org.simantics.scl.ui.editor2", //$NON-NLS-1$
new StandardSCLModuleEditorInput(uri));
} catch (PartInitException e) {
e.printStackTrace();
currentText = graph.getRelatedValue(resource, L0.SCLModule_definition, Bindings.STRING);
immutable = StructuralUtils.isImmutable(graph, resource);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
});
} catch (DatabaseException e) {
return;
String moduleName = graph.getURI(resource);
SCLContext context = SCLContext.getCurrent();
- context.put("graph", graph);
+ context.put("graph", graph); //$NON-NLS-1$
Failable<Module> result = SCLOsgi.MODULE_REPOSITORY.getModule(moduleName, listener);
if(result instanceof Failure) {
synchronized(annotationModel.getLockObject()) {
annotationModel.removeAllAnnotations();
for(CompilationError error : errors) {
- Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true,
+ Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, //$NON-NLS-1$
error.description);
int begin = Locations.beginOf(error.location);
int end = Locations.endOf(error.location);
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument");
+ TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
graph.markUndoPoint();
Layer0 L0 = Layer0.getInstance(graph);
graph.claimLiteral(resource, L0.SCLModule_definition, currentText, Bindings.STRING);
- Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Saved SCL Module " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
}
Section codeSection = tk.createSection(form.getBody(), Section.TITLE_BAR | Section.EXPANDED);
codeSection.setLayout(new FillLayout());
GridDataFactory.fillDefaults().align(SWT.FILL, SWT.FILL).grab(true, true).applyTo(codeSection);
- codeSection.setText("Code");
+ codeSection.setText(Messages.SCLModuleViewer_Code);
Composite codeSectionBody = tk.createComposite(codeSection);
GridLayoutFactory.fillDefaults().numColumns(1).applyTo(codeSectionBody);
GridDataFactory.fillDefaults().applyTo(codeButtons);
GridLayoutFactory.fillDefaults().applyTo(codeButtons);
- Button applyChanges = tk.createButton(codeButtons, "Apply changes", SWT.PUSH);
+ Button applyChanges = tk.createButton(codeButtons, Messages.SCLModuleViewer_ApplyChanges, SWT.PUSH);
code = new SCLTextEditorNew(codeSectionBody, 0);
try {
getResourceInput().init(null);
} catch (DatabaseException e) {
- throw new PartInitException("Failed to initialize " + input, e);
+ throw new PartInitException("Failed to initialize " + input, e); //$NON-NLS-1$
}
}
ModelingResources MOD = ModelingResources.getInstance(graph);
if(isType(graph)) {
Collection<Resource> assertions = graph.getAssertedObjects(resource, MOD.SCLQuery_values);
- if(assertions.size() != 1) throw new DatabaseException("No query text assertion defined in Query Type");
+ if(assertions.size() != 1) throw new DatabaseException("No query text assertion defined in Query Type"); //$NON-NLS-1$
Resource value = assertions.iterator().next();
currentText = graph.getRelatedValue(value, L0.SCLValue_expression, Bindings.STRING);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
} else {
Resource value = graph.getSingleObject(resource, MOD.SCLQuery_values);
currentText = graph.getRelatedValue(value, L0.SCLValue_expression, Bindings.STRING);
errorHappened = false;
- return new Document(currentText != null ? currentText : "");
+ return new Document(currentText != null ? currentText : ""); //$NON-NLS-1$
}
}
});
public void run(ReadGraph graph) throws DatabaseException {
String moduleName = graph.getURI(resource);
SCLContext context = SCLContext.getCurrent();
- context.put("graph", graph);
+ context.put("graph", graph); //$NON-NLS-1$
Failable<Module> result = SCLOsgi.MODULE_REPOSITORY.getModule(moduleName, listener);
if(result instanceof Failure) {
synchronized(annotationModel.getLockObject()) {
annotationModel.removeAllAnnotations();
for(CompilationError error : errors) {
- Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true,
+ Annotation annotation = new Annotation("org.eclipse.ui.workbench.texteditor.error", true, //$NON-NLS-1$
error.description);
int begin = Locations.beginOf(error.location);
int end = Locations.endOf(error.location);
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument");
+ TimeLogger.resetTimeAndLog("SCLModuleEditorDocumentProvider.doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
if(isType(graph)) {
Collection<Resource> assertions = graph.getAssertedObjects(resource, MOD.SCLQuery_values);
- if(assertions.size() > 1) throw new DatabaseException("Invalid query text assertions in Query Type");
+ if(assertions.size() > 1) throw new DatabaseException("Invalid query text assertions in Query Type"); //$NON-NLS-1$
if(assertions.size() == 1) return assertions.iterator().next();
Resource value = graph.newResource();
Layer0 L0 = Layer0.getInstance(graph);
Resource value = getValue(graph);
graph.claimLiteral(value, L0.SCLValue_expression, currentText, Bindings.STRING);
- Layer0Utils.addCommentMetadata(graph, "Saved SCL Query " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING));
+ Layer0Utils.addCommentMetadata(graph, "Saved SCL Query " + graph.getRelatedValue2(resource, Layer0.getInstance(graph).HasName, Bindings.STRING)); //$NON-NLS-1$
}
});
}
errorHappened = false;
return graph.getRelatedValue(text, L0.SCLValue_expression, Bindings.STRING);
}
- return "";
+ return ""; //$NON-NLS-1$
}
protected void updateAnnotations() {
@Override
public void exception(Throwable t) {
Activator.getDefault().getLog().log(
- new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Internal error in procedural user component code compilation.", t));
+ new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.SymbolCodeDocumentProvider2_ActivatorInternalErrorInCodeCompilation, t));
}
@Override
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument");
+ TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
ModelingResources MOD = ModelingResources.getInstance(graph);
Resource newValue = graph.newResource();
graph.claim(newValue, L0.InstanceOf, MOD.SCLValue);
- graph.claimLiteral(newValue, L0.HasValueType, "[String]", Bindings.STRING);
+ graph.claimLiteral(newValue, L0.HasValueType, "[String]", Bindings.STRING); //$NON-NLS-1$
graph.claimLiteral(newValue, L0.SCLValue_expression, currentText, Bindings.STRING);
Layer0Utils.assert_(graph, resource, DIA.symbolCode, newValue);
errorHappened = false;
return graph.getRelatedValue(text, L0.SCLValue_expression, Bindings.STRING);
}
- return "";
+ return ""; //$NON-NLS-1$
}
protected void updateAnnotations() {
@Override
public void exception(Throwable t) {
Activator.getDefault().getLog().log(
- new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Internal error in procedural user component code compilation.", t));
+ new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.SymbolDropHandlerDocumentProvider_ActivatorInternalError, t));
}
@Override
@Override
protected void doSaveDocument(IProgressMonitor monitor, Object element,
IDocument document, boolean overwrite) throws CoreException {
- TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument");
+ TimeLogger.resetTimeAndLog(getClass(), "doSaveDocument"); //$NON-NLS-1$
currentText = document.get();
Simantics.getSession().asyncRequest(new WriteRequest() {
@Override
ModelingResources MOD = ModelingResources.getInstance(graph);
Resource newValue = graph.newResource();
graph.claim(newValue, L0.InstanceOf, MOD.SCLValue);
- graph.claimLiteral(newValue, L0.HasValueType, "[WorkbenchSelectionElement] -> <WriteGraph,Proc> ()", Bindings.STRING);
+ graph.claimLiteral(newValue, L0.HasValueType, "[WorkbenchSelectionElement] -> <WriteGraph,Proc> ()", Bindings.STRING); //$NON-NLS-1$
graph.claimLiteral(newValue, L0.SCLValue_expression, currentText, Bindings.STRING);
Layer0Utils.assert_(graph, resource, DIA.symbolDropHandler, newValue);
--- /dev/null
+ComponentTypeEditor_UserComponentInterface=User Component Interface
+ComponentTypeScriptEditor_ExecuteAnalogAutomation=Execute together with analog automation
+ComponentTypeScriptEditor_ExecuteAtEachStep=Execute at each step
+ComponentTypeScriptEditor_ExecuteBinaryAutomation=Execute together with binary automation
+ComponentTypeScriptEditor_ExecuteDuringPreparation=Execute during preparation
+ComponentTypeViewer_OpenedInReadOnly=(Opened in read-only mode)
+ComponentTypeViewerData_ContainsInvalidCharacters=Property name ''{0}'' contains invalid characters, does not match pattern {1}.
+ComponentTypeViewerData_CtrlEnterApplyChanges=Ctrl+Enter to apply changes, ESC to cancel.
+ComponentTypeViewerData_ESCToClose=ESC to close.
+ComponentTypeViewerData_Exclusive=Exclusive
+ComponentTypeViewerData_Inclusive=Inclusive
+ComponentTypeViewerData_MaximumValue=Maximum Value:
+ComponentTypeViewerData_MinimumValue=Minimum Value:
+ComponentTypeViewerData_NameInUse=Name ''{0}'' is already used for a terminal.
+ComponentTypeViewerData_PropertyNameInUse=Property name ''{0}'' is already in use.
+ConfigurationPropertiesSection_AssignTypes=Assign Types
+ConfigurationPropertiesSection_ConfigurationProperties=Configuration properties
+ConfigurationPropertiesSection_DefaultValue=Default Value
+ConfigurationPropertiesSection_Description=Description
+ConfigurationPropertiesSection_Label=Label
+ConfigurationPropertiesSection_LiftProperties=Lift Properties
+ConfigurationPropertiesSection_Name=Name
+ConfigurationPropertiesSection_NewProperty=New property
+ConfigurationPropertiesSection_Range=Range
+ConfigurationPropertiesSection_RemoveProperty=Remove property
+ConfigurationPropertiesSection_SelectPropertiesToLift=Select properties to lift
+ConfigurationPropertiesSection_SelectUserTypesForProp=Select user types for property
+ConfigurationPropertiesSection_Type=Type
+ConfigurationPropertiesSection_Unit=Unit
+DerivedPropertiesSection_DerivedProperties=Derived properties
+DerivedPropertiesSection_Description=Description
+DerivedPropertiesSection_Expression=Expression
+DerivedPropertiesSection_ExpressionIsEmpty=Expression is empty.
+DerivedPropertiesSection_Label=Label
+DerivedPropertiesSection_Name=Name
+DerivedPropertiesSection_NewProperty=New property
+DerivedPropertiesSection_RemoveProperty=Remove property
+DerivedPropertiesSection_Type=Type
+DerivedPropertiesSection_Unit=Unit
+LiftPropertiesDialog_MapLiftedPropertiesIntoInterface=Map lifted properties into interface
+ProceduralComponentInstanceViewer_CouldnotCreateVariableForResource=Couldn't create variable for the resource.
+ProceduralComponentInstanceViewer_NoProceduralSubstructure=Component does not have a procedural substructure.
+ProceduralComponentInstanceViewerEditorAdapter_ProceduralComponentInstanceViewer=Procedural Component Instance Viewer
+ProceduralComponentTypeCodeDocumentProvider_ActivatorInternalErrorMsg=Internal error in procedural user component code compilation.
+ProceduralComponentTypeEditorNamingService_UnsupportedInput=Unsupported input: {0}
+SCLModuleEditorAdapter_SCLModuleEditor=SCL Module Editor
+SCLModuleViewer_ApplyChanges=Apply changes
+SCLModuleViewer_Code=Code
+SymbolCodeDocumentProvider2_ActivatorInternalErrorInCodeCompilation=Internal error in procedural user component code compilation.
+SymbolDropHandlerDocumentProvider_ActivatorInternalError=Internal error in procedural user component code compilation.
--- /dev/null
+package org.simantics.modeling.ui.diagram;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagram.messages"; //$NON-NLS-1$
+ public static String PageDescComposite_Landscape;
+ public static String PageDescComposite_MarginsMM;
+ public static String PageDescComposite_Orientation;
+ public static String PageDescComposite_Portrait;
+ public static String PageDescComposite_Size;
+ public static String PageSettingsDialog_Display;
+ public static String PageSettingsDialog_GridSizeMM;
+ public static String PageSettingsDialog_GridSnapping;
+ public static String PageSettingsDialog_PageSettings;
+ public static String PageSettingsDialog_PageSize;
+ public static String PageSettingsDialog_ShowMargins;
+ public static String PageSettingsDialog_ShowPageBorders;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public void setPageDesc(PageDesc desc) {
if (desc == null)
- throw new NullPointerException("null page desc");
+ throw new NullPointerException("null page desc"); //$NON-NLS-1$
this.desc = desc;
applyValuesToWidgets();
}
//parent.setBackground(parent.getDisplay().getSystemColor(SWT.COLOR_BLUE));
GridLayoutFactory.fillDefaults().numColumns(3).equalWidth(false).extendedMargins(12, 12, 12, 12).spacing(5, 4).applyTo(parent);
Label label = new Label(parent, 0);
- label.setText("Size:");
+ label.setText(Messages.PageDescComposite_Size);
combo = new Combo(parent, 0);
combo.addListener(SWT.Selection, new Listener() {
@Override
GridDataFactory.fillDefaults().grab(true, true).grab(true, true).align(SWT.CENTER, SWT.CENTER).span(1, 2).applyTo(marginComposite);
GridLayoutFactory.fillDefaults().numColumns(3).margins(5, 5).spacing(3, 3).applyTo(marginComposite);
label = new Label(marginComposite, 0);
- label.setText("Margins (mm)");
+ label.setText(Messages.PageDescComposite_MarginsMM);
GridDataFactory.fillDefaults().align(SWT.CENTER, SWT.TOP).span(3, 1).applyTo(label);
label = new Label(marginComposite, 0);
addMarginListeners();
label = new Label(parent, 0);
- label.setText("Orientation:");
+ label.setText(Messages.PageDescComposite_Orientation);
Composite comp = new Composite(parent, 0);
GridDataFactory.fillDefaults().span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(comp);
GridLayoutFactory.fillDefaults().numColumns(1).applyTo(comp);
portrait = new Button(comp, SWT.RADIO);
landscape = new Button(comp, SWT.RADIO);
- portrait.setText("Portrait");
- landscape.setText("Landscape");
+ portrait.setText(Messages.PageDescComposite_Portrait);
+ landscape.setText(Messages.PageDescComposite_Landscape);
Listener orientationListener = new Listener() {
@Override
@Override
protected void configureShell(Shell newShell) {
super.configureShell(newShell);
- newShell.setText("Page Settings");
+ newShell.setText(Messages.PageSettingsDialog_PageSettings);
}
@Override
Composite composite = (Composite) super.createDialogArea(parent);
Group group = new Group(composite, SWT.NONE);
- group.setText("Grid Snapping");
+ group.setText(Messages.PageSettingsDialog_GridSnapping);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(group);
Label label = new Label(group, SWT.NONE);
- label.setText("Grid size (mm)");
+ label.setText(Messages.PageSettingsDialog_GridSizeMM);
gridSizeText = new Text(group, SWT.SINGLE|SWT.BORDER);
GridLayoutFactory.fillDefaults().numColumns(2).equalWidth(false).extendedMargins(12, 12, 12, 12).spacing(5, 4).applyTo(group);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(gridSizeText);
Group pageGroup = new Group(composite, SWT.NONE);
- pageGroup.setText("Page size");
+ pageGroup.setText(Messages.PageSettingsDialog_PageSize);
pdc = new PageDescComposite(pageGroup, SWT.NONE);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(pageGroup);
GridLayoutFactory.fillDefaults().numColumns(1).equalWidth(false).extendedMargins(12, 12, 12, 12).spacing(5, 4).applyTo(pageGroup);
GridDataFactory.fillDefaults().grab(true, true).span(1, 1).applyTo(pdc);
Group displayGroup = new Group(composite, SWT.NONE);
- displayGroup.setText("Display");
+ displayGroup.setText(Messages.PageSettingsDialog_Display);
showBordersButton = new Button(displayGroup, SWT.CHECK);
- showBordersButton.setText("Show page borders");
+ showBordersButton.setText(Messages.PageSettingsDialog_ShowPageBorders);
showMarginsButton = new Button(displayGroup, SWT.CHECK);
- showMarginsButton.setText("Show margins");
+ showMarginsButton.setText(Messages.PageSettingsDialog_ShowMargins);
GridLayoutFactory.fillDefaults().numColumns(1).equalWidth(false).extendedMargins(12, 12, 12, 12).spacing(5, 4).applyTo(displayGroup);
GridDataFactory.fillDefaults().grab(true, false).span(1, 1).applyTo(displayGroup);
@Override
public void perform(WriteGraph graph) throws DatabaseException {
Resource model = graph.syncRequest(new IndexRoot(diagramResource));
- Commands.get(graph, "Simantics/PageSettings/setPageDesc")
+ Commands.get(graph, "Simantics/PageSettings/setPageDesc") //$NON-NLS-1$
.execute(graph, model, diagramResource, pageDesc.toRepr());
- Commands.get(graph, "Simantics/PageSettings/setGridSize")
+ Commands.get(graph, "Simantics/PageSettings/setGridSize") //$NON-NLS-1$
.execute(graph, model, diagramResource, gridSize);
- Commands.get(graph, "Simantics/PageSettings/setPageBordersVisible")
+ Commands.get(graph, "Simantics/PageSettings/setPageBordersVisible") //$NON-NLS-1$
.execute(graph, model, diagramResource, borders);
- Commands.get(graph, "Simantics/PageSettings/setMarginsVisible")
+ Commands.get(graph, "Simantics/PageSettings/setMarginsVisible") //$NON-NLS-1$
.execute(graph, model, diagramResource, margins);
}
});
*/
public class ResetProfileMonitorTransformContribution extends DynamicMenuContribution implements IExecutableExtension {
- String name = "";
+ String name = ""; //$NON-NLS-1$
ImageDescriptor image = null;
@Override
if (data instanceof Map<?,?>) {
@SuppressWarnings("unchecked")
Map<String, String> args = (Map<String, String>) data;
- name = args.get("name");
- String imageId = args.get("image");
+ name = args.get("name"); //$NON-NLS-1$
+ String imageId = args.get("image"); //$NON-NLS-1$
image = Activator.getDefault().getImageRegistry().getDescriptor(imageId);
}
}
Simantics.async(new WriteRequest() {
@Override
public void perform(WriteGraph graph) throws DatabaseException {
- Command cmd = Commands.get(graph, "Simantics/Profile/resetProfileMonitorPosition");
+ Command cmd = Commands.get(graph, "Simantics/Profile/resetProfileMonitorPosition"); //$NON-NLS-1$
Resource model = graph.syncRequest(new IndexRoot((Resource)elements[0]));
for(Object element : elements)
cmd.execute(graph, model, element);
*/
public class SetFocusabilityContribution extends DynamicMenuContribution implements IExecutableExtension {
- String name = "";
+ String name = ""; //$NON-NLS-1$
ImageDescriptor image = null;
boolean allow = true;
if (data instanceof Map<?,?>) {
@SuppressWarnings("unchecked")
Map<String, String> args = (Map<String, String>) data;
- name = args.get("name");
- String imageId = args.get("image");
+ name = args.get("name"); //$NON-NLS-1$
+ String imageId = args.get("image"); //$NON-NLS-1$
image = Activator.getDefault().getImageRegistry().getDescriptor(imageId);
- allow = Boolean.parseBoolean(args.get("allow"));
+ allow = Boolean.parseBoolean(args.get("allow")); //$NON-NLS-1$
}
}
* @author J-P Laine
*/
public class SliderClass {
- public static final Key KEY_SLIDER_RESOURCE_PATH = new KeyOf(Collection.class, "SLIDER_RESOURCE_PATH");
- public static final Key KEY_SLIDER_COMPONENT = new KeyOf(Object.class, "SLIDER_COMPONENT");
- public static final Key KEY_SLIDER_SUFFIX = new KeyOf(String.class, "SLIDER_SUFFIX");
- public static final Key KEY_SLIDER_RANGE = new KeyOf(Range.class, "SLIDER_SUBSTITUTIONS");
- public static final Key KEY_SLIDER_GC = new KeyOf(Graphics2D.class, "SLIDER_GC");
- public static final Key KEY_SLIDER_VALUE = new KeyOf(Double.class, "SLIDER_VALUE");
- public static final Key KEY_TOOLTIP_TEXT = new KeyOf(String.class, "TOOLTIP_TEXT");
- public static final Key KEY_NUMBER_FORMAT = new KeyOf(MetricsFormat.class, "NUMBER_FORMAT");
+ public static final Key KEY_SLIDER_RESOURCE_PATH = new KeyOf(Collection.class, "SLIDER_RESOURCE_PATH"); //$NON-NLS-1$
+ public static final Key KEY_SLIDER_COMPONENT = new KeyOf(Object.class, "SLIDER_COMPONENT"); //$NON-NLS-1$
+ public static final Key KEY_SLIDER_SUFFIX = new KeyOf(String.class, "SLIDER_SUFFIX"); //$NON-NLS-1$
+ public static final Key KEY_SLIDER_RANGE = new KeyOf(Range.class, "SLIDER_SUBSTITUTIONS"); //$NON-NLS-1$
+ public static final Key KEY_SLIDER_GC = new KeyOf(Graphics2D.class, "SLIDER_GC"); //$NON-NLS-1$
+ public static final Key KEY_SLIDER_VALUE = new KeyOf(Double.class, "SLIDER_VALUE"); //$NON-NLS-1$
+ public static final Key KEY_TOOLTIP_TEXT = new KeyOf(String.class, "TOOLTIP_TEXT"); //$NON-NLS-1$
+ public static final Key KEY_NUMBER_FORMAT = new KeyOf(MetricsFormat.class, "NUMBER_FORMAT"); //$NON-NLS-1$
/**
* If this hint is defined, the monitor will force its x-axis to match this
* angle. If this hint doesn't exist, the monitor will not force x-axis
* orientation.
*/
- public static final Key KEY_DIRECTION = new KeyOf(Double.class, "SLIDER_DIRECTION");
+ public static final Key KEY_DIRECTION = new KeyOf(Double.class, "SLIDER_DIRECTION"); //$NON-NLS-1$
- public static final Key KEY_SG_NODE = new SceneGraphNodeKey(Node.class, "SLIDER_SG_NODE");
+ public static final Key KEY_SG_NODE = new SceneGraphNodeKey(Node.class, "SLIDER_SG_NODE"); //$NON-NLS-1$
public final static MetricsFormat DEFAULT_NUMBER_FORMAT = MetricsFormatList.METRICS_DECIMAL;
public static class Range<T> {
@Override
public Node init(G2DParentNode parent) {
- SliderNode node = parent.getOrCreateNode(""+hashCode(), SliderNode.class);
+ SliderNode node = parent.getOrCreateNode(""+hashCode(), SliderNode.class); //$NON-NLS-1$
node.setValue(0);
node.setBounds(new Rectangle2D.Double(0, 0, 50, 22));
node.setTransform(AffineTransform.getScaleInstance(staticScaleX, staticScaleY));
*/
public class ToggleProfileMonitorsContribution extends DynamicMenuContribution implements IExecutableExtension {
- String name = "";
+ String name = ""; //$NON-NLS-1$
ImageDescriptor image = null;
boolean allow = true;
if (data instanceof Map<?,?>) {
@SuppressWarnings("unchecked")
Map<String, String> args = (Map<String, String>) data;
- name = args.get("name");
- String imageId = args.get("image");
+ name = args.get("name"); //$NON-NLS-1$
+ String imageId = args.get("image"); //$NON-NLS-1$
image = Activator.getDefault().getImageRegistry().getDescriptor(imageId);
- allow = Boolean.parseBoolean(args.get("allow"));
+ allow = Boolean.parseBoolean(args.get("allow")); //$NON-NLS-1$
}
}
@Override
public void perform(WriteGraph graph) throws DatabaseException {
- Command command = Commands.get(graph, "Simantics/Diagram/showProfileMonitors");
+ Command command = Commands.get(graph, "Simantics/Diagram/showProfileMonitors"); //$NON-NLS-1$
for(Object object : elements) {
Resource element = (Resource)object;
command.execute(graph, graph.syncRequest(new IndexRoot(element)), element, allow);
*/
public class UpDownProfileMonitorsContribution extends DynamicMenuContribution implements IExecutableExtension {
- String name = "";
+ String name = ""; //$NON-NLS-1$
ImageDescriptor image = null;
boolean allow = true;
if (data instanceof Map<?,?>) {
@SuppressWarnings("unchecked")
Map<String, String> args = (Map<String, String>) data;
- name = args.get("name");
- String imageId = args.get("image");
+ name = args.get("name"); //$NON-NLS-1$
+ String imageId = args.get("image"); //$NON-NLS-1$
image = Activator.getDefault().getImageRegistry().getDescriptor(imageId);
- allow = Boolean.parseBoolean(args.get("allow"));
+ allow = Boolean.parseBoolean(args.get("allow")); //$NON-NLS-1$
}
}
@Override
public void perform(WriteGraph graph) throws DatabaseException {
- Command command = Commands.get(graph, "Simantics/Diagram/setProfileMonitorsDirectionUp");
+ Command command = Commands.get(graph, "Simantics/Diagram/setProfileMonitorsDirectionUp"); //$NON-NLS-1$
for(Object object : elements) {
Resource element = (Resource)object;
command.execute(graph, graph.syncRequest(new IndexRoot(element)), element, allow);
static String valueStr(Object value_) {
if (value_ == null)
- return "<null>";
+ return "<null>"; //$NON-NLS-1$
//return valueStr(value_, "0.0###");
return valueStr(value_, MetricsFormatList.METRICS_GENERIC);
}
public static String valueStr(Object value_, MetricsFormat decimalFormat) {
if (value_ == null)
- return "<null>";
+ return "<null>"; //$NON-NLS-1$
Class<?> clazz = value_.getClass();
//System.out.println("FOO: " + clazz + ": " + value_);
boolean first = true;
for (double d : ds) {
if (!first)
- sb.append(", ");
+ sb.append(", "); //$NON-NLS-1$
else
first = false;
//sb.append(format.format(d));
boolean first = true;
for (float d : ds) {
if (!first)
- sb.append(", ");
+ sb.append(", "); //$NON-NLS-1$
else
first = false;
//sb.append(format.format(d));
--- /dev/null
+PageDescComposite_Landscape=Landscape\r
+PageDescComposite_MarginsMM=Margins (mm)\r
+PageDescComposite_Orientation=Orientation:\r
+PageDescComposite_Portrait=Portrait\r
+PageDescComposite_Size=Size:\r
+PageSettingsDialog_Display=Display\r
+PageSettingsDialog_GridSizeMM=Grid size (mm)\r
+PageSettingsDialog_GridSnapping=Grid Snapping\r
+PageSettingsDialog_PageSettings=Page Settings\r
+PageSettingsDialog_PageSize=Page size\r
+PageSettingsDialog_ShowMargins=Show margins\r
+PageSettingsDialog_ShowPageBorders=Show page borders\r
for (Resource template : result.values()) {
String label = graph.getPossibleRelatedAdapter(template, L0.HasLabel, String.class);
String format = graph.getPossibleRelatedValue(template, DIA.RealizedFormatter_HasDefinition, Bindings.STRING);
- keys[i] = "" + label + " (" + format + ")";
+ keys[i] = "" + label + " (" + format + ")"; //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
values[i] = template;
++i;
}
Layer0X L0X = Layer0X.getInstance(graph);
String exp = graph.getPossibleRelatedAdapter(monitor, L0X.HasExpression, String.class);
- return exp != null ? exp : "value";
+ return exp != null ? exp : "value"; //$NON-NLS-1$
}
--- /dev/null
+package org.simantics.modeling.ui.diagram.monitor;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagram.monitor.messages"; //$NON-NLS-1$
+ public static String MonitorComposite_Alignment;
+ public static String MonitorComposite_CenterAlignment;
+ public static String MonitorComposite_Color;
+ public static String MonitorComposite_FontFamily;
+ public static String MonitorComposite_FontSize;
+ public static String MonitorComposite_Formatting;
+ public static String MonitorComposite_LeftAlignment;
+ public static String MonitorComposite_ResetLocalChanges;
+ public static String MonitorComposite_RightAlignment;
+ public static String MonitorComposite_SetAsDefault;
+ public static String MonitorComposite_SetAsDefaultForNewlyCreatedMonitors;
+ public static String MonitorComposite_SetMonitorColor;
+ public static String MonitorComposite_Template;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
public class MonitorClassFactory2 extends SyncElementFactory {
private static final Key KEY_VARIABLE_LISTENER = new KeyOf(MonitorListener.class,
- "MONITOR_VARIABLE_LISTENER");
+ "MONITOR_VARIABLE_LISTENER"); //$NON-NLS-1$
- private static final String CLASS_ID = "Monitor";
+ private static final String CLASS_ID = "Monitor"; //$NON-NLS-1$
private static final IHintSynchronizer HINT_SYNCHRONIZER = new CompositeHintSynchronizer(
MonitorSynchronizer.INSTANCE,
loadParentRelationships(graph, element, e);
final Map<String, String> substitutions = new HashMap<String, String>();
- substitutions.put("#v1", "");
+ substitutions.put("#v1", ""); //$NON-NLS-1$ //$NON-NLS-2$
final Resource diagramRuntime = diagram.getHint(DiagramModelHints.KEY_DIAGRAM_RUNTIME_RESOURCE);
if (diagramRuntime != null) {
public class MonitorComposite extends ConfigurationComposite {
- private static final String DATA_CURRENT_COLOR = "COLOR";
+ private static final String DATA_CURRENT_COLOR = "COLOR"; //$NON-NLS-1$
public void create(final Composite body, IWorkbenchSite site, final ISessionContext context, final WidgetSupport support) {
final Display display = body.getDisplay();
support.setParameter(WidgetSupport.RESOURCE_MANAGER, resourceManager);
Label templateHeader = new Label(buttonComposite, support, 0);
- templateHeader.setText("Template");
+ templateHeader.setText(Messages.MonitorComposite_Template);
//templateHeader.setFont(smallFont);
templateHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(templateHeader.getWidget());
GridDataFactory.fillDefaults().grab(true, false).applyTo(templateCombo.getWidget());
Button setDefaultButton = new Button(buttonComposite, support, SWT.NONE | SWT.READ_ONLY);
- setDefaultButton.setText("Set As Default");
- setDefaultButton.setTooltipText("Set As Default for Newly Created Monitors");
+ setDefaultButton.setText(Messages.MonitorComposite_SetAsDefault);
+ setDefaultButton.setTooltipText(Messages.MonitorComposite_SetAsDefaultForNewlyCreatedMonitors);
setDefaultButton.addSelectionListener(new SelectionListenerImpl<Resource>(context) {
@Override
public void apply(WriteGraph graph, Resource monitor) throws DatabaseException {
GridDataFactory.fillDefaults().grab(false, false).applyTo(setDefaultButton.getWidget());
Button resetButton = new Button(buttonComposite, support, SWT.NONE | SWT.READ_ONLY);
- resetButton.setText("Reset Local Changes");
+ resetButton.setText(Messages.MonitorComposite_ResetLocalChanges);
resetButton.addSelectionListener(new SelectionListenerImpl<Resource>(context) {
@Override
public void apply(WriteGraph graph, Resource monitor) throws DatabaseException {
GridDataFactory.fillDefaults().grab(false, false).applyTo(resetButton.getWidget());
Label fontHeader = new Label(buttonComposite, support, 0);
- fontHeader.setText("Font Family");
+ fontHeader.setText(Messages.MonitorComposite_FontFamily);
//fontHeader.setFont(smallFont);
fontHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(fontHeader.getWidget());
GridDataFactory.fillDefaults().grab(true, false).span(3,1).applyTo(fontCombo.getWidget());
Label sizeHeader = new Label(buttonComposite, support, 0);
- sizeHeader.setText("Font Size");
+ sizeHeader.setText(Messages.MonitorComposite_FontSize);
//sizeHeader.setFont(smallFont);
sizeHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(sizeHeader.getWidget());
GridDataFactory.fillDefaults().grab(false, false).span(3,1).minSize(50, 0).applyTo(sizeCombo.getWidget());
Label formatterHeader = new Label(buttonComposite, support, 0);
- formatterHeader.setText("Formatting");
+ formatterHeader.setText(Messages.MonitorComposite_Formatting);
//formatterHeader.setFont(smallFont);
formatterHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(formatterHeader.getWidget());
GridLayoutFactory.fillDefaults().equalWidth(false).numColumns(4).extendedMargins(5,5,5,5).applyTo(rowComposite);
Label alignHeader = new Label(rowComposite, support, 0);
- alignHeader.setText("Alignment");
+ alignHeader.setText(Messages.MonitorComposite_Alignment);
//alignHeader.setFont(smallFont);
alignHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(alignHeader.getWidget());
- Bundle iconBundle = Platform.getBundle("com.famfamfam.silk");
+ Bundle iconBundle = Platform.getBundle("com.famfamfam.silk"); //$NON-NLS-1$
Composite alignComposite = new Composite(rowComposite, SWT.NONE);
alignComposite.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridLayoutFactory.fillDefaults().equalWidth(false).numColumns(4).extendedMargins(5,5,5,5).applyTo(alignComposite);
Button leadButton = new Button(alignComposite, support, SWT.TOGGLE);
- leadButton.setTooltipText("Left Alignment");
- leadButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_left.png")));
+ leadButton.setTooltipText(Messages.MonitorComposite_LeftAlignment);
+ leadButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_left.png"))); //$NON-NLS-1$
leadButton.setSelectionFactory(new AlignmentSelectedFactory(G2DResource.URIs.Alignment_Leading));
leadButton.addSelectionListener(new AlignmentSelectionListener(context, G2DResource.URIs.Alignment_Leading));
Button centerButton = new Button(alignComposite, support, SWT.TOGGLE);
- centerButton.setTooltipText("Center Alignment");
- centerButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_center.png")));
+ centerButton.setTooltipText(Messages.MonitorComposite_CenterAlignment);
+ centerButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_center.png"))); //$NON-NLS-1$
centerButton.setSelectionFactory(new AlignmentSelectedFactory(G2DResource.URIs.Alignment_Center));
centerButton.addSelectionListener(new AlignmentSelectionListener(context, G2DResource.URIs.Alignment_Center));
Button trailButton = new Button(alignComposite, support, SWT.TOGGLE);
- trailButton.setTooltipText("Right Alignment");
- trailButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_right.png")));
+ trailButton.setTooltipText(Messages.MonitorComposite_RightAlignment);
+ trailButton.setImage((Image) resourceManager.get(BundleUtils.getImageDescriptorFromBundle(iconBundle, "icons/text_align_right.png"))); //$NON-NLS-1$
trailButton.setSelectionFactory(new AlignmentSelectedFactory(G2DResource.URIs.Alignment_Trailing));
trailButton.addSelectionListener(new AlignmentSelectionListener(context, G2DResource.URIs.Alignment_Trailing));
Label colorHeader = new Label(rowComposite, support, 0);
- colorHeader.setText("Color");
+ colorHeader.setText(Messages.MonitorComposite_Color);
colorHeader.setBackground(display.getSystemColor(SWT.COLOR_WHITE));
GridDataFactory.fillDefaults().indent(20, 0).grab(false, false).span(1, 1).align(SWT.LEFT, SWT.CENTER).applyTo(colorHeader.getWidget());
final Resource[] resources = ResourceAdaptionUtils.toResources(input);
if (resources.length != 0) {
ColorDialog dialog = new ColorDialog(WorkbenchUtils.getActiveWorkbenchWindowShell(), SWT.NONE);
- dialog.setText("Set Monitor Color");
+ dialog.setText(Messages.MonitorComposite_SetMonitorColor);
Color oldColor = (Color) control.getData(DATA_CURRENT_COLOR);
if (oldColor != null) {
RGB oldRgb = Colors.rgb(oldColor);
graph.claimLiteral(realizedColor, DIA.RealizedColor_HasRGB, L0.DoubleArray, color, Bindings.DOUBLE_ARRAY);
}
CommentMetadata cm = graph.getMetadata(CommentMetadata.class);
- graph.addMetadata(cm.add("Set color to " + rgb + " for resources " + Arrays.toString(resources)));
+ graph.addMetadata(cm.add("Set color to " + rgb + " for resources " + Arrays.toString(resources))); //$NON-NLS-1$ //$NON-NLS-2$
}
});
} catch (DatabaseException e) {
}
public void outAConstantValue(AConstantValue node) {
- if(DEBUG) System.out.println("outAConstantValue " + node);
+ if(DEBUG) System.out.println("outAConstantValue " + node); //$NON-NLS-1$
stack.push(Double.valueOf(node.toString()));
}
public void outAStringValue(AStringValue node) {
- if(DEBUG) System.out.println("outAStringValue " + node);
+ if(DEBUG) System.out.println("outAStringValue " + node); //$NON-NLS-1$
String value = node.toString();
stack.push(value.substring(1, value.length() - 2));
}
public void outAAddressValue(AAddressValue node) {
- if(DEBUG) System.out.println("outAAddressValue " + node);
+ if(DEBUG) System.out.println("outAAddressValue " + node); //$NON-NLS-1$
stack.push('&' + node.getRange().toString());
}
@Override
public void outASingleRange(ASingleRange node) {
- if(DEBUG) System.out.println("outASingleRange " + node);
+ if(DEBUG) System.out.println("outASingleRange " + node); //$NON-NLS-1$
}
@Override
public void outARviValue(ARviValue node) {
- if(DEBUG) System.out.println("outARviValue " + node);
+ if(DEBUG) System.out.println("outARviValue " + node); //$NON-NLS-1$
String rvi = node.toString().trim();
stack.push(format(var.getValue(graph)));
} catch (DatabaseException e) {
Logger.defaultLogError(e);
- stack.push("<No value for '" + rvi + "'>");
+ stack.push("<No value for '" + rvi + "'>"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
@Override
public void outAVariablePrimary(AVariablePrimary node) {
- if(DEBUG) System.out.println("outAVariablePrimary " + node);
+ if(DEBUG) System.out.println("outAVariablePrimary " + node); //$NON-NLS-1$
String identifier = node.toString().trim();
- if("value".equals(identifier)) {
+ if("value".equals(identifier)) { //$NON-NLS-1$
try {
stack.push(format(variable.getValue(graph)));
} catch (DatabaseException e) {
public void outARangeValue(ARangeValue node) {
- if(DEBUG) System.out.println("outARangeValue " + node);
+ if(DEBUG) System.out.println("outARangeValue " + node); //$NON-NLS-1$
String identifier = node.getRange().toString().trim();
stack.push(identifier);
private String format(Object o) {
if(formatter != null)
return formatter.format(o);
- else return o != null ? o.toString() : "";
+ else return o != null ? o.toString() : ""; //$NON-NLS-1$
}
private double extractValue(Object o) {
public void outAPlusExpression(APlusExpression node) {
- if(DEBUG) System.out.println("outAPlusExpression " + node);
+ if(DEBUG) System.out.println("outAPlusExpression " + node); //$NON-NLS-1$
Object o2 = stack.pop();
Object o1 = stack.pop();
public void outAMultMultiplicative(AMultMultiplicative node) {
- if(DEBUG) System.out.println("outAMultiplicative " + node);
+ if(DEBUG) System.out.println("outAMultiplicative " + node); //$NON-NLS-1$
Object o1 = stack.pop();
Object o2 = stack.pop();
public void outAFunctionPrimary(AFunctionPrimary node) {
- if(DEBUG) System.out.println("outAFunctionPrimary " + node);
+ if(DEBUG) System.out.println("outAFunctionPrimary " + node); //$NON-NLS-1$
try {
- String functionName = node.getFunc().getText().replace("(", "");
+ String functionName = node.getFunc().getText().replace("(", ""); //$NON-NLS-1$ //$NON-NLS-2$
if (DEBUG_APPLICATION)
- System.out.println("function apply " + functionName);
+ System.out.println("function apply " + functionName); //$NON-NLS-1$
Function function = builtins.get(functionName);
if (function != null) {
} else {
//stack.push(null);
- throw new EvaluationException("Function not found in dependencies: '" + functionName + "'");
+ throw new EvaluationException("Function not found in dependencies: '" + functionName + "'"); //$NON-NLS-1$ //$NON-NLS-2$
}
public MonitorListener(Resource element, ICanvasContext canvas, IDiagram diagram, Map<String, String> substitutions) {
if (element == null)
- throw new NullPointerException("null element");
+ throw new NullPointerException("null element"); //$NON-NLS-1$
if (canvas == null)
- throw new NullPointerException("null canvas");
+ throw new NullPointerException("null canvas"); //$NON-NLS-1$
if (diagram == null)
- throw new NullPointerException("null diagram");
+ throw new NullPointerException("null diagram"); //$NON-NLS-1$
if (substitutions == null)
- throw new NullPointerException("null substitutions");
+ throw new NullPointerException("null substitutions"); //$NON-NLS-1$
this.element = element;
this.canvas = canvas;
this.diagram = diagram;
// finished.
MonitorVariableValue result = lastScheduledUpdate.getAndSet(null);
- String value = "<no variable>";
+ String value = "<no variable>"; //$NON-NLS-1$
if (result != null) {
if (result.getValue() != null) {
value = result.getValue();//ValueFormatUtil.valueStr(result.getValue(), format);
} else {
- value = "<no value>";
+ value = "<no value>"; //$NON-NLS-1$
}
el.setHint(MonitorClass.KEY_MONITOR_COMPONENT, result.getMonitorVariable().getMonitorComponent());
ElementUtils.setOrRemoveHint(el, MonitorClass.KEY_MONITOR_IS_EXTERNAL, result.getMonitorVariable().isExternal());
el.removeHint(MonitorClass.KEY_MONITOR_IS_EXTERNAL);
}
- substitutions.put("#v1", value);
+ substitutions.put("#v1", value); //$NON-NLS-1$
final Map<String, String> subs = el.getHint(MonitorClass.KEY_MONITOR_SUBSTITUTIONS);
if (substitutions != subs)
Object result = visitor.getResult();
if (result instanceof Throwable)
return ((Throwable) result).getLocalizedMessage();
- return result != null ? result.toString() : "null";
+ return result != null ? result.toString() : "null"; //$NON-NLS-1$
} catch (ExpressionException e) {
ErrorLogger.defaultLogError(e);
return e.getMessage();
// Add a comment to metadata.
CommentMetadata cm = graph.getMetadata(CommentMetadata.class);
- graph.addMetadata(cm.add("Set value " + ObjectUtils.toString(label)));
+ graph.addMetadata(cm.add("Set value " + ObjectUtils.toString(label))); //$NON-NLS-1$
} else {
new VariableWriteImplied(variable, label).perform(graph);
}
Resource monitorComponent = element.getHint(MonitorClass.KEY_MONITOR_COMPONENT);
if (monitorComponent == null)
- throw new IllegalArgumentException("KEY_MONITOR_COMPONENT hint not set");
+ throw new IllegalArgumentException("KEY_MONITOR_COMPONENT hint not set"); //$NON-NLS-1$
Layer0 L0 = Layer0.getInstance(g);
Layer0X L0X = Layer0X.getInstance(g);
}
}
- String label = "";
+ String label = ""; //$NON-NLS-1$
g.claimLiteral(elementResource, L0.HasLabel, label);
Double ddir = element.getHint(MonitorClass.KEY_DIRECTION);
case TRAILING: return g2d.Alignment_Trailing;
case CENTER: return g2d.Alignment_Center;
default:
- throw new IllegalArgumentException("unsupported alignment: " + alignment);
+ throw new IllegalArgumentException("unsupported alignment: " + alignment); //$NON-NLS-1$
}
}
String definition = graph.getRelatedValue(formatter, DIA.RealizedFormatter_HasDefinition, Bindings.STRING);
final String label = graph.getPossibleRelatedAdapter(formatter, L0.HasLabel, String.class);
final DecimalFormat format = new DecimalFormat(definition, DecimalFormatSymbols.getInstance(Locale.US));
- final String toString = label + " (" + definition + ")";
+ final String toString = label + " (" + definition + ")"; //$NON-NLS-1$ //$NON-NLS-2$
return new Formatter() {
private String formatNumber(Number v) {
double dv = v.doubleValue();
if (Double.isInfinite(dv)) {
- return (dv == Double.POSITIVE_INFINITY) ? "\u221E" : "-\u221E";
+ return (dv == Double.POSITIVE_INFINITY) ? "\u221E" : "-\u221E"; //$NON-NLS-1$ //$NON-NLS-2$
} else if (Double.isNaN(dv)) {
- return "NaN";
+ return "NaN"; //$NON-NLS-1$
} else {
return format.format(v);
}
return (String)object;
}
} else {
- return object != null ? object.toString() : "";
+ return object != null ? object.toString() : ""; //$NON-NLS-1$
}
}
Layer0X L0X = Layer0X.getInstance(graph);
String _expression = graph.getPossibleRelatedAdapter(parameter2, L0X.HasExpression, String.class);
- if(_expression == null) _expression = "value";
+ if(_expression == null) _expression = "value"; //$NON-NLS-1$
RVI rvi = null;
try {
--- /dev/null
+MonitorComposite_Alignment=Alignment\r
+MonitorComposite_CenterAlignment=Center Alignment\r
+MonitorComposite_Color=Color\r
+MonitorComposite_FontFamily=Font Family\r
+MonitorComposite_FontSize=Font Size\r
+MonitorComposite_Formatting=Formatting\r
+MonitorComposite_LeftAlignment=Left Alignment\r
+MonitorComposite_ResetLocalChanges=Reset Local Changes\r
+MonitorComposite_RightAlignment=Right Alignment\r
+MonitorComposite_SetAsDefault=Set As Default\r
+MonitorComposite_SetAsDefaultForNewlyCreatedMonitors=Set As Default for Newly Created Monitors\r
+MonitorComposite_SetMonitorColor=Set Monitor Color\r
+MonitorComposite_Template=Template\r
@Override
protected Control createDialogArea(Composite parent) {
- getShell().setText("Rename diagram contents");
+ getShell().setText(Messages.ComponentsRenamingDialog_RenameDiagramContents);
getShell().setLayout(new GridLayout());
Composite composite = new Composite(parent, SWT.NONE);
composite.setLayoutData(new GridData(GridData.FILL_BOTH));
GridLayoutFactory.fillDefaults().numColumns(2).margins(5, 5).applyTo(area);
oldNamePrefixLabel = new Label(area, SWT.NONE);
- oldNamePrefixLabel.setText("Old name prefix:");
+ oldNamePrefixLabel.setText(Messages.ComponentsRenamingDialog_OldNamePrefix);
oldNamePrefix = new Text(area, SWT.READ_ONLY | SWT.BORDER);
oldNamePrefix.setEditable(false);
GridDataFactory.fillDefaults().grab(true, false).applyTo(oldNamePrefix);
Label newNamePrefixLabel = new Label(area, SWT.NONE);
- newNamePrefixLabel.setText("&New name prefix:");
+ newNamePrefixLabel.setText(Messages.ComponentsRenamingDialog_NewNamePrefixAnd);
newNamePrefix = new Text(area, SWT.BORDER);
newNamePrefix.setText(model.oldNamePrefix);
// Reset
final Button resetNames = new Button(composite, SWT.CHECK);
- resetNames.setText("&Reset names");
+ resetNames.setText(Messages.ComponentsRenamingDialog_ResetNamesAnd);
resetNames.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
});
TableViewerColumn oldNameColumn = new TableViewerColumn(tableViewer, SWT.NONE);
- oldNameColumn.getColumn().setText("Old name");
+ oldNameColumn.getColumn().setText(Messages.ComponentsRenamingDialog_OldName);
oldNameColumn.getColumn().setWidth(250);
oldNameColumn.setLabelProvider(new ColumnLabelProvider() {
@Override
});
TableViewerColumn newNameColumn = new TableViewerColumn(tableViewer, SWT.NONE);
- newNameColumn.getColumn().setText("New name");
+ newNameColumn.getColumn().setText(Messages.ComponentsRenamingDialog_NewName);
newNameColumn.getColumn().setWidth(250);
newNameColumn.setLabelProvider(new ColumnLabelProvider() {
@Override
GridDataFactory.fillDefaults().grab(true, false).span(3, 1).applyTo(bar);
bar.setLayout(new RowLayout());
Button selectAll = new Button(bar, SWT.PUSH);
- selectAll.setText("Select &All");
+ selectAll.setText(Messages.ComponentsRenamingDialog_SelectAllAnd);
selectAll.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
}
});
Button clearSelection = new Button(bar, SWT.PUSH);
- clearSelection.setText("&Clear Selection");
+ clearSelection.setText(Messages.ComponentsRenamingDialog_ClearSelectionAnd);
clearSelection.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
shell.open();
ComponentsRenamingModel model = new ComponentsRenamingModel();
- model.oldNamePrefix = "FOO";
- model.newNamePrefix = "FOO";
+ model.oldNamePrefix = "FOO"; //$NON-NLS-1$
+ model.newNamePrefix = "FOO"; //$NON-NLS-1$
for(int i=0;i<100;++i)
- model.entries.add(new NameEntry(null, "FOO"+(i*5), "FOO"+(i*5), "PREFIX"));
+ model.entries.add(new NameEntry(null, "FOO"+(i*5), "FOO"+(i*5), "PREFIX")); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
ComponentsRenamingDialog dialog = new ComponentsRenamingDialog(shell, model);
dialog.open();
Resource componentType = g.getPossibleType(component, STR.Component);
String componentTypePrefix = componentType != null
? g.<String>getPossibleRelatedValue(componentType, L0X.HasGeneratedNamePrefix, Bindings.STRING)
- : "";
+ : ""; //$NON-NLS-1$
entries.add(new NameEntry(component, name, name, componentTypePrefix));
}
Collections.sort(entries);
}
});
} catch (DatabaseException e) {
- Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "validateNewNames failed, see exception for details", e));
+ Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "validateNewNames failed, see exception for details", e)); //$NON-NLS-1$
}
} else {
if (reset) {
--- /dev/null
+package org.simantics.modeling.ui.diagram.renaming;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagram.renaming.messages"; //$NON-NLS-1$
+ public static String ComponentsRenamingDialog_ClearSelectionAnd;
+ public static String ComponentsRenamingDialog_NewName;
+ public static String ComponentsRenamingDialog_NewNamePrefixAnd;
+ public static String ComponentsRenamingDialog_OldName;
+ public static String ComponentsRenamingDialog_OldNamePrefix;
+ public static String ComponentsRenamingDialog_RenameDiagramContents;
+ public static String ComponentsRenamingDialog_ResetNamesAnd;
+ public static String ComponentsRenamingDialog_SelectAllAnd;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
--- /dev/null
+ComponentsRenamingDialog_ClearSelectionAnd=&Clear Selection\r
+ComponentsRenamingDialog_NewName=New name\r
+ComponentsRenamingDialog_NewNamePrefixAnd=&New name prefix:\r
+ComponentsRenamingDialog_OldName=Old name\r
+ComponentsRenamingDialog_OldNamePrefix=Old name prefix:\r
+ComponentsRenamingDialog_RenameDiagramContents=Rename diagram contents\r
+ComponentsRenamingDialog_ResetNamesAnd=&Reset names\r
+ComponentsRenamingDialog_SelectAllAnd=Select &All\r
}
}
- protected static final String PARENT_NODE_NAME_PREFIX = "_tNames";
- protected static final String NODE_NAME_PREFIX = "_";
+ protected static final String PARENT_NODE_NAME_PREFIX = "_tNames"; //$NON-NLS-1$
+ protected static final String NODE_NAME_PREFIX = "_"; //$NON-NLS-1$
- protected static final Font FONT = Font.decode("Arial 6");
+ protected static final Font FONT = Font.decode("Arial 6"); //$NON-NLS-1$
protected static final double DEFAULT_SCALE = 0.05;
if (count < 2)
return;
- G2DParentNode parentNode = ProfileVariables.claimChild(_node, "", PARENT_NODE_NAME_PREFIX, G2DParentNode.class, observer);
+ G2DParentNode parentNode = ProfileVariables.claimChild(_node, "", PARENT_NODE_NAME_PREFIX, G2DParentNode.class, observer); //$NON-NLS-1$
parentNode.setTransform(resultList.get(0).getTransform());
parentNode.setZIndex(Integer.MAX_VALUE >> 1);
for (int i = 1; i < count; ++i) {
Result result = resultList.get(i);
- TextNode node = ProfileVariables.claimChild(parentNode, "", NODE_NAME_PREFIX + i, TextNode.class, observer);
+ TextNode node = ProfileVariables.claimChild(parentNode, "", NODE_NAME_PREFIX + i, TextNode.class, observer); //$NON-NLS-1$
node.setZIndex(i);
node.setBackgroundColor(backgroundColor);
node.setColor(textColor);
@Override
protected void cleanupStyleForNode(INode node) {
if (node instanceof SingleElementNode) {
- ProfileVariables.denyChild(node, "", PARENT_NODE_NAME_PREFIX);
+ ProfileVariables.denyChild(node, "", PARENT_NODE_NAME_PREFIX); //$NON-NLS-1$
}
}
*/
public class DocumentDecorationStyle extends StyleBase<DocumentResult> {
- private static final String DECORATION_NODE_NAME = "documentDecorations";
+ private static final String DECORATION_NODE_NAME = "documentDecorations"; //$NON-NLS-1$
private Set<Resource> getContexts(ReadGraph graph, Resource element) throws DatabaseException {
@Override
public void applyStyleForNode(EvaluationContext observer, INode node, DocumentResult result) {
if (result == null) {
- ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME);
+ ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME); //$NON-NLS-1$
return;
}
- SVGNode svgNode = ProfileVariables.claimChild(node, "", DECORATION_NODE_NAME, DecorationSVGNode.class, observer);
+ SVGNode svgNode = ProfileVariables.claimChild(node, "", DECORATION_NODE_NAME, DecorationSVGNode.class, observer); //$NON-NLS-1$
Rectangle2D bounds = NodeUtil.getLocalBounds(node, Decoration.class);
@Override
protected void cleanupStyleForNode(INode node) {
- ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME);
+ ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME); //$NON-NLS-1$
}
@Override
public String toString() {
- return "Document decoration";
+ return "Document decoration"; //$NON-NLS-1$
}
}
*/
public class IssueDecorationStyle extends StyleBase<IssueResult> {
- private static final String DECORATION_NODE_NAME = "issueDecorations";
+ private static final String DECORATION_NODE_NAME = "issueDecorations"; //$NON-NLS-1$
private List<Resource> getContexts(ReadGraph graph, Resource element) throws DatabaseException {
@Override
public void applyStyleForNode(EvaluationContext observer, INode node, IssueResult result) {
if (result == null) {
- ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME);
+ ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME); //$NON-NLS-1$
return;
}
- SVGNode svgNode = ProfileVariables.claimChild(node, "", DECORATION_NODE_NAME, DecorationSVGNode.class, observer);
+ SVGNode svgNode = ProfileVariables.claimChild(node, "", DECORATION_NODE_NAME, DecorationSVGNode.class, observer); //$NON-NLS-1$
svgNode.setZIndex( Integer.MAX_VALUE );
svgNode.setTransform(getDecorationPosition(node));
@Override
protected void cleanupStyleForNode(INode node) {
- ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME);
+ ProfileVariables.denyChild(node, "", DECORATION_NODE_NAME); //$NON-NLS-1$
}
@Override
public String toString() {
- return "Issue decoration";
+ return "Issue decoration"; //$NON-NLS-1$
}
/**
*/
public class SymbolTerminalNameStyle extends StyleBase<SymbolNameResult> {
- static final Font FONT = Font.decode("Arial 6");
+ static final Font FONT = Font.decode("Arial 6"); //$NON-NLS-1$
- private static final String NODE_NAME = "terminalName";
+ private static final String NODE_NAME = "terminalName"; //$NON-NLS-1$
/**
* Must override the StyleBase implementation because terminals do not
private AffineTransform getSymbolTransform(INode node, Vec2d offset, double size) {
if(node instanceof SingleElementNode) {
SingleElementNode s = (SingleElementNode)node;
- INode symbol = NodeUtil.findChildByPrefix(s, "composite_image");
+ INode symbol = NodeUtil.findChildByPrefix(s, "composite_image"); //$NON-NLS-1$
return translateAndScaleIfNeeded(symbol != null ? ((IG2DNode)symbol).getTransform() : new AffineTransform(), offset, size);
}
return null;
public void applyStyleForNode(EvaluationContext observer, INode _node, SymbolNameResult result) {
if (result == null) {
- ProfileVariables.denyChild(_node, "", NODE_NAME);
+ ProfileVariables.denyChild(_node, "", NODE_NAME); //$NON-NLS-1$
return;
}
- TextNode node = ProfileVariables.claimChild(_node, "", NODE_NAME, TextNode.class, observer);
+ TextNode node = ProfileVariables.claimChild(_node, "", NODE_NAME, TextNode.class, observer); //$NON-NLS-1$
node.setZIndex( Integer.MAX_VALUE );
node.setTransform( getSymbolTransform(_node, new Vec2d(0, -1), 0.08) );
@Override
protected void cleanupStyleForNode(INode node) {
- ProfileVariables.denyChild(node, "", NODE_NAME);
+ ProfileVariables.denyChild(node, "", NODE_NAME); //$NON-NLS-1$
}
}
ShapeNode node = null;
if (_node instanceof ParentNode<?>) {
- node = ProfileVariables.claimChild(_node, "", "typical", DecorationShapeNode.class, context);
+ node = ProfileVariables.claimChild(_node, "", "typical", DecorationShapeNode.class, context); //$NON-NLS-1$ //$NON-NLS-2$
} else {
// Ignore, cannot create decoration.
return;
@Override
protected void cleanupStyleForNode(EvaluationContext context, INode node) {
- ProfileVariables.denyChild(node, "*", "typical");
- ProfileVariables.denyChild(node, "", "typical");
+ ProfileVariables.denyChild(node, "*", "typical"); //$NON-NLS-1$ //$NON-NLS-2$
+ ProfileVariables.denyChild(node, "", "typical"); //$NON-NLS-1$ //$NON-NLS-2$
}
}
public String getName(ReadGraph graph, TerminalInfo info) throws DatabaseException {
Terminal t = graph.syncRequest(new ResolveTerminal(info));
if (t == null)
- return "Could not resolve component terminal";
+ return "Could not resolve component terminal"; //$NON-NLS-1$
return graph.syncRequest(new TerminalMessage(t));
}
if (name.equals(label)) {
sb.append(name);
} else {
- sb.append("(").append(name).append(") ").append(label);
+ sb.append("(").append(name).append(") ").append(label); //$NON-NLS-1$ //$NON-NLS-2$
}
- sb.append(" [").append(componentName);
+ sb.append(" [").append(componentName); //$NON-NLS-1$
if (componentTypeName != null)
- sb.append(" : ").append(componentTypeName);
- sb.append("]");
+ sb.append(" : ").append(componentTypeName); //$NON-NLS-1$
+ sb.append("]"); //$NON-NLS-1$
return sb.toString();
}
import org.eclipse.core.runtime.IExecutableExtension;
import org.eclipse.core.runtime.IProgressMonitor;
import org.eclipse.core.runtime.Platform;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.widgets.Composite;
import org.eclipse.ui.IEditorInput;
*
* @see #setInitializationData(IConfigurationElement, String, Object)
*/
- public static final String ARG_VIEWER = "viewer";
+ public static final String ARG_VIEWER = "viewer"; //$NON-NLS-1$
private Composite parent;
if (data instanceof String) {
viewerContributor = cfig.getContributor().getName();
- String[] parameters = ((String) data).split(";");
+ String[] parameters = ((String) data).split(";"); //$NON-NLS-1$
for (String parameter : parameters) {
- String[] keyValue = parameter.split("=");
+ String[] keyValue = parameter.split("="); //$NON-NLS-1$
if (keyValue.length > 2) {
- ErrorLogger.defaultLogWarning("Invalid parameter '" + parameter + ". Complete view argument: " + data, null);
+ ErrorLogger.defaultLogWarning(NLS.bind(Messages.DiagramEditor_InvalidParameter, parameter, data), null);
continue;
}
String key = keyValue[0];
- String value = keyValue.length > 1 ? keyValue[1] : "";
+ String value = keyValue.length > 1 ? keyValue[1] : ""; //$NON-NLS-1$
if (ARG_VIEWER.equals(key)) {
viewerClassName = value;
protected DiagramViewer createViewer() throws PartInitException {
if (viewerClassName == null)
throw new PartInitException(
- "DiagramViewer contributor class was not specified in editor extension's class attribute viewer-argument. contributor is '"
- + viewerContributor + "'");
+ "DiagramViewer contributor class was not specified in editor extension's class attribute viewer-argument. contributor is '" //$NON-NLS-1$
+ + viewerContributor + "'"); //$NON-NLS-1$
try {
Bundle b = Platform.getBundle(viewerContributor);
if (b == null)
- throw new PartInitException("DiagramViewer '" + viewerClassName + "' contributor bundle '"
- + viewerContributor + "' was not found in the platform.");
+ throw new PartInitException("DiagramViewer '" + viewerClassName + "' contributor bundle '" //$NON-NLS-1$ //$NON-NLS-2$
+ + viewerContributor + "' was not found in the platform."); //$NON-NLS-1$
Class<?> clazz = b.loadClass(viewerClassName);
if (!DiagramViewer.class.isAssignableFrom(clazz))
- throw new PartInitException("DiagramViewer class '" + viewerClassName + "' is not assignable to "
- + DiagramViewer.class + ".");
+ throw new PartInitException("DiagramViewer class '" + viewerClassName + "' is not assignable to " //$NON-NLS-1$ //$NON-NLS-2$
+ + DiagramViewer.class + "."); //$NON-NLS-1$
Constructor<?> ctor = clazz.getConstructor();
return (DiagramViewer) ctor.newInstance();
} catch (Exception e) {
- throw new PartInitException("Failed to instantiate DiagramViewer implementation '" + viewerClassName
- + "' from bundle '" + viewerContributor + "'. See exception for details.", e);
+ throw new PartInitException("Failed to instantiate DiagramViewer implementation '" + viewerClassName //$NON-NLS-1$
+ + "' from bundle '" + viewerContributor + "'. See exception for details.", e); //$NON-NLS-1$ //$NON-NLS-2$
}
}
public class DiagramLayersPage extends Page implements ILayersViewPage {
- private static final String TEXT_APPLY_FOCUS_SETTINGS = "Focus Active";
- private static final String TOOLTIP_APPLY_FOCUS_SETTINGS = "Only Focus Diagram Elements For Active Roles";
- private static final String TEXT_IGNORE_FOCUS_SETTINGS = "Focus All";
- private static final String TOOLTIP_IGNORE_FOCUS_SETTINGS = "Focus All Diagram Elements Regardless Of Active Roles";
+ private static final String TEXT_APPLY_FOCUS_SETTINGS = Messages.DiagramLayersPage_FocusActive;
+ private static final String TOOLTIP_APPLY_FOCUS_SETTINGS = Messages.DiagramLayersPage_FocusActiveTT;
+ private static final String TEXT_IGNORE_FOCUS_SETTINGS = Messages.DiagramLayersPage_FocusAll;
+ private static final String TOOLTIP_IGNORE_FOCUS_SETTINGS = Messages.DiagramLayersPage_FocusAllTT;
- private static final String TEXT_APPLY_VISIBILITY_SETTINGS = "Show Active";
- private static final String TOOLTIP_APPLY_VISIBILITY_SETTINGS = "Only Show Diagram Elements For Active Roles";
- private static final String TEXT_IGNORE_VISIBILITY_SETTINGS = "Show All";
- private static final String TOOLTIP_IGNORE_VISIBILITY_SETTINGS = "Show All Diagram Elements Regardless Of Active Roles";
+ private static final String TEXT_APPLY_VISIBILITY_SETTINGS = Messages.DiagramLayersPage_ShowActive;
+ private static final String TOOLTIP_APPLY_VISIBILITY_SETTINGS = Messages.DiagramLayersPage_ShowActiveTT;
+ private static final String TEXT_IGNORE_VISIBILITY_SETTINGS = Messages.DiagramLayersPage_ShowAll;
+ private static final String TOOLTIP_IGNORE_VISIBILITY_SETTINGS = Messages.DiagramLayersPage_ShowAllTT;
final private ICanvasContext context;
final private IDiagram diagram;
boolean toBoolean() {
switch (this) {
case Both:
- throw new IllegalStateException("cannot convert Tristate Both to boolean");
+ throw new IllegalStateException("cannot convert Tristate Both to boolean"); //$NON-NLS-1$
case False:
return false;
case True:
GridLayoutFactory.fillDefaults().numColumns(4).applyTo(composite);
Button addButton = new Button(composite, SWT.NONE);
- addButton.setText("New");
- addButton.setToolTipText("Create New Diagram Role");
+ addButton.setText(Messages.DiagramLayersPage_New);
+ addButton.setToolTipText(Messages.DiagramLayersPage_NewTT);
addButton.addSelectionListener(new SelectionListener() {
String findFreshName(ILayers layers, String proposal) {
if (!match)
return name;
++i;
- name = proposal + " " + i;
+ name = proposal + " " + i; //$NON-NLS-1$
}
}
@Override
public void widgetSelected(SelectionEvent e) {
- String name = findFreshName(layers, "New Role");
+ String name = findFreshName(layers, Messages.DiagramLayersPage_NewRole);
SimpleLayer layer = new SimpleLayer(name);
layers.addLayer(layer);
layers.activate(layer);
});
final Button removeButton = new Button(composite, SWT.NONE);
- removeButton.setText("Remove");
- removeButton.setToolTipText("Remove Selected Diagram Role");
+ removeButton.setText(Messages.DiagramLayersPage_Remove);
+ removeButton.setToolTipText(Messages.DiagramLayersPage_RemoveTT);
removeButton.addSelectionListener(new SelectionListener() {
@Override
public void widgetSelected(SelectionEvent e) {
viewer = new CheckboxTreeViewer(composite, SWT.BORDER | SWT.FULL_SELECTION );
GridDataFactory.fillDefaults().grab(true, true).span(4, 1).applyTo(viewer.getControl());
- viewer.getControl().setToolTipText("Selects the diagram to include in the exported document.");
+ viewer.getControl().setToolTipText(Messages.DiagramLayersPage_SelectTT);
viewer.setAutoExpandLevel(TreeViewer.ALL_LEVELS);
viewer.getTree().setHeaderVisible(true);
editor = new TreeEditor(viewer.getTree());
final TreeColumn column1 = new TreeColumn(viewer.getTree(), SWT.LEFT);
- column1.setText("Role");
+ column1.setText(Messages.DiagramLayersPage_Role);
column1.setWidth(100);
final TreeColumn column2 = new TreeColumn(viewer.getTree(), SWT.LEFT);
- column2.setText("Show");
+ column2.setText(Messages.DiagramLayersPage_Show);
column2.setWidth(50);
final TreeColumn column3 = new TreeColumn(viewer.getTree(), SWT.LEFT);
- column3.setText("Focus");
+ column3.setText(Messages.DiagramLayersPage_Focus);
column3.setWidth(50);
viewer.getTree().addListener(SWT.Resize, new Listener() {
@Override
// FIXME: Eclipse currently eats F2 presses. This should be
// implemented as a command handler or find some way to
// force these listeners to have priority...
- System.out.println("startediting");
+ System.out.println("startediting"); //$NON-NLS-1$
TreeItem[] items = viewer.getTree().getSelection();
if(items.length != 1)
ILayer layer = (ILayer)cell.getElement();
cell.setText(layer.getName());
} else {
- cell.setText("");
+ cell.setText(""); //$NON-NLS-1$
}
}
});
if(layer instanceof IEditableLayer) {
IEditableLayer l = (IEditableLayer)layer;
l.setName(text.getText());
- System.out.println("renamed layer to " + text.getText());
+ System.out.println("renamed layer to " + text.getText()); //$NON-NLS-1$
viewer.refresh();
}
this.explorer = GraphExplorerFactory.getInstance().selectionDataResolver(new DefaultSelectionDataResolver()).create(composite);
Control control = explorer.getControl();
ISelectionProvider selectionProvider = (ISelectionProvider)explorer.getAdapter(ISelectionProvider.class);
- new ContextMenuInitializer("#GraphExplorerPopup").createContextMenu(control, selectionProvider, getSite());
+ new ContextMenuInitializer("#GraphExplorerPopup").createContextMenu(control, selectionProvider, getSite()); //$NON-NLS-1$
GridDataFactory.fillDefaults().grab(true, true).applyTo(control);
// Consider ENTER presses to simulate mouse left button double clicks
static class LinkWithEditor extends LinkWithEditorContribution {
public LinkWithEditor() {
- super("DiagramOutlinePage.linkWithEditor", Activator.getDefault().getPreferenceStore());
+ super("DiagramOutlinePage.linkWithEditor", Activator.getDefault().getPreferenceStore()); //$NON-NLS-1$
}
}
void doSetTitleToolTip(String name);
}
- public static final String DIAGRAMMING_CONTEXT = "org.simantics.modeling.ui.diagramming";
- private static final String PREFERENCE_VIRTUAL_GRAPH = "preferences";
+ public static final String DIAGRAMMING_CONTEXT = "org.simantics.modeling.ui.diagramming"; //$NON-NLS-1$
+ private static final String PREFERENCE_VIRTUAL_GRAPH = "preferences"; //$NON-NLS-1$
private static final boolean PROFILE = false;
try {
return BrowseContext.getBrowseContextClosure(Simantics.getSession(), defaultPropertyBrowseContexts);
} catch (DatabaseException e) {
- ExceptionUtils.logAndShowError("Failed to load modeled browse contexts for property page, see exception for details.", e);
+ ExceptionUtils.logAndShowError(Messages.DiagramViewer_FailedtoLoadModeled, e);
return defaultPropertyBrowseContexts;
}
}
}
protected String getPopupId() {
- return "#ModelingDiagramPopup";
+ return "#ModelingDiagramPopup"; //$NON-NLS-1$
}
protected void getPreferences() {
resourceManager = new LocalResourceManager(JFaceResources.getResources(), parent);
c = new SWTChassis(parent, 0);
- Object task = BEGIN("DV.precreateParticipants");
+ Object task = BEGIN("DV.precreateParticipants"); //$NON-NLS-1$
createCustomParticipants();
END(task);
swt = SWTThread.getThreadAccess(display);
statusLineManager = getEditorSite().getActionBars().getStatusLineManager();
- Object task = BEGIN("DV.initSession");
+ Object task = BEGIN("DV.initSession"); //$NON-NLS-1$
initSession();
END(task);
this.canvasContext = new CanvasContext(thread);
this.canvasContext.setLocked(true);
- task = BEGIN("DV.createChassis");
+ task = BEGIN("DV.createChassis"); //$NON-NLS-1$
createChassis(parent);
END(task);
} catch (DatabaseException e) {
* Invoke this only from the AWT thread.
*/
protected void initializeCanvas() {
- Object canvasInit = BEGIN("DV.canvasInitialization");
+ Object canvasInit = BEGIN("DV.canvasInitialization"); //$NON-NLS-1$
- Object task = BEGIN("DV.createViewerCanvas");
+ Object task = BEGIN("DV.createViewerCanvas"); //$NON-NLS-1$
initializeCanvasContext(canvasContext);
END(task);
canvasContext.getHintStack().addKeyHintListener(GridPainter.KEY_GRID_ENABLED, canvasHintListener);
canvasContext.getHintStack().addKeyHintListener(RulerPainter.KEY_RULER_ENABLED, canvasHintListener);
- task = BEGIN("DV.setCanvasContext");
+ task = BEGIN("DV.setCanvasContext"); //$NON-NLS-1$
setCanvasContext(canvasContext);
END(task);
* cancelled.
*/
protected void performActivation(IProgressMonitor monitor) {
- SubMonitor progress = SubMonitor.convert(monitor, "Activate Mapping", 100);
+ SubMonitor progress = SubMonitor.convert(monitor, Messages.DiagramViewer_MonitorActivateMapping, 100);
IActivationManager activationManager = sessionContext.getSession().peekService(IActivationManager.class);
if (activationManager != null) {
activation = activationManager.activate(diagramResource);
*/
protected void scheduleZoomToFit(IDiagram diagram) {
if (diagram == null)
- throw new IllegalStateException("diagram is null");
+ throw new IllegalStateException("diagram is null"); //$NON-NLS-1$
CanvasUtils.scheduleZoomToFit(swt, () -> disposed, canvasContext, diagram);
}
}
});
} catch (DatabaseException e) {
- throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e);
+ throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e); //$NON-NLS-1$
}
}
// unnecessary visual glitches.
h.setHint(Hints.KEY_DISABLE_PAINTING, Boolean.TRUE);
- Object task = BEGIN("createSynchronizer");
+ Object task = BEGIN("createSynchronizer"); //$NON-NLS-1$
this.synchronizer = createSynchronizer(ctx, sessionContext);
END(task);
}
}, parameter -> {
if (parameter != null)
- ErrorLogger.defaultLogError("Failed to write default diagram page description to database, see exception for details", parameter);
+ ErrorLogger.defaultLogError("Failed to write default diagram page description to database, see exception for details", parameter); //$NON-NLS-1$
});
}
protected void setDiagramDesc(ICanvasContext ctx, DiagramDesc diagramDesc) {
if (diagramDesc == null)
- throw new NullPointerException("null diagram desc");
+ throw new NullPointerException("null diagram desc"); //$NON-NLS-1$
if (diagramDesc.equals(this.diagramDesc))
return;
public void init(DiagramViewerHost _host, IEditorSite site, IEditorInput input, DataContainer<IDiagram> diagramContainer, WorkbenchSelectionProvider selectionProvider) {
if (!(input instanceof IResourceEditorInput))
- throw new RuntimeException("Invalid input: must be IResourceEditorInput");
+ throw new RuntimeException("Invalid input: must be IResourceEditorInput"); //$NON-NLS-1$
setHost(_host);
setSite(site);
try {
return (T) DiagramTypeUtils.readSymbolProviderFactory(sessionContext.getSession(), diagramResource);
} catch (DatabaseException e) {
- ErrorLogger.defaultLogError(getClass() + " failed to adapt to SymbolProviderFactory, see exception for details.", e);
+ ErrorLogger.defaultLogError(getClass() + " failed to adapt to SymbolProviderFactory, see exception for details.", e); //$NON-NLS-1$
return null;
}
}
@Override
public void contributeToCoolBar(ICoolBarManager coolBarManager) {
- IContributionItem item = coolBarManager.find("org.simantics.modeling.ui.diagramtoolbar");
+ IContributionItem item = coolBarManager.find("org.simantics.modeling.ui.diagramtoolbar"); //$NON-NLS-1$
if (item instanceof ToolBarContributionItem)
mgr = ((ToolBarContributionItem) item).getToolBarManager();
if (mgr == null)
return;
- pointerAction = new ModeAction("org.simantics.modeling.ui.pointerMode", Hints.POINTERTOOL);
- pointerAction.setText("Pointer Mode");
+ pointerAction = new ModeAction("org.simantics.modeling.ui.pointerMode", Hints.POINTERTOOL); //$NON-NLS-1$
+ pointerAction.setText(Messages.DiagramViewerActionContributor_PointerMode);
pointerAction.setImageDescriptor(Activator.POINTER_MODE);
- connectAction = new ModeAction("org.simantics.modeling.ui.connectMode", Hints.CONNECTTOOL);
- connectAction.setText("Connect Mode");
+ connectAction = new ModeAction("org.simantics.modeling.ui.connectMode", Hints.CONNECTTOOL); //$NON-NLS-1$
+ connectAction.setText(Messages.DiagramViewerActionContributor_ConnectMode);
connectAction.setImageDescriptor(Activator.CONNECT_MODE);
pointerItem = new ActionContributionItem(pointerAction);
connectItem = new ActionContributionItem(connectAction);
- mgr.appendToGroup("tool.additions", pointerItem);
- mgr.appendToGroup("tool.additions", connectItem);
+ mgr.appendToGroup("tool.additions", pointerItem); //$NON-NLS-1$
+ mgr.appendToGroup("tool.additions", connectItem); //$NON-NLS-1$
mgr.markDirty();
getPage().addPartListener(partListener);
public void setActiveEditor(IEditorPart part) {
if (DEBUG)
- System.out.println("setActiveEditor: " + part);
+ System.out.println("setActiveEditor: " + part); //$NON-NLS-1$
if (part == activePart)
return;
private void setContext(IEditorPart part, ICanvasContext context) {
if (DEBUG)
- System.out.println("setContext: " + part + "\nNEW CONTEXT: " + context + "\nPREVIOUS CONTEXT: " + currentContext);
+ System.out.println("setContext: " + part + "\nNEW CONTEXT: " + context + "\nPREVIOUS CONTEXT: " + currentContext); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
ICanvasContext previous = currentContext;
currentContext = context;
private void updateActionBars(IEditorPart part, IToolMode toolMode) {
if (DEBUG)
- System.out.println("updateActionBars: " + part + ", " + toolMode);
+ System.out.println("updateActionBars: " + part + ", " + toolMode); //$NON-NLS-1$ //$NON-NLS-2$
updateToolMode(toolMode);
if (part != null)
part.getEditorSite().getActionBars().updateActionBars();
private void updateToolMode(IToolMode toolMode) {
if (DEBUG)
- System.out.println("updateToolMode: " + toolMode);
+ System.out.println("updateToolMode: " + toolMode); //$NON-NLS-1$
if (toolMode != null) {
pointerAction.setEnabled(true);
connectAction.setEnabled(true);
IToolMode toolMode = context.getHintStack().getHint(Hints.KEY_TOOL);
if (!targetMode.equals(toolMode)) {
if (DEBUG)
- System.out.println("changing tool mode to " + targetMode.getId());
+ System.out.println("changing tool mode to " + targetMode.getId()); //$NON-NLS-1$
context.getDefaultHintContext().setHint(Hints.KEY_TOOL, targetMode);
}
}
private DiagramViewer viewer;
public DiagramViewerLoadJob(DiagramViewer viewer) {
- super("Load Diagram");
+ super(Messages.DiagramViewerLoadJob_LoadDiagram);
setUser(true);
this.viewer = viewer;
}
@Override
protected IStatus run(final IProgressMonitor monitor) {
- final SubMonitor mon = SubMonitor.convert(monitor, "Loading Diagram", 200);
+ final SubMonitor mon = SubMonitor.convert(monitor, Messages.DiagramViewerLoadJob_MonitorLoadingDiagram, 200);
try {
- Object task = BEGIN("DV.loadDiagram");
+ Object task = BEGIN("DV.loadDiagram"); //$NON-NLS-1$
final IDiagram diagram = viewer.loadDiagram(mon.newChild(100), viewer.diagramResource);
if (diagram == null)
return Status.CANCEL_STATUS;
// Start an activation for the input resource.
// This will activate mapping if necessary.
- task = BEGIN("DV.performActivation");
+ task = BEGIN("DV.performActivation"); //$NON-NLS-1$
viewer.performActivation(mon.newChild(50));
END(task);
@Override
public void run() {
setThread(viewer.canvasContext.getThreadAccess().getThread());
- mon.setTaskName("Finalize Diagram Loading");
+ mon.setTaskName(Messages.DiagramViewerLoadJob_MonitorFinalizeDiagramLoading);
try {
- Object task = BEGIN("DV.beforeSetDiagram");
+ Object task = BEGIN("DV.beforeSetDiagram"); //$NON-NLS-1$
viewer.beforeSetDiagram(diagram);
mon.worked(10);
END(task);
- task = BEGIN("DV.setDiagramHint");
- mon.subTask("Set Diagram");
+ task = BEGIN("DV.setDiagramHint"); //$NON-NLS-1$
+ mon.subTask(Messages.DiagramViewerLoadJob_SetDiagram);
DataContainer<IDiagram> diagramContainer = viewer.sourceDiagramContainer;
if (diagramContainer != null)
diagramContainer.set( diagram );
viewer.selectionProvider.fireSelection(Collections.emptyList());
// Zoom to fit if no previous view transform is available
- task = BEGIN("DV.scheduleZoomToFit");
+ task = BEGIN("DV.scheduleZoomToFit"); //$NON-NLS-1$
viewer.scheduleZoomToFit(diagram);
mon.worked(10);
END(task);
- task = BEGIN("DV.onCreated");
- mon.subTask("");
+ task = BEGIN("DV.onCreated"); //$NON-NLS-1$
+ mon.subTask(""); //$NON-NLS-1$
viewer.onCreated();
mon.worked(10);
END(task);
- task = BEGIN("DV.applyEditorState");
- mon.subTask("Apply editor state");
+ task = BEGIN("DV.applyEditorState"); //$NON-NLS-1$
+ mon.subTask(Messages.DiagramViewerLoadJob_ApplyEditorState);
viewer.applyEditorState(viewer.editorState, viewer.canvasContext);
mon.worked(10);
END(task);
- task = BEGIN("DV.activateUiContexts");
+ task = BEGIN("DV.activateUiContexts"); //$NON-NLS-1$
viewer.contextUtil.inContextThread(new Runnable() {
@Override
public void run() {
} catch (CancelTransactionException e) {
monitor.done();
viewer = null;
- return new Status(IStatus.CANCEL, Activator.PLUGIN_ID, "Diagram loading was cancelled.", e);
+ return new Status(IStatus.CANCEL, Activator.PLUGIN_ID, Messages.DiagramViewerLoadJob_ActivatorDiagramLoadingCancelled, e);
} catch (Throwable t) {
monitor.done();
viewer = null;
- return new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Diagram loading failed, see exception for details.", t);
+ return new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.DiagramViewerLoadJob_ActivatorDiagramLoadingFailed, t);
}
}
if (resource != null) {
objects.add( constructSelectionElement(runtime, resource) );
} else {
- System.out.println(" unrecognized selection: " + o.getClass() + ": " + o);
+ System.out.println(" unrecognized selection: " + o.getClass() + ": " + o); //$NON-NLS-1$ //$NON-NLS-2$
}
}
if (objects.isEmpty() && runtime != null && dr != null) {
currentlyScheduled = null;
runnable.run();
if(DEBUG)
- System.out.println("Executed disposer " + runnable);
+ System.out.println("Executed disposer " + runnable); //$NON-NLS-1$
if(!disposerQueue.isEmpty())
scheduleDispose();
}
MIN_DELAY);
Display.getCurrent().timerExec((int)delay, disposeOne);
if(DEBUG)
- System.out.println("Scheduled disposer " + currentlyScheduled + " in " + delay + " ms");
+ System.out.println("Scheduled disposer " + currentlyScheduled + " in " + delay + " ms"); //$NON-NLS-1$ //$NON-NLS-2$ //$NON-NLS-3$
}
/**
*/
public void addDisposer(Runnable disposer) {
if(DEBUG)
- System.out.println("Added disposer " + disposer);
+ System.out.println("Added disposer " + disposer); //$NON-NLS-1$
if(disposeTime.contains(disposer))
return;
if(disposerQueue.size() >= maxQueueLength)
*/
public void removeDisposer(Runnable disposer) {
if(DEBUG)
- System.out.println("Removed disposer " + disposer);
+ System.out.println("Removed disposer " + disposer); //$NON-NLS-1$
disposerQueue.remove(disposer);
disposeTime.remove(disposer);
if(disposer == currentlyScheduled) {
import org.eclipse.osgi.util.NLS;
public class Messages extends NLS {
- private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagramEditor.messages"; //$NON-NLS-1$
- public static String PopulateElementDropParticipant_PreDropFixesFailed;
- public static String PopulateElementDropParticipant_PreDropFixesFailed_Title;
- static {
- // initialize resource bundle
- NLS.initializeMessages(BUNDLE_NAME, Messages.class);
- }
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagramEditor.messages"; //$NON-NLS-1$
+ public static String DiagramEditor_InvalidParameter;
+ public static String DiagramLayersPage_FocusActive;
+ public static String DiagramLayersPage_FocusActiveTT;
+ public static String DiagramLayersPage_Focus;
+ public static String DiagramLayersPage_FocusAll;
+ public static String DiagramLayersPage_FocusAllTT;
+ public static String DiagramLayersPage_New;
+ public static String DiagramLayersPage_NewRole;
+ public static String DiagramLayersPage_NewTT;
+ public static String DiagramLayersPage_Remove;
+ public static String DiagramLayersPage_RemoveTT;
+ public static String DiagramLayersPage_Role;
+ public static String DiagramLayersPage_SelectTT;
+ public static String DiagramLayersPage_ShowActive;
+ public static String DiagramLayersPage_ShowActiveTT;
+ public static String DiagramLayersPage_Show;
+ public static String DiagramLayersPage_ShowAll;
+ public static String DiagramLayersPage_ShowAllTT;
+ public static String DiagramViewer_FailedtoLoadModeled;
+ public static String DiagramViewer_MonitorActivateMapping;
+ public static String DiagramViewerActionContributor_ConnectMode;
+ public static String DiagramViewerActionContributor_PointerMode;
+ public static String DiagramViewerLoadJob_ActivatorDiagramLoadingCancelled;
+ public static String DiagramViewerLoadJob_ActivatorDiagramLoadingFailed;
+ public static String DiagramViewerLoadJob_ApplyEditorState;
+ public static String DiagramViewerLoadJob_LoadDiagram;
+ public static String DiagramViewerLoadJob_MonitorFinalizeDiagramLoading;
+ public static String DiagramViewerLoadJob_MonitorLoadingDiagram;
+ public static String DiagramViewerLoadJob_SetDiagram;
+ public static String OpenDiagramAdapter_DiagramEditor;
+ public static String OpenDiagramFromComponentAdapter_ChooseDiagramComponetReference;
+ public static String OpenDiagramFromComponentAdapter_OpenDiagramContainingComponent;
+ public static String OpenDiagramFromComponentAdapter_SelectSingleDiagramfromList;
+ public static String OpenDiagramFromConfigurationAdapter_DiagramEditor;
+ public static String OpenDiagramFromIssue_OpenDiagramRefComponent;
+ public static String OpenDiagramFromSymbolAdapter_SymbolEditor;
+ public static String OpenSheetAdapter_SpreadsheetEditor;
+ public static String PopulateElementDropParticipant_PreDropFixesFailed;
+ public static String PopulateElementDropParticipant_PreDropFixesFailed_Title;
+ public static String SheetViewer_MonitorLoadingDiagram;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
- private Messages() {
- }
+ private Messages() {
+ }
}
*/
public class OpenDiagramAdapter extends AbstractResourceEditorAdapter {
- private static final String EDITOR_ID = "org.simantics.modeling.ui.plainDiagramEditor";
+ private static final String EDITOR_ID = "org.simantics.modeling.ui.plainDiagramEditor"; //$NON-NLS-1$
public OpenDiagramAdapter() {
- super("Diagram Editor", Activator.COMPOSITE_ICON);
+ super(Messages.OpenDiagramAdapter_DiagramEditor, Activator.COMPOSITE_ICON);
}
protected String getEditorId() {
private static final Logger LOGGER = LoggerFactory.getLogger(OpenDiagramFromComponentAdapter.class);
- private static final String EDITOR_ID = "org.simantics.modeling.ui.diagramEditor";
+ private static final String EDITOR_ID = "org.simantics.modeling.ui.diagramEditor"; //$NON-NLS-1$
public OpenDiagramFromComponentAdapter() {
- super("Open Diagram Containing This Component", Activator.SYMBOL_ICON);
+ super(Messages.OpenDiagramFromComponentAdapter_OpenDiagramContainingComponent, Activator.SYMBOL_ICON);
}
@Override
private Pair<Resource, String> tryGetResource(ReadGraph graph, Object input) throws DatabaseException {
Resource r = ResourceAdaptionUtils.toSingleResource(input);
if (r != null)
- return Pair.make(r, "");
+ return Pair.make(r, ""); //$NON-NLS-1$
Variable v = AdaptionUtils.adaptToSingle(input, Variable.class);
return findResource(graph, v);
}
while (v != null) {
Resource r = v.getPossibleRepresents(graph);
if (r != null) {
- String rvi = "";
+ String rvi = ""; //$NON-NLS-1$
if (path != null) {
int pathLength = path.size();
for (int i = 0; i < pathLength; i++)
path.set(i, URIStringUtils.escape(path.get(i)));
Collections.reverse(path);
- rvi = EString.implode(path, "/");
+ rvi = EString.implode(path, "/"); //$NON-NLS-1$
}
return Pair.make(r, rvi);
}
if (path == null)
path = new ArrayList<>(2);
path.add( v.getName(graph) );
- v = v.browsePossible(graph, ".");
+ v = v.browsePossible(graph, "."); //$NON-NLS-1$
}
return null;
}
Variable v = AdaptionUtils.adaptToSingle(input, Variable.class);
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug(getClass().getSimpleName() + ".openEditor: input's nearest parent resource URI: " + NameUtils.getURIOrSafeNameInternal(graph, r.first));
- LOGGER.debug(getClass().getSimpleName() + ".openEditor: input's nearest parent RVI: " + r.second);
- LOGGER.debug(getClass().getSimpleName() + ".openEditor: input variable URI: " + (v != null ? v.getURI(graph) : "null"));
+ LOGGER.debug(getClass().getSimpleName() + ".openEditor: input's nearest parent resource URI: " + NameUtils.getURIOrSafeNameInternal(graph, r.first)); //$NON-NLS-1$
+ LOGGER.debug(getClass().getSimpleName() + ".openEditor: input's nearest parent RVI: " + r.second); //$NON-NLS-1$
+ LOGGER.debug(getClass().getSimpleName() + ".openEditor: input variable URI: " + (v != null ? v.getURI(graph) : "null")); //$NON-NLS-1$ //$NON-NLS-2$
}
final Collection<Runnable> rs = tryFindDiagram(graph, r.first, v, r.second);
Resource diagram = ComponentUtils.getPossibleCompositeDiagram(g, composite);
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: component: " + NameUtils.getURIOrSafeNameInternal(g, component));
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: composite: " + NameUtils.getURIOrSafeNameInternal(g, composite));
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: component: " + NameUtils.getURIOrSafeNameInternal(g, component)); //$NON-NLS-1$
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: composite: " + NameUtils.getURIOrSafeNameInternal(g, composite)); //$NON-NLS-1$
}
Collection<Resource> referenceElements = diagram == null ? g.getObjects(component, MOD.HasParentComponent_Inverse) : Collections.<Resource>emptyList();
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: diagram: " + NameUtils.getURIOrSafeNameInternal(g, diagram));
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: referenceElements: " + referenceElements.size());
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: diagram: " + NameUtils.getURIOrSafeNameInternal(g, diagram)); //$NON-NLS-1$
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: referenceElements: " + referenceElements.size()); //$NON-NLS-1$
for (Object object : referenceElements)
- LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, (Resource) object));
+ LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, (Resource) object)); //$NON-NLS-1$
}
if (diagram == null && referenceElements.isEmpty())
return Collections.emptyList();
if (indexRoot == null)
return Collections.emptyList();
if (LOGGER.isDebugEnabled())
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: Model: " + indexRoot);
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: Model: " + indexRoot); //$NON-NLS-1$
if (diagram != null) {
if(OpenDiagramFromConfigurationAdapter.isLocked(g, diagram))
if (parent != null) {
rvi = parent.getPossibleRVI(g);
if (LOGGER.isDebugEnabled())
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: resolved RVI: " + rvi);
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: resolved RVI: " + rvi); //$NON-NLS-1$
}
}
} else {
allowNullRvi = true;
rvi = compositeVariable.getPossibleRVI(g);
if (LOGGER.isDebugEnabled())
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: resolved RVI from resource path: " + rvi);
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: resolved RVI from resource path: " + rvi); //$NON-NLS-1$
}
if (rvi == null && !allowNullRvi)
return Collections.emptyList();
Collection<Object> selectedObjects = findElementObjects(g, component, rviFromComponent);
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: selected objects: " + selectedObjects.size());
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: selected objects: " + selectedObjects.size()); //$NON-NLS-1$
for (Object object : selectedObjects)
- LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, (Resource) object));
+ LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, (Resource) object)); //$NON-NLS-1$
}
// Prevent diagram from opening if there's nothing to select
// on the diagram based on the received input.
final MapSet<NamedResource, Resource> referencingDiagrams = listReferenceDiagrams(g, referenceElements);
final Set<NamedResource> diagrams = referencingDiagrams.getKeys();
if (LOGGER.isDebugEnabled()) {
- LOGGER.debug(getClass().getSimpleName() + ".findDiagram: selected objects: " + diagrams.size());
+ LOGGER.debug(getClass().getSimpleName() + ".findDiagram: selected objects: " + diagrams.size()); //$NON-NLS-1$
for (NamedResource d : diagrams) {
- LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, d.getResource()) + ":");
+ LOGGER.debug("\t" + NameUtils.getURIOrSafeNameInternal(g, d.getResource()) + ":"); //$NON-NLS-1$ //$NON-NLS-2$
for (Resource referenceElement : referencingDiagrams.getValues(d)) {
- LOGGER.debug("\t\t" + NameUtils.getURIOrSafeNameInternal(g, referenceElement));
+ LOGGER.debug("\t\t" + NameUtils.getURIOrSafeNameInternal(g, referenceElement)); //$NON-NLS-1$
}
}
}
while (v != null) {
Resource represents = v.getPossibleRepresents(graph);
if (LOGGER.isDebugEnabled())
- LOGGER.debug(v.getURI(graph) + " -> " + NameUtils.getURIOrSafeNameInternal(graph, represents));
+ LOGGER.debug(v.getURI(graph) + " -> " + NameUtils.getURIOrSafeNameInternal(graph, represents)); //$NON-NLS-1$
if (represents != null)
return v;
v = v.getParent(graph);
protected NamedResource queryTarget(final Shell parentShell, Collection<NamedResource> options) {
NavigationTargetChooserDialog dialog = new NavigationTargetChooserDialog(
parentShell, options.toArray(new NamedResource[options.size()]),
- "Choose Diagram with Component Reference",
- "Select single diagram from list");
+ Messages.OpenDiagramFromComponentAdapter_ChooseDiagramComponetReference,
+ Messages.OpenDiagramFromComponentAdapter_SelectSingleDiagramfromList);
return dialog.open() != Window.OK ? null : dialog.getSelection();
}
*/
public class OpenDiagramFromConfigurationAdapter extends AbstractResourceEditorAdapter {
- private static final String EDITOR_ID = "org.simantics.modeling.ui.diagramEditor";
+ private static final String EDITOR_ID = "org.simantics.modeling.ui.diagramEditor"; //$NON-NLS-1$
public OpenDiagramFromConfigurationAdapter() {
- super("Diagram Editor", Activator.COMPOSITE_ICON);
+ super(Messages.OpenDiagramFromConfigurationAdapter_DiagramEditor, Activator.COMPOSITE_ICON);
}
protected String getEditorId() {
*/
public class OpenDiagramFromIssue extends AbstractResourceEditorAdapter {
- private static final String EDITOR_ID = "org.simantics.modeling.ui.plainDiagramEditor";
+ private static final String EDITOR_ID = "org.simantics.modeling.ui.plainDiagramEditor"; //$NON-NLS-1$
public OpenDiagramFromIssue() {
- super("Open Diagram Containing Referenced Component", Activator.COMPOSITE_ICON);
+ super(Messages.OpenDiagramFromIssue_OpenDiagramRefComponent, Activator.COMPOSITE_ICON);
}
protected String getEditorId(ReadGraph g, Resource diagram) throws DatabaseException {
}
protected static Collection<Object> findElementObjects(ReadGraph g, Resource component) throws DatabaseException {
- Collection<Object> result = findElementObjects(g, component, "");
+ Collection<Object> result = findElementObjects(g, component, ""); //$NON-NLS-1$
ModelingResources MOD = ModelingResources.getInstance(g);
for (Resource element : g.getObjects(component, MOD.HasParentComponent_Inverse))
result.add(element);
*/
public class OpenDiagramFromSymbolAdapter extends AbstractResourceEditorAdapter {
- private static final String EDITOR_ID = "org.simantics.modeling.ui.symbolEditor";
+ private static final String EDITOR_ID = "org.simantics.modeling.ui.symbolEditor"; //$NON-NLS-1$
public OpenDiagramFromSymbolAdapter() {
- super("Symbol Editor", Activator.SYMBOL_ICON);
+ super(Messages.OpenDiagramFromSymbolAdapter_SymbolEditor, Activator.SYMBOL_ICON);
}
protected String getEditorId() {
public class OpenSheetAdapter extends AbstractResourceEditorAdapter {
private static final Logger LOGGER = LoggerFactory.getLogger(OpenSheetAdapter.class);
- private static final String EDITOR_ID = "org.simantics.spreadsheet.ui.editor2";
+ private static final String EDITOR_ID = "org.simantics.spreadsheet.ui.editor2"; //$NON-NLS-1$
public OpenSheetAdapter() {
- super("Spreadsheet Editor", Activator.COMPOSITE_ICON);
+ super(Messages.OpenSheetAdapter_SpreadsheetEditor, Activator.COMPOSITE_ICON);
}
protected String getEditorId() {
String editorId = getEditorId();
WorkbenchUtils.openEditor(editorId, new ResourceEditorInput2(editorId, r, model, rvi));
} catch (PartInitException e) {
- LOGGER.error("Failed to open the spreadsheet editor.", e);
+ LOGGER.error("Failed to open the spreadsheet editor.", e); //$NON-NLS-1$
}
}
});
try {
Object obj = tr.getTransferData(LocalObjectTransferable.FLAVOR);
if (DEBUG)
- System.out.println("GOT FROM AWT: " + obj);
+ System.out.println("GOT FROM AWT: " + obj); //$NON-NLS-1$
// Check SWT
if (!(obj instanceof IStructuredSelection)) {
obj = LocalObjectTransfer.getTransfer().getObject();
if (DEBUG)
- System.out.println("GOT FROM SWT: " + obj);
+ System.out.println("GOT FROM SWT: " + obj); //$NON-NLS-1$
}
if (obj instanceof IStructuredSelection) {
}
} catch (UnsupportedFlavorException|IOException|DatabaseException e) {
- LOGGER.error("dragEnter failed", e);
+ LOGGER.error("dragEnter failed", e); //$NON-NLS-1$
}
}
public List<ElementClassDragItem> resolve(ReadGraph graph, Variable parameter) throws DatabaseException {
if (DEBUG) {
- System.out.println("PARAM: " + parameter.getURI(graph));
- Variable parent = parameter.browsePossible(graph, "..");
- System.out.println("PARENT: " + parent.getURI(graph));
+ System.out.println("PARAM: " + parameter.getURI(graph)); //$NON-NLS-1$
+ Variable parent = parameter.browsePossible(graph, ".."); //$NON-NLS-1$
+ System.out.println("PARENT: " + parent.getURI(graph)); //$NON-NLS-1$
Resource parentComposite = parent.getPossibleRepresents(graph);
- System.out.println("PARENT REPRESENTS: " + NameUtils.getSafeLabel(graph, parentComposite));
+ System.out.println("PARENT REPRESENTS: " + NameUtils.getSafeLabel(graph, parentComposite)); //$NON-NLS-1$
String prvi = Variables.getRVI(graph, parent);
- System.out.println("PARENT RVI: " + prvi);
+ System.out.println("PARENT RVI: " + prvi); //$NON-NLS-1$
String parvi = Variables.getRVI(graph, parameter);
- System.out.println("PARAM RVI: " + parvi);
+ System.out.println("PARAM RVI: " + parvi); //$NON-NLS-1$
}
Triple<Variable, Resource, IElement> match = findElementInDiagram(graph, parameter, false);
}
if (DEBUG) {
- System.out.println("p=" + parameter.getURI(graph));
- System.out.println("c=" + match.first.getURI(graph));
+ System.out.println("p=" + parameter.getURI(graph)); //$NON-NLS-1$
+ System.out.println("c=" + match.first.getURI(graph)); //$NON-NLS-1$
}
String rvi = Variables.getRVI(graph, match.first, parameter);
if (DEBUG)
- System.out.println("r=" + rvi);
+ System.out.println("r=" + rvi); //$NON-NLS-1$
Resource type = graph.getResource(typeURI);
return null;
if (DEBUG)
- System.out.println("findElementInDiagram " + property.getURI(graph) + " " + property);
+ System.out.println("findElementInDiagram " + property.getURI(graph) + " " + property); //$NON-NLS-1$ //$NON-NLS-2$
DiagramResource DIA = DiagramResource.getInstance(graph);
ModelingResources MOD = ModelingResources.getInstance(graph);
Resource represents = property.getPossibleRepresents(graph);
if (represents != null) {
if (DEBUG)
- System.out.println("represents " + NameUtils.getSafeName(graph, represents, true));
+ System.out.println("represents " + NameUtils.getSafeName(graph, represents, true)); //$NON-NLS-1$
Resource elementResource = graph.getPossibleObject(represents, MOD.ComponentToElement);
// There must have be at least one
// PROPERTY role variable in the
}
}
- return findElementInDiagram(graph, property.browsePossible(graph, "."), propertyRoleFound);
+ return findElementInDiagram(graph, property.browsePossible(graph, "."), propertyRoleFound); //$NON-NLS-1$
}
}
}
protected String getPopupId() {
- return "#ModelingDiagramPopup";
+ return "#ModelingDiagramPopup"; //$NON-NLS-1$
}
protected void getPreferences() {
swt = SWTThread.getThreadAccess(parent.getDisplay());
statusLineManager = getEditorSite().getActionBars().getStatusLineManager();
- Object task = BEGIN("DV.initSession");
+ Object task = BEGIN("DV.initSession"); //$NON-NLS-1$
initSession();
END(task);
readNames();
getPreferences();
- task = BEGIN("DV.createChassis");
+ task = BEGIN("DV.createChassis"); //$NON-NLS-1$
createChassis(parent);
END(task);
}
protected void initializeCanvas() {
- Object canvasInit = BEGIN("DV.canvasInitialization");
+ Object canvasInit = BEGIN("DV.canvasInitialization"); //$NON-NLS-1$
- Object task = BEGIN("DV.createViewerCanvas");
+ Object task = BEGIN("DV.createViewerCanvas"); //$NON-NLS-1$
// ThreadUtils.syncExec(AWTThread.getThreadAccess(), new Runnable() {
// @Override
// public void run() {
//FullscreenUtils.addFullScreenHandler(canvasContext, s, canvasProvider);
- task = BEGIN("DV.setCanvasContext");
+ task = BEGIN("DV.setCanvasContext"); //$NON-NLS-1$
setCanvasContext(canvasContext);
END(task);
try {
- task = BEGIN("DV.loadDiagram");
+ task = BEGIN("DV.loadDiagram"); //$NON-NLS-1$
sourceDiagram = loadDiagram(diagramResource);
END(task);
// Zoom to fit
- task = BEGIN("DV.scheduleZoomToFit");
+ task = BEGIN("DV.scheduleZoomToFit"); //$NON-NLS-1$
// canvasContext.getDefaultHintContext().setHint(Hints.KEY_CANVAS_TRANSFORM, new AffineTransform());
// canvasContext.getContentContext().setDirty();
// Start an activation for the input resource.
// This will activate mapping if necessary.
- task = BEGIN("DV.performActivation");
+ task = BEGIN("DV.performActivation"); //$NON-NLS-1$
performActivation();
END(task);
- task = BEGIN("DV.activate context");
+ task = BEGIN("DV.activate context"); //$NON-NLS-1$
contextUtil.activate(DiagramViewer.DIAGRAMMING_CONTEXT);
END(task);
- task = BEGIN("DV.onCreated");
+ task = BEGIN("DV.onCreated"); //$NON-NLS-1$
onCreated();
END(task);
protected void scheduleZoomToFit() {
if (sourceDiagram == null)
- throw new IllegalStateException("source diagram is null");
+ throw new IllegalStateException("source diagram is null"); //$NON-NLS-1$
sourceDiagram.setHint(Hints.KEY_DISABLE_PAINTING, Boolean.TRUE);
sourceDiagram.setHint(DiagramHints.KEY_INITIAL_ZOOM_TO_FIT, Boolean.TRUE);
PlatformUI.getWorkbench().getProgressService().busyCursorWhile(new IRunnableWithProgress() {
@Override
public void run(IProgressMonitor monitor) throws InvocationTargetException, InterruptedException {
- SubMonitor mon = SubMonitor.convert(monitor, "Loading Diagram", 100);
+ SubMonitor mon = SubMonitor.convert(monitor, Messages.SheetViewer_MonitorLoadingDiagram, 100);
try {
dc.set( loadDiagram(mon.newChild(100), r) );
} catch (DatabaseException e) {
}
protected IDiagram loadDiagram(IProgressMonitor monitor, Resource r) throws DatabaseException {
- SubMonitor mon = SubMonitor.convert(monitor, "Loading Diagram", 100);
+ SubMonitor mon = SubMonitor.convert(monitor, Messages.SheetViewer_MonitorLoadingDiagram, 100);
- Object task = BEGIN("DV.DiagramLoadQuery");
+ Object task = BEGIN("DV.DiagramLoadQuery"); //$NON-NLS-1$
IDiagram d = sessionContext.getSession().syncRequest(DiagramRequests.loadDiagram(mon.newChild(100), getResourceInput2().getModel(null), r, null, structuralPath, synchronizer, null));
END(task);
- task = BEGIN("DV.setDiagramHint");
+ task = BEGIN("DV.setDiagramHint"); //$NON-NLS-1$
canvasContext.getDefaultHintContext().setHint(DiagramHints.KEY_DIAGRAM, d);
END(task);
- task = BEGIN("DV.set other hints");
+ task = BEGIN("DV.set other hints"); //$NON-NLS-1$
// Setup a copy advisor for the synchronizer
//d.setHint(SynchronizationHints.COPY_ADVISOR, new MappedElementCopyAdvisor(new ComponentCopyAdvisor()));
d.setHint(DiagramHints.KEY_USE_CONNECTION_FLAGS, Boolean.FALSE);
}
});
} catch (DatabaseException e) {
- throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e);
+ throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e); //$NON-NLS-1$
}
}
CanvasContext ctx = new CanvasContext(thread);
IHintContext h = ctx.getDefaultHintContext();
- Object task = BEGIN("createSynchronizer");
+ Object task = BEGIN("createSynchronizer"); //$NON-NLS-1$
this.synchronizer = createSynchronizer(ctx, sessionContext);
END(task);
@Override
public void init(IEditorSite site, IEditorInput input) throws PartInitException {
if (!(input instanceof IResourceEditorInput))
- throw new PartInitException("Invalid input: must be IResourceEditorInput");
+ throw new PartInitException("Invalid input: must be IResourceEditorInput"); //$NON-NLS-1$
setSite(site);
setInput(input);
support = new ResourceEditorSupport(this);
IHintContext hints = new HintContext();
hints.setHint(DiagramModelHints.KEY_ACTIVE_EXPERIMENT, experiment);
if(layer != null) {
- System.out.println("using layer '"+layer+"'");
+ System.out.println("using layer '"+layer+"'"); //$NON-NLS-1$ //$NON-NLS-2$
hints.setHint(DiagramHints.KEY_FIXED_LAYERS, new String[] { layer });
}
void scheduleZoomToFit() {
if (sourceDiagram == null)
- throw new IllegalStateException("source diagram is null");
+ throw new IllegalStateException("source diagram is null"); //$NON-NLS-1$
sourceDiagram.setHint(Hints.KEY_DISABLE_PAINTING, Boolean.TRUE);
sourceDiagram.setHint(DiagramHints.KEY_INITIAL_ZOOM_TO_FIT, Boolean.TRUE);
if(experiment != null)
hints.setHint(DiagramModelHints.KEY_ACTIVE_EXPERIMENT, experiment);
if(layer != null) {
- System.out.println("using layer '"+layer+"'");
+ System.out.println("using layer '"+layer+"'"); //$NON-NLS-1$ //$NON-NLS-2$
hints.setHint(DiagramHints.KEY_FIXED_LAYERS, new String[] { layer });
}
IDiagram d = sessionContext.getSession().syncRequest(DiagramRequests.loadDiagram(new NullProgressMonitor(), getResourceInput2().getModel(null), structuralPath.resources[0], null, structuralPath.removeFromBeginning(0), synchronizer, hints));
}
});
} catch (DatabaseException e) {
- throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e);
+ throw new UnsupportedOperationException("Failed to initialize data model synchronizer", e); //$NON-NLS-1$
}
}
@Override
public void dispose() {
- System.out.println("RemoteDiagramViewer.dispose()");
+ System.out.println("RemoteDiagramViewer.dispose()"); //$NON-NLS-1$
if(getSite() != null) {
IContextService contextService = (IContextService) getSite().getService(IContextService.class);
contextService.deactivateContext(contextActivation);
public void init(IEditorSite site, IEditorInput input)
throws PartInitException {
if (!(input instanceof IResourceEditorInput))
- throw new PartInitException("Invalid input: must be IResourceEditorInput");
+ throw new PartInitException("Invalid input: must be IResourceEditorInput"); //$NON-NLS-1$
setSite(site);
setInput(input);
support = new ResourceEditorSupport(this);
try {
SerialisationSupport support = session.getService(SerialisationSupport.class);
ResourceTransferData data = ResourceTransferUtils.readAwtTransferable(support, tr);
- if ("property".equals(data.getPurpose()))
+ if ("property".equals(data.getPurpose())) //$NON-NLS-1$
return data.toResourceArrayArray();
} catch (UnsupportedFlavorException e) {
throw new RuntimeException(e);
import org.eclipse.e4.ui.model.application.ui.basic.MPart;
import org.eclipse.e4.ui.workbench.modeling.EPartService;
import org.eclipse.e4.ui.workbench.modeling.IPartListener;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.widgets.Composite;
import org.eclipse.ui.PartInitException;
*
* @see #setInitializationData(IConfigurationElement, String, Object)
*/
- public static final String ARG_VIEWER = "viewer";
+ public static final String ARG_VIEWER = "viewer"; //$NON-NLS-1$
private Composite parent;
*/
@Override
public void setInitializationData(IConfigurationElement cfig, String propertyName, Object data) {
-// super.setInitializationData(cfig, propertyName, data);
+ // super.setInitializationData(cfig, propertyName, data);
if (data instanceof String) {
viewerContributor = cfig.getContributor().getName();
- String[] parameters = ((String) data).split(";");
+ String[] parameters = ((String) data).split(";"); //$NON-NLS-1$
for (String parameter : parameters) {
- String[] keyValue = parameter.split("=");
+ String[] keyValue = parameter.split("="); //$NON-NLS-1$
if (keyValue.length > 2) {
- ErrorLogger.defaultLogWarning("Invalid parameter '" + parameter + ". Complete view argument: " + data, null);
+ ErrorLogger.defaultLogWarning(NLS.bind(Messages.DiagramEditor_InvalidParameter, parameter, data),
+ null);
continue;
}
String key = keyValue[0];
- String value = keyValue.length > 1 ? keyValue[1] : "";
+ String value = keyValue.length > 1 ? keyValue[1] : ""; //$NON-NLS-1$
if (ARG_VIEWER.equals(key)) {
viewerClassName = value;
- }
+ }
}
}
}
protected DiagramViewer createViewer() throws PartInitException {
if (viewerClassName == null)
throw new PartInitException(
- "DiagramViewer contributor class was not specified in editor extension's class attribute viewer-argument. contributor is '"
- + viewerContributor + "'");
+ "DiagramViewer contributor class was not specified in editor extension's class attribute viewer-argument. contributor is '" //$NON-NLS-1$
+ + viewerContributor + "'"); //$NON-NLS-1$
try {
Bundle b = Platform.getBundle(viewerContributor);
if (b == null)
- throw new PartInitException("DiagramViewer '" + viewerClassName + "' contributor bundle '"
- + viewerContributor + "' was not found in the platform.");
+ throw new PartInitException("DiagramViewer '" + viewerClassName + "' contributor bundle '" //$NON-NLS-1$ //$NON-NLS-2$
+ + viewerContributor + "' was not found in the platform."); //$NON-NLS-1$
Class<?> clazz = b.loadClass(viewerClassName);
if (!DiagramViewer.class.isAssignableFrom(clazz))
- throw new PartInitException("DiagramViewer class '" + viewerClassName + "' is not assignable to "
- + DiagramViewer.class + ".");
+ throw new PartInitException("DiagramViewer class '" + viewerClassName + "' is not assignable to " //$NON-NLS-1$ //$NON-NLS-2$
+ + DiagramViewer.class + "."); //$NON-NLS-1$
Constructor<?> ctor = clazz.getConstructor();
return (DiagramViewer) ctor.newInstance();
} catch (Exception e) {
- throw new PartInitException("Failed to instantiate DiagramViewer implementation '" + viewerClassName
- + "' from bundle '" + viewerContributor + "'. See exception for details.", e);
+ throw new PartInitException("Failed to instantiate DiagramViewer implementation '" + viewerClassName //$NON-NLS-1$
+ + "' from bundle '" + viewerContributor + "'. See exception for details.", e); //$NON-NLS-1$ //$NON-NLS-2$
}
}
--- /dev/null
+package org.simantics.modeling.ui.diagramEditor.e4;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.diagramEditor.e4.messages"; //$NON-NLS-1$
+ public static String DiagramEditor_InvalidParameter;
+ public static String PopulateElementDropParticipant_ActivatorDiagramContentTrackingFailed;
+ public static String PopulateElementDropParticipant_CannotCreateElementIntoDiagram;
+ public static String PopulateElementDropParticipant_CannotInstantiate;
+ public static String PopulateElementDropParticipant_CannotInstantiateUserComponent;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import org.eclipse.core.runtime.Status;
import org.eclipse.e4.ui.model.application.ui.basic.MPart;
import org.eclipse.jface.viewers.IStructuredSelection;
+import org.eclipse.osgi.util.NLS;
import org.simantics.Simantics;
import org.simantics.db.ReadGraph;
import org.simantics.db.RequestProcessor;
return processor.syncRequest(new UniqueRead<String>() {
@Override
public String perform(ReadGraph graph) throws DatabaseException {
-// System.out.println("dragged resource: " + draggedResource);
-// System.out.println("drop target resource: " + dropTarget);
+ // System.out.println("dragged resource: " + draggedResource);
+ // System.out.println("drop target resource: " + dropTarget);
Resource sourceModel = graph.syncRequest(new PossibleIndexRoot(draggedResource));
Resource targetModel = graph.syncRequest(new PossibleIndexRoot(dropTarget));
-// System.out.println("source model: " + sourceModel);
-// System.out.println("target model: " + targetModel);
+ // System.out.println("source model: " + sourceModel);
+ // System.out.println("target model: " + targetModel);
// Prevent dragging data from one source model to another.
// If source is not part of any model, everything is okay.
if (sourceModel != null && !graph.syncRequest(new IsLinkedTo(targetModel, sourceModel))) {
// Prevent a symbol instantiating within its own configuration.
// NOTE: this doesn't handle transitive cycles.
- return "Cannot instantiate " + NameUtils.getSafeName(graph, draggedResource) + " into model "
- + NameUtils.getURIOrSafeNameInternal(graph, targetModel) + ". The source namespace ("
- + NameUtils.getURIOrSafeNameInternal(graph, sourceModel) + ") is not linked to the target model.";
+ return NLS.bind(Messages.PopulateElementDropParticipant_CannotInstantiate,
+ new Object[] { NameUtils.getSafeName(graph, draggedResource),
+ NameUtils.getURIOrSafeNameInternal(graph, targetModel),
+ NameUtils.getURIOrSafeNameInternal(graph, sourceModel) });
}
-
+
// Prevent dragging to published components
ModelingResources MOD = ModelingResources.getInstance(graph);
StructuralResource2 STR = StructuralResource2.getInstance(graph);
Resource configuration = graph.getPossibleObject(dropTarget, MOD.DiagramToComposite);
if (configuration != null) {
Resource componentTypeFromDiagram = graph.getPossibleObject(configuration, STR.Defines);
- if(componentTypeFromDiagram != null) {
- if(Layer0Utils.isPublished(graph, componentTypeFromDiagram))
- return "Cannot create elements into a diagram that belongs to a published user component.";
+ if (componentTypeFromDiagram != null) {
+ if (Layer0Utils.isPublished(graph, componentTypeFromDiagram))
+ return Messages.PopulateElementDropParticipant_CannotCreateElementIntoDiagram;
}
}
if (componentTypeFromSymbol != null) {
if (configuration != null) {
Resource componentTypeFromDiagram = graph.getPossibleObject(configuration, STR.Defines);
- if (componentTypeFromDiagram != null && componentTypeFromSymbol.equals(componentTypeFromDiagram)) {
- return "Cannot instantiate user component within its own configuration.";
+ if (componentTypeFromDiagram != null
+ && componentTypeFromSymbol.equals(componentTypeFromDiagram)) {
+ return Messages.PopulateElementDropParticipant_CannotInstantiateUserComponent;
}
}
}
@Override
public void drop(DropTargetDropEvent dtde, final IDnDContext dp) {
- TimeLogger.resetTimeAndLog(getClass(), "drop");
+ TimeLogger.resetTimeAndLog(getClass(), "drop"); //$NON-NLS-1$
final IDiagram d = getHint(DiagramHints.KEY_DIAGRAM);
if (d == null)
}
}
} catch (DatabaseException e) {
- Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, "Diagram content change tracking failed.", e));
+ Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID, Messages.PopulateElementDropParticipant_ActivatorDiagramContentTrackingFailed, e));
}
}
--- /dev/null
+DiagramEditor_InvalidParameter=Invalid parameter ''{0}''. Complete view argument: {1}
+PopulateElementDropParticipant_ActivatorDiagramContentTrackingFailed=Diagram content change tracking failed.
+PopulateElementDropParticipant_CannotCreateElementIntoDiagram=Cannot create elements into a diagram that belongs to a published user component.
+PopulateElementDropParticipant_CannotInstantiate=Cannot instantiate {0} into model {1}. The source namespace ({2}) is not linked to the target model.
+PopulateElementDropParticipant_CannotInstantiateUserComponent=Cannot instantiate user component within its own configuration.
+DiagramEditor_InvalidParameter=Invalid parameter ''{0}''. Complete view argument: {1}
+DiagramLayersPage_Focus=Focus
+DiagramLayersPage_FocusActive=Focus Active
+DiagramLayersPage_FocusActiveTT=Only Focus Diagram Elements For Active Roles
+DiagramLayersPage_FocusAll=Focus All
+DiagramLayersPage_FocusAllTT=Focus All Diagram Elements Regardless Of Active Roles
+DiagramLayersPage_New=New
+DiagramLayersPage_NewRole=New Role
+DiagramLayersPage_NewTT=Create New Diagram Role
+DiagramLayersPage_Remove=Remove
+DiagramLayersPage_RemoveTT=Remove Selected Diagram Role
+DiagramLayersPage_Role=Role
+DiagramLayersPage_SelectTT=Selects the diagram to include in the exported document.
+DiagramLayersPage_Show=Show
+DiagramLayersPage_ShowActive=Show Active
+DiagramLayersPage_ShowActiveTT=Only Show Diagram Elements For Active Roles
+DiagramLayersPage_ShowAll=Show All
+DiagramLayersPage_ShowAllTT=Show All Diagram Elements Regardless Of Active Roles
+DiagramViewer_FailedtoLoadModeled=Failed to load modeled browse contexts for property page, see exception for details.
+DiagramViewer_MonitorActivateMapping=Activate Mapping
+DiagramViewerActionContributor_ConnectMode=Connect Mode
+DiagramViewerActionContributor_PointerMode=Pointer Mode
+DiagramViewerLoadJob_ActivatorDiagramLoadingCancelled=Diagram loading was cancelled.
+DiagramViewerLoadJob_ActivatorDiagramLoadingFailed=Diagram loading failed, see exception for details.
+DiagramViewerLoadJob_ApplyEditorState=Apply editor state
+DiagramViewerLoadJob_LoadDiagram=Load Diagram
+DiagramViewerLoadJob_MonitorFinalizeDiagramLoading=Finalize Diagram Loading
+DiagramViewerLoadJob_MonitorLoadingDiagram=Loading Diagram
+DiagramViewerLoadJob_SetDiagram=Set Diagram
+OpenDiagramAdapter_DiagramEditor=Diagram Editor
+OpenDiagramFromComponentAdapter_ChooseDiagramComponetReference=Choose Diagram with Component Reference
+OpenDiagramFromComponentAdapter_OpenDiagramContainingComponent=Open Diagram Containing This Component
+OpenDiagramFromComponentAdapter_SelectSingleDiagramfromList=Select single diagram from list
+OpenDiagramFromConfigurationAdapter_DiagramEditor=Diagram Editor
+OpenDiagramFromIssue_OpenDiagramRefComponent=Open Diagram Containing Referenced Component
+OpenDiagramFromSymbolAdapter_SymbolEditor=Symbol Editor
+OpenSheetAdapter_SpreadsheetEditor=Spreadsheet Editor
PopulateElementDropParticipant_PreDropFixesFailed=Drop failed because the following pre-drop fixes could not be performed:\n\n{0}
PopulateElementDropParticipant_PreDropFixesFailed_Title=Drop Failed
+SheetViewer_MonitorLoadingDiagram=Loading Diagram
--- /dev/null
+ModelingUIUtils_SelectQueryType=Select query type from list\r
--- /dev/null
+package org.simantics.modeling.ui.wizard;
+
+import org.eclipse.osgi.util.NLS;
+
+public class Messages extends NLS {
+ private static final String BUNDLE_NAME = "org.simantics.modeling.ui.wizard.messages"; //$NON-NLS-1$
+ public static String MigrateWizard_ActivatorMigrationFailed;
+ public static String MigrateWizard_ActivatorMigrationInterrupted;
+ public static String MigrateWizard_BrowseAnd;
+ public static String MigrateWizard_BrowseAnd1;
+ public static String MigrateWizard_Continue;
+ public static String MigrateWizard_InstanceFoundCannotBeMigrated;
+ public static String MigrateWizard_InstancesWereFound;
+ public static String MigrateWizard_LocationAnd;
+ public static String MigrateWizard_LocationInstance;
+ public static String MigrateWizard_MigratableInstancesFound;
+ public static String MigrateWizard_MigrationReport;
+ public static String MigrateWizard_MonitorCommitingChanges;
+ public static String MigrateWizard_NoInstancesFound;
+ public static String MigrateWizard_NoInstancesWereFound;
+ public static String MigrateWizard_NumberOfInstancesFound;
+ public static String MigrateWizard_OneMigratableInstanceFound;
+ public static String MigrateWizard_PerformMigration;
+ public static String MigrateWizard_RetainSymbolName;
+ public static String MigrateWizard_SelectAllAnd;
+ public static String MigrateWizard_SelectInstancesToMigrate;
+ public static String MigrateWizard_SelectNoneAnd;
+ public static String MigrateWizard_SelectSourceType;
+ public static String MigrateWizard_SelectTargetType;
+ public static String MigrateWizard_SourceAnd;
+ public static String MigrateWizard_TargetAnd;
+ public static String MigrateWizard_TargetAndSymbol;
+ static {
+ // initialize resource bundle
+ NLS.initializeMessages(BUNDLE_NAME, Messages.class);
+ }
+
+ private Messages() {
+ }
+}
import org.eclipse.jface.window.Window;
import org.eclipse.jface.wizard.Wizard;
import org.eclipse.jface.wizard.WizardPage;
+import org.eclipse.osgi.util.NLS;
import org.eclipse.swt.SWT;
import org.eclipse.swt.custom.CCombo;
import org.eclipse.swt.events.ModifyEvent;
import org.simantics.db.WriteGraph;
import org.simantics.db.common.NamedResource;
import org.simantics.db.common.request.ObjectsWithType;
-import org.simantics.db.common.request.ReadRequest;
import org.simantics.db.common.request.UnaryRead;
import org.simantics.db.common.request.UniqueRead;
import org.simantics.db.common.request.WriteResultRequest;
this.initial = initial;
- setWindowTitle("Perform migration");
+ setWindowTitle(Messages.MigrateWizard_PerformMigration);
setNeedsProgressMonitor(true);
setForcePreviousAndNextButtons(false);
setDialogSettings(Activator.getDefault().getDialogSettings());
- prefnode = InstanceScope.INSTANCE.getNode( "org.simantics.modeling.ui.wizard.MigrateWizard" );
+ prefnode = InstanceScope.INSTANCE.getNode( "org.simantics.modeling.ui.wizard.MigrateWizard" ); //$NON-NLS-1$
}
graph.markUndoPoint();
String report = UserComponentMigration.doMigration(mon.newChild(500, SubMonitor.SUPPRESS_NONE), graph, result);
UserComponentMigration.doPostMigration(mon.newChild(500, SubMonitor.SUPPRESS_NONE), graph, result);
- mon.setTaskName("Committing Changes");
- mon.subTask("");
+ mon.setTaskName(Messages.MigrateWizard_MonitorCommitingChanges);
+ mon.subTask(""); //$NON-NLS-1$
return report;
}
});
Throwable cause = e.getCause();
if (!(cause instanceof CancelTransactionException || cause instanceof OperationCanceledException)) {
Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Migration failed, see Error Log for details.", e.getCause()));
+ Messages.MigrateWizard_ActivatorMigrationFailed, e.getCause()));
}
} catch (InterruptedException e) {
Activator.getDefault().getLog().log(new Status(IStatus.ERROR, Activator.PLUGIN_ID,
- "Migration interrupted, see Error Log for details.", e));
+ Messages.MigrateWizard_ActivatorMigrationInterrupted, e));
}
return false;
}
public ReportDialog(Shell shell, String report, int width, int height) {
super(shell,
- "Migration report", null,
- "",
- MessageDialog.INFORMATION, new String[] { "Continue" }, 0);
+ Messages.MigrateWizard_MigrationReport, null,
+ "", //$NON-NLS-1$
+ MessageDialog.INFORMATION, new String[] { Messages.MigrateWizard_Continue }, 0);
this.report = report;
this.initialWidth = width;
this.initialHeight = height;
String previouslySelectedLocationId = null;
public MigratePage(String initial) {
- super("Perform migration", "Perform migration", null);
+ super(Messages.MigrateWizard_PerformMigration, Messages.MigrateWizard_PerformMigration, null);
this.initial = initial;
}
container.setLayout(layout);
}
- new Label(container, SWT.NONE).setText("&Source:");
+ new Label(container, SWT.NONE).setText(Messages.MigrateWizard_SourceAnd);
source = new Text(container, SWT.BORDER);
source.setText(initial);
source.addModifyListener(new ModifyListener() {
GridDataFactory.fillDefaults().grab(true, false).span(8, 1).applyTo(source);
browseSource = new Button(container, SWT.NONE);
- browseSource.setText("&Browse");
+ browseSource.setText(Messages.MigrateWizard_BrowseAnd);
GridDataFactory.fillDefaults().grab(false, false).applyTo(browseSource);
browseSource.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e_) {
try {
Map<String, Pair<String, ImageDescriptor>> map = Simantics.getSession().syncRequest(new BrowseSourceContentRequest(target.getText()));
- String uri = queryTargetSelection("Select Source Type", map);
+ String uri = queryTargetSelection(Messages.MigrateWizard_SelectSourceType, map);
if (uri != null)
source.setText(uri);
} catch (DatabaseException e) {
}
});
- new Label(container, SWT.NONE).setText("&Target:");
+ new Label(container, SWT.NONE).setText(Messages.MigrateWizard_TargetAnd);
target = new Text(container, SWT.BORDER);
target.setText(initial);
target.addModifyListener(new ModifyListener() {
GridDataFactory.fillDefaults().grab(true, false).span(8, 1).applyTo(target);
browseTarget = new Button(container, SWT.NONE);
- browseTarget.setText("B&rowse");
+ browseTarget.setText(Messages.MigrateWizard_BrowseAnd1);
GridDataFactory.fillDefaults().grab(false, false).applyTo(browseTarget);
browseTarget.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e_) {
try {
Map<String, Pair<String, ImageDescriptor>> map = Simantics.getSession().syncRequest(new BrowseTargetContentRequest(source.getText()));
- String uri = queryTargetSelection("Select Target Type", map);
+ String uri = queryTargetSelection(Messages.MigrateWizard_SelectTargetType, map);
if (uri != null)
target.setText(uri);
} catch (DatabaseException e) {
});
symbolsLabel = new Label(container, SWT.NONE);
- symbolsLabel.setText("Target &symbol:");
+ symbolsLabel.setText(Messages.MigrateWizard_TargetAndSymbol);
GridDataFactory.fillDefaults().applyTo(symbolsLabel);
symbols = new CCombo(container, SWT.BORDER | SWT.READ_ONLY);
instanceLabel = new Label(container, SWT.NONE);
GridDataFactory.fillDefaults().grab(true, false).span(10, 1).applyTo(instanceLabel);
- instanceLabel.setText("");
+ instanceLabel.setText(""); //$NON-NLS-1$
locationsLabel = new Label(container, SWT.NONE);
- locationsLabel.setText("&Locations:");
+ locationsLabel.setText(Messages.MigrateWizard_LocationAnd);
locations = new CCombo(container, SWT.BORDER | SWT.READ_ONLY);
locations.setVisibleItemCount(25);
locations.addSelectionListener(new SelectionAdapter() {
GridDataFactory.fillDefaults().grab(true, false).span(9, 1).applyTo(locations);
instancesLabel = new Label(container, SWT.NONE);
- instancesLabel.setText("&Select instances to migrate:");
+ instancesLabel.setText(Messages.MigrateWizard_SelectInstancesToMigrate);
GridDataFactory.fillDefaults().grab(true, false).span(10, 1).applyTo(instancesLabel);
buttonBar = new Composite(container, SWT.NONE);
RowLayoutFactory.fillDefaults().type(SWT.HORIZONTAL).applyTo(buttonBar);
GridDataFactory.fillDefaults().grab(true, false).span(10, 1).applyTo(buttonBar);
Button selectAll = new Button(buttonBar, SWT.PUSH);
- selectAll.setText("Select &All");
+ selectAll.setText(Messages.MigrateWizard_SelectAllAnd);
Button selectNone = new Button(buttonBar, SWT.PUSH);
- selectNone.setText("Select &None");
+ selectNone.setText(Messages.MigrateWizard_SelectNoneAnd);
selectAll.addSelectionListener(new SelectionAdapter() {
@Override
public void widgetSelected(SelectionEvent e) {
});
symbols.removeAll();
- symbols.add("<retain symbol name>");
+ symbols.add(Messages.MigrateWizard_RetainSymbolName);
for(NamedResource nr : syms) {
symbols.add(nr.getName());
}
int preSelect = -1, i = 0;
for (Triple<String,NamedResource,Collection<MigrationOperation>> r : model.instances) {
- locations.add(r.second.getName() + " (" + r.third.size() + " instances)");
+ locations.add(NLS.bind(Messages.MigrateWizard_LocationInstance, r.second.getName(), r.third.size()));
if (r.first.equals(previouslySelectedLocationId))
preSelect = i;
if (preSelect < 0 && model.activeModels.contains(r.second.getResource()))
++i;
}
if (locations.getItemCount() == 0) {
- locations.add("<no instances were found>");
+ locations.add(Messages.MigrateWizard_NoInstancesFound);
locations.select(0);
} else {
locations.select(preSelect > -1 ? preSelect : 0);
void refreshInstances() {
int toMigrate = 0;
- for(Triple<String,NamedResource,Collection<MigrationOperation>> pair : model.instances) {
+ for (Triple<String, NamedResource, Collection<MigrationOperation>> pair : model.instances) {
toMigrate += pair.third.size();
}
- if(model.instanceCount == 0)
- instanceLabel.setText("No instances were found.");
- else if(model.instanceCount == 1) {
- if(toMigrate == 1) {
- instanceLabel.setText("1 migratable instance found.");
+ if (model.instanceCount == 0)
+ instanceLabel.setText(Messages.MigrateWizard_NoInstancesWereFound);
+ else if (model.instanceCount == 1) {
+ if (toMigrate == 1) {
+ instanceLabel.setText(Messages.MigrateWizard_OneMigratableInstanceFound);
} else {
- instanceLabel.setText("1 instance found, but it cannot be migrated with current settings.");
+ instanceLabel.setText(Messages.MigrateWizard_InstanceFoundCannotBeMigrated);
}
} else {
- if(toMigrate < model.instanceCount) {
- if(toMigrate == 0) {
- instanceLabel.setText(model.instanceCount + " instances were found. None of them can be migrated with current settings.");
+ if (toMigrate < model.instanceCount) {
+ if (toMigrate == 0) {
+ instanceLabel
+ .setText(NLS.bind(Messages.MigrateWizard_NumberOfInstancesFound, model.instanceCount));
} else {
- instanceLabel.setText(model.instanceCount + " instances were found. " + (model.instanceCount-toMigrate) + " of them cannot be migrated with current settings.");
+ instanceLabel.setText(NLS.bind(Messages.MigrateWizard_InstancesWereFound, model.instanceCount,
+ (model.instanceCount - toMigrate)));
}
} else {
- instanceLabel.setText(model.instanceCount + " migratable instances found. ");
+ instanceLabel
+ .setText(NLS.bind(Messages.MigrateWizard_MigratableInstancesFound, model.instanceCount));
}
}
if (model == null)
return;
- if(toMigrate == 0) {
+ if (toMigrate == 0) {
locationsLabel.setVisible(false);
locations.setVisible(false);
GridDataFactory.fillDefaults().exclude(true).applyTo(locationsLabel);
GridDataFactory.fillDefaults().grab(true, false).span(9, 1).applyTo(locations);
}
- if(!model.instances.isEmpty()) {
+ if (!model.instances.isEmpty()) {
int locationIndex = locations.getSelectionIndex();
- if(locationIndex == -1) return;
+ if (locationIndex == -1)
+ return;
model.sortedShownInstances = new ArrayList<>();
- for(MigrationOperation o : model.instances.get(locationIndex).third)
+ for (MigrationOperation o : model.instances.get(locationIndex).third)
model.sortedShownInstances.add(o);
Collections.sort(model.sortedShownInstances, MIGRATION_OP_COMPARATOR);
- for(MigrationOperation o : model.sortedShownInstances) {
+ for (MigrationOperation o : model.sortedShownInstances) {
String uri = o.toString();
- uri = uri.replace("http://Projects/Development%20Project/", "");
+ uri = uri.replace("http://Projects/Development%20Project/", ""); //$NON-NLS-1$ //$NON-NLS-2$
uri = URIStringUtils.unescape(uri);
instances.add(uri);
}
}
- if(model.sortedShownInstances.isEmpty()) {
+ if (model.sortedShownInstances.isEmpty()) {
instancesLabel.setVisible(false);
instances.setVisible(false);
buttonBar.setVisible(false);
--- /dev/null
+MigrateWizard_ActivatorMigrationFailed=Migration failed, see Error Log for details.
+MigrateWizard_ActivatorMigrationInterrupted=Migration interrupted, see Error Log for details.
+MigrateWizard_BrowseAnd=&Browse
+MigrateWizard_BrowseAnd1=B&rowse
+MigrateWizard_Continue=Continue
+MigrateWizard_InstanceFoundCannotBeMigrated=1 instance found, but it cannot be migrated with current settings.
+MigrateWizard_InstancesWereFound={0} instances were found. {1} of them cannot be migrated with current settings.
+MigrateWizard_LocationAnd=&Locations:
+MigrateWizard_LocationInstance={0} ({1} instances)
+MigrateWizard_MigratableInstancesFound={0} migratable instances found.
+MigrateWizard_MigrationReport=Migration report
+MigrateWizard_MonitorCommitingChanges=Committing Changes
+MigrateWizard_NoInstancesFound=<no instances were found>
+MigrateWizard_NoInstancesWereFound=No instances were found.
+MigrateWizard_NumberOfInstancesFound={0} instances were found. None of them can be migrated with current settings.
+MigrateWizard_OneMigratableInstanceFound=1 migratable instance found.
+MigrateWizard_PerformMigration=Perform migration
+MigrateWizard_RetainSymbolName=<retain symbol name>
+MigrateWizard_SelectAllAnd=Select &All
+MigrateWizard_SelectInstancesToMigrate=&Select instances to migrate:
+MigrateWizard_SelectNoneAnd=Select &None
+MigrateWizard_SelectSourceType=Select Source Type
+MigrateWizard_SelectTargetType=Select Target Type
+MigrateWizard_SourceAnd=&Source:
+MigrateWizard_TargetAnd=&Target:
+MigrateWizard_TargetAndSymbol=Target &symbol:
TYPE_MAP.put("Vector Double", Types.vector(Types.DOUBLE));
TYPE_MAP.put("Vector String", Types.vector(Types.STRING));
TYPE_MAP.put("ByteArray", Types.BYTE_ARRAY);
-
+
+ // #83: L0.typeResource
+ TCon variable = Types.con("Simantics/Variables", "Variable");
+ add(variable);
+ TYPE_MAP.put("Variable -> Resource -> <ReadGraph> Resource",
+ Types.functionE(new Type[] {variable, Types.RESOURCE}, Types.READ_GRAPH, Types.RESOURCE));
+
add((TCon)Types.RESOURCE);
add(Types.con("Simantics/GUID", "GUID")); // L0.GUID
add(Types.con("Simantics/Variables", "StructuredProperty")); // L0.methods
/*******************************************************************************
- * Copyright (c) 2007, 2018 Association for Decentralized Information Management
+ * Copyright (c) 2007, 2010 Association for Decentralized Information Management
* in Industry THTH ry.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
import org.eclipse.jface.viewers.ISelection;
import org.eclipse.jface.viewers.ISelectionChangedListener;
import org.eclipse.jface.viewers.SelectionChangedEvent;
+import org.eclipse.jface.viewers.StructuredSelection;
+import org.simantics.utils.ObjectUtils;
/**
* BaseSelectionProvider is a base implementation ISelectionProvider -interface.
* </p>
*
* @author Toni Kalajainen
- * @author Tuukka Lehtonen
*/
-public class BasePostSelectionProvider extends BaseSelectionProvider implements IPostSelectionProvider {
+public class BasePostSelectionProvider implements IPostSelectionProvider {
- protected ListenerList<ISelectionChangedListener> postSelectionListeners = new ListenerList<>();
+ protected ListenerList selectionListeners = new ListenerList();
+
+ protected ListenerList postSelectionListeners = new ListenerList();
+
+ protected ISelection selection = StructuredSelection.EMPTY;
+
+ public void addSelectionChangedListener(ISelectionChangedListener listener) {
+ selectionListeners.add(listener);
+ }
+
+ public ISelection getSelection() {
+ return selection;
+ }
public void clearListeners() {
- super.clearListeners();
- clearPostSelectionChangedListeners();
+ selectionListeners.clear();
+ postSelectionListeners.clear();
+ }
+
+ public void clearSelectionChangedListeners() {
+ postSelectionListeners.clear();
}
public void clearPostSelectionChangedListeners() {
postSelectionListeners.clear();
}
+ public void removeSelectionChangedListener(ISelectionChangedListener listener) {
+ selectionListeners.remove(listener);
+ }
+
@Override
public void addPostSelectionChangedListener(ISelectionChangedListener listener) {
postSelectionListeners.add(listener);
postSelectionListeners.remove(listener);
}
+ public void setSelection(ISelection selection) {
+ setSelectionWithoutFiring(selection);
+ }
+
+ protected Object[] getListeners() {
+ return selectionListeners.getListeners();
+ }
+
protected Object[] getPostListeners() {
return postSelectionListeners.getListeners();
}
+ /**
+ * Notify other UIs that selection has changed
+ * @param selection new selection
+ */
+ public void fireSelection(ISelection selection) {
+ if (selection == null)
+ return;
+ SelectionChangedEvent e = new SelectionChangedEvent(this, selection);
+ for (Object l : getListeners())
+ ((ISelectionChangedListener) l).selectionChanged(e);
+ }
+
/**
* Notify other UIs that selection has changed
* @param selection new selection
}
}
+ public void setSelectionWithoutFiring(ISelection selection) {
+ this.selection = selection;
+ }
+
+
+ /**
+ * Sets a new selection and always fires a SelectionChangedEvent about it.
+ *
+ * @param selection the new selection
+ */
+ public void setAndFireSelection(ISelection selection) {
+ setSelection(selection);
+ fireSelection(selection);
+ }
+
+ /**
+ * Sets the new selection for this provider and fires all selection change
+ * listeners if the specified selection differs from the current selection.
+ * If the selection is either the same object or considered equal to the
+ * current selection, the listeners are not fired.
+ *
+ * @param selection the new selection
+ */
+ public void setAndFireNonEqualSelection(ISelection selection) {
+ ISelection old = getSelection();
+ if (ObjectUtils.objectEquals(old, selection))
+ return;
+
+ this.selection = selection;
+ if (selection != null && !selection.equals(old))
+ fireSelection(selection);
+ }
+
+ public boolean selectionEquals(ISelection s) {
+ if (s == selection)
+ return true;
+ if (s == null)
+ // Old selection had to be non-null
+ return true;
+ return s.equals(selection);
+ }
+
}
/*******************************************************************************
- * Copyright (c) 2007, 2018 Association for Decentralized Information Management
+ * Copyright (c) 2007, 2010 Association for Decentralized Information Management
* in Industry THTH ry.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
import org.eclipse.jface.viewers.ISelectionProvider;
import org.eclipse.jface.viewers.SelectionChangedEvent;
import org.eclipse.jface.viewers.StructuredSelection;
-import org.simantics.utils.ObjectUtils;
/**
* BaseSelectionProvider is a base implementation ISelectionProvider -interface.
*/
public class BaseSelectionProvider implements ISelectionProvider {
- protected ListenerList<ISelectionChangedListener> selectionListeners = new ListenerList<>();
+ protected ListenerList selectionListeners = new ListenerList();
protected ISelection selection = StructuredSelection.EMPTY;
return selection;
}
- public void clearListeners() {
- clearSelectionChangedListeners();
- }
-
- public void clearSelectionChangedListeners() {
- selectionListeners.clear();
- }
-
public void removeSelectionChangedListener(ISelectionChangedListener listener) {
selectionListeners.remove(listener);
}
*
* @param selection the new selection
*/
- public boolean setAndFireNonEqualSelection(ISelection selection) {
+ public void setAndFireNonEqualSelection(ISelection selection) {
ISelection old = getSelection();
- if (ObjectUtils.objectEquals(old, selection))
- return false;
+ if (selection == old)
+ return;
this.selection = selection;
- if (selection != null)
+ if (selection != null && !selection.equals(old))
fireSelection(selection);
- return true;
}
public boolean selectionEquals(ISelection s) {
import org.eclipse.jface.viewers.ISelection;
import org.eclipse.jface.viewers.ISelectionChangedListener;
import org.eclipse.jface.viewers.ISelectionProvider;
+import org.eclipse.jface.viewers.SelectionChangedEvent;
import org.eclipse.swt.SWT;
import org.eclipse.swt.widgets.Composite;
+import org.eclipse.swt.widgets.Event;
+import org.eclipse.swt.widgets.Listener;
import org.eclipse.ui.IWorkbenchSite;
import org.simantics.browsing.ui.Column;
import org.simantics.browsing.ui.StatePersistor;
public Boolean useNodeBrowseContexts;
public Boolean useNodeActionContexts;
public StatePersistor persistor;
-
+
public ISelection lastSelection;
-
- private ISelectionChangedListener internalToExternalSelectionPropagator = event -> {
- IWorkbenchSite site = getSite();
- if (site != null) {
- ISelectionProvider sp = site.getSelectionProvider();
- if (sp != null) {
- sp.setSelection(event.getSelection());
- }
- }
- };
-
+
@Override
public void createControls(Composite parent) {
if (uiContext != null) {
control.setUiContexts(Collections.singleton(uiContext));
}
-
+
control.setStatePersistor(persistor);
-
+
control.finish();
setProperties();
-
+
control.setInputSource(PassThruInputSource.INSTANCE);
- ISelectionProvider isp = (ISelectionProvider)control.getExplorer().getAdapter(ISelectionProvider.class);
- if (isp instanceof IPostSelectionProvider) {
- ((IPostSelectionProvider) isp).addPostSelectionChangedListener(internalToExternalSelectionPropagator);
- } else {
- isp.addSelectionChangedListener(internalToExternalSelectionPropagator);
- }
-
- control.addListenerToControl(SWT.Selection, event -> {
- if(selectionListener != null)
- selectionListener.apply(event);
- ISelection selection = (ISelection)control.getExplorer().getWidgetSelection();
- propertyCallback.apply("selection", selection);
- lastSelection = selection;
+ ISelectionProvider sp = (ISelectionProvider)control.getExplorer().getAdapter(ISelectionProvider.class);
+ sp.addSelectionChangedListener(new ISelectionChangedListener() {
+
+ @Override
+ public void selectionChanged(SelectionChangedEvent event) {
+ if (site != null) {
+ ISelectionProvider sp = site.getSelectionProvider();
+ if (sp != null) {
+ sp.setSelection(event.getSelection());
+ }
+ }
+ }
+
});
-
+
+ IPostSelectionProvider psp = (IPostSelectionProvider)control.getExplorer().getAdapter(IPostSelectionProvider.class);
+ psp.addPostSelectionChangedListener(new ISelectionChangedListener() {
+
+ @Override
+ public void selectionChanged(SelectionChangedEvent event) {
+
+// ISelection selection = (ISelection)control.getExplorer().getWidgetSelection();
+ if (site != null) {
+ ISelectionProvider sp = site.getSelectionProvider();
+ if (sp != null) {
+ sp.setSelection(event.getSelection());
+ }
+ }
+
+ }
+
+ });
+
+ control.addListenerToControl(SWT.Selection, new Listener() {
+
+ @Override
+ public void handleEvent(Event event) {
+
+ if(selectionListener != null)
+ selectionListener.apply(event);
+
+ ISelection selection = (ISelection)control.getExplorer().getWidgetSelection();
+ // [Tuukka@2012-04-08] Disabled this because it was causing
+ // horrible selection feedback effects in the Model Browser
+ // view that is using it. It causes the browser to react to
+ // external selections which were initially published as its own
+ // with a delay.
+ //System.out.println("selection: " + selection);
+// if(publishSelection != null && publishSelection) {
+// if (site != null) {
+// ISelectionProvider sp = site.getSelectionProvider();
+// if (sp != null) {
+// sp.setSelection(selection);
+// }
+// }
+// }
+
+ propertyCallback.apply("selection", selection);
+
+ lastSelection = selection;
+
+ }
+
+ });
+
}
public void synchronizeColumnsVisible(Boolean columnsVisible) {
final public void synchronizeLayout(LayoutBean layout) {
}
-
- @Override
- public void dispose() {
- ISelectionProvider isp = (ISelectionProvider)control.getExplorer().getAdapter(ISelectionProvider.class);
- if (isp instanceof IPostSelectionProvider) {
- ((IPostSelectionProvider) isp).removePostSelectionChangedListener(internalToExternalSelectionPropagator);
- } else {
- isp.removeSelectionChangedListener(internalToExternalSelectionPropagator);
- }
- super.dispose();
- }
-
+
}
org.simantics.project;bundle-version="1.0.1",
org.simantics.scenegraph.loader;bundle-version="1.0.0";visibility:=reexport,
org.simantics.scenegraph.ontology;bundle-version="1.0.0",
- org.simantics.utils.thread.swt;bundle-version="1.1.0",
- org.slf4j.api
+ org.simantics.utils.thread.swt;bundle-version="1.1.0"
Export-Package: org.simantics.views.swt
Bundle-Activator: org.simantics.views.swt.Activator
Bundle-Vendor: Semantum Oy
import org.eclipse.ui.IWorkbenchPartReference;
import org.eclipse.ui.IWorkbenchSite;
import org.simantics.Simantics;
+import org.simantics.browsing.ui.common.ErrorLogger;
import org.simantics.browsing.ui.swt.widgets.impl.WidgetSupport;
import org.simantics.browsing.ui.swt.widgets.impl.WidgetSupportImpl;
import org.simantics.db.ReadGraph;
import org.simantics.db.WriteGraph;
import org.simantics.db.common.request.WriteRequest;
import org.simantics.db.common.request.WriteResultRequest;
+import org.simantics.db.common.utils.Logger;
import org.simantics.db.exception.DatabaseException;
import org.simantics.db.exception.ServiceNotFoundException;
import org.simantics.db.layer0.util.RemoverUtil;
import org.simantics.scenegraph.ontology.ScenegraphResources;
import org.simantics.scl.runtime.function.Function1;
import org.simantics.ui.workbench.IPropertyPage;
-import org.simantics.utils.ui.ErrorLogger;
-import org.simantics.utils.ui.jface.BasePostSelectionProvider;
+import org.simantics.utils.ui.jface.ActiveSelectionProvider;
import org.simantics.views.swt.client.base.SWTRoot;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
/**
* To use this class, first model your view contents in .pgraph files according
*/
public class ModelledView extends SimanticsView implements IPartListener2 {
- private static final Logger LOGGER = LoggerFactory.getLogger(ModelledView.class);
-
public static final int TIME_BEFORE_DISPOSE_WHEN_HIDDEN = 30000; // ms
private static final boolean DEBUG = false;
protected ModelledSupport support;
- private BasePostSelectionProvider selectionProvider = new BasePostSelectionProvider() {
+ ActiveSelectionProvider selectionProvider = new ActiveSelectionProvider() {
@Override
public void setSelection(ISelection selection) {
- super.setAndFireNonEqualSelection(selection);
- super.firePostSelection(selection);
+ super.setSelection(selection);
}
};
@Override
protected WidgetSupportImpl createSupport() {
+
try {
runtime = Simantics.getSession().sync(
new WriteResultRequest<Resource>(Simantics.getSession().getService(VirtualGraph.class)) {
return runtime;
}
});
- } catch (ServiceNotFoundException | DatabaseException e) {
- LOGGER.error("Failed to initialize modelled view database runtime support structures", e);
+ } catch (ServiceNotFoundException e) {
+ Logger.defaultLogError(e);
+ } catch (DatabaseException e) {
+ Logger.defaultLogError(e);
}
support = new ModelledSupport(this);
return support;
+
}
public void fireInput() {
}
if (load) {
+
try {
+
loader = new SWTViewLoaderProcess(this, getSite(), getClass().getSimpleName());
viewVariable = loader.getVariable(Simantics.getSession(), configurationURI(), runtime);
body.layout(true);
+ getSite().setSelectionProvider(selectionProvider);
+
} catch (DatabaseException e) {
- LOGGER.error("Failed to create modelled SWT view controls", e);
+
+ e.printStackTrace();
+ Logger.defaultLogError(e);
+
}
+
}
+
}
@Override
// Only create controls if the part is TRULY visible.
// Fast view parts seem to cause calls to createPartControl even
// when the part is hidden in reality
+ boolean visible = site.getPage().isPartVisible(this);
if (DEBUG)
System.out.println(this + ": createControls( visible=" + site.getPage().isPartVisible(this) + " )");
doCreateControls(true);
getSite().setSelectionProvider(selectionProvider);
getSite().getPage().addPartListener(this);
+
}
protected void inputChanged(IWorkbenchPart provider, Object input) {
RemoverUtil.remove(graph, rt);
}
});
- } catch (ServiceNotFoundException | DatabaseException e) {
- LOGGER.error("Failed to dispose of modelled view database runtime support structures", e);
+ } catch (ServiceNotFoundException e) {
+ Logger.defaultLogError(e);
+ } catch (DatabaseException e) {
+ Logger.defaultLogError(e);
}
}
}
}
}
-
+
// Can be used to cancel already scheduled dispose
volatile boolean reallyClearExisting = false;
-
+
Runnable clearExisting = new Runnable() {
@Override
protected IPropertyPage getPropertyPage() {
return null;
}
-
+
}
## Strings externalized from bundles ##
* [x] org.simantics.scl.ui
+* [x] org.simantics.db.procore.ui
+* [x] org.simantics.debug.ui
+* [x] org.simantics.desktop.ui
+* [x] org.simantics.document.linking.ui
+* [x] org.simantics.document.ui
+* [x] org.simantics.document.ui.ontology
+* [x] org.simantics.export.ui
+* [x] org.simantics.fileimport.ui
+* [x] org.simantics.graphviz.ui
+* [x] org.simantics.help.ui
+* [x] org.simantics.image.ui
+* [x] org.simantics.issues.ui
+* [x] org.simantics.logging.ui
+* [x] org.simantics.message.ui
+* [x] org.simantics.migration.ui
+* ...
## TODO ##
+* /org.simantics.browsing.ui
+* /org.simantics.browsing.ui.common (All can be ignored)
+* /org.simantics.browsing.ui.graph (Nothing to externalize or all can be ignored)
+* /org.simantics.browsing.ui.graph (Nothing to externalize or all can be ignored)
+* /org.simantics.browsing.ui.graph.impl (Nothing to externalize or all can be ignored)
+* /org.simantics.browsing.ui.model
+* /org.simantics.browsing.ui.nattable
+* /org.simantics.browsing.ui.ontology (Nothing to externalize or all can be ignored)
+* /org.simantics.browsing.ui.platform (Nothing to externalize or all can be ignored)
+* /org.simantics.browsing.ui.swt (Nothing to externalize or all can be ignored)
+* /org.simantics.debug.browser.ui (Nothing to externalize or all can be ignored)
+* /org.simantics.desktop.ui.ontology (No strings to externalize)
+* /org.simantics.issues.ui.ontology (Nothing to externalize)
+
+
+* /org.simantics.modeling.ui (In progress)
+* /org.simantics.modeling.ui.workbench
+* /org.simantics.platform.ui.ontology
+* /org.simantics.scenegraph.ui
+* /org.simantics.simulation.ui
+* /org.simantics.spreadsheet.ui
+* /org.simantics.structural.ui
+* /org.simantics.team.ui
+* /org.simantics.tests.modelled.ui
+* /org.simantics.tests.modelled.ui.ontology
+* /org.simantics.ui
+* /org.simantics.ui.workspace.tracker
+* /org.simantics.utils.ui
+* /org.simantics.wiki.ui
-* [ ] org.simantics.event
-* [ ] org.simantics.modeling.ui
-* [ ] org.simantics.browsing.ui*
+*
+*
* ...
<grpc.version.actual>1.14.0.b007</grpc.version.actual>
<protobuf.version>3.5.1</protobuf.version>
<zeroturnaround.version>1.10</zeroturnaround.version>
+ <eclipse.collections.version>9.2.0</eclipse.collections.version>
+ <caffeine.version>2.6.2</caffeine.version>
</properties>
<repositories>
<source>true</source>
</artifact>
<artifact>
- <id>org.eclipse.collections:eclipse-collections-api:8.1.0</id>
+ <id>org.eclipse.collections:eclipse-collections-api:${eclipse.collections.version}</id>
<override>true</override>
<source>true</source>
<instructions>
</instructions>
</artifact>
<artifact>
- <id>org.eclipse.collections:eclipse-collections:8.1.0</id>
+ <id>org.eclipse.collections:eclipse-collections:${eclipse.collections.version}</id>
<source>true</source>
+ <instructions>
+ <Require-Bundle>org.eclipse.collections.eclipse-collections-api;bundle-version="${eclipse.collections.version}"</Require-Bundle>
+ <Import-Package>!org.eclipse.*,!sun.misc.*,*;resolution:=optional</Import-Package>
+ </instructions>
</artifact>
<artifact>
<id>net.sf.trove4j:trove4j:3.0.3</id>
<source>true</source>
<transitive>false</transitive>
</artifact>
+ <artifact>
+ <id>com.github.ben-manes.caffeine:caffeine:${caffeine.version}</id>
+ <source>true</source>
+ <override>true</override>
+ <instructions>
+ <Bundle-SymbolicName>com.github.benmanes.caffeine</Bundle-SymbolicName>
+ </instructions>
+ </artifact>
+ <artifact>
+ <id>net.jcip:jcip-annotations:1.0</id>
+ <source>true</source>
+ </artifact>
</artifacts>
</configuration>
</execution>
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
<?pde?>
<!-- generated with https://github.com/mbarbero/fr.obeo.releng.targetplatform -->
-<target name="Eclipse Oxygen" sequenceNumber="1536132643">
+<target name="Eclipse Oxygen" sequenceNumber="1536142643">
<locations>
<location includeMode="slicer" includeAllPlatforms="true" includeSource="true" includeConfigurePhase="false" type="InstallableUnit">
<unit id="com.google.guava" version="21.0.0.v20170206-1425"/>
<unit id="org.bouncycastle.bcprov-jdk14.source" version="1.38.0"/>
<unit id="org.bouncycastle.bctsp-jdk14" version="1.38.0"/>
<unit id="org.bouncycastle.bctsp-jdk14.source" version="1.38.0"/>
- <unit id="org.eclipse.collections.eclipse-collections-api" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections-api.source" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections.source" version="8.1.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections-api" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections-api.source" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections.source" version="9.2.0"/>
<unit id="org.eclipse.jetty.servlets" version="9.4.5.v20170502"/>
<unit id="org.eclipse.jetty.servlets.source" version="9.4.5.v20170502"/>
+ <unit id="com.github.benmanes.caffeine" version="2.6.2"/>
+ <unit id="com.github.benmanes.caffeine.source" version="2.6.2"/>
<unit id="org.glassfish.hk2.api" version="2.5.0.b32"/>
<unit id="org.glassfish.hk2.api.source" version="2.5.0.b32"/>
<unit id="org.glassfish.hk2.locator" version="2.5.0.b32"/>
org.eclipse.collections.eclipse-collections.source
org.eclipse.jetty.servlets
org.eclipse.jetty.servlets.source
+ com.github.benmanes.caffeine
+ com.github.benmanes.caffeine.source
org.glassfish.hk2.api
org.glassfish.hk2.api.source
org.glassfish.hk2.locator
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
<?pde?>
<!-- generated with https://github.com/mbarbero/fr.obeo.releng.targetplatform -->
-<target name="Simantics 1.37.0" sequenceNumber="1540817210">
+<target name="Simantics 1.37.0" sequenceNumber="1536142643">
<locations>
<location includeMode="slicer" includeAllPlatforms="true" includeSource="true" includeConfigurePhase="false" type="InstallableUnit">
<unit id="com.google.guava" version="21.0.0.v20170206-1425"/>
<unit id="org.bouncycastle.bcprov-jdk14.source" version="1.38.0"/>
<unit id="org.bouncycastle.bctsp-jdk14" version="1.38.0"/>
<unit id="org.bouncycastle.bctsp-jdk14.source" version="1.38.0"/>
- <unit id="org.eclipse.collections.eclipse-collections-api" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections-api.source" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections" version="8.1.0"/>
- <unit id="org.eclipse.collections.eclipse-collections.source" version="8.1.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections-api" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections-api.source" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections" version="9.2.0"/>
+ <unit id="org.eclipse.collections.eclipse-collections.source" version="9.2.0"/>
<unit id="org.eclipse.jetty.servlets" version="9.4.5.v20170502"/>
<unit id="org.eclipse.jetty.servlets.source" version="9.4.5.v20170502"/>
+ <unit id="com.github.benmanes.caffeine" version="2.6.2"/>
+ <unit id="com.github.benmanes.caffeine.source" version="2.6.2"/>
<unit id="org.glassfish.hk2.api" version="2.5.0.b32"/>
<unit id="org.glassfish.hk2.api.source" version="2.5.0.b32"/>
<unit id="org.glassfish.hk2.locator" version="2.5.0.b32"/>
Code Review / simantics / platform.git / commitdiff